Compare commits

..

1 commit

Author SHA1 Message Date
Amaan Qureshi
588c1a5610
feat: allow external scanners to reuse the internal character ranges 2024-11-24 17:45:50 -05:00
483 changed files with 22016 additions and 43785 deletions

View file

@ -10,9 +10,6 @@ insert_final_newline = true
[*.rs] [*.rs]
indent_size = 4 indent_size = 4
[*.{zig,zon}]
indent_size = 4
[Makefile] [Makefile]
indent_style = tab indent_style = tab
indent_size = 8 indent_size = 8

1
.envrc
View file

@ -1 +0,0 @@
use flake

1
.gitattributes vendored
View file

@ -3,4 +3,5 @@
/lib/src/unicode/*.h linguist-vendored /lib/src/unicode/*.h linguist-vendored
/lib/src/unicode/LICENSE linguist-vendored /lib/src/unicode/LICENSE linguist-vendored
/cli/src/generate/prepare_grammar/*.json -diff
Cargo.lock -diff Cargo.lock -diff

15
.github/FUNDING.yml vendored
View file

@ -1,15 +0,0 @@
# These are supported funding model platforms
github: tree-sitter
patreon: # Replace with a single Patreon username
open_collective: tree-sitter # Replace with a single Open Collective username
ko_fi: amaanq
tidelift: # Replace with a single Tidelift platform-name/package-name e.g., npm/babel
community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
liberapay: # Replace with a single Liberapay username
issuehunt: # Replace with a single IssueHunt username
lfx_crowdfunding: # Replace with a single LFX Crowdfunding project-name e.g., cloud-foundry
polar: # Replace with a single Polar username
buy_me_a_coffee: # Replace with a single Buy Me a Coffee username
thanks_dev: # Replace with a single thanks.dev username
custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']

View file

@ -1,6 +1,6 @@
name: Bug Report name: Bug Report
description: Report a problem description: Report a problem
type: Bug labels: [bug]
body: body:
- type: textarea - type: textarea
attributes: attributes:

View file

@ -1,6 +1,6 @@
name: Feature request name: Feature request
description: Request an enhancement description: Request an enhancement
type: Feature labels: [enhancement]
body: body:
- type: markdown - type: markdown
attributes: attributes:

View file

@ -17,9 +17,7 @@ runs:
test/fixtures/grammars test/fixtures/grammars
target/release/tree-sitter-*.wasm target/release/tree-sitter-*.wasm
key: fixtures-${{ join(matrix.*, '_') }}-${{ hashFiles( key: fixtures-${{ join(matrix.*, '_') }}-${{ hashFiles(
'crates/generate/src/**', 'cli/generate/src/**',
'lib/src/parser.h', 'xtask/src/*',
'lib/src/array.h',
'lib/src/alloc.h',
'test/fixtures/grammars/*/**/src/*.c', 'test/fixtures/grammars/*/**/src/*.c',
'.github/actions/cache/action.yml') }} '.github/actions/cache/action.yml') }}

4
.github/cliff.toml vendored
View file

@ -16,13 +16,13 @@ body = """
{% for commit in commits%}\ {% for commit in commits%}\
{% if not commit.scope %}\ {% if not commit.scope %}\
- {{ commit.message | upper_first }}\ - {{ commit.message | upper_first }}\
{% if commit.remote.pr_number %} (<https://github.com/{{ remote.github.owner }}/{{ remote.github.repo }}/pull/{{ commit.remote.pr_number }}>){%- endif %} {% if commit.github.pr_number %} (<https://github.com/{{ remote.github.owner }}/{{ remote.github.repo }}/pull/{{ commit.github.pr_number }}>){%- endif %}
{% endif %}\ {% endif %}\
{% endfor %}\ {% endfor %}\
{% for group, commits in commits | group_by(attribute="scope") %}\ {% for group, commits in commits | group_by(attribute="scope") %}\
{% for commit in commits %}\ {% for commit in commits %}\
- **{{commit.scope}}**: {{ commit.message | upper_first }}\ - **{{commit.scope}}**: {{ commit.message | upper_first }}\
{% if commit.remote.pr_number %} (<https://github.com/{{ remote.github.owner }}/{{ remote.github.repo }}/pull/{{ commit.remote.pr_number }}>){%- endif %} {% if commit.github.pr_number %} (<https://github.com/{{ remote.github.owner }}/{{ remote.github.repo }}/pull/{{ commit.github.pr_number }}>){%- endif %}
{% endfor %}\ {% endfor %}\
{% endfor %} {% endfor %}
{% endfor %} {% endfor %}

View file

@ -4,8 +4,6 @@ updates:
directory: "/" directory: "/"
schedule: schedule:
interval: "weekly" interval: "weekly"
cooldown:
default-days: 3
commit-message: commit-message:
prefix: "build(deps)" prefix: "build(deps)"
labels: labels:
@ -14,16 +12,10 @@ updates:
groups: groups:
cargo: cargo:
patterns: ["*"] patterns: ["*"]
ignore:
- dependency-name: "*"
update-types: ["version-update:semver-major", "version-update:semver-minor"]
- package-ecosystem: "github-actions" - package-ecosystem: "github-actions"
directory: "/" directory: "/"
schedule: schedule:
interval: "weekly" interval: "weekly"
cooldown:
default-days: 3
commit-message: commit-message:
prefix: "ci" prefix: "ci"
labels: labels:
@ -32,22 +24,3 @@ updates:
groups: groups:
actions: actions:
patterns: ["*"] patterns: ["*"]
- package-ecosystem: "npm"
versioning-strategy: increase
directories:
- "/crates/npm"
- "/crates/eslint"
- "/lib/binding_web"
schedule:
interval: "weekly"
cooldown:
default-days: 3
commit-message:
prefix: "build(deps)"
labels:
- "dependencies"
- "npm"
groups:
npm:
patterns: ["*"]

View file

@ -1,29 +0,0 @@
module.exports = async ({ github, context }) => {
let target = context.payload.issue;
if (target) {
await github.rest.issues.update({
...context.repo,
issue_number: target.number,
state: "closed",
state_reason: "not_planned",
title: "[spam]",
body: "",
type: null,
});
} else {
target = context.payload.pull_request;
await github.rest.pulls.update({
...context.repo,
pull_number: target.number,
state: "closed",
title: "[spam]",
body: "",
});
}
await github.rest.issues.lock({
...context.repo,
issue_number: target.number,
lock_reason: "spam",
});
};

3
.github/scripts/cross.sh vendored Executable file
View file

@ -0,0 +1,3 @@
#!/bin/bash -eu
exec docker run --rm -v /home/runner:/home/runner -w "$PWD" "$CROSS_IMAGE" "$@"

9
.github/scripts/make.sh vendored Executable file
View file

@ -0,0 +1,9 @@
#!/bin/bash -eu
tree_sitter="$ROOT"/target/"$TARGET"/release/tree-sitter
if [[ $BUILD_CMD == cross ]]; then
cross.sh make CC="$CC" AR="$AR" "$@"
else
exec make "$@"
fi

9
.github/scripts/tree-sitter.sh vendored Executable file
View file

@ -0,0 +1,9 @@
#!/bin/bash -eu
tree_sitter="$ROOT"/target/"$TARGET"/release/tree-sitter
if [[ $BUILD_CMD == cross ]]; then
cross.sh "$CROSS_RUNNER" "$tree_sitter" "$@"
else
exec "$tree_sitter" "$@"
fi

View file

@ -1,25 +0,0 @@
module.exports = async ({ github, context, core }) => {
if (context.eventName !== 'pull_request') return;
const prNumber = context.payload.pull_request.number;
const owner = context.repo.owner;
const repo = context.repo.repo;
const { data: files } = await github.rest.pulls.listFiles({
owner,
repo,
pull_number: prNumber
});
const changedFiles = files.map(file => file.filename);
const wasmStdLibSrc = 'crates/language/wasm/';
const dirChanged = changedFiles.some(file => file.startsWith(wasmStdLibSrc));
if (!dirChanged) return;
const wasmStdLibHeader = 'lib/src/wasm/wasm-stdlib.h';
const requiredChanged = changedFiles.includes(wasmStdLibHeader);
if (!requiredChanged) core.setFailed(`Changes detected in ${wasmStdLibSrc} but ${wasmStdLibHeader} was not modified.`);
};

View file

@ -14,17 +14,17 @@ jobs:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Create app token - name: Create app token
uses: actions/create-github-app-token@v2 uses: actions/create-github-app-token@v1
id: app-token id: app-token
with: with:
app-id: ${{ vars.BACKPORT_APP }} app-id: ${{ vars.BACKPORT_APP }}
private-key: ${{ secrets.BACKPORT_KEY }} private-key: ${{ secrets.BACKPORT_KEY }}
- name: Create backport PR - name: Create backport PR
uses: korthout/backport-action@v4 uses: korthout/backport-action@v3
with: with:
pull_title: "${pull_title}" pull_title: "${pull_title}"
label_pattern: "^ci:backport ([^ ]+)$" label_pattern: "^ci:backport ([^ ]+)$"

View file

@ -2,21 +2,15 @@ name: Check Bindgen Output
on: on:
pull_request: pull_request:
paths:
- lib/include/tree_sitter/api.h
- lib/binding_rust/bindings.rs
push: push:
branches: [master] branches: [master]
paths:
- lib/include/tree_sitter/api.h
- lib/binding_rust/bindings.rs
jobs: jobs:
check-bindgen: check-bindgen:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Set up stable Rust toolchain - name: Set up stable Rust toolchain
uses: actions-rust-lang/setup-rust-toolchain@v1 uses: actions-rust-lang/setup-rust-toolchain@v1

View file

@ -1,5 +1,10 @@
name: Build & Test name: Build & Test
env:
CARGO_TERM_COLOR: always
RUSTFLAGS: "-D warnings"
CROSS_DEBUG: 1
on: on:
workflow_call: workflow_call:
inputs: inputs:
@ -26,41 +31,38 @@ jobs:
- windows-x86 - windows-x86
- macos-arm64 - macos-arm64
- macos-x64 - macos-x64
- wasm32
include: include:
# When adding a new `target`: # When adding a new `target`:
# 1. Define a new platform alias above # 1. Define a new platform alias above
# 2. Add a new record to the matrix map in `crates/cli/npm/install.js` # 2. Add a new record to the matrix map in `cli/npm/install.js`
- { platform: linux-arm64 , target: aarch64-unknown-linux-gnu , os: ubuntu-24.04-arm } - { platform: linux-arm64 , target: aarch64-unknown-linux-gnu , os: ubuntu-latest , use-cross: true }
- { platform: linux-arm , target: armv7-unknown-linux-gnueabihf , os: ubuntu-24.04-arm } - { platform: linux-arm , target: arm-unknown-linux-gnueabi , os: ubuntu-latest , use-cross: true }
- { platform: linux-x64 , target: x86_64-unknown-linux-gnu , os: ubuntu-24.04 } - { platform: linux-x64 , target: x86_64-unknown-linux-gnu , os: ubuntu-20.04 , features: wasm } # See #2272
- { platform: linux-x86 , target: i686-unknown-linux-gnu , os: ubuntu-24.04 } - { platform: linux-x86 , target: i686-unknown-linux-gnu , os: ubuntu-latest , use-cross: true }
- { platform: linux-powerpc64 , target: powerpc64-unknown-linux-gnu , os: ubuntu-24.04 } - { platform: linux-powerpc64 , target: powerpc64-unknown-linux-gnu , os: ubuntu-latest , use-cross: true }
- { platform: windows-arm64 , target: aarch64-pc-windows-msvc , os: windows-11-arm } - { platform: windows-arm64 , target: aarch64-pc-windows-msvc , os: windows-latest }
- { platform: windows-x64 , target: x86_64-pc-windows-msvc , os: windows-2025 } - { platform: windows-x64 , target: x86_64-pc-windows-msvc , os: windows-latest , features: wasm }
- { platform: windows-x86 , target: i686-pc-windows-msvc , os: windows-2025 } - { platform: windows-x86 , target: i686-pc-windows-msvc , os: windows-latest }
- { platform: macos-arm64 , target: aarch64-apple-darwin , os: macos-15 } - { platform: macos-arm64 , target: aarch64-apple-darwin , os: macos-14 , features: wasm }
- { platform: macos-x64 , target: x86_64-apple-darwin , os: macos-15-intel } - { platform: macos-x64 , target: x86_64-apple-darwin , os: macos-13 , features: wasm }
- { platform: wasm32 , target: wasm32-unknown-unknown , os: ubuntu-24.04 }
# Extra features # Cross compilers for C library
- { platform: linux-arm64 , features: wasm } - { platform: linux-arm64 , cc: aarch64-linux-gnu-gcc , ar: aarch64-linux-gnu-ar }
- { platform: linux-x64 , features: wasm } - { platform: linux-arm , cc: arm-linux-gnueabi-gcc , ar: arm-linux-gnueabi-ar }
- { platform: macos-arm64 , features: wasm } - { platform: linux-x86 , cc: i686-linux-gnu-gcc , ar: i686-linux-gnu-ar }
- { platform: macos-x64 , features: wasm } - { platform: linux-powerpc64 , cc: powerpc64-linux-gnu-gcc , ar: powerpc64-linux-gnu-ar }
# Cross-compilation # Prevent race condition (see #2041)
- { platform: linux-arm , cross: true } - { platform: windows-x64 , rust-test-threads: 1 }
- { platform: linux-x86 , cross: true } - { platform: windows-x86 , rust-test-threads: 1 }
- { platform: linux-powerpc64 , cross: true }
# Compile-only # Can't natively run CLI on Github runner's host
- { platform: wasm32 , no-run: true } - { platform: windows-arm64 , no-run: true }
env: env:
CARGO_TERM_COLOR: always BUILD_CMD: cargo
RUSTFLAGS: -D warnings SUFFIX: ${{ contains(matrix.target, 'windows') && '.exe' || '' }}
defaults: defaults:
run: run:
@ -68,28 +70,13 @@ jobs:
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Set up cross-compilation - name: Read Emscripten version
if: matrix.cross run: printf 'EMSCRIPTEN_VERSION=%s\n' "$(<cli/loader/emscripten-version)" >> $GITHUB_ENV
run: |
for target in armv7-unknown-linux-gnueabihf i686-unknown-linux-gnu powerpc64-unknown-linux-gnu; do
camel_target=${target//-/_}; target_cc=${target/-unknown/}
printf 'CC_%s=%s\n' "$camel_target" "${target_cc/v7/}-gcc"
printf 'AR_%s=%s\n' "$camel_target" "${target_cc/v7/}-ar"
printf 'CARGO_TARGET_%s_LINKER=%s\n' "${camel_target^^}" "${target_cc/v7/}-gcc"
done >> $GITHUB_ENV
{
printf 'CARGO_TARGET_ARMV7_UNKNOWN_LINUX_GNUEABIHF_RUNNER=qemu-arm -L /usr/arm-linux-gnueabihf\n'
printf 'CARGO_TARGET_POWERPC64_UNKNOWN_LINUX_GNU_RUNNER=qemu-ppc64 -L /usr/powerpc64-linux-gnu\n'
} >> $GITHUB_ENV
- name: Get emscripten version
if: contains(matrix.features, 'wasm')
run: printf 'EMSCRIPTEN_VERSION=%s\n' "$(<crates/loader/emscripten-version)" >> $GITHUB_ENV
- name: Install Emscripten - name: Install Emscripten
if: contains(matrix.features, 'wasm') if: ${{ !matrix.no-run && !matrix.use-cross }}
uses: mymindstorm/setup-emsdk@v14 uses: mymindstorm/setup-emsdk@v14
with: with:
version: ${{ env.EMSCRIPTEN_VERSION }} version: ${{ env.EMSCRIPTEN_VERSION }}
@ -99,84 +86,58 @@ jobs:
with: with:
target: ${{ matrix.target }} target: ${{ matrix.target }}
- name: Install cross-compilation toolchain - name: Install cross
if: matrix.cross if: ${{ matrix.use-cross }}
run: cargo install cross --git https://github.com/cross-rs/cross
- name: Configure cross
if: ${{ matrix.use-cross }}
run: | run: |
sudo apt-get update -qy printf '%s\n' > Cross.toml \
if [[ $PLATFORM == linux-arm ]]; then '[target.${{ matrix.target }}]' \
sudo apt-get install -qy {binutils,gcc}-arm-linux-gnueabihf qemu-user 'image = "ghcr.io/cross-rs/${{ matrix.target }}:edge"' \
elif [[ $PLATFORM == linux-x86 ]]; then '[build]' \
sudo apt-get install -qy {binutils,gcc}-i686-linux-gnu 'pre-build = [' \
elif [[ $PLATFORM == linux-powerpc64 ]]; then ' "dpkg --add-architecture $CROSS_DEB_ARCH",' \
sudo apt-get install -qy {binutils,gcc}-powerpc64-linux-gnu qemu-user ' "curl -fsSL https://deb.nodesource.com/setup_22.x | bash -",' \
' "apt-get update && apt-get -y install libssl-dev nodejs"' \
']'
cat - Cross.toml <<< 'Cross.toml:'
printf '%s\n' >> $GITHUB_ENV \
"CROSS_CONFIG=$PWD/Cross.toml" \
"CROSS_IMAGE=ghcr.io/cross-rs/${{ matrix.target }}:edge"
- name: Set up environment
env:
RUST_TEST_THREADS: ${{ matrix.rust-test-threads }}
USE_CROSS: ${{ matrix.use-cross }}
TARGET: ${{ matrix.target }}
CC: ${{ matrix.cc }}
AR: ${{ matrix.ar }}
run: |
PATH="$PWD/.github/scripts:$PATH"
printf '%s/.github/scripts\n' "$PWD" >> $GITHUB_PATH
printf '%s\n' >> $GITHUB_ENV \
'TREE_SITTER=tree-sitter.sh' \
"TARGET=$TARGET" \
"ROOT=$PWD"
[[ -n $RUST_TEST_THREADS ]] && \
printf 'RUST_TEST_THREADS=%s\n' "$RUST_TEST_THREADS" >> $GITHUB_ENV
[[ -n $CC ]] && printf 'CC=%s\n' "$CC" >> $GITHUB_ENV
[[ -n $AR ]] && printf 'AR=%s\n' "$AR" >> $GITHUB_ENV
if [[ $USE_CROSS == true ]]; then
printf 'BUILD_CMD=cross\n' >> $GITHUB_ENV
runner=$(cross.sh bash -c "env | sed -n 's/^CARGO_TARGET_.*_RUNNER=//p'")
[[ -n $runner ]] && printf 'CROSS_RUNNER=%s\n' "$runner" >> $GITHUB_ENV
fi fi
env:
PLATFORM: ${{ matrix.platform }}
- name: Install MinGW and Clang (Windows x64 MSYS2)
if: matrix.platform == 'windows-x64'
uses: msys2/setup-msys2@v2
with:
update: true
install: |
mingw-w64-x86_64-toolchain
mingw-w64-x86_64-clang
mingw-w64-x86_64-make
mingw-w64-x86_64-cmake
# TODO: Remove RUSTFLAGS="--cap-lints allow" once we use a wasmtime release that addresses
# the `mismatched-lifetime-syntaxes` lint
- name: Build wasmtime library (Windows x64 MSYS2)
if: contains(matrix.features, 'wasm') && matrix.platform == 'windows-x64'
run: |
mkdir -p target
WASMTIME_VERSION=$(cargo metadata --format-version=1 --locked --features wasm | \
jq -r '.packages[] | select(.name == "wasmtime-c-api-impl") | .version')
curl -LSs "$WASMTIME_REPO/archive/refs/tags/v${WASMTIME_VERSION}.tar.gz" | tar xzf - -C target
cd target/wasmtime-${WASMTIME_VERSION}
cmake -S crates/c-api -B target/c-api \
-DCMAKE_INSTALL_PREFIX="$PWD/artifacts" \
-DWASMTIME_DISABLE_ALL_FEATURES=ON \
-DWASMTIME_FEATURE_CRANELIFT=ON \
-DWASMTIME_TARGET='x86_64-pc-windows-gnu'
cmake --build target/c-api && cmake --install target/c-api
printf 'CMAKE_PREFIX_PATH=%s\n' "$PWD/artifacts" >> $GITHUB_ENV
env:
WASMTIME_REPO: https://github.com/bytecodealliance/wasmtime
RUSTFLAGS: ${{ env.RUSTFLAGS }} --cap-lints allow
- name: Build C library (Windows x64 MSYS2 CMake)
if: matrix.platform == 'windows-x64'
shell: msys2 {0}
run: |
cmake -G Ninja -S . -B build/static \
-DBUILD_SHARED_LIBS=OFF \
-DCMAKE_BUILD_TYPE=Debug \
-DCMAKE_COMPILE_WARNING_AS_ERROR=ON \
-DTREE_SITTER_FEATURE_WASM=$WASM \
-DCMAKE_C_COMPILER=clang
cmake --build build/static
cmake -G Ninja -S . -B build/shared \
-DBUILD_SHARED_LIBS=ON \
-DCMAKE_BUILD_TYPE=Debug \
-DCMAKE_COMPILE_WARNING_AS_ERROR=ON \
-DTREE_SITTER_FEATURE_WASM=$WASM \
-DCMAKE_C_COMPILER=clang
cmake --build build/shared
rm -rf \
build/{static,shared} \
"${CMAKE_PREFIX_PATH}/artifacts" \
target/wasmtime-${WASMTIME_VERSION}
env:
WASM: ${{ contains(matrix.features, 'wasm') && 'ON' || 'OFF' }}
# TODO: Remove RUSTFLAGS="--cap-lints allow" once we use a wasmtime release that addresses
# the `mismatched-lifetime-syntaxes` lint
- name: Build wasmtime library - name: Build wasmtime library
if: contains(matrix.features, 'wasm') if: ${{ !matrix.use-cross && contains(matrix.features, 'wasm') }}
run: | run: |
mkdir -p target
WASMTIME_VERSION=$(cargo metadata --format-version=1 --locked --features wasm | \ WASMTIME_VERSION=$(cargo metadata --format-version=1 --locked --features wasm | \
jq -r '.packages[] | select(.name == "wasmtime-c-api-impl") | .version') jq -r '.packages[] | select(.name == "wasmtime-c-api-impl") | .version')
curl -LSs "$WASMTIME_REPO/archive/refs/tags/v${WASMTIME_VERSION}.tar.gz" | tar xzf - -C target curl -LSs "$WASMTIME_REPO/archive/refs/tags/v${WASMTIME_VERSION}.tar.gz" | tar xzf - -C target
@ -190,122 +151,86 @@ jobs:
printf 'CMAKE_PREFIX_PATH=%s\n' "$PWD/artifacts" >> $GITHUB_ENV printf 'CMAKE_PREFIX_PATH=%s\n' "$PWD/artifacts" >> $GITHUB_ENV
env: env:
WASMTIME_REPO: https://github.com/bytecodealliance/wasmtime WASMTIME_REPO: https://github.com/bytecodealliance/wasmtime
RUSTFLAGS: ${{ env.RUSTFLAGS }} --cap-lints allow
- name: Build C library (make) - name: Build C library (make)
if: runner.os != 'Windows' if: ${{ runner.os != 'Windows' }}
run: | run: make.sh -j CFLAGS="$CFLAGS"
if [[ $PLATFORM == linux-arm ]]; then
CC=arm-linux-gnueabihf-gcc; AR=arm-linux-gnueabihf-ar
elif [[ $PLATFORM == linux-x86 ]]; then
CC=i686-linux-gnu-gcc; AR=i686-linux-gnu-ar
elif [[ $PLATFORM == linux-powerpc64 ]]; then
CC=powerpc64-linux-gnu-gcc; AR=powerpc64-linux-gnu-ar
else
CC=gcc; AR=ar
fi
make -j CFLAGS="$CFLAGS" CC=$CC AR=$AR
env: env:
PLATFORM: ${{ matrix.platform }}
CFLAGS: -g -Werror -Wall -Wextra -Wshadow -Wpedantic -Werror=incompatible-pointer-types CFLAGS: -g -Werror -Wall -Wextra -Wshadow -Wpedantic -Werror=incompatible-pointer-types
- name: Build C library (CMake) - name: Build C library (CMake)
if: "!matrix.cross" if: ${{ !matrix.use-cross }}
run: | run: |
cmake -S . -B build/static \ cmake -S lib -B build/static \
-DBUILD_SHARED_LIBS=OFF \ -DBUILD_SHARED_LIBS=OFF \
-DCMAKE_BUILD_TYPE=Debug \ -DCMAKE_BUILD_TYPE=Debug \
-DCMAKE_COMPILE_WARNING_AS_ERROR=ON \ -DCMAKE_COMPILE_WARNING_AS_ERROR=ON \
-DTREE_SITTER_FEATURE_WASM=$WASM -DTREE_SITTER_FEATURE_WASM=$WASM
cmake --build build/static --verbose cmake --build build/static --verbose
cmake -S . -B build/shared \ cmake -S lib -B build/shared \
-DBUILD_SHARED_LIBS=ON \ -DBUILD_SHARED_LIBS=ON \
-DCMAKE_BUILD_TYPE=Debug \ -DCMAKE_BUILD_TYPE=Debug \
-DCMAKE_COMPILE_WARNING_AS_ERROR=ON \ -DCMAKE_COMPILE_WARNING_AS_ERROR=ON \
-DTREE_SITTER_FEATURE_WASM=$WASM -DTREE_SITTER_FEATURE_WASM=$WASM
cmake --build build/shared --verbose cmake --build build/shared --verbose
env: env:
CC: ${{ contains(matrix.platform, 'linux') && 'clang' || '' }} CC: ${{ contains(matrix.target, 'linux') && 'clang' || '' }}
WASM: ${{ contains(matrix.features, 'wasm') && 'ON' || 'OFF' }} WASM: ${{ contains(matrix.features, 'wasm') && 'ON' || 'OFF' }}
- name: Build Wasm library - name: Build wasm library
if: contains(matrix.features, 'wasm') # No reason to build on the same Github runner hosts many times
shell: bash if: ${{ !matrix.no-run && !matrix.use-cross }}
run: | run: $BUILD_CMD run -p xtask -- build-wasm
cd lib/binding_web
npm ci
CJS=true npm run build
CJS=true npm run build:debug
npm run build
npm run build:debug
- name: Check no_std builds
if: inputs.run-test && !matrix.no-run
working-directory: lib
shell: bash
run: cargo check --no-default-features --target='${{ matrix.target }}'
- name: Build target - name: Build target
run: cargo build --release --target='${{ matrix.target }}' --features='${{ matrix.features }}' $PACKAGE run: $BUILD_CMD build --release --target=${{ matrix.target }} --features=${{ matrix.features }}
env:
PACKAGE: ${{ matrix.platform == 'wasm32' && '-p tree-sitter' || '' }}
- name: Cache fixtures - name: Cache fixtures
id: cache id: cache
if: inputs.run-test && !matrix.no-run if: ${{ !matrix.no-run && inputs.run-test }}
uses: ./.github/actions/cache uses: ./.github/actions/cache
- name: Fetch fixtures - name: Fetch fixtures
if: inputs.run-test && !matrix.no-run if: ${{ !matrix.no-run && inputs.run-test }}
run: cargo run -p xtask --target='${{ matrix.target }}' -- fetch-fixtures run: $BUILD_CMD run -p xtask -- fetch-fixtures
- name: Generate fixtures - name: Generate fixtures
if: inputs.run-test && !matrix.no-run && steps.cache.outputs.cache-hit != 'true' if: ${{ !matrix.no-run && inputs.run-test && steps.cache.outputs.cache-hit != 'true' }}
run: cargo run -p xtask --target='${{ matrix.target }}' -- generate-fixtures run: $BUILD_CMD run -p xtask -- generate-fixtures
- name: Generate Wasm fixtures - name: Generate Wasm fixtures
if: inputs.run-test && !matrix.no-run && contains(matrix.features, 'wasm') && steps.cache.outputs.cache-hit != 'true' if: ${{ !matrix.no-run && !matrix.use-cross && inputs.run-test && steps.cache.outputs.cache-hit != 'true' }}
run: cargo run -p xtask --target='${{ matrix.target }}' -- generate-fixtures --wasm run: $BUILD_CMD run -p xtask -- generate-fixtures --wasm
- name: Run main tests - name: Run main tests
if: inputs.run-test && !matrix.no-run if: ${{ !matrix.no-run && inputs.run-test }}
run: cargo test --target='${{ matrix.target }}' --features='${{ matrix.features }}' run: $BUILD_CMD test --target=${{ matrix.target }} --features=${{ matrix.features }}
- name: Run Wasm tests - name: Run wasm tests
if: inputs.run-test && !matrix.no-run && contains(matrix.features, 'wasm') if: ${{ !matrix.no-run && !matrix.use-cross && inputs.run-test }}
run: cargo run -p xtask --target='${{ matrix.target }}' -- test-wasm run: $BUILD_CMD run -p xtask -- test-wasm
- name: Run benchmarks
# Cross-compiled benchmarks are pointless
if: ${{ !matrix.no-run && !matrix.use-cross && inputs.run-test }}
run: $BUILD_CMD bench benchmark -p tree-sitter-cli --target=${{ matrix.target }}
- name: Upload CLI artifact - name: Upload CLI artifact
if: "!matrix.no-run" uses: actions/upload-artifact@v4
uses: actions/upload-artifact@v6
with: with:
name: tree-sitter.${{ matrix.platform }} name: tree-sitter.${{ matrix.platform }}
path: target/${{ matrix.target }}/release/tree-sitter${{ contains(matrix.target, 'windows') && '.exe' || '' }} path: target/${{ matrix.target }}/release/tree-sitter${{ env.SUFFIX }}
if-no-files-found: error if-no-files-found: error
retention-days: 7 retention-days: 7
- name: Upload Wasm artifacts - name: Upload Wasm artifacts
if: matrix.platform == 'linux-x64' if: ${{ matrix.platform == 'linux-x64' }}
uses: actions/upload-artifact@v6 uses: actions/upload-artifact@v4
with: with:
name: tree-sitter.wasm name: tree-sitter.wasm
path: | path: |
lib/binding_web/web-tree-sitter.js lib/binding_web/tree-sitter.js
lib/binding_web/web-tree-sitter.js.map lib/binding_web/tree-sitter.wasm
lib/binding_web/web-tree-sitter.cjs
lib/binding_web/web-tree-sitter.cjs.map
lib/binding_web/web-tree-sitter.wasm
lib/binding_web/web-tree-sitter.wasm.map
lib/binding_web/debug/web-tree-sitter.cjs
lib/binding_web/debug/web-tree-sitter.cjs.map
lib/binding_web/debug/web-tree-sitter.js
lib/binding_web/debug/web-tree-sitter.js.map
lib/binding_web/debug/web-tree-sitter.wasm
lib/binding_web/debug/web-tree-sitter.wasm.map
lib/binding_web/lib/*.c
lib/binding_web/lib/*.h
lib/binding_web/lib/*.ts
lib/binding_web/src/*.ts
if-no-files-found: error if-no-files-found: error
retention-days: 7 retention-days: 7

View file

@ -2,20 +2,8 @@ name: CI
on: on:
pull_request: pull_request:
paths-ignore:
- docs/**
- "**/README.md"
- CONTRIBUTING.md
- LICENSE
- cli/src/templates
push: push:
branches: [master] branches: [master]
paths-ignore:
- docs/**
- "**/README.md"
- CONTRIBUTING.md
- LICENSE
- cli/src/templates
concurrency: concurrency:
group: ${{ github.workflow }}-${{ github.ref }} group: ${{ github.workflow }}-${{ github.ref }}
@ -26,24 +14,24 @@ jobs:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Set up stable Rust toolchain - name: Set up stable Rust toolchain
uses: actions-rust-lang/setup-rust-toolchain@v1 uses: actions-rust-lang/setup-rust-toolchain@v1
with: with:
toolchain: stable toolchain: stable
- name: Set up nightly Rust toolchain
uses: actions-rust-lang/setup-rust-toolchain@v1
with:
toolchain: nightly
components: clippy, rustfmt components: clippy, rustfmt
- name: Lint files - name: Lint files
run: | run: make lint
make lint
make lint-web
sanitize: sanitize:
uses: ./.github/workflows/sanitize.yml uses: ./.github/workflows/sanitize.yml
build: build:
uses: ./.github/workflows/build.yml uses: ./.github/workflows/build.yml
check-wasm-stdlib:
uses: ./.github/workflows/wasm_stdlib.yml

View file

@ -1,50 +0,0 @@
name: Deploy Docs
on:
push:
branches: [master]
paths: [docs/**]
workflow_dispatch:
jobs:
deploy-docs:
runs-on: ubuntu-latest
permissions:
contents: write
pages: write
id-token: write
steps:
- name: Checkout repository
uses: actions/checkout@v6
- name: Set up Rust
uses: actions-rust-lang/setup-rust-toolchain@v1
- name: Install mdbook
env:
GH_TOKEN: ${{ github.token }}
run: |
jq_expr='.assets[] | select(.name | contains("x86_64-unknown-linux-gnu")) | .browser_download_url'
url=$(gh api repos/rust-lang/mdbook/releases/tags/v0.4.52 --jq "$jq_expr")
mkdir mdbook
curl -sSL "$url" | tar -xz -C mdbook
printf '%s/mdbook\n' "$PWD" >> "$GITHUB_PATH"
- name: Install mdbook-admonish
run: cargo install mdbook-admonish
- name: Build Book
run: mdbook build docs
- name: Setup Pages
uses: actions/configure-pages@v5
- name: Upload artifact
uses: actions/upload-pages-artifact@v4
with:
path: docs/book
- name: Deploy to GitHub Pages
id: deployment
uses: actions/deploy-pages@v4

View file

@ -3,10 +3,7 @@ name: nvim-treesitter parser tests
on: on:
pull_request: pull_request:
paths: paths:
- 'crates/cli/**' - 'cli/**'
- 'crates/config/**'
- 'crates/generate/**'
- 'crates/loader/**'
- '.github/workflows/nvim_ts.yml' - '.github/workflows/nvim_ts.yml'
workflow_dispatch: workflow_dispatch:
@ -16,7 +13,7 @@ concurrency:
jobs: jobs:
check_compilation: check_compilation:
timeout-minutes: 30 timeout-minutes: 20
strategy: strategy:
fail-fast: false fail-fast: false
matrix: matrix:
@ -28,9 +25,9 @@ jobs:
NVIM: ${{ matrix.os == 'windows-latest' && 'nvim-win64\\bin\\nvim.exe' || 'nvim' }} NVIM: ${{ matrix.os == 'windows-latest' && 'nvim-win64\\bin\\nvim.exe' || 'nvim' }}
NVIM_TS_DIR: nvim-treesitter NVIM_TS_DIR: nvim-treesitter
steps: steps:
- uses: actions/checkout@v6 - uses: actions/checkout@v4
- uses: actions/checkout@v6 - uses: actions/checkout@v4
with: with:
repository: nvim-treesitter/nvim-treesitter repository: nvim-treesitter/nvim-treesitter
path: ${{ env.NVIM_TS_DIR }} path: ${{ env.NVIM_TS_DIR }}
@ -58,7 +55,7 @@ jobs:
- if: matrix.type == 'build' - if: matrix.type == 'build'
name: Compile parsers name: Compile parsers
run: $NVIM -l ./scripts/install-parsers.lua --max-jobs=10 run: $NVIM -l ./scripts/install-parsers.lua
working-directory: ${{ env.NVIM_TS_DIR }} working-directory: ${{ env.NVIM_TS_DIR }}
shell: bash shell: bash

View file

@ -17,15 +17,13 @@ jobs:
runs-on: ubuntu-latest runs-on: ubuntu-latest
needs: build needs: build
permissions: permissions:
id-token: write
attestations: write
contents: write contents: write
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Download build artifacts - name: Download build artifacts
uses: actions/download-artifact@v7 uses: actions/download-artifact@v4
with: with:
path: artifacts path: artifacts
@ -35,13 +33,9 @@ jobs:
- name: Prepare release artifacts - name: Prepare release artifacts
run: | run: |
mkdir -p target web mkdir -p target
mv artifacts/tree-sitter.wasm/* web/ mv artifacts/tree-sitter.wasm/* target/
tar -czf target/web-tree-sitter.tar.gz -C web .
rm -r artifacts/tree-sitter.wasm rm -r artifacts/tree-sitter.wasm
for platform in $(cd artifacts; ls | sed 's/^tree-sitter\.//'); do for platform in $(cd artifacts; ls | sed 's/^tree-sitter\.//'); do
exe=$(ls artifacts/tree-sitter.$platform/tree-sitter*) exe=$(ls artifacts/tree-sitter.$platform/tree-sitter*)
gzip --stdout --name $exe > target/tree-sitter-$platform.gz gzip --stdout --name $exe > target/tree-sitter-$platform.gz
@ -49,65 +43,47 @@ jobs:
rm -rf artifacts rm -rf artifacts
ls -l target/ ls -l target/
- name: Generate attestations
uses: actions/attest-build-provenance@v3
with:
subject-path: |
target/tree-sitter-*.gz
target/web-tree-sitter.tar.gz
- name: Create release - name: Create release
run: |- run: |-
gh release create $GITHUB_REF_NAME \ gh release create \
target/tree-sitter-*.gz \ target/tree-sitter-*.gz \
target/web-tree-sitter.tar.gz target/tree-sitter.wasm \
target/tree-sitter.js
env: env:
GH_TOKEN: ${{ github.token }} GH_TOKEN: ${{ github.token }}
crates_io: crates_io:
name: Publish packages to Crates.io name: Publish packages to Crates.io
runs-on: ubuntu-latest runs-on: ubuntu-latest
environment: crates
permissions:
id-token: write
contents: read
needs: release needs: release
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Set up Rust - name: Set up Rust
uses: actions-rust-lang/setup-rust-toolchain@v1 uses: actions-rust-lang/setup-rust-toolchain@v1
- name: Set up registry token
id: auth
uses: rust-lang/crates-io-auth-action@v1
- name: Publish crates to Crates.io - name: Publish crates to Crates.io
uses: katyo/publish-crates@v2 uses: katyo/publish-crates@v2
with: with:
registry-token: ${{ steps.auth.outputs.token }} registry-token: ${{ secrets.CARGO_REGISTRY_TOKEN }}
npm: npm:
name: Publish packages to npmjs.com name: Publish packages to npmjs.com
runs-on: ubuntu-latest runs-on: ubuntu-latest
environment: npm
permissions:
id-token: write
contents: read
needs: release needs: release
strategy: strategy:
fail-fast: false fail-fast: false
matrix: matrix:
directory: [crates/cli/npm, lib/binding_web] directory: [cli/npm, lib/binding_web]
steps: steps:
- name: Checkout repository - name: CHeckout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Set up Node - name: Set up Node
uses: actions/setup-node@v6 uses: actions/setup-node@v4
with: with:
node-version: 24 node-version: 20
registry-url: https://registry.npmjs.org registry-url: https://registry.npmjs.org
- name: Set up Rust - name: Set up Rust
@ -115,15 +91,10 @@ jobs:
- name: Build wasm - name: Build wasm
if: matrix.directory == 'lib/binding_web' if: matrix.directory == 'lib/binding_web'
run: | run: cargo xtask build-wasm
cd ${{ matrix.directory }}
npm ci
npm run build
npm run build:debug
CJS=true npm run build
CJS=true npm run build:debug
npm run build:dts
- name: Publish to npmjs.com - name: Publish to npmjs.com
working-directory: ${{ matrix.directory }} working-directory: ${{ matrix.directory }}
run: npm publish run: npm publish
env:
NODE_AUTH_TOKEN: ${{ secrets.NPM_TOKEN }}

View file

@ -17,13 +17,13 @@ jobs:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- name: Checkout script - name: Checkout script
uses: actions/checkout@v6 uses: actions/checkout@v4
with: with:
sparse-checkout: .github/scripts/close_unresponsive.js sparse-checkout: .github/scripts/close_unresponsive.js
sparse-checkout-cone-mode: false sparse-checkout-cone-mode: false
- name: Run script - name: Run script
uses: actions/github-script@v8 uses: actions/github-script@v7
with: with:
script: | script: |
const script = require('./.github/scripts/close_unresponsive.js') const script = require('./.github/scripts/close_unresponsive.js')
@ -35,13 +35,13 @@ jobs:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- name: Checkout script - name: Checkout script
uses: actions/checkout@v6 uses: actions/checkout@v4
with: with:
sparse-checkout: .github/scripts/remove_response_label.js sparse-checkout: .github/scripts/remove_response_label.js
sparse-checkout-cone-mode: false sparse-checkout-cone-mode: false
- name: Run script - name: Run script
uses: actions/github-script@v8 uses: actions/github-script@v7
with: with:
script: | script: |
const script = require('./.github/scripts/remove_response_label.js') const script = require('./.github/scripts/remove_response_label.js')

View file

@ -12,13 +12,13 @@ jobs:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- name: Checkout script - name: Checkout script
uses: actions/checkout@v6 uses: actions/checkout@v4
with: with:
sparse-checkout: .github/scripts/reviewers_remove.js sparse-checkout: .github/scripts/reviewers_remove.js
sparse-checkout-cone-mode: false sparse-checkout-cone-mode: false
- name: Run script - name: Run script
uses: actions/github-script@v8 uses: actions/github-script@v7
with: with:
script: | script: |
const script = require('./.github/scripts/reviewers_remove.js') const script = require('./.github/scripts/reviewers_remove.js')

View file

@ -15,7 +15,7 @@ jobs:
TREE_SITTER: ${{ github.workspace }}/target/release/tree-sitter TREE_SITTER: ${{ github.workspace }}/target/release/tree-sitter
steps: steps:
- name: Checkout repository - name: Checkout repository
uses: actions/checkout@v6 uses: actions/checkout@v4
- name: Install UBSAN library - name: Install UBSAN library
run: sudo apt-get update -y && sudo apt-get install -y libubsan1 run: sudo apt-get update -y && sudo apt-get install -y libubsan1

View file

@ -1,29 +0,0 @@
name: Close as spam
on:
issues:
types: [labeled]
pull_request_target:
types: [labeled]
permissions:
issues: write
pull-requests: write
jobs:
spam:
runs-on: ubuntu-latest
if: github.event.label.name == 'spam'
steps:
- name: Checkout script
uses: actions/checkout@v6
with:
sparse-checkout: .github/scripts/close_spam.js
sparse-checkout-cone-mode: false
- name: Run script
uses: actions/github-script@v8
with:
script: |
const script = require('./.github/scripts/close_spam.js')
await script({github, context})

View file

@ -1,41 +0,0 @@
name: Check Wasm Exports
on:
pull_request:
paths:
- lib/include/tree_sitter/api.h
- lib/binding_web/**
- xtask/src/**
push:
branches: [master]
paths:
- lib/include/tree_sitter/api.h
- lib/binding_rust/bindings.rs
- CMakeLists.txt
jobs:
check-wasm-exports:
runs-on: ubuntu-latest
steps:
- name: Checkout repository
uses: actions/checkout@v6
- name: Set up stable Rust toolchain
uses: actions-rust-lang/setup-rust-toolchain@v1
with:
toolchain: stable
- name: Install wasm-objdump
run: sudo apt-get update -y && sudo apt-get install -y wabt
- name: Build C library (make)
run: make -j CFLAGS="$CFLAGS"
env:
CFLAGS: -g -Werror -Wall -Wextra -Wshadow -Wpedantic -Werror=incompatible-pointer-types
- name: Build Wasm Library
working-directory: lib/binding_web
run: npm ci && npm run build:debug
- name: Check Wasm exports
run: cargo xtask check-wasm-exports

View file

@ -1,19 +0,0 @@
name: Check Wasm Stdlib build
on:
workflow_call:
jobs:
check:
runs-on: ubuntu-latest
steps:
- name: Checkout repository
uses: actions/checkout@v6
- name: Check directory changes
uses: actions/github-script@v8
with:
script: |
const scriptPath = `${process.env.GITHUB_WORKSPACE}/.github/scripts/wasm_stdlib.js`;
const script = require(scriptPath);
return script({ github, context, core });

6
.gitignore vendored
View file

@ -1,12 +1,10 @@
log*.html log*.html
.direnv
.idea .idea
*.xcodeproj *.xcodeproj
.vscode .vscode
.cache .cache
.zig-cache .zig-cache
.direnv
profile* profile*
fuzz-results fuzz-results
@ -14,6 +12,7 @@ test/fuzz/out
test/fixtures/grammars/* test/fixtures/grammars/*
!test/fixtures/grammars/.gitkeep !test/fixtures/grammars/.gitkeep
package-lock.json
node_modules node_modules
docs/assets/js/tree-sitter.js docs/assets/js/tree-sitter.js
@ -26,7 +25,6 @@ docs/assets/js/tree-sitter.js
*.dylib *.dylib
*.so *.so
*.so.[0-9]* *.so.[0-9]*
*.dll
*.o *.o
*.obj *.obj
*.exp *.exp
@ -36,5 +34,3 @@ docs/assets/js/tree-sitter.js
.build .build
build build
zig-* zig-*
/result

View file

@ -1,11 +0,0 @@
{
"lsp": {
"rust-analyzer": {
"initialization_options": {
"cargo": {
"features": "all"
}
}
}
}
}

View file

@ -1 +1 @@
See [docs/src/6-contributing.md](./docs/src/6-contributing.md) See [section-6-contributing.md](./docs/section-6-contributing.md)

1958
Cargo.lock generated

File diff suppressed because it is too large Load diff

View file

@ -1,26 +1,22 @@
[workspace] [workspace]
default-members = ["crates/cli"] default-members = ["cli"]
members = [ members = [
"crates/cli", "cli",
"crates/config", "cli/config",
"crates/generate", "cli/loader",
"crates/highlight",
"crates/loader",
"crates/tags",
"crates/xtask",
"crates/language",
"lib", "lib",
"lib/language",
"tags",
"highlight",
"xtask",
] ]
resolver = "2" resolver = "2"
[workspace.package] [workspace.package]
version = "0.27.0" version = "0.25.0"
authors = [ authors = ["Max Brunsfeld <maxbrunsfeld@gmail.com>"]
"Max Brunsfeld <maxbrunsfeld@gmail.com>",
"Amaan Qureshi <amaanq12@gmail.com>",
]
edition = "2021" edition = "2021"
rust-version = "1.85" rust-version = "1.74.1"
homepage = "https://tree-sitter.github.io/tree-sitter" homepage = "https://tree-sitter.github.io/tree-sitter"
repository = "https://github.com/tree-sitter/tree-sitter" repository = "https://github.com/tree-sitter/tree-sitter"
license = "MIT" license = "MIT"
@ -60,8 +56,6 @@ missing_errors_doc = "allow"
missing_panics_doc = "allow" missing_panics_doc = "allow"
module_name_repetitions = "allow" module_name_repetitions = "allow"
multiple_crate_versions = "allow" multiple_crate_versions = "allow"
needless_for_each = "allow"
obfuscated_if_else = "allow"
option_if_let_else = "allow" option_if_let_else = "allow"
or_fun_call = "allow" or_fun_call = "allow"
range_plus_one = "allow" range_plus_one = "allow"
@ -78,9 +72,6 @@ unnecessary_wraps = "allow"
unused_self = "allow" unused_self = "allow"
used_underscore_items = "allow" used_underscore_items = "allow"
[workspace.lints.rust]
mismatched_lifetime_syntaxes = "allow"
[profile.optimize] [profile.optimize]
inherits = "release" inherits = "release"
strip = true # Automatically strip symbols from the binary. strip = true # Automatically strip symbols from the binary.
@ -102,62 +93,61 @@ incremental = true
codegen-units = 256 codegen-units = 256
[workspace.dependencies] [workspace.dependencies]
ansi_colours = "1.2.3" anstyle = "1.0.8"
anstyle = "1.0.13" anyhow = "1.0.89"
anyhow = "1.0.100" bstr = "1.11.0"
bstr = "1.12.0" cc = "1.2.1"
cc = "1.2.53" clap = { version = "4.5.21", features = [
clap = { version = "4.5.54", features = [
"cargo", "cargo",
"derive", "derive",
"env", "env",
"help", "help",
"string",
"unstable-styles", "unstable-styles",
] } ] }
clap_complete = "4.5.65" clap_complete = "4.5.38"
clap_complete_nushell = "4.5.10" ctor = "0.2.8"
crc32fast = "1.5.0" ctrlc = { version = "3.4.5", features = ["termination"] }
ctor = "0.2.9"
ctrlc = { version = "3.5.0", features = ["termination"] }
dialoguer = { version = "0.11.0", features = ["fuzzy-select"] } dialoguer = { version = "0.11.0", features = ["fuzzy-select"] }
etcetera = "0.11.0" dirs = "5.0.1"
fs4 = "0.12.0" filetime = "0.2.25"
glob = "0.3.3" fs4 = "0.9.1"
git2 = "0.19.0"
glob = "0.3.1"
heck = "0.5.0" heck = "0.5.0"
html-escape = "0.2.13" html-escape = "0.2.13"
indexmap = "2.12.1" indexmap = "2.5.0"
indoc = "2.0.6" indoc = "2.0.5"
libloading = "0.9.0" lazy_static = "1.5.0"
log = { version = "0.4.28", features = ["std"] } libloading = "0.8.5"
memchr = "2.7.6" log = { version = "0.4.22", features = ["std"] }
once_cell = "1.21.3" memchr = "2.7.4"
once_cell = "1.19.0"
path-slash = "0.2.1"
pretty_assertions = "1.4.1" pretty_assertions = "1.4.1"
rand = "0.8.5" rand = "0.8.5"
regex = "1.11.3" regex = "1.10.6"
regex-syntax = "0.8.6" regex-syntax = "0.8.4"
rustc-hash = "2.1.1" rustc-hash = "2.0.0"
schemars = "1.0.5" semver = { version = "1.0.23", features = ["serde"] }
semver = { version = "1.0.27", features = ["serde"] } serde = { version = "1.0.215", features = ["derive"] }
serde = { version = "1.0.219", features = ["derive"] } serde_derive = "1.0.210"
serde_json = { version = "1.0.149", features = ["preserve_order"] } serde_json = { version = "1.0.133", features = ["preserve_order"] }
similar = "2.7.0" similar = "2.6.0"
smallbitvec = "2.6.0" smallbitvec = "2.5.3"
streaming-iterator = "0.1.9" streaming-iterator = "0.1.9"
tempfile = "3.23.0" tempfile = "3.14.0"
thiserror = "2.0.17" thiserror = "1.0.69"
tiny_http = "0.12.0" tiny_http = "0.12.0"
topological-sort = "0.2.2" toml = "0.8.19"
unindent = "0.2.4" unindent = "0.2.3"
url = { version = "2.5.2", features = ["serde"] }
walkdir = "2.5.0" walkdir = "2.5.0"
wasmparser = "0.243.0" wasmparser = "0.218.0"
webbrowser = "1.0.5" webbrowser = "1.0.2"
tree-sitter = { version = "0.27.0", path = "./lib" } tree-sitter = { version = "0.25.0", path = "./lib" }
tree-sitter-generate = { version = "0.27.0", path = "./crates/generate" } tree-sitter-generate = { version = "0.25.0", path = "./cli/generate" }
tree-sitter-loader = { version = "0.27.0", path = "./crates/loader" } tree-sitter-loader = { version = "0.25.0", path = "./cli/loader" }
tree-sitter-config = { version = "0.27.0", path = "./crates/config" } tree-sitter-config = { version = "0.25.0", path = "./cli/config" }
tree-sitter-highlight = { version = "0.27.0", path = "./crates/highlight" } tree-sitter-highlight = { version = "0.25.0", path = "./highlight" }
tree-sitter-tags = { version = "0.27.0", path = "./crates/tags" } tree-sitter-tags = { version = "0.25.0", path = "./tags" }
tree-sitter-language = { version = "0.1", path = "./crates/language" }

View file

@ -1,6 +1,6 @@
The MIT License (MIT) The MIT License (MIT)
Copyright (c) 2018 Max Brunsfeld Copyright (c) 2018-2024 Max Brunsfeld
Permission is hereby granted, free of charge, to any person obtaining a copy Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal of this software and associated documentation files (the "Software"), to deal

View file

@ -1,4 +1,8 @@
VERSION := 0.27.0 ifeq ($(OS),Windows_NT)
$(error Windows is not supported)
endif
VERSION := 0.25.0
DESCRIPTION := An incremental parsing system for programming tools DESCRIPTION := An incremental parsing system for programming tools
HOMEPAGE_URL := https://tree-sitter.github.io/tree-sitter/ HOMEPAGE_URL := https://tree-sitter.github.io/tree-sitter/
@ -6,7 +10,6 @@ HOMEPAGE_URL := https://tree-sitter.github.io/tree-sitter/
PREFIX ?= /usr/local PREFIX ?= /usr/local
INCLUDEDIR ?= $(PREFIX)/include INCLUDEDIR ?= $(PREFIX)/include
LIBDIR ?= $(PREFIX)/lib LIBDIR ?= $(PREFIX)/lib
BINDIR ?= $(PREFIX)/bin
PCLIBDIR ?= $(LIBDIR)/pkgconfig PCLIBDIR ?= $(LIBDIR)/pkgconfig
# collect sources # collect sources
@ -24,7 +27,7 @@ OBJ := $(SRC:.c=.o)
ARFLAGS := rcs ARFLAGS := rcs
CFLAGS ?= -O3 -Wall -Wextra -Wshadow -Wpedantic -Werror=incompatible-pointer-types CFLAGS ?= -O3 -Wall -Wextra -Wshadow -Wpedantic -Werror=incompatible-pointer-types
override CFLAGS += -std=c11 -fPIC -fvisibility=hidden override CFLAGS += -std=c11 -fPIC -fvisibility=hidden
override CFLAGS += -D_POSIX_C_SOURCE=200112L -D_DEFAULT_SOURCE -D_BSD_SOURCE -D_DARWIN_C_SOURCE override CFLAGS += -D_POSIX_C_SOURCE=200112L -D_DEFAULT_SOURCE
override CFLAGS += -Ilib/src -Ilib/src/wasm -Ilib/include override CFLAGS += -Ilib/src -Ilib/src/wasm -Ilib/include
# ABI versioning # ABI versioning
@ -32,25 +35,20 @@ SONAME_MAJOR := $(word 1,$(subst ., ,$(VERSION)))
SONAME_MINOR := $(word 2,$(subst ., ,$(VERSION))) SONAME_MINOR := $(word 2,$(subst ., ,$(VERSION)))
# OS-specific bits # OS-specific bits
MACHINE := $(shell $(CC) -dumpmachine) ifneq ($(findstring darwin,$(shell $(CC) -dumpmachine)),)
ifneq ($(findstring darwin,$(MACHINE)),)
SOEXT = dylib SOEXT = dylib
SOEXTVER_MAJOR = $(SONAME_MAJOR).$(SOEXT) SOEXTVER_MAJOR = $(SONAME_MAJOR).$(SOEXT)
SOEXTVER = $(SONAME_MAJOR).$(SONAME_MINOR).$(SOEXT) SOEXTVER = $(SONAME_MAJOR).$(SONAME_MINOR).$(SOEXT)
LINKSHARED += -dynamiclib -Wl,-install_name,$(LIBDIR)/libtree-sitter.$(SOEXTVER) LINKSHARED += -dynamiclib -Wl,-install_name,$(LIBDIR)/libtree-sitter.$(SOEXTVER)
else ifneq ($(findstring mingw32,$(MACHINE)),)
SOEXT = dll
LINKSHARED += -s -shared -Wl,--out-implib,libtree-sitter.dll.a
else else
SOEXT = so SOEXT = so
SOEXTVER_MAJOR = $(SOEXT).$(SONAME_MAJOR) SOEXTVER_MAJOR = $(SOEXT).$(SONAME_MAJOR)
SOEXTVER = $(SOEXT).$(SONAME_MAJOR).$(SONAME_MINOR) SOEXTVER = $(SOEXT).$(SONAME_MAJOR).$(SONAME_MINOR)
LINKSHARED += -shared -Wl,-soname,libtree-sitter.$(SOEXTVER) LINKSHARED += -shared -Wl,-soname,libtree-sitter.$(SOEXTVER)
endif
ifneq ($(filter $(shell uname),FreeBSD NetBSD DragonFly),) ifneq ($(filter $(shell uname),FreeBSD NetBSD DragonFly),)
PCLIBDIR := $(PREFIX)/libdata/pkgconfig PCLIBDIR := $(PREFIX)/libdata/pkgconfig
endif endif
endif
all: libtree-sitter.a libtree-sitter.$(SOEXT) tree-sitter.pc all: libtree-sitter.a libtree-sitter.$(SOEXT) tree-sitter.pc
@ -63,10 +61,6 @@ ifneq ($(STRIP),)
$(STRIP) $@ $(STRIP) $@
endif endif
ifneq ($(findstring mingw32,$(MACHINE)),)
libtree-sitter.dll.a: libtree-sitter.$(SOEXT)
endif
tree-sitter.pc: lib/tree-sitter.pc.in tree-sitter.pc: lib/tree-sitter.pc.in
sed -e 's|@PROJECT_VERSION@|$(VERSION)|' \ sed -e 's|@PROJECT_VERSION@|$(VERSION)|' \
-e 's|@CMAKE_INSTALL_LIBDIR@|$(LIBDIR:$(PREFIX)/%=%)|' \ -e 's|@CMAKE_INSTALL_LIBDIR@|$(LIBDIR:$(PREFIX)/%=%)|' \
@ -75,27 +69,17 @@ tree-sitter.pc: lib/tree-sitter.pc.in
-e 's|@PROJECT_HOMEPAGE_URL@|$(HOMEPAGE_URL)|' \ -e 's|@PROJECT_HOMEPAGE_URL@|$(HOMEPAGE_URL)|' \
-e 's|@CMAKE_INSTALL_PREFIX@|$(PREFIX)|' $< > $@ -e 's|@CMAKE_INSTALL_PREFIX@|$(PREFIX)|' $< > $@
shared: libtree-sitter.$(SOEXT)
static: libtree-sitter.a
clean: clean:
$(RM) $(OBJ) tree-sitter.pc libtree-sitter.a libtree-sitter.$(SOEXT) libtree-stitter.dll.a $(RM) $(OBJ) tree-sitter.pc libtree-sitter.a libtree-sitter.$(SOEXT)
install: all install: all
install -d '$(DESTDIR)$(INCLUDEDIR)'/tree_sitter '$(DESTDIR)$(PCLIBDIR)' '$(DESTDIR)$(LIBDIR)' install -d '$(DESTDIR)$(INCLUDEDIR)'/tree_sitter '$(DESTDIR)$(PCLIBDIR)' '$(DESTDIR)$(LIBDIR)'
install -m644 lib/include/tree_sitter/api.h '$(DESTDIR)$(INCLUDEDIR)'/tree_sitter/api.h install -m644 lib/include/tree_sitter/api.h '$(DESTDIR)$(INCLUDEDIR)'/tree_sitter/api.h
install -m644 tree-sitter.pc '$(DESTDIR)$(PCLIBDIR)'/tree-sitter.pc install -m644 tree-sitter.pc '$(DESTDIR)$(PCLIBDIR)'/tree-sitter.pc
install -m644 libtree-sitter.a '$(DESTDIR)$(LIBDIR)'/libtree-sitter.a install -m644 libtree-sitter.a '$(DESTDIR)$(LIBDIR)'/libtree-sitter.a
ifneq ($(findstring mingw32,$(MACHINE)),)
install -d '$(DESTDIR)$(BINDIR)'
install -m755 libtree-sitter.dll '$(DESTDIR)$(BINDIR)'/libtree-sitter.dll
install -m755 libtree-sitter.dll.a '$(DESTDIR)$(LIBDIR)'/libtree-sitter.dll.a
else
install -m755 libtree-sitter.$(SOEXT) '$(DESTDIR)$(LIBDIR)'/libtree-sitter.$(SOEXTVER) install -m755 libtree-sitter.$(SOEXT) '$(DESTDIR)$(LIBDIR)'/libtree-sitter.$(SOEXTVER)
cd '$(DESTDIR)$(LIBDIR)' && ln -sf libtree-sitter.$(SOEXTVER) libtree-sitter.$(SOEXTVER_MAJOR) ln -sf libtree-sitter.$(SOEXTVER) '$(DESTDIR)$(LIBDIR)'/libtree-sitter.$(SOEXTVER_MAJOR)
cd '$(DESTDIR)$(LIBDIR)' && ln -sf libtree-sitter.$(SOEXTVER_MAJOR) libtree-sitter.$(SOEXT) ln -sf libtree-sitter.$(SOEXTVER_MAJOR) '$(DESTDIR)$(LIBDIR)'/libtree-sitter.$(SOEXT)
endif
uninstall: uninstall:
$(RM) '$(DESTDIR)$(LIBDIR)'/libtree-sitter.a \ $(RM) '$(DESTDIR)$(LIBDIR)'/libtree-sitter.a \
@ -104,9 +88,8 @@ uninstall:
'$(DESTDIR)$(LIBDIR)'/libtree-sitter.$(SOEXT) \ '$(DESTDIR)$(LIBDIR)'/libtree-sitter.$(SOEXT) \
'$(DESTDIR)$(INCLUDEDIR)'/tree_sitter/api.h \ '$(DESTDIR)$(INCLUDEDIR)'/tree_sitter/api.h \
'$(DESTDIR)$(PCLIBDIR)'/tree-sitter.pc '$(DESTDIR)$(PCLIBDIR)'/tree-sitter.pc
rmdir '$(DESTDIR)$(INCLUDEDIR)'/tree_sitter
.PHONY: all shared static install uninstall clean .PHONY: all install uninstall clean
##### Dev targets ##### ##### Dev targets #####
@ -116,24 +99,20 @@ test:
cargo xtask generate-fixtures cargo xtask generate-fixtures
cargo xtask test cargo xtask test
test-wasm: test_wasm:
cargo xtask generate-fixtures --wasm cargo xtask generate-fixtures-wasm
cargo xtask test-wasm cargo xtask test-wasm
lint: lint:
cargo update --workspace --locked --quiet cargo update --workspace --locked --quiet
cargo check --workspace --all-targets cargo check --workspace --all-targets
cargo fmt --all --check cargo +nightly fmt --all --check
cargo clippy --workspace --all-targets -- -D warnings cargo +nightly clippy --workspace --all-targets -- -D warnings
lint-web:
npm --prefix lib/binding_web ci
npm --prefix lib/binding_web run lint
format: format:
cargo fmt --all cargo +nightly fmt --all
changelog: changelog:
@git-cliff --config .github/cliff.toml --prepend CHANGELOG.md --latest --github-token $(shell gh auth token) @git-cliff --config .github/cliff.toml --prepend CHANGELOG.md --latest --github-token $(shell gh auth token)
.PHONY: test test-wasm lint format changelog .PHONY: test test_wasm lint format changelog

View file

@ -14,21 +14,11 @@ let package = Package(
targets: [ targets: [
.target(name: "TreeSitter", .target(name: "TreeSitter",
path: "lib", path: "lib",
exclude: [ sources: ["src/lib.c"],
"src/unicode/ICU_SHA",
"src/unicode/README.md",
"src/unicode/LICENSE",
"src/wasm/stdlib-symbols.txt",
"src/lib.c",
],
sources: ["src"],
publicHeadersPath: "include",
cSettings: [ cSettings: [
.headerSearchPath("src"), .headerSearchPath("src"),
.define("_POSIX_C_SOURCE", to: "200112L"), .define("_POSIX_C_SOURCE", to: "200112L"),
.define("_DEFAULT_SOURCE"), .define("_DEFAULT_SOURCE"),
.define("_BSD_SOURCE"),
.define("_DARWIN_C_SOURCE"),
]), ]),
], ],
cLanguageStandard: .c11 cLanguageStandard: .c11

View file

@ -14,8 +14,8 @@ Tree-sitter is a parser generator tool and an incremental parsing library. It ca
## Links ## Links
- [Documentation](https://tree-sitter.github.io) - [Documentation](https://tree-sitter.github.io)
- [Rust binding](lib/binding_rust/README.md) - [Rust binding](lib/binding_rust/README.md)
- [Wasm binding](lib/binding_web/README.md) - [WASM binding](lib/binding_web/README.md)
- [Command-line interface](crates/cli/README.md) - [Command-line interface](cli/README.md)
[discord]: https://img.shields.io/discord/1063097320771698699?logo=discord&label=discord [discord]: https://img.shields.io/discord/1063097320771698699?logo=discord&label=discord
[matrix]: https://img.shields.io/matrix/tree-sitter-chat%3Amatrix.org?logo=matrix&label=matrix [matrix]: https://img.shields.io/matrix/tree-sitter-chat%3Amatrix.org?logo=matrix&label=matrix

218
build.zig
View file

@ -1,142 +1,116 @@
const std = @import("std"); const std = @import("std");
pub fn build(b: *std.Build) !void { pub fn build(b: *std.Build) !void {
const target = b.standardTargetOptions(.{}); const target = b.standardTargetOptions(.{});
const optimize = b.standardOptimizeOption(.{}); const optimize = b.standardOptimizeOption(.{});
const wasm = b.option(bool, "enable-wasm", "Enable Wasm support") orelse false; const wasm = b.option(bool, "enable-wasm", "Enable Wasm support") orelse false;
const shared = b.option(bool, "build-shared", "Build a shared library") orelse false; const shared = b.option(bool, "build-shared", "Build a shared library") orelse false;
const amalgamated = b.option(bool, "amalgamated", "Build using an amalgamated source") orelse false; const amalgamated = b.option(bool, "amalgamated", "Build using an amalgamated source") orelse false;
const lib: *std.Build.Step.Compile = b.addLibrary(.{ const lib: *std.Build.Step.Compile = if (!shared) b.addStaticLibrary(.{
.name = "tree-sitter", .name = "tree-sitter",
.linkage = if (shared) .dynamic else .static, .target = target,
.root_module = b.createModule(.{ .optimize = optimize,
.target = target, .link_libc = true,
.optimize = optimize, }) else b.addSharedLibrary(.{
.link_libc = true, .name = "tree-sitter",
.pic = if (shared) true else null, .pic = true,
}), .target = target,
.optimize = optimize,
.link_libc = true,
});
if (amalgamated) {
lib.addCSourceFile(.{
.file = b.path("lib/src/lib.c"),
.flags = &.{"-std=c11"},
}); });
} else {
lib.addCSourceFiles(.{
.root = b.path("lib/src"),
.files = try findSourceFiles(b),
.flags = &.{"-std=c11"},
});
}
if (amalgamated) { lib.addIncludePath(b.path("lib/include"));
lib.addCSourceFile(.{ lib.addIncludePath(b.path("lib/src"));
.file = b.path("lib/src/lib.c"), lib.addIncludePath(b.path("lib/src/wasm"));
.flags = &.{"-std=c11"},
}); lib.root_module.addCMacro("_POSIX_C_SOURCE", "200112L");
} else { lib.root_module.addCMacro("_DEFAULT_SOURCE", "");
const files = try findSourceFiles(b);
defer b.allocator.free(files); if (wasm) {
lib.addCSourceFiles(.{ if (b.lazyDependency(wasmtimeDep(target.result), .{})) |wasmtime| {
.root = b.path("lib/src"), lib.root_module.addCMacro("TREE_SITTER_FEATURE_WASM", "");
.files = files, lib.addSystemIncludePath(wasmtime.path("include"));
.flags = &.{"-std=c11"}, lib.addLibraryPath(wasmtime.path("lib"));
}); lib.linkSystemLibrary("wasmtime");
} }
}
lib.addIncludePath(b.path("lib/include")); lib.installHeadersDirectory(b.path("lib/include"), ".", .{});
lib.addIncludePath(b.path("lib/src"));
lib.addIncludePath(b.path("lib/src/wasm"));
lib.root_module.addCMacro("_POSIX_C_SOURCE", "200112L"); b.installArtifact(lib);
lib.root_module.addCMacro("_DEFAULT_SOURCE", "");
lib.root_module.addCMacro("_BSD_SOURCE", "");
lib.root_module.addCMacro("_DARWIN_C_SOURCE", "");
if (wasm) {
if (b.lazyDependency(wasmtimeDep(target.result), .{})) |wasmtime| {
lib.root_module.addCMacro("TREE_SITTER_FEATURE_WASM", "");
lib.addSystemIncludePath(wasmtime.path("include"));
lib.addLibraryPath(wasmtime.path("lib"));
if (shared) lib.linkSystemLibrary("wasmtime");
}
}
lib.installHeadersDirectory(b.path("lib/include"), ".", .{});
b.installArtifact(lib);
} }
/// Get the name of the wasmtime dependency for this target. fn wasmtimeDep(target: std.Target) []const u8 {
pub fn wasmtimeDep(target: std.Target) []const u8 { const arch = target.cpu.arch;
const arch = target.cpu.arch; const os = target.os.tag;
const os = target.os.tag; const abi = target.abi;
const abi = target.abi; return switch (os) {
return @as(?[]const u8, switch (os) { .linux => switch (arch) {
.linux => switch (arch) { .x86_64 => switch (abi) {
.x86_64 => switch (abi) { .gnu => "wasmtime_c_api_x86_64_linux",
.gnu => "wasmtime_c_api_x86_64_linux", .musl => "wasmtime_c_api_x86_64_musl",
.musl => "wasmtime_c_api_x86_64_musl", .android => "wasmtime_c_api_x86_64_android",
.android => "wasmtime_c_api_x86_64_android", else => null
else => null, },
}, .aarch64 => switch (abi) {
.aarch64 => switch (abi) { .gnu => "wasmtime_c_api_aarch64_linux",
.gnu => "wasmtime_c_api_aarch64_linux", .android => "wasmtime_c_api_aarch64_android",
.musl => "wasmtime_c_api_aarch64_musl", else => null
.android => "wasmtime_c_api_aarch64_android", },
else => null, .s390x => "wasmtime_c_api_s390x_linux",
}, .riscv64 => "wasmtime_c_api_riscv64gc_linux",
.x86 => switch (abi) { else => null
.gnu => "wasmtime_c_api_i686_linux", },
else => null, .windows => switch (arch) {
}, .x86_64 => switch (abi) {
.arm => switch (abi) { .gnu => "wasmtime_c_api_x86_64_mingw",
.gnueabi => "wasmtime_c_api_armv7_linux", .msvc => "wasmtime_c_api_x86_64_windows",
else => null, else => null
}, },
.s390x => switch (abi) { else => null
.gnu => "wasmtime_c_api_s390x_linux", },
else => null, .macos => switch (arch) {
}, .x86_64 => "wasmtime_c_api_x86_64_macos",
.riscv64 => switch (abi) { .aarch64 => "wasmtime_c_api_aarch64_macos",
.gnu => "wasmtime_c_api_riscv64gc_linux", else => null
else => null, },
}, else => null
else => null, } orelse std.debug.panic(
}, "Unsupported target for wasmtime: {s}-{s}-{s}",
.windows => switch (arch) { .{ @tagName(arch), @tagName(os), @tagName(abi) }
.x86_64 => switch (abi) { );
.gnu => "wasmtime_c_api_x86_64_mingw",
.msvc => "wasmtime_c_api_x86_64_windows",
else => null,
},
.aarch64 => switch (abi) {
.msvc => "wasmtime_c_api_aarch64_windows",
else => null,
},
.x86 => switch (abi) {
.msvc => "wasmtime_c_api_i686_windows",
else => null,
},
else => null,
},
.macos => switch (arch) {
.x86_64 => "wasmtime_c_api_x86_64_macos",
.aarch64 => "wasmtime_c_api_aarch64_macos",
else => null,
},
else => null,
}) orelse std.debug.panic(
"Unsupported target for wasmtime: {s}-{s}-{s}",
.{ @tagName(arch), @tagName(os), @tagName(abi) },
);
} }
fn findSourceFiles(b: *std.Build) ![]const []const u8 { fn findSourceFiles(b: *std.Build) ![]const []const u8 {
var sources: std.ArrayListUnmanaged([]const u8) = .empty; var sources = std.ArrayList([]const u8).init(b.allocator);
var dir = try b.build_root.handle.openDir("lib/src", .{ .iterate = true }); var dir = try b.build_root.handle.openDir("lib/src", .{ .iterate = true });
var iter = dir.iterate(); var iter = dir.iterate();
defer dir.close(); defer dir.close();
while (try iter.next()) |entry| { while (try iter.next()) |entry| {
if (entry.kind != .file) continue; if (entry.kind != .file) continue;
const file = entry.name; const file = entry.name;
const ext = std.fs.path.extension(file); const ext = std.fs.path.extension(file);
if (std.mem.eql(u8, ext, ".c") and !std.mem.eql(u8, file, "lib.c")) { if (std.mem.eql(u8, ext, ".c") and !std.mem.eql(u8, file, "lib.c")) {
try sources.append(b.allocator, b.dupe(file)); try sources.append(b.dupe(file));
}
} }
}
return sources.toOwnedSlice(b.allocator); return sources.items;
} }

View file

@ -1,96 +1,69 @@
.{ .{
.name = .tree_sitter, .name = "tree-sitter",
.fingerprint = 0x841224b447ac0d4f, .version = "0.25.0",
.version = "0.27.0", .paths = .{
.minimum_zig_version = "0.14.1", "build.zig",
.paths = .{ "build.zig.zon",
"build.zig", "lib/src",
"build.zig.zon", "lib/include",
"lib/src", "README.md",
"lib/include", "LICENSE",
"README.md", },
"LICENSE", .dependencies = .{
.wasmtime_c_api_aarch64_android = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-aarch64-android-c-api.tar.xz",
.hash = "12208b1c6fc26df81b3bf6b82ba38a2099bcbfb3eea21b93c9cca797d8f0067d891f",
.lazy = true,
}, },
.dependencies = .{ .wasmtime_c_api_aarch64_linux = .{
.wasmtime_c_api_aarch64_android = .{ .url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-aarch64-linux-c-api.tar.xz",
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-aarch64-android-c-api.tar.xz", .hash = "12209aaa1bd480ad8674b8d9cc89300e8b045f0fc626938b64158a09e87597705a45",
.hash = "N-V-__8AAIfPIgdw2YnV3QyiFQ2NHdrxrXzzCdjYJyxJDOta", .lazy = true,
.lazy = true,
},
.wasmtime_c_api_aarch64_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-aarch64-linux-c-api.tar.xz",
.hash = "N-V-__8AAIt97QZi7Pf7nNJ2mVY6uxA80Klyuvvtop3pLMRK",
.lazy = true,
},
.wasmtime_c_api_aarch64_macos = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-aarch64-macos-c-api.tar.xz",
.hash = "N-V-__8AAAO48QQf91w9RmmUDHTja8DrXZA1n6Bmc8waW3qe",
.lazy = true,
},
.wasmtime_c_api_aarch64_musl = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-aarch64-musl-c-api.tar.xz",
.hash = "N-V-__8AAI196wa9pwADoA2RbCDp5F7bKQg1iOPq6gIh8-FH",
.lazy = true,
},
.wasmtime_c_api_aarch64_windows = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-aarch64-windows-c-api.zip",
.hash = "N-V-__8AAC9u4wXfqd1Q6XyQaC8_DbQZClXux60Vu5743N05",
.lazy = true,
},
.wasmtime_c_api_armv7_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-armv7-linux-c-api.tar.xz",
.hash = "N-V-__8AAHXe8gWs3s83Cc5G6SIq0_jWxj8fGTT5xG4vb6-x",
.lazy = true,
},
.wasmtime_c_api_i686_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-i686-linux-c-api.tar.xz",
.hash = "N-V-__8AAN2pzgUUfulRCYnipSfis9IIYHoTHVlieLRmKuct",
.lazy = true,
},
.wasmtime_c_api_i686_windows = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-i686-windows-c-api.zip",
.hash = "N-V-__8AAJu0YAUUTFBLxFIOi-MSQVezA6MMkpoFtuaf2Quf",
.lazy = true,
},
.wasmtime_c_api_riscv64gc_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-riscv64gc-linux-c-api.tar.xz",
.hash = "N-V-__8AAG8m-gc3E3AIImtTZ3l1c7HC6HUWazQ9OH5KACX4",
.lazy = true,
},
.wasmtime_c_api_s390x_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-s390x-linux-c-api.tar.xz",
.hash = "N-V-__8AAH314gd-gE4IBp2uvAL3gHeuW1uUZjMiLLeUdXL_",
.lazy = true,
},
.wasmtime_c_api_x86_64_android = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-x86_64-android-c-api.tar.xz",
.hash = "N-V-__8AAIPNRwfNkznebrcGb0IKUe7f35bkuZEYOjcx6q3f",
.lazy = true,
},
.wasmtime_c_api_x86_64_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-x86_64-linux-c-api.tar.xz",
.hash = "N-V-__8AAI8EDwcyTtk_Afhk47SEaqfpoRqGkJeZpGs69ChF",
.lazy = true,
},
.wasmtime_c_api_x86_64_macos = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-x86_64-macos-c-api.tar.xz",
.hash = "N-V-__8AAGtGNgVaOpHSxC22IjrampbRIy6lLwscdcAE8nG1",
.lazy = true,
},
.wasmtime_c_api_x86_64_mingw = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-x86_64-mingw-c-api.zip",
.hash = "N-V-__8AAPS2PAbVix50L6lnddlgazCPTz3whLUFk1qnRtnZ",
.lazy = true,
},
.wasmtime_c_api_x86_64_musl = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-x86_64-musl-c-api.tar.xz",
.hash = "N-V-__8AAF-WEQe0nzvi09PgusM5i46FIuCKJmIDWUleWgQ3",
.lazy = true,
},
.wasmtime_c_api_x86_64_windows = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v33.0.2/wasmtime-v33.0.2-x86_64-windows-c-api.zip",
.hash = "N-V-__8AAKGNXwbpJQsn0_6kwSIVDDWifSg8cBzf7T2RzsC9",
.lazy = true,
},
}, },
.wasmtime_c_api_aarch64_macos = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-aarch64-macos-c-api.tar.xz",
.hash = "12206de8f3ce815b0cd9fd735fc61ac73f338e7601e973916b06ae050b4fa7118baf",
.lazy = true,
},
.wasmtime_c_api_riscv64gc_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-riscv64gc-linux-c-api.tar.xz",
.hash = "122005e52855c8be82f574b6f35c1e2f5bc6d74ec1e12f16852654e4edd6ac7e2fc1",
.lazy = true,
},
.wasmtime_c_api_s390x_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-s390x-linux-c-api.tar.xz",
.hash = "1220a4643445f5e67daffe6473c8e68267682aa92e4d612355b7ac6d46be41d8511e",
.lazy = true,
},
.wasmtime_c_api_x86_64_android = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-x86_64-android-c-api.tar.xz",
.hash = "122082a6f5db4787a639d8fa587087d3452aa53a92137fef701dfd2be4d62a70102f",
.lazy = true,
},
.wasmtime_c_api_x86_64_linux = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-x86_64-linux-c-api.tar.xz",
.hash = "12201e8daa6057abd4ce5d25d29a053f4be66a81b695f32f65a14f999bf075ddc0f2",
.lazy = true,
},
.wasmtime_c_api_x86_64_macos = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-x86_64-macos-c-api.tar.xz",
.hash = "122063a6a6811cf6a3ae6838a61abb66ff4c348447c657a5ed2348c0d310efc2edbb",
.lazy = true,
},
.wasmtime_c_api_x86_64_mingw = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-x86_64-mingw-c-api.zip",
.hash = "1220bdd5c3711af386ca07795c7ee8917f58365b0bb6b95255424aa86e08a7fcb4fa",
.lazy = true,
},
.wasmtime_c_api_x86_64_musl = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-x86_64-musl-c-api.tar.xz",
.hash = "12200037419e1a5f8a529d42e0ec289919dc5baf06981bc98295e61df4976563566d",
.lazy = true,
},
.wasmtime_c_api_x86_64_windows = .{
.url = "https://github.com/bytecodealliance/wasmtime/releases/download/v26.0.1/wasmtime-v26.0.1-x86_64-windows-c-api.zip",
.hash = "122069341103b7d16b1f47c3bb96101614af0845ba63a0664e5cc857e9feb369a772",
.lazy = true,
},
}
} }

View file

@ -8,18 +8,13 @@ rust-version.workspace = true
readme = "README.md" readme = "README.md"
homepage.workspace = true homepage.workspace = true
repository.workspace = true repository.workspace = true
documentation = "https://docs.rs/tree-sitter-cli"
license.workspace = true license.workspace = true
keywords.workspace = true keywords.workspace = true
categories.workspace = true categories.workspace = true
include = ["build.rs", "README.md", "LICENSE", "benches/*", "src/**"]
[lints] [lints]
workspace = true workspace = true
[lib]
path = "src/tree_sitter_cli.rs"
[[bin]] [[bin]]
name = "tree-sitter" name = "tree-sitter"
path = "src/main.rs" path = "src/main.rs"
@ -30,38 +25,40 @@ name = "benchmark"
harness = false harness = false
[features] [features]
default = ["qjs-rt"]
wasm = ["tree-sitter/wasm", "tree-sitter-loader/wasm"] wasm = ["tree-sitter/wasm", "tree-sitter-loader/wasm"]
qjs-rt = ["tree-sitter-generate/qjs-rt"]
[dependencies] [dependencies]
ansi_colours.workspace = true
anstyle.workspace = true anstyle.workspace = true
anyhow.workspace = true anyhow.workspace = true
bstr.workspace = true bstr.workspace = true
clap.workspace = true clap.workspace = true
clap_complete.workspace = true clap_complete.workspace = true
clap_complete_nushell.workspace = true
crc32fast.workspace = true
ctor.workspace = true ctor.workspace = true
ctrlc.workspace = true ctrlc.workspace = true
dialoguer.workspace = true dialoguer.workspace = true
dirs.workspace = true
filetime.workspace = true
glob.workspace = true glob.workspace = true
heck.workspace = true heck.workspace = true
html-escape.workspace = true html-escape.workspace = true
indexmap.workspace = true
indoc.workspace = true indoc.workspace = true
lazy_static.workspace = true
log.workspace = true log.workspace = true
memchr.workspace = true memchr.workspace = true
rand.workspace = true rand.workspace = true
regex.workspace = true regex.workspace = true
schemars.workspace = true regex-syntax.workspace = true
rustc-hash.workspace = true
semver.workspace = true semver.workspace = true
serde.workspace = true serde.workspace = true
serde_derive.workspace = true
serde_json.workspace = true serde_json.workspace = true
similar.workspace = true similar.workspace = true
smallbitvec.workspace = true
streaming-iterator.workspace = true streaming-iterator.workspace = true
thiserror.workspace = true
tiny_http.workspace = true tiny_http.workspace = true
url.workspace = true
walkdir.workspace = true walkdir.workspace = true
wasmparser.workspace = true wasmparser.workspace = true
webbrowser.workspace = true webbrowser.workspace = true
@ -75,7 +72,7 @@ tree-sitter-tags.workspace = true
[dev-dependencies] [dev-dependencies]
encoding_rs = "0.8.35" encoding_rs = "0.8.35"
widestring = "1.2.1" widestring = "1.1.0"
tree_sitter_proc_macro = { path = "src/tests/proc_macro", package = "tree-sitter-tests-proc-macro" } tree_sitter_proc_macro = { path = "src/tests/proc_macro", package = "tree-sitter-tests-proc-macro" }
tempfile.workspace = true tempfile.workspace = true

View file

@ -7,8 +7,7 @@
[npmjs.com]: https://www.npmjs.org/package/tree-sitter-cli [npmjs.com]: https://www.npmjs.org/package/tree-sitter-cli
[npmjs.com badge]: https://img.shields.io/npm/v/tree-sitter-cli.svg?color=%23BF4A4A [npmjs.com badge]: https://img.shields.io/npm/v/tree-sitter-cli.svg?color=%23BF4A4A
The Tree-sitter CLI allows you to develop, test, and use Tree-sitter grammars from the command line. It works on `MacOS`, The Tree-sitter CLI allows you to develop, test, and use Tree-sitter grammars from the command line. It works on `MacOS`, `Linux`, and `Windows`.
`Linux`, and `Windows`.
### Installation ### Installation
@ -35,11 +34,9 @@ The `tree-sitter` binary itself has no dependencies, but specific commands have
### Commands ### Commands
* `generate` - The `tree-sitter generate` command will generate a Tree-sitter parser based on the grammar in the current * `generate` - The `tree-sitter generate` command will generate a Tree-sitter parser based on the grammar in the current working directory. See [the documentation] for more information.
working directory. See [the documentation] for more information.
* `test` - The `tree-sitter test` command will run the unit tests for the Tree-sitter parser in the current working directory. * `test` - The `tree-sitter test` command will run the unit tests for the Tree-sitter parser in the current working directory. See [the documentation] for more information.
See [the documentation] for more information.
* `parse` - The `tree-sitter parse` command will parse a file (or list of files) using Tree-sitter parsers. * `parse` - The `tree-sitter parse` command will parse a file (or list of files) using Tree-sitter parsers.

View file

@ -3,77 +3,70 @@ use std::{
env, fs, env, fs,
path::{Path, PathBuf}, path::{Path, PathBuf},
str, str,
sync::LazyLock,
time::Instant, time::Instant,
}; };
use anyhow::Context; use anyhow::Context;
use log::info; use lazy_static::lazy_static;
use tree_sitter::{Language, Parser, Query}; use tree_sitter::{Language, Parser, Query};
use tree_sitter_loader::{CompileConfig, Loader}; use tree_sitter_loader::{CompileConfig, Loader};
include!("../src/tests/helpers/dirs.rs"); include!("../src/tests/helpers/dirs.rs");
static LANGUAGE_FILTER: LazyLock<Option<String>> = lazy_static! {
LazyLock::new(|| env::var("TREE_SITTER_BENCHMARK_LANGUAGE_FILTER").ok()); static ref LANGUAGE_FILTER: Option<String> =
static EXAMPLE_FILTER: LazyLock<Option<String>> = env::var("TREE_SITTER_BENCHMARK_LANGUAGE_FILTER").ok();
LazyLock::new(|| env::var("TREE_SITTER_BENCHMARK_EXAMPLE_FILTER").ok()); static ref EXAMPLE_FILTER: Option<String> =
static REPETITION_COUNT: LazyLock<usize> = LazyLock::new(|| { env::var("TREE_SITTER_BENCHMARK_EXAMPLE_FILTER").ok();
env::var("TREE_SITTER_BENCHMARK_REPETITION_COUNT") static ref REPETITION_COUNT: usize = env::var("TREE_SITTER_BENCHMARK_REPETITION_COUNT")
.map(|s| s.parse::<usize>().unwrap()) .map(|s| s.parse::<usize>().unwrap())
.unwrap_or(5) .unwrap_or(5);
}); static ref TEST_LOADER: Loader = Loader::with_parser_lib_path(SCRATCH_DIR.clone());
static TEST_LOADER: LazyLock<Loader> = static ref EXAMPLE_AND_QUERY_PATHS_BY_LANGUAGE_DIR: BTreeMap<PathBuf, (Vec<PathBuf>, Vec<PathBuf>)> = {
LazyLock::new(|| Loader::with_parser_lib_path(SCRATCH_DIR.clone())); fn process_dir(result: &mut BTreeMap<PathBuf, (Vec<PathBuf>, Vec<PathBuf>)>, dir: &Path) {
if dir.join("grammar.js").exists() {
let relative_path = dir.strip_prefix(GRAMMARS_DIR.as_path()).unwrap();
let (example_paths, query_paths) =
result.entry(relative_path.to_owned()).or_default();
#[allow(clippy::type_complexity)] if let Ok(example_files) = fs::read_dir(dir.join("examples")) {
static EXAMPLE_AND_QUERY_PATHS_BY_LANGUAGE_DIR: LazyLock< example_paths.extend(example_files.filter_map(|p| {
BTreeMap<PathBuf, (Vec<PathBuf>, Vec<PathBuf>)>, let p = p.unwrap().path();
> = LazyLock::new(|| { if p.is_file() {
fn process_dir(result: &mut BTreeMap<PathBuf, (Vec<PathBuf>, Vec<PathBuf>)>, dir: &Path) { Some(p)
if dir.join("grammar.js").exists() { } else {
let relative_path = dir.strip_prefix(GRAMMARS_DIR.as_path()).unwrap(); None
let (example_paths, query_paths) = result.entry(relative_path.to_owned()).or_default(); }
}));
}
if let Ok(example_files) = fs::read_dir(dir.join("examples")) { if let Ok(query_files) = fs::read_dir(dir.join("queries")) {
example_paths.extend(example_files.filter_map(|p| { query_paths.extend(query_files.filter_map(|p| {
let p = p.unwrap().path(); let p = p.unwrap().path();
if p.is_file() { if p.is_file() {
Some(p) Some(p)
} else { } else {
None None
}
}));
}
} else {
for entry in fs::read_dir(dir).unwrap() {
let entry = entry.unwrap().path();
if entry.is_dir() {
process_dir(result, &entry);
} }
}));
}
if let Ok(query_files) = fs::read_dir(dir.join("queries")) {
query_paths.extend(query_files.filter_map(|p| {
let p = p.unwrap().path();
if p.is_file() {
Some(p)
} else {
None
}
}));
}
} else {
for entry in fs::read_dir(dir).unwrap() {
let entry = entry.unwrap().path();
if entry.is_dir() {
process_dir(result, &entry);
} }
} }
} }
}
let mut result = BTreeMap::new(); let mut result = BTreeMap::new();
process_dir(&mut result, &GRAMMARS_DIR); process_dir(&mut result, &GRAMMARS_DIR);
result result
}); };
}
fn main() { fn main() {
tree_sitter_cli::logger::init();
let max_path_length = EXAMPLE_AND_QUERY_PATHS_BY_LANGUAGE_DIR let max_path_length = EXAMPLE_AND_QUERY_PATHS_BY_LANGUAGE_DIR
.values() .values()
.flat_map(|(e, q)| { .flat_map(|(e, q)| {
@ -84,7 +77,7 @@ fn main() {
.max() .max()
.unwrap_or(0); .unwrap_or(0);
info!("Benchmarking with {} repetitions", *REPETITION_COUNT); eprintln!("Benchmarking with {} repetitions", *REPETITION_COUNT);
let mut parser = Parser::new(); let mut parser = Parser::new();
let mut all_normal_speeds = Vec::new(); let mut all_normal_speeds = Vec::new();
@ -101,11 +94,11 @@ fn main() {
} }
} }
info!("\nLanguage: {language_name}"); eprintln!("\nLanguage: {language_name}");
let language = get_language(language_path); let language = get_language(language_path);
parser.set_language(&language).unwrap(); parser.set_language(&language).unwrap();
info!(" Constructing Queries"); eprintln!(" Constructing Queries");
for path in query_paths { for path in query_paths {
if let Some(filter) = EXAMPLE_FILTER.as_ref() { if let Some(filter) = EXAMPLE_FILTER.as_ref() {
if !path.to_str().unwrap().contains(filter.as_str()) { if !path.to_str().unwrap().contains(filter.as_str()) {
@ -115,12 +108,12 @@ fn main() {
parse(path, max_path_length, |source| { parse(path, max_path_length, |source| {
Query::new(&language, str::from_utf8(source).unwrap()) Query::new(&language, str::from_utf8(source).unwrap())
.with_context(|| format!("Query file path: {}", path.display())) .with_context(|| format!("Query file path: {path:?}"))
.expect("Failed to parse query"); .expect("Failed to parse query");
}); });
} }
info!(" Parsing Valid Code:"); eprintln!(" Parsing Valid Code:");
let mut normal_speeds = Vec::new(); let mut normal_speeds = Vec::new();
for example_path in example_paths { for example_path in example_paths {
if let Some(filter) = EXAMPLE_FILTER.as_ref() { if let Some(filter) = EXAMPLE_FILTER.as_ref() {
@ -134,7 +127,7 @@ fn main() {
})); }));
} }
info!(" Parsing Invalid Code (mismatched languages):"); eprintln!(" Parsing Invalid Code (mismatched languages):");
let mut error_speeds = Vec::new(); let mut error_speeds = Vec::new();
for (other_language_path, (example_paths, _)) in for (other_language_path, (example_paths, _)) in
EXAMPLE_AND_QUERY_PATHS_BY_LANGUAGE_DIR.iter() EXAMPLE_AND_QUERY_PATHS_BY_LANGUAGE_DIR.iter()
@ -155,30 +148,30 @@ fn main() {
} }
if let Some((average_normal, worst_normal)) = aggregate(&normal_speeds) { if let Some((average_normal, worst_normal)) = aggregate(&normal_speeds) {
info!(" Average Speed (normal): {average_normal} bytes/ms"); eprintln!(" Average Speed (normal): {average_normal} bytes/ms");
info!(" Worst Speed (normal): {worst_normal} bytes/ms"); eprintln!(" Worst Speed (normal): {worst_normal} bytes/ms");
} }
if let Some((average_error, worst_error)) = aggregate(&error_speeds) { if let Some((average_error, worst_error)) = aggregate(&error_speeds) {
info!(" Average Speed (errors): {average_error} bytes/ms"); eprintln!(" Average Speed (errors): {average_error} bytes/ms");
info!(" Worst Speed (errors): {worst_error} bytes/ms"); eprintln!(" Worst Speed (errors): {worst_error} bytes/ms");
} }
all_normal_speeds.extend(normal_speeds); all_normal_speeds.extend(normal_speeds);
all_error_speeds.extend(error_speeds); all_error_speeds.extend(error_speeds);
} }
info!("\n Overall"); eprintln!("\n Overall");
if let Some((average_normal, worst_normal)) = aggregate(&all_normal_speeds) { if let Some((average_normal, worst_normal)) = aggregate(&all_normal_speeds) {
info!(" Average Speed (normal): {average_normal} bytes/ms"); eprintln!(" Average Speed (normal): {average_normal} bytes/ms");
info!(" Worst Speed (normal): {worst_normal} bytes/ms"); eprintln!(" Worst Speed (normal): {worst_normal} bytes/ms");
} }
if let Some((average_error, worst_error)) = aggregate(&all_error_speeds) { if let Some((average_error, worst_error)) = aggregate(&all_error_speeds) {
info!(" Average Speed (errors): {average_error} bytes/ms"); eprintln!(" Average Speed (errors): {average_error} bytes/ms");
info!(" Worst Speed (errors): {worst_error} bytes/ms"); eprintln!(" Worst Speed (errors): {worst_error} bytes/ms");
} }
info!(""); eprintln!();
} }
fn aggregate(speeds: &[usize]) -> Option<(usize, usize)> { fn aggregate(speeds: &[usize]) -> Option<(usize, usize)> {
@ -197,8 +190,14 @@ fn aggregate(speeds: &[usize]) -> Option<(usize, usize)> {
} }
fn parse(path: &Path, max_path_length: usize, mut action: impl FnMut(&[u8])) -> usize { fn parse(path: &Path, max_path_length: usize, mut action: impl FnMut(&[u8])) -> usize {
eprint!(
" {:width$}\t",
path.file_name().unwrap().to_str().unwrap(),
width = max_path_length
);
let source_code = fs::read(path) let source_code = fs::read(path)
.with_context(|| format!("Failed to read {}", path.display())) .with_context(|| format!("Failed to read {path:?}"))
.unwrap(); .unwrap();
let time = Instant::now(); let time = Instant::now();
for _ in 0..*REPETITION_COUNT { for _ in 0..*REPETITION_COUNT {
@ -207,9 +206,8 @@ fn parse(path: &Path, max_path_length: usize, mut action: impl FnMut(&[u8])) ->
let duration = time.elapsed() / (*REPETITION_COUNT as u32); let duration = time.elapsed() / (*REPETITION_COUNT as u32);
let duration_ns = duration.as_nanos(); let duration_ns = duration.as_nanos();
let speed = ((source_code.len() as u128) * 1_000_000) / duration_ns; let speed = ((source_code.len() as u128) * 1_000_000) / duration_ns;
info!( eprintln!(
" {:max_path_length$}\ttime {:>7.2} ms\t\tspeed {speed:>6} bytes/ms", "time {:>7.2} ms\t\tspeed {speed:>6} bytes/ms",
path.file_name().unwrap().to_str().unwrap(),
(duration_ns as f64) / 1e6, (duration_ns as f64) / 1e6,
); );
speed as usize speed as usize
@ -219,6 +217,6 @@ fn get_language(path: &Path) -> Language {
let src_path = GRAMMARS_DIR.join(path).join("src"); let src_path = GRAMMARS_DIR.join(path).join("src");
TEST_LOADER TEST_LOADER
.load_language_at_path(CompileConfig::new(&src_path, None, None)) .load_language_at_path(CompileConfig::new(&src_path, None, None))
.with_context(|| format!("Failed to load language at path {}", src_path.display())) .with_context(|| format!("Failed to load language at path {src_path:?}"))
.unwrap() .unwrap()
} }

View file

@ -52,14 +52,16 @@ fn main() {
fn web_playground_files_present() -> bool { fn web_playground_files_present() -> bool {
let paths = [ let paths = [
"../../docs/src/assets/js/playground.js", "../docs/assets/js/playground.js",
"../../lib/binding_web/web-tree-sitter.js", "../lib/binding_web/tree-sitter.js",
"../../lib/binding_web/web-tree-sitter.wasm", "../lib/binding_web/tree-sitter.wasm",
]; ];
paths.iter().all(|p| Path::new(p).exists()) paths.iter().all(|p| Path::new(p).exists())
} }
// When updating this function, don't forget to also update generate/build.rs which has a
// near-identical function.
fn read_git_sha() -> Option<String> { fn read_git_sha() -> Option<String> {
let crate_path = PathBuf::from(env::var("CARGO_MANIFEST_DIR").unwrap()); let crate_path = PathBuf::from(env::var("CARGO_MANIFEST_DIR").unwrap());

View file

@ -8,20 +8,15 @@ rust-version.workspace = true
readme = "README.md" readme = "README.md"
homepage.workspace = true homepage.workspace = true
repository.workspace = true repository.workspace = true
documentation = "https://docs.rs/tree-sitter-config"
license.workspace = true license.workspace = true
keywords.workspace = true keywords.workspace = true
categories.workspace = true categories.workspace = true
[lib]
path = "src/tree_sitter_config.rs"
[lints] [lints]
workspace = true workspace = true
[dependencies] [dependencies]
etcetera.workspace = true anyhow.workspace = true
log.workspace = true dirs.workspace = true
serde.workspace = true serde.workspace = true
serde_json.workspace = true serde_json.workspace = true
thiserror.workspace = true

View file

@ -1,54 +1,10 @@
#![cfg_attr(not(any(test, doctest)), doc = include_str!("../README.md"))] #![doc = include_str!("../README.md")]
use std::{ use std::{env, fs, path::PathBuf};
env, fs,
path::{Path, PathBuf},
};
use etcetera::BaseStrategy as _; use anyhow::{anyhow, Context, Result};
use log::warn;
use serde::{Deserialize, Serialize}; use serde::{Deserialize, Serialize};
use serde_json::Value; use serde_json::Value;
use thiserror::Error;
pub type ConfigResult<T> = Result<T, ConfigError>;
#[derive(Debug, Error)]
pub enum ConfigError {
#[error("Bad JSON config {0} -- {1}")]
ConfigRead(String, serde_json::Error),
#[error(transparent)]
HomeDir(#[from] etcetera::HomeDirError),
#[error(transparent)]
IO(IoError),
#[error(transparent)]
Serialization(#[from] serde_json::Error),
}
#[derive(Debug, Error)]
pub struct IoError {
pub error: std::io::Error,
pub path: Option<String>,
}
impl IoError {
fn new(error: std::io::Error, path: Option<&Path>) -> Self {
Self {
error,
path: path.map(|p| p.to_string_lossy().to_string()),
}
}
}
impl std::fmt::Display for IoError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(f, "{}", self.error)?;
if let Some(ref path) = self.path {
write!(f, " ({path})")?;
}
Ok(())
}
}
/// Holds the contents of tree-sitter's configuration file. /// Holds the contents of tree-sitter's configuration file.
/// ///
@ -65,7 +21,7 @@ pub struct Config {
} }
impl Config { impl Config {
pub fn find_config_file() -> ConfigResult<Option<PathBuf>> { pub fn find_config_file() -> Result<Option<PathBuf>> {
if let Ok(path) = env::var("TREE_SITTER_DIR") { if let Ok(path) = env::var("TREE_SITTER_DIR") {
let mut path = PathBuf::from(path); let mut path = PathBuf::from(path);
path.push("config.json"); path.push("config.json");
@ -82,28 +38,8 @@ impl Config {
return Ok(Some(xdg_path)); return Ok(Some(xdg_path));
} }
if cfg!(target_os = "macos") { let legacy_path = dirs::home_dir()
let legacy_apple_path = etcetera::base_strategy::Apple::new()? .ok_or_else(|| anyhow!("Cannot determine home directory"))?
.data_dir() // `$HOME/Library/Application Support/`
.join("tree-sitter")
.join("config.json");
if legacy_apple_path.is_file() {
let xdg_dir = xdg_path.parent().unwrap();
fs::create_dir_all(xdg_dir)
.map_err(|e| ConfigError::IO(IoError::new(e, Some(xdg_dir))))?;
fs::rename(&legacy_apple_path, &xdg_path).map_err(|e| {
ConfigError::IO(IoError::new(e, Some(legacy_apple_path.as_path())))
})?;
warn!(
"Your config.json file has been automatically migrated from \"{}\" to \"{}\"",
legacy_apple_path.display(),
xdg_path.display()
);
return Ok(Some(xdg_path));
}
}
let legacy_path = etcetera::home_dir()?
.join(".tree-sitter") .join(".tree-sitter")
.join("config.json"); .join("config.json");
if legacy_path.is_file() { if legacy_path.is_file() {
@ -113,9 +49,9 @@ impl Config {
Ok(None) Ok(None)
} }
fn xdg_config_file() -> ConfigResult<PathBuf> { fn xdg_config_file() -> Result<PathBuf> {
let xdg_path = etcetera::choose_base_strategy()? let xdg_path = dirs::config_dir()
.config_dir() .ok_or_else(|| anyhow!("Cannot determine config directory"))?
.join("tree-sitter") .join("tree-sitter")
.join("config.json"); .join("config.json");
Ok(xdg_path) Ok(xdg_path)
@ -127,10 +63,10 @@ impl Config {
/// - Location specified by the path parameter if provided /// - Location specified by the path parameter if provided
/// - `$TREE_SITTER_DIR/config.json`, if the `TREE_SITTER_DIR` environment variable is set /// - `$TREE_SITTER_DIR/config.json`, if the `TREE_SITTER_DIR` environment variable is set
/// - `tree-sitter/config.json` in your default user configuration directory, as determined by /// - `tree-sitter/config.json` in your default user configuration directory, as determined by
/// [`etcetera::choose_base_strategy`](https://docs.rs/etcetera/*/etcetera/#basestrategy) /// [`dirs::config_dir`](https://docs.rs/dirs/*/dirs/fn.config_dir.html)
/// - `$HOME/.tree-sitter/config.json` as a fallback from where tree-sitter _used_ to store /// - `$HOME/.tree-sitter/config.json` as a fallback from where tree-sitter _used_ to store
/// its configuration /// its configuration
pub fn load(path: Option<PathBuf>) -> ConfigResult<Self> { pub fn load(path: Option<PathBuf>) -> Result<Self> {
let location = if let Some(path) = path { let location = if let Some(path) = path {
path path
} else if let Some(path) = Self::find_config_file()? { } else if let Some(path) = Self::find_config_file()? {
@ -140,9 +76,9 @@ impl Config {
}; };
let content = fs::read_to_string(&location) let content = fs::read_to_string(&location)
.map_err(|e| ConfigError::IO(IoError::new(e, Some(location.as_path()))))?; .with_context(|| format!("Failed to read {}", &location.to_string_lossy()))?;
let config = serde_json::from_str(&content) let config = serde_json::from_str(&content)
.map_err(|e| ConfigError::ConfigRead(location.to_string_lossy().to_string(), e))?; .with_context(|| format!("Bad JSON config {}", &location.to_string_lossy()))?;
Ok(Self { location, config }) Ok(Self { location, config })
} }
@ -152,7 +88,7 @@ impl Config {
/// disk. /// disk.
/// ///
/// (Note that this is typically only done by the `tree-sitter init-config` command.) /// (Note that this is typically only done by the `tree-sitter init-config` command.)
pub fn initial() -> ConfigResult<Self> { pub fn initial() -> Result<Self> {
let location = if let Ok(path) = env::var("TREE_SITTER_DIR") { let location = if let Ok(path) = env::var("TREE_SITTER_DIR") {
let mut path = PathBuf::from(path); let mut path = PathBuf::from(path);
path.push("config.json"); path.push("config.json");
@ -165,20 +101,17 @@ impl Config {
} }
/// Saves this configuration to the file that it was originally loaded from. /// Saves this configuration to the file that it was originally loaded from.
pub fn save(&self) -> ConfigResult<()> { pub fn save(&self) -> Result<()> {
let json = serde_json::to_string_pretty(&self.config)?; let json = serde_json::to_string_pretty(&self.config)?;
let config_dir = self.location.parent().unwrap(); fs::create_dir_all(self.location.parent().unwrap())?;
fs::create_dir_all(config_dir) fs::write(&self.location, json)?;
.map_err(|e| ConfigError::IO(IoError::new(e, Some(config_dir))))?;
fs::write(&self.location, json)
.map_err(|e| ConfigError::IO(IoError::new(e, Some(self.location.as_path()))))?;
Ok(()) Ok(())
} }
/// Parses a component-specific configuration from the configuration file. The type `C` must /// Parses a component-specific configuration from the configuration file. The type `C` must
/// be [deserializable](https://docs.rs/serde/*/serde/trait.Deserialize.html) from a JSON /// be [deserializable](https://docs.rs/serde/*/serde/trait.Deserialize.html) from a JSON
/// object, and must only include the fields relevant to that component. /// object, and must only include the fields relevant to that component.
pub fn get<C>(&self) -> ConfigResult<C> pub fn get<C>(&self) -> Result<C>
where where
C: for<'de> Deserialize<'de>, C: for<'de> Deserialize<'de>,
{ {
@ -189,7 +122,7 @@ impl Config {
/// Adds a component-specific configuration to the configuration file. The type `C` must be /// Adds a component-specific configuration to the configuration file. The type `C` must be
/// [serializable](https://docs.rs/serde/*/serde/trait.Serialize.html) into a JSON object, and /// [serializable](https://docs.rs/serde/*/serde/trait.Serialize.html) into a JSON object, and
/// must only include the fields relevant to that component. /// must only include the fields relevant to that component.
pub fn add<C>(&mut self, config: C) -> ConfigResult<()> pub fn add<C>(&mut self, config: C) -> Result<()>
where where
C: Serialize, C: Serialize,
{ {

View file

@ -305,9 +305,9 @@
"peer": true "peer": true
}, },
"node_modules/brace-expansion": { "node_modules/brace-expansion": {
"version": "1.1.12", "version": "1.1.11",
"resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.12.tgz", "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
"integrity": "sha512-9T9UjW3r0UW5c1Q7GTwllptXwhvYmEzFhzMfZ9H7FQWt+uZePjZPjBP/W1ZEyZ1twGWom5/56TF4lPcqjnDHcg==", "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
"license": "MIT", "license": "MIT",
"peer": true, "peer": true,
"dependencies": { "dependencies": {
@ -805,9 +805,9 @@
"peer": true "peer": true
}, },
"node_modules/js-yaml": { "node_modules/js-yaml": {
"version": "4.1.1", "version": "4.1.0",
"resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.1.tgz", "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz",
"integrity": "sha512-qQKT4zQxXl8lLwBtHMWwaTcGfFOZviOJet3Oy/xmGk2gZH677CJM9EvtfdSkgWcATZhj/55JZ0rmy3myCT5lsA==", "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==",
"license": "MIT", "license": "MIT",
"peer": true, "peer": true,
"dependencies": { "dependencies": {

View file

@ -4,8 +4,7 @@
"description": "Eslint configuration for Tree-sitter grammar files", "description": "Eslint configuration for Tree-sitter grammar files",
"repository": { "repository": {
"type": "git", "type": "git",
"url": "git+https://github.com/tree-sitter/tree-sitter.git", "url": "git+https://github.com/tree-sitter/tree-sitter.git"
"directory": "crates/cli/eslint"
}, },
"license": "MIT", "license": "MIT",
"author": "Amaan Qureshi <amaanq12@gmail.com>", "author": "Amaan Qureshi <amaanq12@gmail.com>",
@ -21,9 +20,5 @@
}, },
"peerDependencies": { "peerDependencies": {
"eslint": ">= 9" "eslint": ">= 9"
},
"scripts": {
"prepack": "cp ../../../LICENSE .",
"postpack": "rm LICENSE"
} }
} }

View file

@ -8,44 +8,27 @@ rust-version.workspace = true
readme = "README.md" readme = "README.md"
homepage.workspace = true homepage.workspace = true
repository.workspace = true repository.workspace = true
documentation = "https://docs.rs/tree-sitter-generate"
license.workspace = true license.workspace = true
keywords.workspace = true keywords.workspace = true
categories.workspace = true categories.workspace = true
[lib]
path = "src/generate.rs"
[lints] [lints]
workspace = true workspace = true
[features]
default = ["qjs-rt"]
load = ["dep:semver"]
qjs-rt = ["load", "rquickjs", "pathdiff"]
[dependencies] [dependencies]
bitflags = "2.9.4" anyhow.workspace = true
dunce = "1.0.5" heck.workspace = true
indexmap.workspace = true indexmap.workspace = true
indoc.workspace = true indoc.workspace = true
lazy_static.workspace = true
log.workspace = true log.workspace = true
pathdiff = { version = "0.2.3", optional = true }
regex.workspace = true regex.workspace = true
regex-syntax.workspace = true regex-syntax.workspace = true
rquickjs = { version = "0.11.0", optional = true, features = [
"bindgen",
"loader",
"macro",
"phf",
] }
rustc-hash.workspace = true rustc-hash.workspace = true
semver = { workspace = true, optional = true } semver.workspace = true
serde.workspace = true serde.workspace = true
serde_json.workspace = true serde_json.workspace = true
smallbitvec.workspace = true smallbitvec.workspace = true
thiserror.workspace = true url.workspace = true
topological-sort.workspace = true
[dev-dependencies] tree-sitter.workspace = true
tempfile.workspace = true

32
cli/generate/build.rs Normal file
View file

@ -0,0 +1,32 @@
use std::{env, path::PathBuf, process::Command};
fn main() {
if let Some(git_sha) = read_git_sha() {
println!("cargo:rustc-env=BUILD_SHA={git_sha}");
}
}
// This is copied from the build.rs in parent directory. This should be updated if the
// parent build.rs gets fixes.
fn read_git_sha() -> Option<String> {
let crate_path = PathBuf::from(env::var("CARGO_MANIFEST_DIR").unwrap());
if !crate_path
.parent()?
.parent()
.is_some_and(|p| p.join(".git").exists())
{
return None;
}
Command::new("git")
.args(["rev-parse", "HEAD"])
.current_dir(crate_path)
.output()
.map_or(None, |output| {
if !output.status.success() {
return None;
}
Some(String::from_utf8_lossy(&output.stdout).to_string())
})
}

View file

@ -3,7 +3,7 @@ use std::{
mem, mem,
}; };
use log::debug; use log::info;
use super::{coincident_tokens::CoincidentTokenIndex, token_conflicts::TokenConflictMap}; use super::{coincident_tokens::CoincidentTokenIndex, token_conflicts::TokenConflictMap};
use crate::{ use crate::{
@ -43,17 +43,15 @@ pub fn build_lex_table(
let tokens = state let tokens = state
.terminal_entries .terminal_entries
.keys() .keys()
.copied()
.chain(state.reserved_words.iter())
.filter_map(|token| { .filter_map(|token| {
if token.is_terminal() { if token.is_terminal() {
if keywords.contains(&token) { if keywords.contains(token) {
syntax_grammar.word_token syntax_grammar.word_token
} else { } else {
Some(token) Some(*token)
} }
} else if token.is_eof() { } else if token.is_eof() {
Some(token) Some(*token)
} else { } else {
None None
} }
@ -176,8 +174,9 @@ impl<'a> LexTableBuilder<'a> {
let (state_id, is_new) = self.add_state(nfa_states, eof_valid); let (state_id, is_new) = self.add_state(nfa_states, eof_valid);
if is_new { if is_new {
debug!( info!(
"entry point state: {state_id}, tokens: {:?}", "entry point state: {}, tokens: {:?}",
state_id,
tokens tokens
.iter() .iter()
.map(|t| &self.lexical_grammar.variables[t.index].name) .map(|t| &self.lexical_grammar.variables[t.index].name)
@ -358,7 +357,9 @@ fn minimize_lex_table(table: &mut LexTable, parse_table: &mut ParseTable) {
&mut group_ids_by_state_id, &mut group_ids_by_state_id,
1, 1,
lex_states_differ, lex_states_differ,
) {} ) {
continue;
}
let mut new_states = Vec::with_capacity(state_ids_by_group_id.len()); let mut new_states = Vec::with_capacity(state_ids_by_group_id.len());
for state_ids in &state_ids_by_group_id { for state_ids in &state_ids_by_group_id {

View file

@ -1,21 +1,22 @@
use std::{ use std::{
cmp::Ordering, cmp::Ordering,
collections::{BTreeMap, BTreeSet, HashMap, HashSet, VecDeque}, collections::{BTreeMap, HashMap, HashSet, VecDeque},
fmt::Write,
hash::BuildHasherDefault, hash::BuildHasherDefault,
}; };
use anyhow::{anyhow, Result};
use indexmap::{map::Entry, IndexMap}; use indexmap::{map::Entry, IndexMap};
use log::warn;
use rustc_hash::FxHasher; use rustc_hash::FxHasher;
use serde::Serialize;
use thiserror::Error;
use super::{ use super::{
item::{ParseItem, ParseItemSet, ParseItemSetCore, ParseItemSetEntry}, item::{ParseItem, ParseItemSet, ParseItemSetCore},
item_set_builder::ParseItemSetBuilder, item_set_builder::ParseItemSetBuilder,
}; };
use crate::{ use crate::{
grammars::{LexicalGrammar, PrecedenceEntry, ReservedWordSetId, SyntaxGrammar, VariableType}, grammars::{
InlinedProductionMap, LexicalGrammar, PrecedenceEntry, SyntaxGrammar, VariableType,
},
node_types::VariableInfo, node_types::VariableInfo,
rules::{Associativity, Precedence, Symbol, SymbolType, TokenSet}, rules::{Associativity, Precedence, Symbol, SymbolType, TokenSet},
tables::{ tables::{
@ -65,208 +66,8 @@ struct ParseTableBuilder<'a> {
parse_table: ParseTable, parse_table: ParseTable,
} }
pub type BuildTableResult<T> = Result<T, ParseTableBuilderError>;
#[derive(Debug, Error, Serialize)]
pub enum ParseTableBuilderError {
#[error("Unresolved conflict for symbol sequence:\n\n{0}")]
Conflict(#[from] ConflictError),
#[error("Extra rules must have unambiguous endings. Conflicting rules: {0}")]
AmbiguousExtra(#[from] AmbiguousExtraError),
#[error(
"The non-terminal rule `{0}` is used in a non-terminal `extra` rule, which is not allowed."
)]
ImproperNonTerminalExtra(String),
#[error("State count `{0}` exceeds the max value {max}.", max=u16::MAX)]
StateCount(usize),
}
#[derive(Default, Debug, Serialize, Error)]
pub struct ConflictError {
pub symbol_sequence: Vec<String>,
pub conflicting_lookahead: String,
pub possible_interpretations: Vec<Interpretation>,
pub possible_resolutions: Vec<Resolution>,
}
#[derive(Default, Debug, Serialize, Error)]
pub struct Interpretation {
pub preceding_symbols: Vec<String>,
pub variable_name: String,
pub production_step_symbols: Vec<String>,
pub step_index: u32,
pub done: bool,
pub conflicting_lookahead: String,
pub precedence: Option<String>,
pub associativity: Option<String>,
}
#[derive(Debug, Serialize)]
pub enum Resolution {
Precedence { symbols: Vec<String> },
Associativity { symbols: Vec<String> },
AddConflict { symbols: Vec<String> },
}
#[derive(Debug, Serialize, Error)]
pub struct AmbiguousExtraError {
pub parent_symbols: Vec<String>,
}
impl std::fmt::Display for ConflictError {
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
for symbol in &self.symbol_sequence {
write!(f, " {symbol}")?;
}
writeln!(f, " • {} …\n", self.conflicting_lookahead)?;
writeln!(f, "Possible interpretations:\n")?;
let mut interpretations = self
.possible_interpretations
.iter()
.map(|i| {
let line = i.to_string();
let prec_line = if let (Some(precedence), Some(associativity)) =
(&i.precedence, &i.associativity)
{
Some(format!(
"(precedence: {precedence}, associativity: {associativity})",
))
} else {
i.precedence
.as_ref()
.map(|precedence| format!("(precedence: {precedence})"))
};
(line, prec_line)
})
.collect::<Vec<_>>();
let max_interpretation_length = interpretations
.iter()
.map(|i| i.0.chars().count())
.max()
.unwrap();
interpretations.sort_unstable();
for (i, (line, prec_suffix)) in interpretations.into_iter().enumerate() {
write!(f, " {}:", i + 1).unwrap();
write!(f, "{line}")?;
if let Some(prec_suffix) = prec_suffix {
write!(
f,
"{:1$}",
"",
max_interpretation_length.saturating_sub(line.chars().count()) + 2
)?;
write!(f, "{prec_suffix}")?;
}
writeln!(f)?;
}
writeln!(f, "\nPossible resolutions:\n")?;
for (i, resolution) in self.possible_resolutions.iter().enumerate() {
writeln!(f, " {}: {resolution}", i + 1)?;
}
Ok(())
}
}
impl std::fmt::Display for Interpretation {
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
for symbol in &self.preceding_symbols {
write!(f, " {symbol}")?;
}
write!(f, " ({}", self.variable_name)?;
for (i, symbol) in self.production_step_symbols.iter().enumerate() {
if i == self.step_index as usize {
write!(f, "")?;
}
write!(f, " {symbol}")?;
}
write!(f, ")")?;
if self.done {
write!(f, " • {} …", self.conflicting_lookahead)?;
}
Ok(())
}
}
impl std::fmt::Display for Resolution {
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
match self {
Self::Precedence { symbols } => {
write!(f, "Specify a higher precedence in ")?;
for (i, symbol) in symbols.iter().enumerate() {
if i > 0 {
write!(f, " and ")?;
}
write!(f, "`{symbol}`")?;
}
write!(f, " than in the other rules.")?;
}
Self::Associativity { symbols } => {
write!(f, "Specify a left or right associativity in ")?;
for (i, symbol) in symbols.iter().enumerate() {
if i > 0 {
write!(f, ", ")?;
}
write!(f, "`{symbol}`")?;
}
}
Self::AddConflict { symbols } => {
write!(f, "Add a conflict for these rules: ")?;
for (i, symbol) in symbols.iter().enumerate() {
if i > 0 {
write!(f, ", ")?;
}
write!(f, "`{symbol}`")?;
}
}
}
Ok(())
}
}
impl std::fmt::Display for AmbiguousExtraError {
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
for (i, symbol) in self.parent_symbols.iter().enumerate() {
if i > 0 {
write!(f, ", ")?;
}
write!(f, "{symbol}")?;
}
Ok(())
}
}
impl<'a> ParseTableBuilder<'a> { impl<'a> ParseTableBuilder<'a> {
fn new( fn build(mut self) -> Result<(ParseTable, Vec<ParseStateInfo<'a>>)> {
syntax_grammar: &'a SyntaxGrammar,
lexical_grammar: &'a LexicalGrammar,
item_set_builder: ParseItemSetBuilder<'a>,
variable_info: &'a [VariableInfo],
) -> Self {
Self {
syntax_grammar,
lexical_grammar,
item_set_builder,
variable_info,
non_terminal_extra_states: Vec::new(),
state_ids_by_item_set: IndexMap::default(),
core_ids_by_core: HashMap::new(),
parse_state_info_by_id: Vec::new(),
parse_state_queue: VecDeque::new(),
actual_conflicts: syntax_grammar.expected_conflicts.iter().cloned().collect(),
parse_table: ParseTable {
states: Vec::new(),
symbols: Vec::new(),
external_lex_states: Vec::new(),
production_infos: Vec::new(),
max_aliased_production_length: 1,
},
}
}
fn build(mut self) -> BuildTableResult<(ParseTable, Vec<ParseStateInfo<'a>>)> {
// Ensure that the empty alias sequence has index 0. // Ensure that the empty alias sequence has index 0.
self.parse_table self.parse_table
.production_infos .production_infos
@ -279,13 +80,10 @@ impl<'a> ParseTableBuilder<'a> {
self.add_parse_state( self.add_parse_state(
&Vec::new(), &Vec::new(),
&Vec::new(), &Vec::new(),
ParseItemSet { ParseItemSet::with(std::iter::once((
entries: vec![ParseItemSetEntry { ParseItem::start(),
item: ParseItem::start(), std::iter::once(Symbol::end()).collect(),
lookaheads: std::iter::once(Symbol::end()).collect(), ))),
following_reserved_word_set: ReservedWordSetId::default(),
}],
},
); );
// Compute the possible item sets for non-terminal extras. // Compute the possible item sets for non-terminal extras.
@ -301,35 +99,23 @@ impl<'a> ParseTableBuilder<'a> {
non_terminal_extra_item_sets_by_first_terminal non_terminal_extra_item_sets_by_first_terminal
.entry(production.first_symbol().unwrap()) .entry(production.first_symbol().unwrap())
.or_insert_with(ParseItemSet::default) .or_insert_with(ParseItemSet::default)
.insert(ParseItem { .insert(
variable_index: extra_non_terminal.index as u32, ParseItem {
production, variable_index: extra_non_terminal.index as u32,
step_index: 1, production,
has_preceding_inherited_fields: false, step_index: 1,
}) has_preceding_inherited_fields: false,
.lookaheads },
.insert(Symbol::end_of_nonterminal_extra()); &std::iter::once(Symbol::end_of_nonterminal_extra()).collect(),
);
} }
} }
let non_terminal_sets_len = non_terminal_extra_item_sets_by_first_terminal.len();
self.non_terminal_extra_states
.reserve(non_terminal_sets_len);
self.parse_state_info_by_id.reserve(non_terminal_sets_len);
self.parse_table.states.reserve(non_terminal_sets_len);
self.parse_state_queue.reserve(non_terminal_sets_len);
// Add a state for each starting terminal of a non-terminal extra rule. // Add a state for each starting terminal of a non-terminal extra rule.
for (terminal, item_set) in non_terminal_extra_item_sets_by_first_terminal { for (terminal, item_set) in non_terminal_extra_item_sets_by_first_terminal {
if terminal.is_non_terminal() { self.non_terminal_extra_states
Err(ParseTableBuilderError::ImproperNonTerminalExtra( .push((terminal, self.parse_table.states.len()));
self.symbol_name(&terminal), self.add_parse_state(&Vec::new(), &Vec::new(), item_set);
))?;
}
// Add the parse state, and *then* push the terminal and the state id into the
// list of nonterminal extra states
let state_id = self.add_parse_state(&Vec::new(), &Vec::new(), item_set);
self.non_terminal_extra_states.push((terminal, state_id));
} }
while let Some(entry) = self.parse_state_queue.pop_front() { while let Some(entry) = self.parse_state_queue.pop_front() {
@ -346,21 +132,17 @@ impl<'a> ParseTableBuilder<'a> {
} }
if !self.actual_conflicts.is_empty() { if !self.actual_conflicts.is_empty() {
warn!( println!("Warning: unnecessary conflicts");
"unnecessary conflicts:\n {}", for conflict in &self.actual_conflicts {
&self println!(
.actual_conflicts " {}",
.iter() conflict
.map(|conflict| { .iter()
conflict .map(|symbol| format!("`{}`", self.symbol_name(symbol)))
.iter() .collect::<Vec<_>>()
.map(|symbol| format!("`{}`", self.symbol_name(symbol))) .join(", ")
.collect::<Vec<_>>() );
.join(", ") }
})
.collect::<Vec<_>>()
.join("\n ")
);
} }
Ok((self.parse_table, self.parse_state_info_by_id)) Ok((self.parse_table, self.parse_state_info_by_id))
@ -394,7 +176,6 @@ impl<'a> ParseTableBuilder<'a> {
external_lex_state_id: 0, external_lex_state_id: 0,
terminal_entries: IndexMap::default(), terminal_entries: IndexMap::default(),
nonterminal_entries: IndexMap::default(), nonterminal_entries: IndexMap::default(),
reserved_words: TokenSet::default(),
core_id, core_id,
}); });
self.parse_state_queue.push_back(ParseStateQueueEntry { self.parse_state_queue.push_back(ParseStateQueueEntry {
@ -413,7 +194,7 @@ impl<'a> ParseTableBuilder<'a> {
mut preceding_auxiliary_symbols: AuxiliarySymbolSequence, mut preceding_auxiliary_symbols: AuxiliarySymbolSequence,
state_id: ParseStateId, state_id: ParseStateId,
item_set: &ParseItemSet<'a>, item_set: &ParseItemSet<'a>,
) -> BuildTableResult<()> { ) -> Result<()> {
let mut terminal_successors = BTreeMap::new(); let mut terminal_successors = BTreeMap::new();
let mut non_terminal_successors = BTreeMap::new(); let mut non_terminal_successors = BTreeMap::new();
let mut lookaheads_with_conflicts = TokenSet::new(); let mut lookaheads_with_conflicts = TokenSet::new();
@ -421,18 +202,13 @@ impl<'a> ParseTableBuilder<'a> {
// Each item in the item set contributes to either or a Shift action or a Reduce // Each item in the item set contributes to either or a Shift action or a Reduce
// action in this state. // action in this state.
for ParseItemSetEntry { for (item, lookaheads) in &item_set.entries {
item,
lookaheads,
following_reserved_word_set: reserved_lookaheads,
} in &item_set.entries
{
// If the item is unfinished, then this state has a transition for the item's // If the item is unfinished, then this state has a transition for the item's
// next symbol. Advance the item to its next step and insert the resulting // next symbol. Advance the item to its next step and insert the resulting
// item into the successor item set. // item into the successor item set.
if let Some(next_symbol) = item.symbol() { if let Some(next_symbol) = item.symbol() {
let mut successor = item.successor(); let mut successor = item.successor();
let successor_set = if next_symbol.is_non_terminal() { if next_symbol.is_non_terminal() {
let variable = &self.syntax_grammar.variables[next_symbol.index]; let variable = &self.syntax_grammar.variables[next_symbol.index];
// Keep track of where auxiliary non-terminals (repeat symbols) are // Keep track of where auxiliary non-terminals (repeat symbols) are
@ -461,16 +237,13 @@ impl<'a> ParseTableBuilder<'a> {
non_terminal_successors non_terminal_successors
.entry(next_symbol) .entry(next_symbol)
.or_insert_with(ParseItemSet::default) .or_insert_with(ParseItemSet::default)
.insert(successor, lookaheads);
} else { } else {
terminal_successors terminal_successors
.entry(next_symbol) .entry(next_symbol)
.or_insert_with(ParseItemSet::default) .or_insert_with(ParseItemSet::default)
}; .insert(successor, lookaheads);
let successor_entry = successor_set.insert(successor); }
successor_entry.lookaheads.insert_all(lookaheads);
successor_entry.following_reserved_word_set = successor_entry
.following_reserved_word_set
.max(*reserved_lookaheads);
} }
// If the item is finished, then add a Reduce action to this state based // If the item is finished, then add a Reduce action to this state based
// on this item. // on this item.
@ -597,7 +370,7 @@ impl<'a> ParseTableBuilder<'a> {
)?; )?;
} }
// Add actions for the grammar's `extra` symbols. // Finally, add actions for the grammar's `extra` symbols.
let state = &mut self.parse_table.states[state_id]; let state = &mut self.parse_table.states[state_id];
let is_end_of_non_terminal_extra = state.is_end_of_non_terminal_extra(); let is_end_of_non_terminal_extra = state.is_end_of_non_terminal_extra();
@ -609,7 +382,7 @@ impl<'a> ParseTableBuilder<'a> {
let parent_symbols = item_set let parent_symbols = item_set
.entries .entries
.iter() .iter()
.filter_map(|ParseItemSetEntry { item, .. }| { .filter_map(|(item, _)| {
if !item.is_augmented() && item.step_index > 0 { if !item.is_augmented() && item.step_index > 0 {
Some(item.variable_index) Some(item.variable_index)
} else { } else {
@ -617,18 +390,15 @@ impl<'a> ParseTableBuilder<'a> {
} }
}) })
.collect::<HashSet<_>>(); .collect::<HashSet<_>>();
let parent_symbol_names = parent_symbols let mut message =
.iter() "Extra rules must have unambiguous endings. Conflicting rules: ".to_string();
.map(|&variable_index| { for (i, variable_index) in parent_symbols.iter().enumerate() {
self.syntax_grammar.variables[variable_index as usize] if i > 0 {
.name message += ", ";
.clone() }
}) message += &self.syntax_grammar.variables[*variable_index as usize].name;
.collect::<Vec<_>>(); }
return Err(anyhow!(message));
Err(AmbiguousExtraError {
parent_symbols: parent_symbol_names,
})?;
} }
} }
// Add actions for the start tokens of each non-terminal extra rule. // Add actions for the start tokens of each non-terminal extra rule.
@ -666,30 +436,6 @@ impl<'a> ParseTableBuilder<'a> {
} }
} }
if let Some(keyword_capture_token) = self.syntax_grammar.word_token {
let reserved_word_set_id = item_set
.entries
.iter()
.filter_map(|entry| {
if let Some(next_step) = entry.item.step() {
if next_step.symbol == keyword_capture_token {
Some(next_step.reserved_word_set_id)
} else {
None
}
} else if entry.lookaheads.contains(&keyword_capture_token) {
Some(entry.following_reserved_word_set)
} else {
None
}
})
.max();
if let Some(reserved_word_set_id) = reserved_word_set_id {
state.reserved_words =
self.syntax_grammar.reserved_word_sets[reserved_word_set_id.0].clone();
}
}
Ok(()) Ok(())
} }
@ -701,7 +447,7 @@ impl<'a> ParseTableBuilder<'a> {
preceding_auxiliary_symbols: &[AuxiliarySymbolInfo], preceding_auxiliary_symbols: &[AuxiliarySymbolInfo],
conflicting_lookahead: Symbol, conflicting_lookahead: Symbol,
reduction_info: &ReductionInfo, reduction_info: &ReductionInfo,
) -> BuildTableResult<()> { ) -> Result<()> {
let entry = self.parse_table.states[state_id] let entry = self.parse_table.states[state_id]
.terminal_entries .terminal_entries
.get_mut(&conflicting_lookahead) .get_mut(&conflicting_lookahead)
@ -715,11 +461,8 @@ impl<'a> ParseTableBuilder<'a> {
// precedence, and there can still be SHIFT/REDUCE conflicts. // precedence, and there can still be SHIFT/REDUCE conflicts.
let mut considered_associativity = false; let mut considered_associativity = false;
let mut shift_precedence = Vec::<(&Precedence, Symbol)>::new(); let mut shift_precedence = Vec::<(&Precedence, Symbol)>::new();
let mut conflicting_items = BTreeSet::new(); let mut conflicting_items = HashSet::new();
for ParseItemSetEntry { for (item, lookaheads) in &item_set.entries {
item, lookaheads, ..
} in &item_set.entries
{
if let Some(step) = item.step() { if let Some(step) = item.step() {
if item.step_index > 0 if item.step_index > 0
&& self && self
@ -856,55 +599,93 @@ impl<'a> ParseTableBuilder<'a> {
return Ok(()); return Ok(());
} }
let mut conflict_error = ConflictError::default(); let mut msg = "Unresolved conflict for symbol sequence:\n\n".to_string();
for symbol in preceding_symbols { for symbol in preceding_symbols {
conflict_error write!(&mut msg, " {}", self.symbol_name(symbol)).unwrap();
.symbol_sequence
.push(self.symbol_name(symbol));
} }
conflict_error.conflicting_lookahead = self.symbol_name(&conflicting_lookahead);
let interpretations = conflicting_items writeln!(
&mut msg,
" • {} …\n",
self.symbol_name(&conflicting_lookahead)
)
.unwrap();
writeln!(&mut msg, "Possible interpretations:\n").unwrap();
let mut interpretations = conflicting_items
.iter() .iter()
.map(|item| { .map(|item| {
let preceding_symbols = preceding_symbols let mut line = String::new();
for preceding_symbol in preceding_symbols
.iter() .iter()
.take(preceding_symbols.len() - item.step_index as usize) .take(preceding_symbols.len() - item.step_index as usize)
.map(|symbol| self.symbol_name(symbol)) {
.collect::<Vec<_>>(); write!(&mut line, " {}", self.symbol_name(preceding_symbol)).unwrap();
}
let variable_name = self.syntax_grammar.variables[item.variable_index as usize] write!(
.name &mut line,
.clone(); " ({}",
&self.syntax_grammar.variables[item.variable_index as usize].name
)
.unwrap();
let production_step_symbols = item for (j, step) in item.production.steps.iter().enumerate() {
.production if j as u32 == item.step_index {
.steps write!(&mut line, "").unwrap();
.iter() }
.map(|step| self.symbol_name(&step.symbol)) write!(&mut line, " {}", self.symbol_name(&step.symbol)).unwrap();
.collect::<Vec<_>>(); }
let precedence = match item.precedence() { write!(&mut line, ")").unwrap();
Precedence::None => None,
_ => Some(item.precedence().to_string()), if item.is_done() {
write!(
&mut line,
" • {} …",
self.symbol_name(&conflicting_lookahead)
)
.unwrap();
}
let precedence = item.precedence();
let associativity = item.associativity();
let prec_line = if let Some(associativity) = associativity {
Some(format!(
"(precedence: {precedence}, associativity: {associativity:?})",
))
} else if !precedence.is_none() {
Some(format!("(precedence: {precedence})"))
} else {
None
}; };
let associativity = item.associativity().map(|assoc| format!("{assoc:?}")); (line, prec_line)
Interpretation {
preceding_symbols,
variable_name,
production_step_symbols,
step_index: item.step_index,
done: item.is_done(),
conflicting_lookahead: self.symbol_name(&conflicting_lookahead),
precedence,
associativity,
}
}) })
.collect::<Vec<_>>(); .collect::<Vec<_>>();
conflict_error.possible_interpretations = interpretations;
let max_interpretation_length = interpretations
.iter()
.map(|i| i.0.chars().count())
.max()
.unwrap();
interpretations.sort_unstable();
for (i, (line, prec_suffix)) in interpretations.into_iter().enumerate() {
write!(&mut msg, " {}:", i + 1).unwrap();
msg += &line;
if let Some(prec_suffix) = prec_suffix {
for _ in line.chars().count()..max_interpretation_length {
msg.push(' ');
}
msg += " ";
msg += &prec_suffix;
}
msg.push('\n');
}
let mut resolution_count = 0;
writeln!(&mut msg, "\nPossible resolutions:\n").unwrap();
let mut shift_items = Vec::new(); let mut shift_items = Vec::new();
let mut reduce_items = Vec::new(); let mut reduce_items = Vec::new();
for item in conflicting_items { for item in conflicting_items {
@ -917,57 +698,76 @@ impl<'a> ParseTableBuilder<'a> {
shift_items.sort_unstable(); shift_items.sort_unstable();
reduce_items.sort_unstable(); reduce_items.sort_unstable();
let get_rule_names = |items: &[&ParseItem]| -> Vec<String> { let list_rule_names = |mut msg: &mut String, items: &[&ParseItem]| {
let mut last_rule_id = None; let mut last_rule_id = None;
let mut result = Vec::with_capacity(items.len());
for item in items { for item in items {
if last_rule_id == Some(item.variable_index) { if last_rule_id == Some(item.variable_index) {
continue; continue;
} }
last_rule_id = Some(item.variable_index);
result.push(self.symbol_name(&Symbol::non_terminal(item.variable_index as usize)));
}
result if last_rule_id.is_some() {
write!(&mut msg, " and").unwrap();
}
last_rule_id = Some(item.variable_index);
write!(
msg,
" `{}`",
self.symbol_name(&Symbol::non_terminal(item.variable_index as usize))
)
.unwrap();
}
}; };
if actual_conflict.len() > 1 { if actual_conflict.len() > 1 {
if !shift_items.is_empty() { if !shift_items.is_empty() {
let names = get_rule_names(&shift_items); resolution_count += 1;
conflict_error write!(
.possible_resolutions &mut msg,
.push(Resolution::Precedence { symbols: names }); " {resolution_count}: Specify a higher precedence in",
)
.unwrap();
list_rule_names(&mut msg, &shift_items);
writeln!(&mut msg, " than in the other rules.").unwrap();
} }
for item in &reduce_items { for item in &reduce_items {
let name = self.symbol_name(&Symbol::non_terminal(item.variable_index as usize)); resolution_count += 1;
conflict_error writeln!(
.possible_resolutions &mut msg,
.push(Resolution::Precedence { " {resolution_count}: Specify a higher precedence in `{}` than in the other rules.",
symbols: vec![name], self.symbol_name(&Symbol::non_terminal(item.variable_index as usize))
}); )
.unwrap();
} }
} }
if considered_associativity { if considered_associativity {
let names = get_rule_names(&reduce_items); resolution_count += 1;
conflict_error write!(
.possible_resolutions &mut msg,
.push(Resolution::Associativity { symbols: names }); " {resolution_count}: Specify a left or right associativity in",
)
.unwrap();
list_rule_names(&mut msg, &reduce_items);
writeln!(&mut msg).unwrap();
} }
conflict_error resolution_count += 1;
.possible_resolutions write!(
.push(Resolution::AddConflict { &mut msg,
symbols: actual_conflict " {resolution_count}: Add a conflict for these rules: ",
.iter() )
.map(|s| self.symbol_name(s)) .unwrap();
.collect(), for (i, symbol) in actual_conflict.iter().enumerate() {
}); if i > 0 {
write!(&mut msg, ", ").unwrap();
}
write!(&mut msg, "`{}`", self.symbol_name(symbol)).unwrap();
}
writeln!(&mut msg).unwrap();
self.actual_conflicts.insert(actual_conflict); Err(anyhow!(msg))
Err(conflict_error)?
} }
fn compare_precedence( fn compare_precedence(
@ -1036,7 +836,7 @@ impl<'a> ParseTableBuilder<'a> {
let parent_symbols = item_set let parent_symbols = item_set
.entries .entries
.iter() .iter()
.filter_map(|ParseItemSetEntry { item, .. }| { .filter_map(|(item, _)| {
let variable_index = item.variable_index as usize; let variable_index = item.variable_index as usize;
if item.symbol() == Some(symbol) if item.symbol() == Some(symbol)
&& !self.syntax_grammar.variables[variable_index].is_auxiliary() && !self.syntax_grammar.variables[variable_index].is_auxiliary()
@ -1124,24 +924,84 @@ impl<'a> ParseTableBuilder<'a> {
if variable.kind == VariableType::Named { if variable.kind == VariableType::Named {
variable.name.clone() variable.name.clone()
} else { } else {
format!("'{}'", variable.name) format!("'{}'", &variable.name)
} }
} }
} }
} }
} }
fn populate_following_tokens(
result: &mut [TokenSet],
grammar: &SyntaxGrammar,
inlines: &InlinedProductionMap,
builder: &ParseItemSetBuilder,
) {
let productions = grammar
.variables
.iter()
.flat_map(|v| &v.productions)
.chain(&inlines.productions);
let all_tokens = (0..result.len())
.map(Symbol::terminal)
.collect::<TokenSet>();
for production in productions {
for i in 1..production.steps.len() {
let left_tokens = builder.last_set(&production.steps[i - 1].symbol);
let right_tokens = builder.first_set(&production.steps[i].symbol);
for left_token in left_tokens.iter() {
if left_token.is_terminal() {
result[left_token.index].insert_all_terminals(right_tokens);
}
}
}
}
for extra in &grammar.extra_symbols {
if extra.is_terminal() {
for entry in result.iter_mut() {
entry.insert(*extra);
}
result[extra.index].clone_from(&all_tokens);
}
}
}
pub fn build_parse_table<'a>( pub fn build_parse_table<'a>(
syntax_grammar: &'a SyntaxGrammar, syntax_grammar: &'a SyntaxGrammar,
lexical_grammar: &'a LexicalGrammar, lexical_grammar: &'a LexicalGrammar,
item_set_builder: ParseItemSetBuilder<'a>, inlines: &'a InlinedProductionMap,
variable_info: &'a [VariableInfo], variable_info: &'a [VariableInfo],
) -> BuildTableResult<(ParseTable, Vec<ParseStateInfo<'a>>)> { ) -> Result<(ParseTable, Vec<TokenSet>, Vec<ParseStateInfo<'a>>)> {
ParseTableBuilder::new( let actual_conflicts = syntax_grammar.expected_conflicts.iter().cloned().collect();
let item_set_builder = ParseItemSetBuilder::new(syntax_grammar, lexical_grammar, inlines);
let mut following_tokens = vec![TokenSet::new(); lexical_grammar.variables.len()];
populate_following_tokens(
&mut following_tokens,
syntax_grammar,
inlines,
&item_set_builder,
);
let (table, item_sets) = ParseTableBuilder {
syntax_grammar, syntax_grammar,
lexical_grammar, lexical_grammar,
item_set_builder, item_set_builder,
variable_info, variable_info,
) non_terminal_extra_states: Vec::new(),
.build() actual_conflicts,
state_ids_by_item_set: IndexMap::default(),
core_ids_by_core: HashMap::new(),
parse_state_info_by_id: Vec::new(),
parse_state_queue: VecDeque::new(),
parse_table: ParseTable {
states: Vec::new(),
symbols: Vec::new(),
external_lex_states: Vec::new(),
production_infos: Vec::new(),
max_aliased_production_length: 1,
},
}
.build()?;
Ok((table, following_tokens, item_sets))
} }

View file

@ -2,31 +2,30 @@ use std::{
cmp::Ordering, cmp::Ordering,
fmt, fmt,
hash::{Hash, Hasher}, hash::{Hash, Hasher},
sync::LazyLock,
}; };
use lazy_static::lazy_static;
use crate::{ use crate::{
grammars::{ grammars::{LexicalGrammar, Production, ProductionStep, SyntaxGrammar},
LexicalGrammar, Production, ProductionStep, ReservedWordSetId, SyntaxGrammar,
NO_RESERVED_WORDS,
},
rules::{Associativity, Precedence, Symbol, SymbolType, TokenSet}, rules::{Associativity, Precedence, Symbol, SymbolType, TokenSet},
}; };
static START_PRODUCTION: LazyLock<Production> = LazyLock::new(|| Production { lazy_static! {
dynamic_precedence: 0, static ref START_PRODUCTION: Production = Production {
steps: vec![ProductionStep { dynamic_precedence: 0,
symbol: Symbol { steps: vec![ProductionStep {
index: 0, symbol: Symbol {
kind: SymbolType::NonTerminal, index: 0,
}, kind: SymbolType::NonTerminal,
precedence: Precedence::None, },
associativity: None, precedence: Precedence::None,
alias: None, associativity: None,
field_name: None, alias: None,
reserved_word_set_id: NO_RESERVED_WORDS, field_name: None,
}], }],
}); };
}
/// A [`ParseItem`] represents an in-progress match of a single production in a grammar. /// A [`ParseItem`] represents an in-progress match of a single production in a grammar.
#[derive(Clone, Copy, Debug)] #[derive(Clone, Copy, Debug)]
@ -59,14 +58,7 @@ pub struct ParseItem<'a> {
/// to a state in the final parse table. /// to a state in the final parse table.
#[derive(Clone, Debug, PartialEq, Eq, Default)] #[derive(Clone, Debug, PartialEq, Eq, Default)]
pub struct ParseItemSet<'a> { pub struct ParseItemSet<'a> {
pub entries: Vec<ParseItemSetEntry<'a>>, pub entries: Vec<(ParseItem<'a>, TokenSet)>,
}
#[derive(Clone, Debug, PartialEq, Eq)]
pub struct ParseItemSetEntry<'a> {
pub item: ParseItem<'a>,
pub lookaheads: TokenSet,
pub following_reserved_word_set: ReservedWordSetId,
} }
/// A [`ParseItemSetCore`] is like a [`ParseItemSet`], but without the lookahead /// A [`ParseItemSetCore`] is like a [`ParseItemSet`], but without the lookahead
@ -160,26 +152,30 @@ impl<'a> ParseItem<'a> {
} }
impl<'a> ParseItemSet<'a> { impl<'a> ParseItemSet<'a> {
pub fn insert(&mut self, item: ParseItem<'a>) -> &mut ParseItemSetEntry<'a> { pub fn with(elements: impl IntoIterator<Item = (ParseItem<'a>, TokenSet)>) -> Self {
match self.entries.binary_search_by(|e| e.item.cmp(&item)) { let mut result = Self::default();
for (item, lookaheads) in elements {
result.insert(item, &lookaheads);
}
result
}
pub fn insert(&mut self, item: ParseItem<'a>, lookaheads: &TokenSet) -> &mut TokenSet {
match self.entries.binary_search_by(|(i, _)| i.cmp(&item)) {
Err(i) => { Err(i) => {
self.entries.insert( self.entries.insert(i, (item, lookaheads.clone()));
i, &mut self.entries[i].1
ParseItemSetEntry { }
item, Ok(i) => {
lookaheads: TokenSet::new(), self.entries[i].1.insert_all(lookaheads);
following_reserved_word_set: ReservedWordSetId::default(), &mut self.entries[i].1
},
);
&mut self.entries[i]
} }
Ok(i) => &mut self.entries[i],
} }
} }
pub fn core(&self) -> ParseItemSetCore<'a> { pub fn core(&self) -> ParseItemSetCore<'a> {
ParseItemSetCore { ParseItemSetCore {
entries: self.entries.iter().map(|e| e.item).collect(), entries: self.entries.iter().map(|e| e.0).collect(),
} }
} }
} }
@ -192,42 +188,35 @@ impl fmt::Display for ParseItemDisplay<'_> {
write!( write!(
f, f,
"{} →", "{} →",
self.1.variables[self.0.variable_index as usize].name &self.1.variables[self.0.variable_index as usize].name
)?; )?;
} }
for (i, step) in self.0.production.steps.iter().enumerate() { for (i, step) in self.0.production.steps.iter().enumerate() {
if i == self.0.step_index as usize { if i == self.0.step_index as usize {
write!(f, "")?; write!(f, "")?;
if !step.precedence.is_none() if let Some(associativity) = step.associativity {
|| step.associativity.is_some() if step.precedence.is_none() {
|| step.reserved_word_set_id != ReservedWordSetId::default() write!(f, " ({associativity:?})")?;
{ } else {
write!(f, " (")?; write!(f, " ({} {associativity:?})", step.precedence)?;
if !step.precedence.is_none() {
write!(f, " {}", step.precedence)?;
} }
if let Some(associativity) = step.associativity { } else if !step.precedence.is_none() {
write!(f, " {associativity:?}")?; write!(f, " ({})", step.precedence)?;
}
if step.reserved_word_set_id != ReservedWordSetId::default() {
write!(f, "reserved: {}", step.reserved_word_set_id)?;
}
write!(f, " )")?;
} }
} }
write!(f, " ")?; write!(f, " ")?;
if step.symbol.is_terminal() { if step.symbol.is_terminal() {
if let Some(variable) = self.2.variables.get(step.symbol.index) { if let Some(variable) = self.2.variables.get(step.symbol.index) {
write!(f, "{}", variable.name)?; write!(f, "{}", &variable.name)?;
} else { } else {
write!(f, "terminal-{}", step.symbol.index)?; write!(f, "terminal-{}", step.symbol.index)?;
} }
} else if step.symbol.is_external() { } else if step.symbol.is_external() {
write!(f, "{}", self.1.external_tokens[step.symbol.index].name)?; write!(f, "{}", &self.1.external_tokens[step.symbol.index].name)?;
} else { } else {
write!(f, "{}", self.1.variables[step.symbol.index].name)?; write!(f, "{}", &self.1.variables[step.symbol.index].name)?;
} }
if let Some(alias) = &step.alias { if let Some(alias) = &step.alias {
@ -254,32 +243,6 @@ impl fmt::Display for ParseItemDisplay<'_> {
} }
} }
const fn escape_invisible(c: char) -> Option<&'static str> {
Some(match c {
'\n' => "\\n",
'\r' => "\\r",
'\t' => "\\t",
'\0' => "\\0",
'\\' => "\\\\",
'\x0b' => "\\v",
'\x0c' => "\\f",
_ => return None,
})
}
fn display_variable_name(source: &str) -> String {
source
.chars()
.fold(String::with_capacity(source.len()), |mut acc, c| {
if let Some(esc) = escape_invisible(c) {
acc.push_str(esc);
} else {
acc.push(c);
}
acc
})
}
impl fmt::Display for TokenSetDisplay<'_> { impl fmt::Display for TokenSetDisplay<'_> {
fn fmt(&self, f: &mut fmt::Formatter) -> Result<(), fmt::Error> { fn fmt(&self, f: &mut fmt::Formatter) -> Result<(), fmt::Error> {
write!(f, "[")?; write!(f, "[")?;
@ -290,14 +253,14 @@ impl fmt::Display for TokenSetDisplay<'_> {
if symbol.is_terminal() { if symbol.is_terminal() {
if let Some(variable) = self.2.variables.get(symbol.index) { if let Some(variable) = self.2.variables.get(symbol.index) {
write!(f, "{}", display_variable_name(&variable.name))?; write!(f, "{}", &variable.name)?;
} else { } else {
write!(f, "terminal-{}", symbol.index)?; write!(f, "terminal-{}", symbol.index)?;
} }
} else if symbol.is_external() { } else if symbol.is_external() {
write!(f, "{}", self.1.external_tokens[symbol.index].name)?; write!(f, "{}", &self.1.external_tokens[symbol.index].name)?;
} else { } else {
write!(f, "{}", self.1.variables[symbol.index].name)?; write!(f, "{}", &self.1.variables[symbol.index].name)?;
} }
} }
write!(f, "]")?; write!(f, "]")?;
@ -307,21 +270,13 @@ impl fmt::Display for TokenSetDisplay<'_> {
impl fmt::Display for ParseItemSetDisplay<'_> { impl fmt::Display for ParseItemSetDisplay<'_> {
fn fmt(&self, f: &mut fmt::Formatter) -> Result<(), fmt::Error> { fn fmt(&self, f: &mut fmt::Formatter) -> Result<(), fmt::Error> {
for entry in &self.0.entries { for (item, lookaheads) in &self.0.entries {
write!( writeln!(
f, f,
"{}\t{}", "{}\t{}",
ParseItemDisplay(&entry.item, self.1, self.2), ParseItemDisplay(item, self.1, self.2),
TokenSetDisplay(&entry.lookaheads, self.1, self.2), TokenSetDisplay(lookaheads, self.1, self.2)
)?; )?;
if entry.following_reserved_word_set != ReservedWordSetId::default() {
write!(
f,
"\treserved word set: {}",
entry.following_reserved_word_set
)?;
}
writeln!(f)?;
} }
Ok(()) Ok(())
} }
@ -341,7 +296,7 @@ impl Hash for ParseItem<'_> {
// this item, unless any of the following are true: // this item, unless any of the following are true:
// * the children have fields // * the children have fields
// * the children have aliases // * the children have aliases
// * the children are hidden and represent rules that have fields. // * the children are hidden and
// See the docs for `has_preceding_inherited_fields`. // See the docs for `has_preceding_inherited_fields`.
for step in &self.production.steps[0..self.step_index as usize] { for step in &self.production.steps[0..self.step_index as usize] {
step.alias.hash(hasher); step.alias.hash(hasher);
@ -444,10 +399,9 @@ impl Eq for ParseItem<'_> {}
impl Hash for ParseItemSet<'_> { impl Hash for ParseItemSet<'_> {
fn hash<H: Hasher>(&self, hasher: &mut H) { fn hash<H: Hasher>(&self, hasher: &mut H) {
hasher.write_usize(self.entries.len()); hasher.write_usize(self.entries.len());
for entry in &self.entries { for (item, lookaheads) in &self.entries {
entry.item.hash(hasher); item.hash(hasher);
entry.lookaheads.hash(hasher); lookaheads.hash(hasher);
entry.following_reserved_word_set.hash(hasher);
} }
} }
} }

View file

@ -3,9 +3,9 @@ use std::{
fmt, fmt,
}; };
use super::item::{ParseItem, ParseItemDisplay, ParseItemSet, ParseItemSetEntry, TokenSetDisplay}; use super::item::{ParseItem, ParseItemDisplay, ParseItemSet, TokenSetDisplay};
use crate::{ use crate::{
grammars::{InlinedProductionMap, LexicalGrammar, ReservedWordSetId, SyntaxGrammar}, grammars::{InlinedProductionMap, LexicalGrammar, SyntaxGrammar},
rules::{Symbol, SymbolType, TokenSet}, rules::{Symbol, SymbolType, TokenSet},
}; };
@ -15,10 +15,9 @@ struct TransitiveClosureAddition<'a> {
info: FollowSetInfo, info: FollowSetInfo,
} }
#[derive(Clone, Debug, Default, PartialEq, Eq)] #[derive(Clone, Debug, PartialEq, Eq)]
struct FollowSetInfo { struct FollowSetInfo {
lookaheads: TokenSet, lookaheads: TokenSet,
reserved_lookaheads: ReservedWordSetId,
propagates_lookaheads: bool, propagates_lookaheads: bool,
} }
@ -26,7 +25,6 @@ pub struct ParseItemSetBuilder<'a> {
syntax_grammar: &'a SyntaxGrammar, syntax_grammar: &'a SyntaxGrammar,
lexical_grammar: &'a LexicalGrammar, lexical_grammar: &'a LexicalGrammar,
first_sets: HashMap<Symbol, TokenSet>, first_sets: HashMap<Symbol, TokenSet>,
reserved_first_sets: HashMap<Symbol, ReservedWordSetId>,
last_sets: HashMap<Symbol, TokenSet>, last_sets: HashMap<Symbol, TokenSet>,
inlines: &'a InlinedProductionMap, inlines: &'a InlinedProductionMap,
transitive_closure_additions: Vec<Vec<TransitiveClosureAddition<'a>>>, transitive_closure_additions: Vec<Vec<TransitiveClosureAddition<'a>>>,
@ -48,7 +46,6 @@ impl<'a> ParseItemSetBuilder<'a> {
syntax_grammar, syntax_grammar,
lexical_grammar, lexical_grammar,
first_sets: HashMap::new(), first_sets: HashMap::new(),
reserved_first_sets: HashMap::new(),
last_sets: HashMap::new(), last_sets: HashMap::new(),
inlines, inlines,
transitive_closure_additions: vec![Vec::new(); syntax_grammar.variables.len()], transitive_closure_additions: vec![Vec::new(); syntax_grammar.variables.len()],
@ -57,7 +54,8 @@ impl<'a> ParseItemSetBuilder<'a> {
// For each grammar symbol, populate the FIRST and LAST sets: the set of // For each grammar symbol, populate the FIRST and LAST sets: the set of
// terminals that appear at the beginning and end that symbol's productions, // terminals that appear at the beginning and end that symbol's productions,
// respectively. // respectively.
// For a terminal symbol, the FIRST and LAST sets just consist of the //
// For a terminal symbol, the FIRST and LAST set just consists of the
// terminal itself. // terminal itself.
for i in 0..lexical_grammar.variables.len() { for i in 0..lexical_grammar.variables.len() {
let symbol = Symbol::terminal(i); let symbol = Symbol::terminal(i);
@ -65,9 +63,6 @@ impl<'a> ParseItemSetBuilder<'a> {
set.insert(symbol); set.insert(symbol);
result.first_sets.insert(symbol, set.clone()); result.first_sets.insert(symbol, set.clone());
result.last_sets.insert(symbol, set); result.last_sets.insert(symbol, set);
result
.reserved_first_sets
.insert(symbol, ReservedWordSetId::default());
} }
for i in 0..syntax_grammar.external_tokens.len() { for i in 0..syntax_grammar.external_tokens.len() {
@ -76,15 +71,12 @@ impl<'a> ParseItemSetBuilder<'a> {
set.insert(symbol); set.insert(symbol);
result.first_sets.insert(symbol, set.clone()); result.first_sets.insert(symbol, set.clone());
result.last_sets.insert(symbol, set); result.last_sets.insert(symbol, set);
result
.reserved_first_sets
.insert(symbol, ReservedWordSetId::default());
} }
// The FIRST set of a non-terminal `i` is the union of the FIRST sets // The FIRST set of a non-terminal `i` is the union of the following sets:
// of all the symbols that appear at the beginnings of i's productions. Some // * the set of all terminals that appear at the beginnings of i's productions
// of these symbols may themselves be non-terminals, so this is a recursive // * the FIRST sets of all the non-terminals that appear at the beginnings of i's
// definition. // productions
// //
// Rather than computing these sets using recursion, we use an explicit stack // Rather than computing these sets using recursion, we use an explicit stack
// called `symbols_to_process`. // called `symbols_to_process`.
@ -92,36 +84,37 @@ impl<'a> ParseItemSetBuilder<'a> {
let mut processed_non_terminals = HashSet::new(); let mut processed_non_terminals = HashSet::new();
for i in 0..syntax_grammar.variables.len() { for i in 0..syntax_grammar.variables.len() {
let symbol = Symbol::non_terminal(i); let symbol = Symbol::non_terminal(i);
let first_set = result.first_sets.entry(symbol).or_default();
let reserved_first_set = result.reserved_first_sets.entry(symbol).or_default();
let first_set = result
.first_sets
.entry(symbol)
.or_insert_with(TokenSet::new);
processed_non_terminals.clear(); processed_non_terminals.clear();
symbols_to_process.clear(); symbols_to_process.clear();
symbols_to_process.push(symbol); symbols_to_process.push(symbol);
while let Some(sym) = symbols_to_process.pop() { while let Some(current_symbol) = symbols_to_process.pop() {
for production in &syntax_grammar.variables[sym.index].productions { if current_symbol.is_terminal() || current_symbol.is_external() {
if let Some(step) = production.steps.first() { first_set.insert(current_symbol);
if step.symbol.is_terminal() || step.symbol.is_external() { } else if processed_non_terminals.insert(current_symbol) {
first_set.insert(step.symbol); for production in &syntax_grammar.variables[current_symbol.index].productions {
} else if processed_non_terminals.insert(step.symbol) { if let Some(step) = production.steps.first() {
symbols_to_process.push(step.symbol); symbols_to_process.push(step.symbol);
} }
*reserved_first_set = (*reserved_first_set).max(step.reserved_word_set_id);
} }
} }
} }
// The LAST set is defined in a similar way to the FIRST set. // The LAST set is defined in a similar way to the FIRST set.
let last_set = result.last_sets.entry(symbol).or_default(); let last_set = result.last_sets.entry(symbol).or_insert_with(TokenSet::new);
processed_non_terminals.clear(); processed_non_terminals.clear();
symbols_to_process.clear(); symbols_to_process.clear();
symbols_to_process.push(symbol); symbols_to_process.push(symbol);
while let Some(sym) = symbols_to_process.pop() { while let Some(current_symbol) = symbols_to_process.pop() {
for production in &syntax_grammar.variables[sym.index].productions { if current_symbol.is_terminal() || current_symbol.is_external() {
if let Some(step) = production.steps.last() { last_set.insert(current_symbol);
if step.symbol.is_terminal() || step.symbol.is_external() { } else if processed_non_terminals.insert(current_symbol) {
last_set.insert(step.symbol); for production in &syntax_grammar.variables[current_symbol.index].productions {
} else if processed_non_terminals.insert(step.symbol) { if let Some(step) = production.steps.last() {
symbols_to_process.push(step.symbol); symbols_to_process.push(step.symbol);
} }
} }
@ -131,75 +124,67 @@ impl<'a> ParseItemSetBuilder<'a> {
// To compute an item set's transitive closure, we find each item in the set // To compute an item set's transitive closure, we find each item in the set
// whose next symbol is a non-terminal, and we add new items to the set for // whose next symbol is a non-terminal, and we add new items to the set for
// each of that symbol's productions. These productions might themselves begin // each of that symbols' productions. These productions might themselves begin
// with non-terminals, so the process continues recursively. In this process, // with non-terminals, so the process continues recursively. In this process,
// the total set of entries that get added depends only on two things: // the total set of entries that get added depends only on two things:
// // * the set of non-terminal symbols that occur at each item's current position
// * the non-terminal symbol that occurs next in each item // * the set of terminals that occurs after each of these non-terminal symbols
//
// * the set of terminals that can follow that non-terminal symbol in the item
// //
// So we can avoid a lot of duplicated recursive work by precomputing, for each // So we can avoid a lot of duplicated recursive work by precomputing, for each
// non-terminal symbol `i`, a final list of *additions* that must be made to an // non-terminal symbol `i`, a final list of *additions* that must be made to an
// item set when symbol `i` occurs as the next symbol in one if its core items. // item set when `i` occurs as the next symbol in one if its core items. The
// The structure of a precomputed *addition* is as follows: // structure of an *addition* is as follows:
// // * `item` - the new item that must be added as part of the expansion of `i`
// * `item` - the new item that must be added as part of the expansion of the symbol `i`. // * `lookaheads` - lookahead tokens that can always come after that item in the expansion
// // of `i`
// * `lookaheads` - the set of possible lookahead tokens that can always come after `item`
// in an expansion of symbol `i`.
//
// * `reserved_lookaheads` - the set of reserved lookahead lookahead tokens that can
// always come after `item` in the expansion of symbol `i`.
//
// * `propagates_lookaheads` - a boolean indicating whether or not `item` can occur at the // * `propagates_lookaheads` - a boolean indicating whether or not `item` can occur at the
// *end* of the expansion of symbol `i`, so that i's own current lookahead tokens can // *end* of the expansion of `i`, so that i's own current lookahead tokens can occur
// occur after `item`. // after `item`.
// //
// Rather than computing these additions recursively, we use an explicit stack. // Again, rather than computing these additions recursively, we use an explicit
let empty_lookaheads = TokenSet::new(); // stack called `entries_to_process`.
let mut stack = Vec::new();
let mut follow_set_info_by_non_terminal = HashMap::<usize, FollowSetInfo>::new();
for i in 0..syntax_grammar.variables.len() { for i in 0..syntax_grammar.variables.len() {
let empty_lookaheads = TokenSet::new();
let mut entries_to_process = vec![(i, &empty_lookaheads, true)];
// First, build up a map whose keys are all of the non-terminals that can // First, build up a map whose keys are all of the non-terminals that can
// appear at the beginning of non-terminal `i`, and whose values store // appear at the beginning of non-terminal `i`, and whose values store
// information about the tokens that can follow those non-terminals. // information about the tokens that can follow each non-terminal.
stack.clear(); let mut follow_set_info_by_non_terminal = HashMap::new();
stack.push((i, &empty_lookaheads, ReservedWordSetId::default(), true)); while let Some(entry) = entries_to_process.pop() {
follow_set_info_by_non_terminal.clear(); let (variable_index, lookaheads, propagates_lookaheads) = entry;
while let Some((sym_ix, lookaheads, reserved_word_set_id, propagates_lookaheads)) = let existing_info = follow_set_info_by_non_terminal
stack.pop() .entry(variable_index)
{ .or_insert_with(|| FollowSetInfo {
let mut did_add = false; lookaheads: TokenSet::new(),
let info = follow_set_info_by_non_terminal.entry(sym_ix).or_default(); propagates_lookaheads: false,
did_add |= info.lookaheads.insert_all(lookaheads); });
if reserved_word_set_id > info.reserved_lookaheads {
info.reserved_lookaheads = reserved_word_set_id; let did_add_follow_set_info;
did_add = true; if propagates_lookaheads {
} did_add_follow_set_info = !existing_info.propagates_lookaheads;
did_add |= propagates_lookaheads && !info.propagates_lookaheads; existing_info.propagates_lookaheads = true;
info.propagates_lookaheads |= propagates_lookaheads; } else {
if !did_add { did_add_follow_set_info = existing_info.lookaheads.insert_all(lookaheads);
continue;
} }
for production in &syntax_grammar.variables[sym_ix].productions { if did_add_follow_set_info {
if let Some(symbol) = production.first_symbol() { for production in &syntax_grammar.variables[variable_index].productions {
if symbol.is_non_terminal() { if let Some(symbol) = production.first_symbol() {
if let Some(next_step) = production.steps.get(1) { if symbol.is_non_terminal() {
stack.push(( if production.steps.len() == 1 {
symbol.index, entries_to_process.push((
&result.first_sets[&next_step.symbol], symbol.index,
result.reserved_first_sets[&next_step.symbol], lookaheads,
false, propagates_lookaheads,
)); ));
} else { } else {
stack.push(( entries_to_process.push((
symbol.index, symbol.index,
lookaheads, &result.first_sets[&production.steps[1].symbol],
reserved_word_set_id, false,
propagates_lookaheads, ));
)); }
} }
} }
} }
@ -209,7 +194,7 @@ impl<'a> ParseItemSetBuilder<'a> {
// Store all of those non-terminals' productions, along with their associated // Store all of those non-terminals' productions, along with their associated
// lookahead info, as *additions* associated with non-terminal `i`. // lookahead info, as *additions* associated with non-terminal `i`.
let additions_for_non_terminal = &mut result.transitive_closure_additions[i]; let additions_for_non_terminal = &mut result.transitive_closure_additions[i];
for (&variable_index, follow_set_info) in &follow_set_info_by_non_terminal { for (variable_index, follow_set_info) in follow_set_info_by_non_terminal {
let variable = &syntax_grammar.variables[variable_index]; let variable = &syntax_grammar.variables[variable_index];
let non_terminal = Symbol::non_terminal(variable_index); let non_terminal = Symbol::non_terminal(variable_index);
let variable_index = variable_index as u32; let variable_index = variable_index as u32;
@ -254,23 +239,20 @@ impl<'a> ParseItemSetBuilder<'a> {
pub fn transitive_closure(&self, item_set: &ParseItemSet<'a>) -> ParseItemSet<'a> { pub fn transitive_closure(&self, item_set: &ParseItemSet<'a>) -> ParseItemSet<'a> {
let mut result = ParseItemSet::default(); let mut result = ParseItemSet::default();
for entry in &item_set.entries { for (item, lookaheads) in &item_set.entries {
if let Some(productions) = self if let Some(productions) = self
.inlines .inlines
.inlined_productions(entry.item.production, entry.item.step_index) .inlined_productions(item.production, item.step_index)
{ {
for production in productions { for production in productions {
self.add_item( self.add_item(
&mut result, &mut result,
&ParseItemSetEntry { item.substitute_production(production),
item: entry.item.substitute_production(production), lookaheads,
lookaheads: entry.lookaheads.clone(),
following_reserved_word_set: entry.following_reserved_word_set,
},
); );
} }
} else { } else {
self.add_item(&mut result, entry); self.add_item(&mut result, *item, lookaheads);
} }
} }
result result
@ -280,64 +262,30 @@ impl<'a> ParseItemSetBuilder<'a> {
&self.first_sets[symbol] &self.first_sets[symbol]
} }
pub fn reserved_first_set(&self, symbol: &Symbol) -> Option<&TokenSet> {
let id = *self.reserved_first_sets.get(symbol)?;
Some(&self.syntax_grammar.reserved_word_sets[id.0])
}
pub fn last_set(&self, symbol: &Symbol) -> &TokenSet { pub fn last_set(&self, symbol: &Symbol) -> &TokenSet {
&self.last_sets[symbol] &self.last_sets[symbol]
} }
fn add_item(&self, set: &mut ParseItemSet<'a>, entry: &ParseItemSetEntry<'a>) { fn add_item(&self, set: &mut ParseItemSet<'a>, item: ParseItem<'a>, lookaheads: &TokenSet) {
if let Some(step) = entry.item.step() { if let Some(step) = item.step() {
if step.symbol.is_non_terminal() { if step.symbol.is_non_terminal() {
let next_step = entry.item.successor().step(); let next_step = item.successor().step();
// Determine which tokens can follow this non-terminal. // Determine which tokens can follow this non-terminal.
let (following_tokens, following_reserved_tokens) = let following_tokens = next_step.map_or(lookaheads, |next_step| {
if let Some(next_step) = next_step { self.first_sets.get(&next_step.symbol).unwrap()
( });
self.first_sets.get(&next_step.symbol).unwrap(),
*self.reserved_first_sets.get(&next_step.symbol).unwrap(),
)
} else {
(&entry.lookaheads, entry.following_reserved_word_set)
};
// Use the pre-computed *additions* to expand the non-terminal. // Use the pre-computed *additions* to expand the non-terminal.
for addition in &self.transitive_closure_additions[step.symbol.index] { for addition in &self.transitive_closure_additions[step.symbol.index] {
let entry = set.insert(addition.item); let lookaheads = set.insert(addition.item, &addition.info.lookaheads);
entry.lookaheads.insert_all(&addition.info.lookaheads);
if let Some(word_token) = self.syntax_grammar.word_token {
if addition.info.lookaheads.contains(&word_token) {
entry.following_reserved_word_set = entry
.following_reserved_word_set
.max(addition.info.reserved_lookaheads);
}
}
if addition.info.propagates_lookaheads { if addition.info.propagates_lookaheads {
entry.lookaheads.insert_all(following_tokens); lookaheads.insert_all(following_tokens);
if let Some(word_token) = self.syntax_grammar.word_token {
if following_tokens.contains(&word_token) {
entry.following_reserved_word_set = entry
.following_reserved_word_set
.max(following_reserved_tokens);
}
}
} }
} }
} }
} }
set.insert(item, lookaheads);
let e = set.insert(entry.item);
e.lookaheads.insert_all(&entry.lookaheads);
e.following_reserved_word_set = e
.following_reserved_word_set
.max(entry.following_reserved_word_set);
} }
} }

View file

@ -3,7 +3,7 @@ use std::{
mem, mem,
}; };
use log::debug; use log::info;
use super::token_conflicts::TokenConflictMap; use super::token_conflicts::TokenConflictMap;
use crate::{ use crate::{
@ -11,7 +11,6 @@ use crate::{
grammars::{LexicalGrammar, SyntaxGrammar, VariableType}, grammars::{LexicalGrammar, SyntaxGrammar, VariableType},
rules::{AliasMap, Symbol, TokenSet}, rules::{AliasMap, Symbol, TokenSet},
tables::{GotoAction, ParseAction, ParseState, ParseStateId, ParseTable, ParseTableEntry}, tables::{GotoAction, ParseAction, ParseState, ParseStateId, ParseTable, ParseTableEntry},
OptLevel,
}; };
pub fn minimize_parse_table( pub fn minimize_parse_table(
@ -21,7 +20,6 @@ pub fn minimize_parse_table(
simple_aliases: &AliasMap, simple_aliases: &AliasMap,
token_conflict_map: &TokenConflictMap, token_conflict_map: &TokenConflictMap,
keywords: &TokenSet, keywords: &TokenSet,
optimizations: OptLevel,
) { ) {
let mut minimizer = Minimizer { let mut minimizer = Minimizer {
parse_table, parse_table,
@ -31,9 +29,7 @@ pub fn minimize_parse_table(
keywords, keywords,
simple_aliases, simple_aliases,
}; };
if optimizations.contains(OptLevel::MergeStates) { minimizer.merge_compatible_states();
minimizer.merge_compatible_states();
}
minimizer.remove_unit_reductions(); minimizer.remove_unit_reductions();
minimizer.remove_unused_states(); minimizer.remove_unused_states();
minimizer.reorder_states_by_descending_size(); minimizer.reorder_states_by_descending_size();
@ -155,7 +151,9 @@ impl Minimizer<'_> {
&mut group_ids_by_state_id, &mut group_ids_by_state_id,
0, 0,
|left, right, groups| self.state_successors_differ(left, right, groups), |left, right, groups| self.state_successors_differ(left, right, groups),
) {} ) {
continue;
}
let error_group_index = state_ids_by_group_id let error_group_index = state_ids_by_group_id
.iter() .iter()
@ -172,12 +170,17 @@ impl Minimizer<'_> {
let mut new_states = Vec::with_capacity(state_ids_by_group_id.len()); let mut new_states = Vec::with_capacity(state_ids_by_group_id.len());
for state_ids in &state_ids_by_group_id { for state_ids in &state_ids_by_group_id {
// Initialize the new state based on the first old state in the group. // Initialize the new state based on the first old state in the group.
let mut parse_state = mem::take(&mut self.parse_table.states[state_ids[0]]); let mut parse_state = ParseState::default();
mem::swap(&mut parse_state, &mut self.parse_table.states[state_ids[0]]);
// Extend the new state with all of the actions from the other old states // Extend the new state with all of the actions from the other old states
// in the group. // in the group.
for state_id in &state_ids[1..] { for state_id in &state_ids[1..] {
let other_parse_state = mem::take(&mut self.parse_table.states[*state_id]); let mut other_parse_state = ParseState::default();
mem::swap(
&mut other_parse_state,
&mut self.parse_table.states[*state_id],
);
parse_state parse_state
.terminal_entries .terminal_entries
@ -185,12 +188,6 @@ impl Minimizer<'_> {
parse_state parse_state
.nonterminal_entries .nonterminal_entries
.extend(other_parse_state.nonterminal_entries); .extend(other_parse_state.nonterminal_entries);
parse_state
.reserved_words
.insert_all(&other_parse_state.reserved_words);
for symbol in parse_state.terminal_entries.keys() {
parse_state.reserved_words.remove(symbol);
}
} }
// Update the new state's outgoing references using the new grouping. // Update the new state's outgoing references using the new grouping.
@ -219,14 +216,24 @@ impl Minimizer<'_> {
) { ) {
return true; return true;
} }
} else if self.token_conflicts(left_state.id, right_state.id, right_state, *token) { } else if self.token_conflicts(
left_state.id,
right_state.id,
right_state.terminal_entries.keys(),
*token,
) {
return true; return true;
} }
} }
for token in right_state.terminal_entries.keys() { for token in right_state.terminal_entries.keys() {
if !left_state.terminal_entries.contains_key(token) if !left_state.terminal_entries.contains_key(token)
&& self.token_conflicts(left_state.id, right_state.id, left_state, *token) && self.token_conflicts(
left_state.id,
right_state.id,
left_state.terminal_entries.keys(),
*token,
)
{ {
return true; return true;
} }
@ -248,7 +255,7 @@ impl Minimizer<'_> {
let group1 = group_ids_by_state_id[*s1]; let group1 = group_ids_by_state_id[*s1];
let group2 = group_ids_by_state_id[*s2]; let group2 = group_ids_by_state_id[*s2];
if group1 != group2 { if group1 != group2 {
debug!( info!(
"split states {} {} - successors for {} are split: {s1} {s2}", "split states {} {} - successors for {} are split: {s1} {s2}",
state1.id, state1.id,
state2.id, state2.id,
@ -264,12 +271,12 @@ impl Minimizer<'_> {
for (symbol, s1) in &state1.nonterminal_entries { for (symbol, s1) in &state1.nonterminal_entries {
if let Some(s2) = state2.nonterminal_entries.get(symbol) { if let Some(s2) = state2.nonterminal_entries.get(symbol) {
match (s1, s2) { match (s1, s2) {
(GotoAction::ShiftExtra, GotoAction::ShiftExtra) => {} (GotoAction::ShiftExtra, GotoAction::ShiftExtra) => continue,
(GotoAction::Goto(s1), GotoAction::Goto(s2)) => { (GotoAction::Goto(s1), GotoAction::Goto(s2)) => {
let group1 = group_ids_by_state_id[*s1]; let group1 = group_ids_by_state_id[*s1];
let group2 = group_ids_by_state_id[*s2]; let group2 = group_ids_by_state_id[*s2];
if group1 != group2 { if group1 != group2 {
debug!( info!(
"split states {} {} - successors for {} are split: {s1} {s2}", "split states {} {} - successors for {} are split: {s1} {s2}",
state1.id, state1.id,
state2.id, state2.id,
@ -299,14 +306,16 @@ impl Minimizer<'_> {
let actions1 = &entry1.actions; let actions1 = &entry1.actions;
let actions2 = &entry2.actions; let actions2 = &entry2.actions;
if actions1.len() != actions2.len() { if actions1.len() != actions2.len() {
debug!( info!(
"split states {state_id1} {state_id2} - differing action counts for token {}", "split states {state_id1} {state_id2} - differing action counts for token {}",
self.symbol_name(token) self.symbol_name(token)
); );
return true; return true;
} }
for (action1, action2) in actions1.iter().zip(actions2.iter()) { for (i, action1) in actions1.iter().enumerate() {
let action2 = &actions2[i];
// Two shift actions are equivalent if their destinations are in the same group. // Two shift actions are equivalent if their destinations are in the same group.
if let ( if let (
ParseAction::Shift { ParseAction::Shift {
@ -324,13 +333,13 @@ impl Minimizer<'_> {
if group1 == group2 && is_repetition1 == is_repetition2 { if group1 == group2 && is_repetition1 == is_repetition2 {
continue; continue;
} }
debug!( info!(
"split states {state_id1} {state_id2} - successors for {} are split: {s1} {s2}", "split states {state_id1} {state_id2} - successors for {} are split: {s1} {s2}",
self.symbol_name(token), self.symbol_name(token),
); );
return true; return true;
} else if action1 != action2 { } else if action1 != action2 {
debug!( info!(
"split states {state_id1} {state_id2} - unequal actions for {}", "split states {state_id1} {state_id2} - unequal actions for {}",
self.symbol_name(token), self.symbol_name(token),
); );
@ -341,32 +350,28 @@ impl Minimizer<'_> {
false false
} }
fn token_conflicts( fn token_conflicts<'b>(
&self, &self,
left_id: ParseStateId, left_id: ParseStateId,
right_id: ParseStateId, right_id: ParseStateId,
right_state: &ParseState, existing_tokens: impl Iterator<Item = &'b Symbol>,
new_token: Symbol, new_token: Symbol,
) -> bool { ) -> bool {
if new_token == Symbol::end_of_nonterminal_extra() { if new_token == Symbol::end_of_nonterminal_extra() {
debug!("split states {left_id} {right_id} - end of non-terminal extra",); info!("split states {left_id} {right_id} - end of non-terminal extra",);
return true; return true;
} }
// Do not add external tokens; they could conflict lexically with any of the state's // Do not add external tokens; they could conflict lexically with any of the state's
// existing lookahead tokens. // existing lookahead tokens.
if new_token.is_external() { if new_token.is_external() {
debug!( info!(
"split states {left_id} {right_id} - external token {}", "split states {left_id} {right_id} - external token {}",
self.symbol_name(&new_token), self.symbol_name(&new_token),
); );
return true; return true;
} }
if right_state.reserved_words.contains(&new_token) {
return false;
}
// Do not add tokens which are both internal and external. Their validity could // Do not add tokens which are both internal and external. Their validity could
// influence the behavior of the external scanner. // influence the behavior of the external scanner.
if self if self
@ -375,7 +380,7 @@ impl Minimizer<'_> {
.iter() .iter()
.any(|external| external.corresponding_internal_token == Some(new_token)) .any(|external| external.corresponding_internal_token == Some(new_token))
{ {
debug!( info!(
"split states {left_id} {right_id} - internal/external token {}", "split states {left_id} {right_id} - internal/external token {}",
self.symbol_name(&new_token), self.symbol_name(&new_token),
); );
@ -383,30 +388,23 @@ impl Minimizer<'_> {
} }
// Do not add a token if it conflicts with an existing token. // Do not add a token if it conflicts with an existing token.
for token in right_state.terminal_entries.keys().copied() { for token in existing_tokens {
if !token.is_terminal() { if token.is_terminal()
continue; && !(self.syntax_grammar.word_token == Some(*token)
} && self.keywords.contains(&new_token))
if self.syntax_grammar.word_token == Some(token) && self.keywords.contains(&new_token) { && !(self.syntax_grammar.word_token == Some(new_token)
continue; && self.keywords.contains(token))
} && (self
if self.syntax_grammar.word_token == Some(new_token) && self.keywords.contains(&token) {
continue;
}
if self
.token_conflict_map
.does_conflict(new_token.index, token.index)
|| self
.token_conflict_map .token_conflict_map
.does_match_same_string(new_token.index, token.index) .does_conflict(new_token.index, token.index)
|| self
.token_conflict_map
.does_match_same_string(new_token.index, token.index))
{ {
debug!( info!(
"split states {} {} - token {} conflicts with {}", "split states {left_id} {right_id} - token {} conflicts with {}",
left_id,
right_id,
self.symbol_name(&new_token), self.symbol_name(&new_token),
self.symbol_name(&token), self.symbol_name(token),
); );
return true; return true;
} }

View file

@ -8,16 +8,14 @@ mod token_conflicts;
use std::collections::{BTreeSet, HashMap}; use std::collections::{BTreeSet, HashMap};
use anyhow::Result;
pub use build_lex_table::LARGE_CHARACTER_RANGE_COUNT; pub use build_lex_table::LARGE_CHARACTER_RANGE_COUNT;
use build_parse_table::BuildTableResult; use log::info;
pub use build_parse_table::ParseTableBuilderError;
use log::{debug, info};
use self::{ use self::{
build_lex_table::build_lex_table, build_lex_table::build_lex_table,
build_parse_table::{build_parse_table, ParseStateInfo}, build_parse_table::{build_parse_table, ParseStateInfo},
coincident_tokens::CoincidentTokenIndex, coincident_tokens::CoincidentTokenIndex,
item_set_builder::ParseItemSetBuilder,
minimize_parse_table::minimize_parse_table, minimize_parse_table::minimize_parse_table,
token_conflicts::TokenConflictMap, token_conflicts::TokenConflictMap,
}; };
@ -27,13 +25,13 @@ use crate::{
node_types::VariableInfo, node_types::VariableInfo,
rules::{AliasMap, Symbol, SymbolType, TokenSet}, rules::{AliasMap, Symbol, SymbolType, TokenSet},
tables::{LexTable, ParseAction, ParseTable, ParseTableEntry}, tables::{LexTable, ParseAction, ParseTable, ParseTableEntry},
OptLevel,
}; };
pub struct Tables { pub struct Tables {
pub parse_table: ParseTable, pub parse_table: ParseTable,
pub main_lex_table: LexTable, pub main_lex_table: LexTable,
pub keyword_lex_table: LexTable, pub keyword_lex_table: LexTable,
pub word_token: Option<Symbol>,
pub large_character_sets: Vec<(Option<Symbol>, CharacterSet)>, pub large_character_sets: Vec<(Option<Symbol>, CharacterSet)>,
} }
@ -44,17 +42,9 @@ pub fn build_tables(
variable_info: &[VariableInfo], variable_info: &[VariableInfo],
inlines: &InlinedProductionMap, inlines: &InlinedProductionMap,
report_symbol_name: Option<&str>, report_symbol_name: Option<&str>,
optimizations: OptLevel, ) -> Result<Tables> {
) -> BuildTableResult<Tables> { let (mut parse_table, following_tokens, parse_state_info) =
let item_set_builder = ParseItemSetBuilder::new(syntax_grammar, lexical_grammar, inlines); build_parse_table(syntax_grammar, lexical_grammar, inlines, variable_info)?;
let following_tokens =
get_following_tokens(syntax_grammar, lexical_grammar, inlines, &item_set_builder);
let (mut parse_table, parse_state_info) = build_parse_table(
syntax_grammar,
lexical_grammar,
item_set_builder,
variable_info,
)?;
let token_conflict_map = TokenConflictMap::new(lexical_grammar, following_tokens); let token_conflict_map = TokenConflictMap::new(lexical_grammar, following_tokens);
let coincident_token_index = CoincidentTokenIndex::new(&parse_table, lexical_grammar); let coincident_token_index = CoincidentTokenIndex::new(&parse_table, lexical_grammar);
let keywords = identify_keywords( let keywords = identify_keywords(
@ -80,7 +70,6 @@ pub fn build_tables(
simple_aliases, simple_aliases,
&token_conflict_map, &token_conflict_map,
&keywords, &keywords,
optimizations,
); );
let lex_tables = build_lex_table( let lex_tables = build_lex_table(
&mut parse_table, &mut parse_table,
@ -103,59 +92,15 @@ pub fn build_tables(
); );
} }
if parse_table.states.len() > u16::MAX as usize {
Err(ParseTableBuilderError::StateCount(parse_table.states.len()))?;
}
Ok(Tables { Ok(Tables {
parse_table, parse_table,
main_lex_table: lex_tables.main_lex_table, main_lex_table: lex_tables.main_lex_table,
keyword_lex_table: lex_tables.keyword_lex_table, keyword_lex_table: lex_tables.keyword_lex_table,
large_character_sets: lex_tables.large_character_sets, large_character_sets: lex_tables.large_character_sets,
word_token: syntax_grammar.word_token,
}) })
} }
fn get_following_tokens(
syntax_grammar: &SyntaxGrammar,
lexical_grammar: &LexicalGrammar,
inlines: &InlinedProductionMap,
builder: &ParseItemSetBuilder,
) -> Vec<TokenSet> {
let mut result = vec![TokenSet::new(); lexical_grammar.variables.len()];
let productions = syntax_grammar
.variables
.iter()
.flat_map(|v| &v.productions)
.chain(&inlines.productions);
let all_tokens = (0..result.len())
.map(Symbol::terminal)
.collect::<TokenSet>();
for production in productions {
for i in 1..production.steps.len() {
let left_tokens = builder.last_set(&production.steps[i - 1].symbol);
let right_tokens = builder.first_set(&production.steps[i].symbol);
let right_reserved_tokens = builder.reserved_first_set(&production.steps[i].symbol);
for left_token in left_tokens.iter() {
if left_token.is_terminal() {
result[left_token.index].insert_all_terminals(right_tokens);
if let Some(reserved_tokens) = right_reserved_tokens {
result[left_token.index].insert_all_terminals(reserved_tokens);
}
}
}
}
}
for extra in &syntax_grammar.extra_symbols {
if extra.is_terminal() {
for entry in &mut result {
entry.insert(*extra);
}
result[extra.index] = all_tokens.clone();
}
}
result
}
fn populate_error_state( fn populate_error_state(
parse_table: &mut ParseTable, parse_table: &mut ParseTable,
syntax_grammar: &SyntaxGrammar, syntax_grammar: &SyntaxGrammar,
@ -179,7 +124,7 @@ fn populate_error_state(
if conflicts_with_other_tokens { if conflicts_with_other_tokens {
None None
} else { } else {
debug!( info!(
"error recovery - token {} has no conflicts", "error recovery - token {} has no conflicts",
lexical_grammar.variables[i].name lexical_grammar.variables[i].name
); );
@ -205,14 +150,14 @@ fn populate_error_state(
!coincident_token_index.contains(symbol, *t) !coincident_token_index.contains(symbol, *t)
&& token_conflict_map.does_conflict(symbol.index, t.index) && token_conflict_map.does_conflict(symbol.index, t.index)
}) { }) {
debug!( info!(
"error recovery - exclude token {} because of conflict with {}", "error recovery - exclude token {} because of conflict with {}",
lexical_grammar.variables[i].name, lexical_grammar.variables[t.index].name lexical_grammar.variables[i].name, lexical_grammar.variables[t.index].name
); );
continue; continue;
} }
} }
debug!( info!(
"error recovery - include token {}", "error recovery - include token {}",
lexical_grammar.variables[i].name lexical_grammar.variables[i].name
); );
@ -345,7 +290,7 @@ fn identify_keywords(
&& token_conflict_map.does_match_same_string(i, word_token.index) && token_conflict_map.does_match_same_string(i, word_token.index)
&& !token_conflict_map.does_match_different_string(i, word_token.index) && !token_conflict_map.does_match_different_string(i, word_token.index)
{ {
debug!( info!(
"Keywords - add candidate {}", "Keywords - add candidate {}",
lexical_grammar.variables[i].name lexical_grammar.variables[i].name
); );
@ -364,7 +309,7 @@ fn identify_keywords(
if other_token != *token if other_token != *token
&& token_conflict_map.does_match_same_string(other_token.index, token.index) && token_conflict_map.does_match_same_string(other_token.index, token.index)
{ {
debug!( info!(
"Keywords - exclude {} because it matches the same string as {}", "Keywords - exclude {} because it matches the same string as {}",
lexical_grammar.variables[token.index].name, lexical_grammar.variables[token.index].name,
lexical_grammar.variables[other_token.index].name lexical_grammar.variables[other_token.index].name
@ -406,7 +351,7 @@ fn identify_keywords(
word_token.index, word_token.index,
other_index, other_index,
) { ) {
debug!( info!(
"Keywords - exclude {} because of conflict with {}", "Keywords - exclude {} because of conflict with {}",
lexical_grammar.variables[token.index].name, lexical_grammar.variables[token.index].name,
lexical_grammar.variables[other_index].name lexical_grammar.variables[other_index].name
@ -415,7 +360,7 @@ fn identify_keywords(
} }
} }
debug!( info!(
"Keywords - include {}", "Keywords - include {}",
lexical_grammar.variables[token.index].name, lexical_grammar.variables[token.index].name,
); );
@ -469,9 +414,9 @@ fn report_state_info<'a>(
for (i, state) in parse_table.states.iter().enumerate() { for (i, state) in parse_table.states.iter().enumerate() {
all_state_indices.insert(i); all_state_indices.insert(i);
let item_set = &parse_state_info[state.id]; let item_set = &parse_state_info[state.id];
for entry in &item_set.1.entries { for (item, _) in &item_set.1.entries {
if !entry.item.is_augmented() { if !item.is_augmented() {
symbols_with_state_indices[entry.item.variable_index as usize] symbols_with_state_indices[item.variable_index as usize]
.1 .1
.insert(i); .insert(i);
} }
@ -487,14 +432,14 @@ fn report_state_info<'a>(
.max() .max()
.unwrap(); .unwrap();
for (symbol, states) in &symbols_with_state_indices { for (symbol, states) in &symbols_with_state_indices {
info!( eprintln!(
"{:width$}\t{}", "{:width$}\t{}",
syntax_grammar.variables[symbol.index].name, syntax_grammar.variables[symbol.index].name,
states.len(), states.len(),
width = max_symbol_name_length width = max_symbol_name_length
); );
} }
info!(""); eprintln!();
let state_indices = if report_symbol_name == "*" { let state_indices = if report_symbol_name == "*" {
Some(&all_state_indices) Some(&all_state_indices)
@ -517,27 +462,22 @@ fn report_state_info<'a>(
for state_index in state_indices { for state_index in state_indices {
let id = parse_table.states[state_index].id; let id = parse_table.states[state_index].id;
let (preceding_symbols, item_set) = &parse_state_info[id]; let (preceding_symbols, item_set) = &parse_state_info[id];
info!("state index: {state_index}"); eprintln!("state index: {state_index}");
info!("state id: {id}"); eprintln!("state id: {id}");
info!( eprint!("symbol sequence:");
"symbol sequence: {}", for symbol in preceding_symbols {
preceding_symbols let name = if symbol.is_terminal() {
.iter() &lexical_grammar.variables[symbol.index].name
.map(|symbol| { } else if symbol.is_external() {
if symbol.is_terminal() { &syntax_grammar.external_tokens[symbol.index].name
lexical_grammar.variables[symbol.index].name.clone() } else {
} else if symbol.is_external() { &syntax_grammar.variables[symbol.index].name
syntax_grammar.external_tokens[symbol.index].name.clone() };
} else { eprint!(" {name}");
syntax_grammar.variables[symbol.index].name.clone() }
} eprintln!(
})
.collect::<Vec<_>>()
.join(" ")
);
info!(
"\nitems:\n{}", "\nitems:\n{}",
item::ParseItemSetDisplay(item_set, syntax_grammar, lexical_grammar), self::item::ParseItemSetDisplay(item_set, syntax_grammar, lexical_grammar,),
); );
} }
} }

View file

@ -28,7 +28,7 @@ pub struct TokenConflictMap<'a> {
impl<'a> TokenConflictMap<'a> { impl<'a> TokenConflictMap<'a> {
/// Create a token conflict map based on a lexical grammar, which describes the structure /// Create a token conflict map based on a lexical grammar, which describes the structure
/// of each token, and a `following_token` map, which indicates which tokens may be appear /// each token, and a `following_token` map, which indicates which tokens may be appear
/// immediately after each other token. /// immediately after each other token.
/// ///
/// This analyzes the possible kinds of overlap between each pair of tokens and stores /// This analyzes the possible kinds of overlap between each pair of tokens and stores

View file

@ -3,7 +3,7 @@ pub fn split_state_id_groups<S>(
state_ids_by_group_id: &mut Vec<Vec<usize>>, state_ids_by_group_id: &mut Vec<Vec<usize>>,
group_ids_by_state_id: &mut [usize], group_ids_by_state_id: &mut [usize],
start_group_id: usize, start_group_id: usize,
mut should_split: impl FnMut(&S, &S, &[usize]) -> bool, mut f: impl FnMut(&S, &S, &[usize]) -> bool,
) -> bool { ) -> bool {
let mut result = false; let mut result = false;
@ -33,7 +33,7 @@ pub fn split_state_id_groups<S>(
} }
let right_state = &states[right_state_id]; let right_state = &states[right_state_id];
if should_split(left_state, right_state, group_ids_by_state_id) { if f(left_state, right_state, group_ids_by_state_id) {
split_state_ids.push(right_state_id); split_state_ids.push(right_state_id);
} }

View file

@ -16,7 +16,6 @@ function alias(rule, value) {
result.value = value.symbol.name; result.value = value.symbol.name;
return result; return result;
case Object: case Object:
case GrammarSymbol:
if (typeof value.type === 'string' && value.type === 'SYMBOL') { if (typeof value.type === 'string' && value.type === 'SYMBOL') {
result.named = true; result.named = true;
result.value = value.name; result.value = value.name;
@ -70,7 +69,7 @@ function prec(number, rule) {
}; };
} }
prec.left = function (number, rule) { prec.left = function(number, rule) {
if (rule == null) { if (rule == null) {
rule = number; rule = number;
number = 0; number = 0;
@ -92,7 +91,7 @@ prec.left = function (number, rule) {
}; };
} }
prec.right = function (number, rule) { prec.right = function(number, rule) {
if (rule == null) { if (rule == null) {
rule = number; rule = number;
number = 0; number = 0;
@ -114,7 +113,7 @@ prec.right = function (number, rule) {
}; };
} }
prec.dynamic = function (number, rule) { prec.dynamic = function(number, rule) {
checkPrecedence(number); checkPrecedence(number);
checkArguments( checkArguments(
arguments, arguments,
@ -154,26 +153,11 @@ function seq(...elements) {
}; };
} }
class GrammarSymbol {
constructor(name) {
this.type = "SYMBOL";
this.name = name;
}
}
function reserved(wordset, rule) {
if (typeof wordset !== 'string') {
throw new Error('Invalid reserved word set name: ' + wordset)
}
return {
type: "RESERVED",
content: normalize(rule),
context_name: wordset,
}
}
function sym(name) { function sym(name) {
return new GrammarSymbol(name); return {
type: "SYMBOL",
name
};
} }
function token(value) { function token(value) {
@ -184,7 +168,7 @@ function token(value) {
}; };
} }
token.immediate = function (value) { token.immediate = function(value) {
checkArguments(arguments, arguments.length, token.immediate, 'token.immediate', '', 'literal'); checkArguments(arguments, arguments.length, token.immediate, 'token.immediate', '', 'literal');
return { return {
type: "IMMEDIATE_TOKEN", type: "IMMEDIATE_TOKEN",
@ -211,11 +195,6 @@ function normalize(value) {
type: 'PATTERN', type: 'PATTERN',
value: value.source value: value.source
}; };
case RustRegex:
return {
type: 'PATTERN',
value: value.value
};
case ReferenceError: case ReferenceError:
throw value throw value
default: default:
@ -257,7 +236,6 @@ function grammar(baseGrammar, options) {
inline: [], inline: [],
supertypes: [], supertypes: [],
precedences: [], precedences: [],
reserved: {},
}; };
} else { } else {
baseGrammar = baseGrammar.grammar; baseGrammar = baseGrammar.grammar;
@ -331,28 +309,6 @@ function grammar(baseGrammar, options) {
} }
} }
let reserved = baseGrammar.reserved;
if (options.reserved) {
if (typeof options.reserved !== "object") {
throw new Error("Grammar's 'reserved' property must be an object.");
}
for (const reservedWordSetName of Object.keys(options.reserved)) {
const reservedWordSetFn = options.reserved[reservedWordSetName]
if (typeof reservedWordSetFn !== "function") {
throw new Error(`Grammar reserved word sets must all be functions. '${reservedWordSetName}' is not.`);
}
const reservedTokens = reservedWordSetFn.call(ruleBuilder, ruleBuilder, baseGrammar.reserved[reservedWordSetName]);
if (!Array.isArray(reservedTokens)) {
throw new Error(`Grammar's reserved word set functions must all return arrays of rules. '${reservedWordSetName}' does not.`);
}
reserved[reservedWordSetName] = reservedTokens.map(normalize);
}
}
let extras = baseGrammar.extras.slice(); let extras = baseGrammar.extras.slice();
if (options.extras) { if (options.extras) {
if (typeof options.extras !== "function") { if (typeof options.extras !== "function") {
@ -483,17 +439,10 @@ function grammar(baseGrammar, options) {
externals, externals,
inline, inline,
supertypes, supertypes,
reserved,
}, },
}; };
} }
class RustRegex {
constructor(value) {
this.value = value;
}
}
function checkArguments(args, ruleCount, caller, callerName, suffix = '', argType = 'rule') { function checkArguments(args, ruleCount, caller, callerName, suffix = '', argType = 'rule') {
// Allow for .map() usage where additional arguments are index and the entire array. // Allow for .map() usage where additional arguments are index and the entire array.
const isMapCall = ruleCount === 3 && typeof args[1] === 'number' && Array.isArray(args[2]); const isMapCall = ruleCount === 3 && typeof args[1] === 'number' && Array.isArray(args[2]);
@ -517,7 +466,6 @@ function checkPrecedence(value) {
} }
function getEnv(name) { function getEnv(name) {
if (globalThis.native) return globalThis.__ts_grammar_path;
if (globalThis.process) return process.env[name]; // Node/Bun if (globalThis.process) return process.env[name]; // Node/Bun
if (globalThis.Deno) return Deno.env.get(name); // Deno if (globalThis.Deno) return Deno.env.get(name); // Deno
throw Error("Unsupported JS runtime"); throw Error("Unsupported JS runtime");
@ -530,31 +478,20 @@ globalThis.optional = optional;
globalThis.prec = prec; globalThis.prec = prec;
globalThis.repeat = repeat; globalThis.repeat = repeat;
globalThis.repeat1 = repeat1; globalThis.repeat1 = repeat1;
globalThis.reserved = reserved;
globalThis.seq = seq; globalThis.seq = seq;
globalThis.sym = sym; globalThis.sym = sym;
globalThis.token = token; globalThis.token = token;
globalThis.grammar = grammar; globalThis.grammar = grammar;
globalThis.field = field; globalThis.field = field;
globalThis.RustRegex = RustRegex;
const grammarPath = getEnv("TREE_SITTER_GRAMMAR_PATH");
let result = await import(grammarPath);
let grammarObj = result.default?.grammar ?? result.grammar;
if (globalThis.native && !grammarObj) {
grammarObj = module.exports.grammar;
}
const result = await import(getEnv("TREE_SITTER_GRAMMAR_PATH"));
const object = { const object = {
"$schema": "https://tree-sitter.github.io/tree-sitter/assets/schemas/grammar.schema.json", "$schema": "https://tree-sitter.github.io/tree-sitter/assets/schemas/grammar.schema.json",
...grammarObj, ...(result.default?.grammar ?? result.grammar)
}; };
const output = JSON.stringify(object); const output = JSON.stringify(object);
if (globalThis.native) { if (globalThis.process) { // Node/Bun
globalThis.output = output;
} else if (globalThis.process) { // Node/Bun
process.stdout.write(output); process.stdout.write(output);
} else if (globalThis.Deno) { // Deno } else if (globalThis.Deno) { // Deno
Deno.stdout.writeSync(new TextEncoder().encode(output)); Deno.stdout.writeSync(new TextEncoder().encode(output));

View file

@ -0,0 +1 @@

View file

@ -2,7 +2,7 @@ use std::{collections::HashMap, fmt};
use super::{ use super::{
nfa::Nfa, nfa::Nfa,
rules::{Alias, Associativity, Precedence, Rule, Symbol, TokenSet}, rules::{Alias, Associativity, Precedence, Rule, Symbol},
}; };
#[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)] #[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
@ -39,13 +39,6 @@ pub struct InputGrammar {
pub variables_to_inline: Vec<String>, pub variables_to_inline: Vec<String>,
pub supertype_symbols: Vec<String>, pub supertype_symbols: Vec<String>,
pub word_token: Option<String>, pub word_token: Option<String>,
pub reserved_words: Vec<ReservedWordContext<Rule>>,
}
#[derive(Debug, Default, PartialEq, Eq)]
pub struct ReservedWordContext<T> {
pub name: String,
pub reserved_words: Vec<T>,
} }
// Extracted lexical grammar // Extracted lexical grammar
@ -73,20 +66,8 @@ pub struct ProductionStep {
pub associativity: Option<Associativity>, pub associativity: Option<Associativity>,
pub alias: Option<Alias>, pub alias: Option<Alias>,
pub field_name: Option<String>, pub field_name: Option<String>,
pub reserved_word_set_id: ReservedWordSetId,
} }
#[derive(Clone, Copy, Debug, Default, PartialEq, Eq, Hash, PartialOrd, Ord)]
pub struct ReservedWordSetId(pub usize);
impl fmt::Display for ReservedWordSetId {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
self.0.fmt(f)
}
}
pub const NO_RESERVED_WORDS: ReservedWordSetId = ReservedWordSetId(usize::MAX);
#[derive(Clone, Debug, Default, PartialEq, Eq)] #[derive(Clone, Debug, Default, PartialEq, Eq)]
pub struct Production { pub struct Production {
pub steps: Vec<ProductionStep>, pub steps: Vec<ProductionStep>,
@ -123,44 +104,51 @@ pub struct SyntaxGrammar {
pub variables_to_inline: Vec<Symbol>, pub variables_to_inline: Vec<Symbol>,
pub word_token: Option<Symbol>, pub word_token: Option<Symbol>,
pub precedence_orderings: Vec<Vec<PrecedenceEntry>>, pub precedence_orderings: Vec<Vec<PrecedenceEntry>>,
pub reserved_word_sets: Vec<TokenSet>,
} }
#[cfg(test)] #[cfg(test)]
impl ProductionStep { impl ProductionStep {
#[must_use] #[must_use]
pub fn new(symbol: Symbol) -> Self { pub const fn new(symbol: Symbol) -> Self {
Self { Self {
symbol, symbol,
precedence: Precedence::None, precedence: Precedence::None,
associativity: None, associativity: None,
alias: None, alias: None,
field_name: None, field_name: None,
reserved_word_set_id: ReservedWordSetId::default(),
} }
} }
pub fn with_prec( pub fn with_prec(self, precedence: Precedence, associativity: Option<Associativity>) -> Self {
mut self, Self {
precedence: Precedence, symbol: self.symbol,
associativity: Option<Associativity>, precedence,
) -> Self { associativity,
self.precedence = precedence; alias: self.alias,
self.associativity = associativity; field_name: self.field_name,
self }
} }
pub fn with_alias(mut self, value: &str, is_named: bool) -> Self { pub fn with_alias(self, value: &str, is_named: bool) -> Self {
self.alias = Some(Alias { Self {
value: value.to_string(), symbol: self.symbol,
is_named, precedence: self.precedence,
}); associativity: self.associativity,
self alias: Some(Alias {
value: value.to_string(),
is_named,
}),
field_name: self.field_name,
}
} }
pub fn with_field_name(self, name: &str) -> Self {
pub fn with_field_name(mut self, name: &str) -> Self { Self {
self.field_name = Some(name.to_string()); symbol: self.symbol,
self precedence: self.precedence,
associativity: self.associativity,
alias: self.alias,
field_name: Some(name.to_string()),
}
} }
} }
@ -253,7 +241,7 @@ impl InlinedProductionMap {
step_index: u32, step_index: u32,
) -> Option<impl Iterator<Item = &'a Production> + 'a> { ) -> Option<impl Iterator<Item = &'a Production> + 'a> {
self.production_map self.production_map
.get(&(std::ptr::from_ref::<Production>(production), step_index)) .get(&(production as *const Production, step_index))
.map(|production_indices| { .map(|production_indices| {
production_indices production_indices
.iter() .iter()

257
cli/generate/src/lib.rs Normal file
View file

@ -0,0 +1,257 @@
use std::{
env, fs,
io::Write,
path::{Path, PathBuf},
process::{Command, Stdio},
};
use anyhow::{anyhow, Context, Result};
use build_tables::build_tables;
use grammars::InputGrammar;
use lazy_static::lazy_static;
use parse_grammar::parse_grammar;
use prepare_grammar::prepare_grammar;
use regex::{Regex, RegexBuilder};
use render::render_c_code;
use semver::Version;
mod build_tables;
mod dedup;
mod grammar_files;
mod grammars;
mod nfa;
mod node_types;
pub mod parse_grammar;
mod prepare_grammar;
mod render;
mod rules;
mod tables;
lazy_static! {
static ref JSON_COMMENT_REGEX: Regex = RegexBuilder::new("^\\s*//.*")
.multi_line(true)
.build()
.unwrap();
}
struct GeneratedParser {
c_code: String,
node_types_json: String,
header_tail: String,
}
pub const ALLOC_HEADER: &str = include_str!("templates/alloc.h");
pub const ARRAY_HEADER: &str = include_str!("templates/array.h");
pub fn generate_parser_in_directory(
repo_path: &Path,
out_path: Option<&str>,
grammar_path: Option<&str>,
abi_version: usize,
report_symbol_name: Option<&str>,
js_runtime: Option<&str>,
) -> Result<()> {
let mut repo_path = repo_path.to_owned();
let mut grammar_path = grammar_path;
// Populate a new empty grammar directory.
if let Some(path) = grammar_path {
let path = PathBuf::from(path);
if !path
.try_exists()
.with_context(|| "Some error with specified path")?
{
fs::create_dir_all(&path)?;
grammar_path = None;
repo_path = path;
}
}
let grammar_path = grammar_path.map_or_else(|| repo_path.join("grammar.js"), PathBuf::from);
// Read the grammar file.
let grammar_json = load_grammar_file(&grammar_path, js_runtime)?;
let src_path = out_path.map_or_else(|| repo_path.join("src"), PathBuf::from);
let header_path = src_path.join("tree_sitter");
// Ensure that the output directories exist.
fs::create_dir_all(&src_path)?;
fs::create_dir_all(&header_path)?;
if grammar_path.file_name().unwrap() != "grammar.json" {
fs::write(src_path.join("grammar.json"), &grammar_json)
.with_context(|| format!("Failed to write grammar.json to {src_path:?}"))?;
}
// Parse and preprocess the grammar.
let input_grammar = parse_grammar(&grammar_json)?;
// Generate the parser and related files.
let GeneratedParser {
c_code,
node_types_json,
header_tail,
} = generate_parser_for_grammar_with_opts(&input_grammar, abi_version, report_symbol_name)?;
write_file(&src_path.join("parser.c"), c_code)?;
write_file(&src_path.join("node-types.json"), node_types_json)?;
write_file(&header_path.join("alloc.h"), ALLOC_HEADER)?;
write_file(&header_path.join("array.h"), ARRAY_HEADER)?;
write_file(
&header_path.join("parser.h"),
format!("{}\n{header_tail}", tree_sitter::PARSER_HEADER),
)?;
Ok(())
}
pub fn generate_parser_for_grammar(grammar_json: &str) -> Result<(String, String)> {
let grammar_json = JSON_COMMENT_REGEX.replace_all(grammar_json, "\n");
let input_grammar = parse_grammar(&grammar_json)?;
let parser =
generate_parser_for_grammar_with_opts(&input_grammar, tree_sitter::LANGUAGE_VERSION, None)?;
Ok((input_grammar.name, parser.c_code))
}
fn generate_parser_for_grammar_with_opts(
input_grammar: &InputGrammar,
abi_version: usize,
report_symbol_name: Option<&str>,
) -> Result<GeneratedParser> {
let (syntax_grammar, lexical_grammar, inlines, simple_aliases) =
prepare_grammar(input_grammar)?;
let variable_info =
node_types::get_variable_info(&syntax_grammar, &lexical_grammar, &simple_aliases)?;
let node_types_json = node_types::generate_node_types_json(
&syntax_grammar,
&lexical_grammar,
&simple_aliases,
&variable_info,
);
let tables = build_tables(
&syntax_grammar,
&lexical_grammar,
&simple_aliases,
&variable_info,
&inlines,
report_symbol_name,
)?;
let (c_code, header_tail) = render_c_code(
&input_grammar.name,
tables,
syntax_grammar,
lexical_grammar,
simple_aliases,
abi_version,
);
Ok(GeneratedParser {
c_code,
node_types_json: serde_json::to_string_pretty(&node_types_json).unwrap(),
header_tail,
})
}
pub fn load_grammar_file(grammar_path: &Path, js_runtime: Option<&str>) -> Result<String> {
if grammar_path.is_dir() {
return Err(anyhow!(
"Path to a grammar file with `.js` or `.json` extension is required"
));
}
match grammar_path.extension().and_then(|e| e.to_str()) {
Some("js") => Ok(load_js_grammar_file(grammar_path, js_runtime)
.with_context(|| "Failed to load grammar.js")?),
Some("json") => {
Ok(fs::read_to_string(grammar_path).with_context(|| "Failed to load grammar.json")?)
}
_ => Err(anyhow!("Unknown grammar file extension: {grammar_path:?}",)),
}
}
fn load_js_grammar_file(grammar_path: &Path, js_runtime: Option<&str>) -> Result<String> {
let grammar_path = fs::canonicalize(grammar_path)?;
#[cfg(windows)]
let grammar_path = url::Url::from_file_path(grammar_path)
.expect("Failed to convert path to URL")
.to_string();
let js_runtime = js_runtime.unwrap_or("node");
let mut js_command = Command::new(js_runtime);
match js_runtime {
"node" => {
js_command.args(["--input-type=module", "-"]);
}
"bun" => {
js_command.arg("-");
}
"deno" => {
js_command.args(["run", "--allow-all", "-"]);
}
_ => {}
}
let mut js_process = js_command
.env("TREE_SITTER_GRAMMAR_PATH", grammar_path)
.stdin(Stdio::piped())
.stdout(Stdio::piped())
.spawn()
.with_context(|| format!("Failed to run `{js_runtime}`"))?;
let mut js_stdin = js_process
.stdin
.take()
.with_context(|| format!("Failed to open stdin for {js_runtime}"))?;
let cli_version = Version::parse(env!("CARGO_PKG_VERSION"))
.with_context(|| "Could not parse this package's version as semver.")?;
write!(
js_stdin,
"globalThis.TREE_SITTER_CLI_VERSION_MAJOR = {};
globalThis.TREE_SITTER_CLI_VERSION_MINOR = {};
globalThis.TREE_SITTER_CLI_VERSION_PATCH = {};",
cli_version.major, cli_version.minor, cli_version.patch,
)
.with_context(|| format!("Failed to write tree-sitter version to {js_runtime}'s stdin"))?;
js_stdin
.write(include_bytes!("./dsl.js"))
.with_context(|| format!("Failed to write grammar dsl to {js_runtime}'s stdin"))?;
drop(js_stdin);
let output = js_process
.wait_with_output()
.with_context(|| format!("Failed to read output from {js_runtime}"))?;
match output.status.code() {
None => panic!("{js_runtime} process was killed"),
Some(0) => {
let stdout = String::from_utf8(output.stdout)
.with_context(|| format!("Got invalid UTF8 from {js_runtime}"))?;
let mut grammar_json = &stdout[..];
if let Some(pos) = stdout.rfind('\n') {
// If there's a newline, split the last line from the rest of the output
let node_output = &stdout[..pos];
grammar_json = &stdout[pos + 1..];
let mut stdout = std::io::stdout().lock();
stdout.write_all(node_output.as_bytes())?;
stdout.write_all(b"\n")?;
stdout.flush()?;
}
Ok(serde_json::to_string_pretty(
&serde_json::from_str::<serde_json::Value>(grammar_json)
.with_context(|| "Failed to parse grammar JSON")?,
)
.with_context(|| "Failed to serialize grammar JSON")?
+ "\n")
}
Some(code) => Err(anyhow!("{js_runtime} process exited with status {code}")),
}
}
pub fn write_file(path: &Path, body: impl AsRef<[u8]>) -> Result<()> {
fs::write(path, body)
.with_context(|| format!("Failed to write {:?}", path.file_name().unwrap()))
}

View file

@ -434,7 +434,6 @@ impl Nfa {
} }
pub fn last_state_id(&self) -> u32 { pub fn last_state_id(&self) -> u32 {
assert!(!self.states.is_empty());
self.states.len() as u32 - 1 self.states.len() as u32 - 1
} }
} }
@ -950,19 +949,20 @@ mod tests {
assert_eq!( assert_eq!(
left.remove_intersection(&mut right), left.remove_intersection(&mut right),
row.intersection, row.intersection,
"row {i}a: {:?} && {:?}", "row {}a: {:?} && {:?}",
i,
row.left, row.left,
row.right row.right
); );
assert_eq!( assert_eq!(
left, row.left_only, left, row.left_only,
"row {i}a: {:?} - {:?}", "row {}a: {:?} - {:?}",
row.left, row.right i, row.left, row.right
); );
assert_eq!( assert_eq!(
right, row.right_only, right, row.right_only,
"row {i}a: {:?} - {:?}", "row {}a: {:?} - {:?}",
row.right, row.left i, row.right, row.left
); );
let mut left = row.left.clone(); let mut left = row.left.clone();
@ -970,25 +970,27 @@ mod tests {
assert_eq!( assert_eq!(
right.remove_intersection(&mut left), right.remove_intersection(&mut left),
row.intersection, row.intersection,
"row {i}b: {:?} && {:?}", "row {}b: {:?} && {:?}",
i,
row.left, row.left,
row.right row.right
); );
assert_eq!( assert_eq!(
left, row.left_only, left, row.left_only,
"row {i}b: {:?} - {:?}", "row {}b: {:?} - {:?}",
row.left, row.right i, row.left, row.right
); );
assert_eq!( assert_eq!(
right, row.right_only, right, row.right_only,
"row {i}b: {:?} - {:?}", "row {}b: {:?} - {:?}",
row.right, row.left i, row.right, row.left
); );
assert_eq!( assert_eq!(
row.left.clone().difference(row.right.clone()), row.left.clone().difference(row.right.clone()),
row.left_only, row.left_only,
"row {i}b: {:?} -- {:?}", "row {}b: {:?} -- {:?}",
i,
row.left, row.left,
row.right row.right
); );

View file

@ -1,7 +1,10 @@
use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet}; use std::{
cmp::Ordering,
collections::{BTreeMap, HashMap, HashSet},
};
use anyhow::{anyhow, Result};
use serde::Serialize; use serde::Serialize;
use thiserror::Error;
use super::{ use super::{
grammars::{LexicalGrammar, SyntaxGrammar, VariableType}, grammars::{LexicalGrammar, SyntaxGrammar, VariableType},
@ -29,15 +32,12 @@ pub struct VariableInfo {
} }
#[derive(Debug, Serialize, PartialEq, Eq, Default, PartialOrd, Ord)] #[derive(Debug, Serialize, PartialEq, Eq, Default, PartialOrd, Ord)]
#[cfg(feature = "load")]
pub struct NodeInfoJSON { pub struct NodeInfoJSON {
#[serde(rename = "type")] #[serde(rename = "type")]
kind: String, kind: String,
named: bool, named: bool,
#[serde(skip_serializing_if = "std::ops::Not::not")] #[serde(skip_serializing_if = "std::ops::Not::not")]
root: bool, root: bool,
#[serde(skip_serializing_if = "std::ops::Not::not")]
extra: bool,
#[serde(skip_serializing_if = "Option::is_none")] #[serde(skip_serializing_if = "Option::is_none")]
fields: Option<BTreeMap<String, FieldInfoJSON>>, fields: Option<BTreeMap<String, FieldInfoJSON>>,
#[serde(skip_serializing_if = "Option::is_none")] #[serde(skip_serializing_if = "Option::is_none")]
@ -47,7 +47,6 @@ pub struct NodeInfoJSON {
} }
#[derive(Clone, Debug, Serialize, PartialEq, Eq, PartialOrd, Ord, Hash)] #[derive(Clone, Debug, Serialize, PartialEq, Eq, PartialOrd, Ord, Hash)]
#[cfg(feature = "load")]
pub struct NodeTypeJSON { pub struct NodeTypeJSON {
#[serde(rename = "type")] #[serde(rename = "type")]
kind: String, kind: String,
@ -55,7 +54,6 @@ pub struct NodeTypeJSON {
} }
#[derive(Debug, Serialize, PartialEq, Eq, PartialOrd, Ord)] #[derive(Debug, Serialize, PartialEq, Eq, PartialOrd, Ord)]
#[cfg(feature = "load")]
pub struct FieldInfoJSON { pub struct FieldInfoJSON {
multiple: bool, multiple: bool,
required: bool, required: bool,
@ -69,7 +67,6 @@ pub struct ChildQuantity {
multiple: bool, multiple: bool,
} }
#[cfg(feature = "load")]
impl Default for FieldInfoJSON { impl Default for FieldInfoJSON {
fn default() -> Self { fn default() -> Self {
Self { Self {
@ -105,7 +102,7 @@ impl ChildQuantity {
} }
} }
const fn append(&mut self, other: Self) { fn append(&mut self, other: Self) {
if other.exists { if other.exists {
if self.exists || other.multiple { if self.exists || other.multiple {
self.multiple = true; self.multiple = true;
@ -117,7 +114,7 @@ impl ChildQuantity {
} }
} }
const fn union(&mut self, other: Self) -> bool { fn union(&mut self, other: Self) -> bool {
let mut result = false; let mut result = false;
if !self.exists && other.exists { if !self.exists && other.exists {
result = true; result = true;
@ -135,14 +132,6 @@ impl ChildQuantity {
} }
} }
pub type VariableInfoResult<T> = Result<T, VariableInfoError>;
#[derive(Debug, Error, Serialize)]
pub enum VariableInfoError {
#[error("Grammar error: Supertype symbols must always have a single visible child, but `{0}` can have multiple")]
InvalidSupertype(String),
}
/// Compute a summary of the public-facing structure of each variable in the /// Compute a summary of the public-facing structure of each variable in the
/// grammar. Each variable in the grammar corresponds to a distinct public-facing /// grammar. Each variable in the grammar corresponds to a distinct public-facing
/// node type. /// node type.
@ -168,7 +157,7 @@ pub fn get_variable_info(
syntax_grammar: &SyntaxGrammar, syntax_grammar: &SyntaxGrammar,
lexical_grammar: &LexicalGrammar, lexical_grammar: &LexicalGrammar,
default_aliases: &AliasMap, default_aliases: &AliasMap,
) -> VariableInfoResult<Vec<VariableInfo>> { ) -> Result<Vec<VariableInfo>> {
let child_type_is_visible = |t: &ChildType| { let child_type_is_visible = |t: &ChildType| {
variable_type_for_child_type(t, syntax_grammar, lexical_grammar) >= VariableType::Anonymous variable_type_for_child_type(t, syntax_grammar, lexical_grammar) >= VariableType::Anonymous
}; };
@ -349,7 +338,13 @@ pub fn get_variable_info(
for supertype_symbol in &syntax_grammar.supertype_symbols { for supertype_symbol in &syntax_grammar.supertype_symbols {
if result[supertype_symbol.index].has_multi_step_production { if result[supertype_symbol.index].has_multi_step_production {
let variable = &syntax_grammar.variables[supertype_symbol.index]; let variable = &syntax_grammar.variables[supertype_symbol.index];
Err(VariableInfoError::InvalidSupertype(variable.name.clone()))?; return Err(anyhow!(
concat!(
"Grammar error: Supertype symbols must always ",
"have a single visible child, but `{}` can have multiple"
),
variable.name
));
} }
} }
@ -374,105 +369,12 @@ pub fn get_variable_info(
Ok(result) Ok(result)
} }
fn get_aliases_by_symbol(
syntax_grammar: &SyntaxGrammar,
default_aliases: &AliasMap,
) -> HashMap<Symbol, BTreeSet<Option<Alias>>> {
let mut aliases_by_symbol = HashMap::new();
for (symbol, alias) in default_aliases {
aliases_by_symbol.insert(*symbol, {
let mut aliases = BTreeSet::new();
aliases.insert(Some(alias.clone()));
aliases
});
}
for extra_symbol in &syntax_grammar.extra_symbols {
if !default_aliases.contains_key(extra_symbol) {
aliases_by_symbol
.entry(*extra_symbol)
.or_insert_with(BTreeSet::new)
.insert(None);
}
}
for variable in &syntax_grammar.variables {
for production in &variable.productions {
for step in &production.steps {
aliases_by_symbol
.entry(step.symbol)
.or_insert_with(BTreeSet::new)
.insert(
step.alias
.as_ref()
.or_else(|| default_aliases.get(&step.symbol))
.cloned(),
);
}
}
}
aliases_by_symbol.insert(
Symbol::non_terminal(0),
std::iter::once(&None).cloned().collect(),
);
aliases_by_symbol
}
pub fn get_supertype_symbol_map(
syntax_grammar: &SyntaxGrammar,
default_aliases: &AliasMap,
variable_info: &[VariableInfo],
) -> BTreeMap<Symbol, Vec<ChildType>> {
let aliases_by_symbol = get_aliases_by_symbol(syntax_grammar, default_aliases);
let mut supertype_symbol_map = BTreeMap::new();
let mut symbols_by_alias = HashMap::new();
for (symbol, aliases) in &aliases_by_symbol {
for alias in aliases.iter().flatten() {
symbols_by_alias
.entry(alias)
.or_insert_with(Vec::new)
.push(*symbol);
}
}
for (i, info) in variable_info.iter().enumerate() {
let symbol = Symbol::non_terminal(i);
if syntax_grammar.supertype_symbols.contains(&symbol) {
let subtypes = info.children.types.clone();
supertype_symbol_map.insert(symbol, subtypes);
}
}
supertype_symbol_map
}
#[cfg(feature = "load")]
pub type SuperTypeCycleResult<T> = Result<T, SuperTypeCycleError>;
#[derive(Debug, Error, Serialize)]
pub struct SuperTypeCycleError {
items: Vec<String>,
}
impl std::fmt::Display for SuperTypeCycleError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(f, "Dependency cycle detected in node types:")?;
for (i, item) in self.items.iter().enumerate() {
write!(f, " {item}")?;
if i < self.items.len() - 1 {
write!(f, ",")?;
}
}
Ok(())
}
}
#[cfg(feature = "load")]
pub fn generate_node_types_json( pub fn generate_node_types_json(
syntax_grammar: &SyntaxGrammar, syntax_grammar: &SyntaxGrammar,
lexical_grammar: &LexicalGrammar, lexical_grammar: &LexicalGrammar,
default_aliases: &AliasMap, default_aliases: &AliasMap,
variable_info: &[VariableInfo], variable_info: &[VariableInfo],
) -> SuperTypeCycleResult<Vec<NodeInfoJSON>> { ) -> Vec<NodeInfoJSON> {
let mut node_types_json = BTreeMap::new(); let mut node_types_json = BTreeMap::new();
let child_type_to_node_type = |child_type: &ChildType| match child_type { let child_type_to_node_type = |child_type: &ChildType| match child_type {
@ -528,32 +430,41 @@ pub fn generate_node_types_json(
} }
}; };
let aliases_by_symbol = get_aliases_by_symbol(syntax_grammar, default_aliases); let mut aliases_by_symbol = HashMap::new();
for (symbol, alias) in default_aliases {
let empty = BTreeSet::new(); aliases_by_symbol.insert(*symbol, {
let extra_names = syntax_grammar let mut aliases = HashSet::new();
.extra_symbols aliases.insert(Some(alias.clone()));
.iter() aliases
.flat_map(|symbol| { });
}
for extra_symbol in &syntax_grammar.extra_symbols {
if !default_aliases.contains_key(extra_symbol) {
aliases_by_symbol aliases_by_symbol
.get(symbol) .entry(*extra_symbol)
.unwrap_or(&empty) .or_insert_with(HashSet::new)
.iter() .insert(None);
.map(|alias| { }
alias.as_ref().map_or( }
match symbol.kind { for variable in &syntax_grammar.variables {
SymbolType::NonTerminal => &syntax_grammar.variables[symbol.index].name, for production in &variable.productions {
SymbolType::Terminal => &lexical_grammar.variables[symbol.index].name, for step in &production.steps {
SymbolType::External => { aliases_by_symbol
&syntax_grammar.external_tokens[symbol.index].name .entry(step.symbol)
} .or_insert_with(HashSet::new)
_ => unreachable!(), .insert(
}, step.alias
|alias| &alias.value, .as_ref()
) .or_else(|| default_aliases.get(&step.symbol))
}) .cloned(),
}) );
.collect::<HashSet<_>>(); }
}
}
aliases_by_symbol.insert(
Symbol::non_terminal(0),
std::iter::once(&None).cloned().collect(),
);
let mut subtype_map = Vec::new(); let mut subtype_map = Vec::new();
for (i, info) in variable_info.iter().enumerate() { for (i, info) in variable_info.iter().enumerate() {
@ -567,7 +478,6 @@ pub fn generate_node_types_json(
kind: variable.name.clone(), kind: variable.name.clone(),
named: true, named: true,
root: false, root: false,
extra: extra_names.contains(&variable.name),
fields: None, fields: None,
children: None, children: None,
subtypes: None, subtypes: None,
@ -589,7 +499,7 @@ pub fn generate_node_types_json(
} else if !syntax_grammar.variables_to_inline.contains(&symbol) { } else if !syntax_grammar.variables_to_inline.contains(&symbol) {
// If a rule is aliased under multiple names, then its information // If a rule is aliased under multiple names, then its information
// contributes to multiple entries in the final JSON. // contributes to multiple entries in the final JSON.
for alias in aliases_by_symbol.get(&symbol).unwrap_or(&BTreeSet::new()) { for alias in aliases_by_symbol.get(&symbol).unwrap_or(&HashSet::new()) {
let kind; let kind;
let is_named; let is_named;
if let Some(alias) = alias { if let Some(alias) = alias {
@ -611,7 +521,6 @@ pub fn generate_node_types_json(
kind: kind.clone(), kind: kind.clone(),
named: is_named, named: is_named,
root: i == 0, root: i == 0,
extra: extra_names.contains(&kind),
fields: Some(BTreeMap::new()), fields: Some(BTreeMap::new()),
children: None, children: None,
subtypes: None, subtypes: None,
@ -650,33 +559,15 @@ pub fn generate_node_types_json(
} }
} }
// Sort the subtype map topologically so that subtypes are listed before their supertypes. // Sort the subtype map so that subtypes are listed before their supertypes.
let mut sorted_kinds = Vec::with_capacity(subtype_map.len());
let mut top_sort = topological_sort::TopologicalSort::<String>::new();
for (supertype, subtypes) in &subtype_map {
for subtype in subtypes {
top_sort.add_dependency(subtype.kind.clone(), supertype.kind.clone());
}
}
loop {
let mut next_kinds = top_sort.pop_all();
match (next_kinds.is_empty(), top_sort.is_empty()) {
(true, true) => break,
(true, false) => {
let mut items = top_sort.collect::<Vec<String>>();
items.sort();
return Err(SuperTypeCycleError { items });
}
(false, _) => {
next_kinds.sort();
sorted_kinds.extend(next_kinds);
}
}
}
subtype_map.sort_by(|a, b| { subtype_map.sort_by(|a, b| {
let a_idx = sorted_kinds.iter().position(|n| n.eq(&a.0.kind)).unwrap(); if b.1.contains(&a.0) {
let b_idx = sorted_kinds.iter().position(|n| n.eq(&b.0.kind)).unwrap(); Ordering::Less
a_idx.cmp(&b_idx) } else if a.1.contains(&b.0) {
Ordering::Greater
} else {
Ordering::Equal
}
}); });
for node_type_json in node_types_json.values_mut() { for node_type_json in node_types_json.values_mut() {
@ -700,6 +591,7 @@ pub fn generate_node_types_json(
let mut anonymous_node_types = Vec::new(); let mut anonymous_node_types = Vec::new();
let empty = HashSet::new();
let regular_tokens = lexical_grammar let regular_tokens = lexical_grammar
.variables .variables
.iter() .iter()
@ -744,7 +636,6 @@ pub fn generate_node_types_json(
kind: name.clone(), kind: name.clone(),
named: true, named: true,
root: false, root: false,
extra: extra_names.contains(&name),
fields: None, fields: None,
children: None, children: None,
subtypes: None, subtypes: None,
@ -762,7 +653,6 @@ pub fn generate_node_types_json(
kind: name.clone(), kind: name.clone(),
named: false, named: false,
root: false, root: false,
extra: extra_names.contains(&name),
fields: None, fields: None,
children: None, children: None,
subtypes: None, subtypes: None,
@ -783,15 +673,11 @@ pub fn generate_node_types_json(
a_is_leaf.cmp(&b_is_leaf) a_is_leaf.cmp(&b_is_leaf)
}) })
.then_with(|| a.kind.cmp(&b.kind)) .then_with(|| a.kind.cmp(&b.kind))
.then_with(|| a.named.cmp(&b.named))
.then_with(|| a.root.cmp(&b.root))
.then_with(|| a.extra.cmp(&b.extra))
}); });
result.dedup(); result.dedup();
Ok(result) result
} }
#[cfg(feature = "load")]
fn process_supertypes(info: &mut FieldInfoJSON, subtype_map: &[(NodeTypeJSON, Vec<NodeTypeJSON>)]) { fn process_supertypes(info: &mut FieldInfoJSON, subtype_map: &[(NodeTypeJSON, Vec<NodeTypeJSON>)]) {
for (supertype, subtypes) in subtype_map { for (supertype, subtypes) in subtype_map {
if info.types.contains(supertype) { if info.types.contains(supertype) {
@ -828,17 +714,17 @@ fn extend_sorted<'a, T>(vec: &mut Vec<T>, values: impl IntoIterator<Item = &'a T
where where
T: 'a + Clone + Eq + Ord, T: 'a + Clone + Eq + Ord,
{ {
values.into_iter().fold(false, |acc, value| { values.into_iter().any(|value| {
if let Err(i) = vec.binary_search(value) { if let Err(i) = vec.binary_search(value) {
vec.insert(i, value.clone()); vec.insert(i, value.clone());
true true
} else { } else {
acc false
} }
}) })
} }
#[cfg(all(test, feature = "load"))] #[cfg(test)]
mod tests { mod tests {
use super::*; use super::*;
use crate::{ use crate::{
@ -875,8 +761,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!(node_types.len(), 3); assert_eq!(node_types.len(), 3);
@ -886,7 +771,6 @@ mod tests {
kind: "v1".to_string(), kind: "v1".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: Some( fields: Some(
@ -925,7 +809,6 @@ mod tests {
kind: ";".to_string(), kind: ";".to_string(),
named: false, named: false,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None fields: None
@ -937,7 +820,6 @@ mod tests {
kind: "v2".to_string(), kind: "v2".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None fields: None
@ -965,9 +847,7 @@ mod tests {
}, },
// This rule is not reachable from the start symbol, but // This rule is not reachable from the start symbol, but
// it is reachable from the 'extra_symbols' so it // it is reachable from the 'extra_symbols' so it
// should be present in the node_types. // should be present in the node_types
// But because it's only a literal, it will get replaced by
// a lexical variable.
Variable { Variable {
name: "v3".to_string(), name: "v3".to_string(),
kind: VariableType::Named, kind: VariableType::Named,
@ -975,8 +855,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!(node_types.len(), 4); assert_eq!(node_types.len(), 4);
@ -986,7 +865,6 @@ mod tests {
kind: "v1".to_string(), kind: "v1".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: Some( fields: Some(
@ -1025,7 +903,6 @@ mod tests {
kind: ";".to_string(), kind: ";".to_string(),
named: false, named: false,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None fields: None
@ -1037,7 +914,6 @@ mod tests {
kind: "v2".to_string(), kind: "v2".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None fields: None
@ -1049,119 +925,6 @@ mod tests {
kind: "v3".to_string(), kind: "v3".to_string(),
named: true, named: true,
root: false, root: false,
extra: true,
subtypes: None,
children: None,
fields: None
}
);
}
#[test]
fn test_node_types_deeper_extras() {
let node_types = get_node_types(&InputGrammar {
extra_symbols: vec![Rule::named("v3")],
variables: vec![
Variable {
name: "v1".to_string(),
kind: VariableType::Named,
rule: Rule::seq(vec![
Rule::field("f1".to_string(), Rule::named("v2")),
Rule::field("f2".to_string(), Rule::string(";")),
]),
},
Variable {
name: "v2".to_string(),
kind: VariableType::Named,
rule: Rule::string("x"),
},
// This rule is not reachable from the start symbol, but
// it is reachable from the 'extra_symbols' so it
// should be present in the node_types.
// Because it is not just a literal, it won't get replaced
// by a lexical variable.
Variable {
name: "v3".to_string(),
kind: VariableType::Named,
rule: Rule::seq(vec![Rule::string("y"), Rule::repeat(Rule::string("z"))]),
},
],
..Default::default()
})
.unwrap();
assert_eq!(node_types.len(), 6);
assert_eq!(
node_types[0],
NodeInfoJSON {
kind: "v1".to_string(),
named: true,
root: true,
extra: false,
subtypes: None,
children: None,
fields: Some(
vec![
(
"f1".to_string(),
FieldInfoJSON {
multiple: false,
required: true,
types: vec![NodeTypeJSON {
kind: "v2".to_string(),
named: true,
}]
}
),
(
"f2".to_string(),
FieldInfoJSON {
multiple: false,
required: true,
types: vec![NodeTypeJSON {
kind: ";".to_string(),
named: false,
}]
}
),
]
.into_iter()
.collect()
)
}
);
assert_eq!(
node_types[1],
NodeInfoJSON {
kind: "v3".to_string(),
named: true,
root: false,
extra: true,
subtypes: None,
children: None,
fields: Some(BTreeMap::default())
}
);
assert_eq!(
node_types[2],
NodeInfoJSON {
kind: ";".to_string(),
named: false,
root: false,
extra: false,
subtypes: None,
children: None,
fields: None
}
);
assert_eq!(
node_types[3],
NodeInfoJSON {
kind: "v2".to_string(),
named: true,
root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None fields: None
@ -1200,8 +963,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
node_types[0], node_types[0],
@ -1209,7 +971,6 @@ mod tests {
kind: "_v2".to_string(), kind: "_v2".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
fields: None, fields: None,
children: None, children: None,
subtypes: Some(vec![ subtypes: Some(vec![
@ -1234,7 +995,6 @@ mod tests {
kind: "v1".to_string(), kind: "v1".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: Some( fields: Some(
@ -1290,8 +1050,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
node_types[0], node_types[0],
@ -1299,7 +1058,6 @@ mod tests {
kind: "v1".to_string(), kind: "v1".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
children: Some(FieldInfoJSON { children: Some(FieldInfoJSON {
multiple: true, multiple: true,
@ -1338,7 +1096,6 @@ mod tests {
kind: "v2".to_string(), kind: "v2".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: Some(FieldInfoJSON { children: Some(FieldInfoJSON {
multiple: false, multiple: false,
@ -1376,8 +1133,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
node_types[0], node_types[0],
@ -1385,7 +1141,6 @@ mod tests {
kind: "v1".to_string(), kind: "v1".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
children: Some(FieldInfoJSON { children: Some(FieldInfoJSON {
multiple: true, multiple: true,
@ -1451,8 +1206,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!(node_types.iter().find(|t| t.kind == "foo_identifier"), None); assert_eq!(node_types.iter().find(|t| t.kind == "foo_identifier"), None);
assert_eq!( assert_eq!(
@ -1461,7 +1215,6 @@ mod tests {
kind: "identifier".to_string(), kind: "identifier".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None, fields: None,
@ -1473,7 +1226,6 @@ mod tests {
kind: "type_identifier".to_string(), kind: "type_identifier".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: None, fields: None,
@ -1508,8 +1260,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
node_types[0], node_types[0],
@ -1517,7 +1268,6 @@ mod tests {
kind: "a".to_string(), kind: "a".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
children: Some(FieldInfoJSON { children: Some(FieldInfoJSON {
multiple: true, multiple: true,
@ -1558,8 +1308,7 @@ mod tests {
]), ]),
}], }],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
node_types, node_types,
@ -1567,7 +1316,6 @@ mod tests {
kind: "script".to_string(), kind: "script".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
fields: Some(BTreeMap::new()), fields: Some(BTreeMap::new()),
children: None, children: None,
subtypes: None subtypes: None
@ -1607,8 +1355,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
&node_types &node_types
@ -1626,7 +1373,6 @@ mod tests {
kind: "a".to_string(), kind: "a".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: None, children: None,
fields: Some( fields: Some(
@ -1683,7 +1429,6 @@ mod tests {
kind: "script".to_string(), kind: "script".to_string(),
named: true, named: true,
root: true, root: true,
extra: false,
subtypes: None, subtypes: None,
// Only one node // Only one node
children: Some(FieldInfoJSON { children: Some(FieldInfoJSON {
@ -1727,8 +1472,7 @@ mod tests {
}, },
], ],
..Default::default() ..Default::default()
}) });
.unwrap();
assert_eq!( assert_eq!(
node_types.iter().map(|n| &n.kind).collect::<Vec<_>>(), node_types.iter().map(|n| &n.kind).collect::<Vec<_>>(),
@ -1740,7 +1484,6 @@ mod tests {
kind: "b".to_string(), kind: "b".to_string(),
named: true, named: true,
root: false, root: false,
extra: false,
subtypes: None, subtypes: None,
children: Some(FieldInfoJSON { children: Some(FieldInfoJSON {
multiple: true, multiple: true,
@ -2055,7 +1798,7 @@ mod tests {
); );
} }
fn get_node_types(grammar: &InputGrammar) -> SuperTypeCycleResult<Vec<NodeInfoJSON>> { fn get_node_types(grammar: &InputGrammar) -> Vec<NodeInfoJSON> {
let (syntax_grammar, lexical_grammar, _, default_aliases) = let (syntax_grammar, lexical_grammar, _, default_aliases) =
prepare_grammar(grammar).unwrap(); prepare_grammar(grammar).unwrap();
let variable_info = let variable_info =

View file

@ -0,0 +1,343 @@
use std::collections::HashSet;
use anyhow::{anyhow, Result};
use serde::Deserialize;
use serde_json::{Map, Value};
use super::{
grammars::{InputGrammar, PrecedenceEntry, Variable, VariableType},
rules::{Precedence, Rule},
};
#[derive(Deserialize)]
#[serde(tag = "type")]
#[allow(non_camel_case_types)]
#[allow(clippy::upper_case_acronyms)]
enum RuleJSON {
ALIAS {
content: Box<RuleJSON>,
named: bool,
value: String,
},
BLANK,
STRING {
value: String,
},
PATTERN {
value: String,
flags: Option<String>,
},
SYMBOL {
name: String,
},
CHOICE {
members: Vec<RuleJSON>,
},
FIELD {
name: String,
content: Box<RuleJSON>,
},
SEQ {
members: Vec<RuleJSON>,
},
REPEAT {
content: Box<RuleJSON>,
},
REPEAT1 {
content: Box<RuleJSON>,
},
PREC_DYNAMIC {
value: i32,
content: Box<RuleJSON>,
},
PREC_LEFT {
value: PrecedenceValueJSON,
content: Box<RuleJSON>,
},
PREC_RIGHT {
value: PrecedenceValueJSON,
content: Box<RuleJSON>,
},
PREC {
value: PrecedenceValueJSON,
content: Box<RuleJSON>,
},
TOKEN {
content: Box<RuleJSON>,
},
IMMEDIATE_TOKEN {
content: Box<RuleJSON>,
},
}
#[derive(Deserialize)]
#[serde(untagged)]
enum PrecedenceValueJSON {
Integer(i32),
Name(String),
}
#[derive(Deserialize)]
pub struct GrammarJSON {
pub name: String,
rules: Map<String, Value>,
#[serde(default)]
precedences: Vec<Vec<RuleJSON>>,
#[serde(default)]
conflicts: Vec<Vec<String>>,
#[serde(default)]
externals: Vec<RuleJSON>,
#[serde(default)]
extras: Vec<RuleJSON>,
#[serde(default)]
inline: Vec<String>,
#[serde(default)]
supertypes: Vec<String>,
word: Option<String>,
}
fn rule_is_referenced(rule: &Rule, target: &str) -> bool {
match rule {
Rule::NamedSymbol(name) => name == target,
Rule::Choice(rules) | Rule::Seq(rules) => {
rules.iter().any(|r| rule_is_referenced(r, target))
}
Rule::Metadata { rule, .. } => rule_is_referenced(rule, target),
Rule::Repeat(inner) => rule_is_referenced(inner, target),
Rule::Blank | Rule::String(_) | Rule::Pattern(_, _) | Rule::Symbol(_) => false,
}
}
fn variable_is_used(
grammar_rules: &[(String, Rule)],
other_rules: (&[Rule], &[Rule]),
target_name: &str,
in_progress: &mut HashSet<String>,
) -> bool {
let root = &grammar_rules.first().unwrap().0;
if target_name == root {
return true;
}
if other_rules
.0
.iter()
.chain(other_rules.1.iter())
.any(|rule| rule_is_referenced(rule, target_name))
{
return true;
}
in_progress.insert(target_name.to_string());
let result = grammar_rules
.iter()
.filter(|(key, _)| *key != target_name)
.any(|(name, rule)| {
if !rule_is_referenced(rule, target_name) || in_progress.contains(name) {
return false;
}
variable_is_used(grammar_rules, other_rules, name, in_progress)
});
in_progress.remove(target_name);
result
}
pub(crate) fn parse_grammar(input: &str) -> Result<InputGrammar> {
let mut grammar_json = serde_json::from_str::<GrammarJSON>(input)?;
let mut extra_symbols =
grammar_json
.extras
.into_iter()
.try_fold(Vec::new(), |mut acc, item| {
let rule = parse_rule(item);
if let Rule::String(ref value) = rule {
if value.is_empty() {
return Err(anyhow!(
"Rules in the `extras` array must not contain empty strings"
));
}
}
acc.push(rule);
Ok(acc)
})?;
let mut external_tokens = grammar_json
.externals
.into_iter()
.map(parse_rule)
.collect::<Vec<_>>();
let mut precedence_orderings = Vec::with_capacity(grammar_json.precedences.len());
for list in grammar_json.precedences {
let mut ordering = Vec::with_capacity(list.len());
for entry in list {
ordering.push(match entry {
RuleJSON::STRING { value } => PrecedenceEntry::Name(value),
RuleJSON::SYMBOL { name } => PrecedenceEntry::Symbol(name),
_ => {
return Err(anyhow!(
"Invalid rule in precedences array. Only strings and symbols are allowed"
))
}
});
}
precedence_orderings.push(ordering);
}
let mut variables = Vec::with_capacity(grammar_json.rules.len());
let rules = grammar_json
.rules
.into_iter()
.map(|(n, r)| Ok((n, parse_rule(serde_json::from_value(r)?))))
.collect::<Result<Vec<_>>>()?;
let mut in_progress = HashSet::new();
for (name, rule) in &rules {
if !variable_is_used(
&rules,
(&extra_symbols, &external_tokens),
name,
&mut in_progress,
) && grammar_json.word.as_ref().is_some_and(|w| w != name)
{
grammar_json.conflicts.retain(|r| !r.contains(name));
grammar_json.supertypes.retain(|r| r != name);
grammar_json.inline.retain(|r| r != name);
extra_symbols.retain(|r| !rule_is_referenced(r, name));
external_tokens.retain(|r| !rule_is_referenced(r, name));
precedence_orderings.retain(|r| {
!r.iter().any(|e| {
let PrecedenceEntry::Symbol(s) = e else {
return false;
};
s == name
})
});
continue;
}
variables.push(Variable {
name: name.clone(),
kind: VariableType::Named,
rule: rule.clone(),
});
}
Ok(InputGrammar {
name: grammar_json.name,
word_token: grammar_json.word,
expected_conflicts: grammar_json.conflicts,
supertype_symbols: grammar_json.supertypes,
variables_to_inline: grammar_json.inline,
precedence_orderings,
variables,
extra_symbols,
external_tokens,
})
}
fn parse_rule(json: RuleJSON) -> Rule {
match json {
RuleJSON::ALIAS {
content,
value,
named,
} => Rule::alias(parse_rule(*content), value, named),
RuleJSON::BLANK => Rule::Blank,
RuleJSON::STRING { value } => Rule::String(value),
RuleJSON::PATTERN { value, flags } => Rule::Pattern(
value,
flags.map_or(String::new(), |f| {
f.matches(|c| {
if c == 'i' {
true
} else {
// silently ignore unicode flags
if c != 'u' && c != 'v' {
eprintln!("Warning: unsupported flag {c}");
}
false
}
})
.collect()
}),
),
RuleJSON::SYMBOL { name } => Rule::NamedSymbol(name),
RuleJSON::CHOICE { members } => Rule::choice(members.into_iter().map(parse_rule).collect()),
RuleJSON::FIELD { content, name } => Rule::field(name, parse_rule(*content)),
RuleJSON::SEQ { members } => Rule::seq(members.into_iter().map(parse_rule).collect()),
RuleJSON::REPEAT1 { content } => Rule::repeat(parse_rule(*content)),
RuleJSON::REPEAT { content } => {
Rule::choice(vec![Rule::repeat(parse_rule(*content)), Rule::Blank])
}
RuleJSON::PREC { value, content } => Rule::prec(value.into(), parse_rule(*content)),
RuleJSON::PREC_LEFT { value, content } => {
Rule::prec_left(value.into(), parse_rule(*content))
}
RuleJSON::PREC_RIGHT { value, content } => {
Rule::prec_right(value.into(), parse_rule(*content))
}
RuleJSON::PREC_DYNAMIC { value, content } => {
Rule::prec_dynamic(value, parse_rule(*content))
}
RuleJSON::TOKEN { content } => Rule::token(parse_rule(*content)),
RuleJSON::IMMEDIATE_TOKEN { content } => Rule::immediate_token(parse_rule(*content)),
}
}
impl From<PrecedenceValueJSON> for Precedence {
fn from(val: PrecedenceValueJSON) -> Self {
match val {
PrecedenceValueJSON::Integer(i) => Self::Integer(i),
PrecedenceValueJSON::Name(i) => Self::Name(i),
}
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_parse_grammar() {
let grammar = parse_grammar(
r#"{
"name": "my_lang",
"rules": {
"file": {
"type": "REPEAT1",
"content": {
"type": "SYMBOL",
"name": "statement"
}
},
"statement": {
"type": "STRING",
"value": "foo"
}
}
}"#,
)
.unwrap();
assert_eq!(grammar.name, "my_lang");
assert_eq!(
grammar.variables,
vec![
Variable {
name: "file".to_string(),
kind: VariableType::Named,
rule: Rule::repeat(Rule::NamedSymbol("statement".to_string()))
},
Variable {
name: "statement".to_string(),
kind: VariableType::Named,
rule: Rule::String("foo".to_string())
},
]
);
}
}

View file

@ -1,9 +1,9 @@
use anyhow::{anyhow, Context, Result};
use indoc::indoc;
use regex_syntax::{ use regex_syntax::{
hir::{Class, Hir, HirKind}, hir::{Class, Hir, HirKind},
ParserBuilder, ParserBuilder,
}; };
use serde::Serialize;
use thiserror::Error;
use super::ExtractedLexicalGrammar; use super::ExtractedLexicalGrammar;
use crate::{ use crate::{
@ -18,40 +18,6 @@ struct NfaBuilder {
precedence_stack: Vec<i32>, precedence_stack: Vec<i32>,
} }
pub type ExpandTokensResult<T> = Result<T, ExpandTokensError>;
#[derive(Debug, Error, Serialize)]
pub enum ExpandTokensError {
#[error(
"The rule `{0}` matches the empty string.
Tree-sitter does not support syntactic rules that match the empty string
unless they are used only as the grammar's start rule.
"
)]
EmptyString(String),
#[error(transparent)]
Processing(ExpandTokensProcessingError),
#[error(transparent)]
ExpandRule(ExpandRuleError),
}
#[derive(Debug, Error, Serialize)]
pub struct ExpandTokensProcessingError {
rule: String,
error: ExpandRuleError,
}
impl std::fmt::Display for ExpandTokensProcessingError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
writeln!(
f,
"Error processing rule {}: Grammar error: Unexpected rule {:?}",
self.rule, self.error
)?;
Ok(())
}
}
fn get_implicit_precedence(rule: &Rule) -> i32 { fn get_implicit_precedence(rule: &Rule) -> i32 {
match rule { match rule {
Rule::String(_) => 2, Rule::String(_) => 2,
@ -75,7 +41,7 @@ const fn get_completion_precedence(rule: &Rule) -> i32 {
0 0
} }
pub fn expand_tokens(mut grammar: ExtractedLexicalGrammar) -> ExpandTokensResult<LexicalGrammar> { pub fn expand_tokens(mut grammar: ExtractedLexicalGrammar) -> Result<LexicalGrammar> {
let mut builder = NfaBuilder { let mut builder = NfaBuilder {
nfa: Nfa::new(), nfa: Nfa::new(),
is_sep: true, is_sep: true,
@ -89,10 +55,17 @@ pub fn expand_tokens(mut grammar: ExtractedLexicalGrammar) -> ExpandTokensResult
Rule::repeat(Rule::choice(grammar.separators)) Rule::repeat(Rule::choice(grammar.separators))
}; };
let mut variables = Vec::with_capacity(grammar.variables.len()); let mut variables = Vec::new();
for (i, variable) in grammar.variables.into_iter().enumerate() { for (i, variable) in grammar.variables.into_iter().enumerate() {
if variable.rule.is_empty() { if variable.rule.is_empty() {
Err(ExpandTokensError::EmptyString(variable.name.clone()))?; return Err(anyhow!(
indoc! {"
The rule `{}` matches the empty string.
Tree-sitter does not support syntactic rules that match the empty string
unless they are used only as the grammar's start rule.
"},
variable.name
));
} }
let is_immediate_token = match &variable.rule { let is_immediate_token = match &variable.rule {
@ -108,19 +81,12 @@ pub fn expand_tokens(mut grammar: ExtractedLexicalGrammar) -> ExpandTokensResult
let last_state_id = builder.nfa.last_state_id(); let last_state_id = builder.nfa.last_state_id();
builder builder
.expand_rule(&variable.rule, last_state_id) .expand_rule(&variable.rule, last_state_id)
.map_err(|e| { .with_context(|| format!("Error processing rule {}", variable.name))?;
ExpandTokensError::Processing(ExpandTokensProcessingError {
rule: variable.name.clone(),
error: e,
})
})?;
if !is_immediate_token { if !is_immediate_token {
builder.is_sep = true; builder.is_sep = true;
let last_state_id = builder.nfa.last_state_id(); let last_state_id = builder.nfa.last_state_id();
builder builder.expand_rule(&separator_rule, last_state_id)?;
.expand_rule(&separator_rule, last_state_id)
.map_err(ExpandTokensError::ExpandRule)?;
} }
variables.push(LexicalVariable { variables.push(LexicalVariable {
@ -137,30 +103,8 @@ pub fn expand_tokens(mut grammar: ExtractedLexicalGrammar) -> ExpandTokensResult
}) })
} }
pub type ExpandRuleResult<T> = Result<T, ExpandRuleError>;
#[derive(Debug, Error, Serialize)]
pub enum ExpandRuleError {
#[error("Grammar error: Unexpected rule {0:?}")]
UnexpectedRule(Rule),
#[error("{0}")]
Parse(String),
#[error(transparent)]
ExpandRegex(ExpandRegexError),
}
pub type ExpandRegexResult<T> = Result<T, ExpandRegexError>;
#[derive(Debug, Error, Serialize)]
pub enum ExpandRegexError {
#[error("{0}")]
Utf8(String),
#[error("Regex error: Assertions are not supported")]
Assertion,
}
impl NfaBuilder { impl NfaBuilder {
fn expand_rule(&mut self, rule: &Rule, mut next_state_id: u32) -> ExpandRuleResult<bool> { fn expand_rule(&mut self, rule: &Rule, mut next_state_id: u32) -> Result<bool> {
match rule { match rule {
Rule::Pattern(s, f) => { Rule::Pattern(s, f) => {
// With unicode enabled, `\w`, `\s` and `\d` expand to character sets that are much // With unicode enabled, `\w`, `\s` and `\d` expand to character sets that are much
@ -180,21 +124,18 @@ impl NfaBuilder {
.unicode(true) .unicode(true)
.utf8(false) .utf8(false)
.build(); .build();
let hir = parser let hir = parser.parse(&s)?;
.parse(&s)
.map_err(|e| ExpandRuleError::Parse(e.to_string()))?;
self.expand_regex(&hir, next_state_id) self.expand_regex(&hir, next_state_id)
.map_err(ExpandRuleError::ExpandRegex)
} }
Rule::String(s) => { Rule::String(s) => {
for c in s.chars().rev() { for c in s.chars().rev() {
self.push_advance(CharacterSet::from_char(c), next_state_id); self.push_advance(CharacterSet::empty().add_char(c), next_state_id);
next_state_id = self.nfa.last_state_id(); next_state_id = self.nfa.last_state_id();
} }
Ok(!s.is_empty()) Ok(!s.is_empty())
} }
Rule::Choice(elements) => { Rule::Choice(elements) => {
let mut alternative_state_ids = Vec::with_capacity(elements.len()); let mut alternative_state_ids = Vec::new();
for element in elements { for element in elements {
if self.expand_rule(element, next_state_id)? { if self.expand_rule(element, next_state_id)? {
alternative_state_ids.push(self.nfa.last_state_id()); alternative_state_ids.push(self.nfa.last_state_id());
@ -248,19 +189,15 @@ impl NfaBuilder {
result result
} }
Rule::Blank => Ok(false), Rule::Blank => Ok(false),
_ => Err(ExpandRuleError::UnexpectedRule(rule.clone()))?, _ => Err(anyhow!("Grammar error: Unexpected rule {rule:?}")),
} }
} }
fn expand_regex(&mut self, hir: &Hir, mut next_state_id: u32) -> ExpandRegexResult<bool> { fn expand_regex(&mut self, hir: &Hir, mut next_state_id: u32) -> Result<bool> {
match hir.kind() { match hir.kind() {
HirKind::Empty => Ok(false), HirKind::Empty => Ok(false),
HirKind::Literal(literal) => { HirKind::Literal(literal) => {
for character in std::str::from_utf8(&literal.0) for character in std::str::from_utf8(&literal.0)?.chars().rev() {
.map_err(|e| ExpandRegexError::Utf8(e.to_string()))?
.chars()
.rev()
{
let char_set = CharacterSet::from_char(character); let char_set = CharacterSet::from_char(character);
self.push_advance(char_set, next_state_id); self.push_advance(char_set, next_state_id);
next_state_id = self.nfa.last_state_id(); next_state_id = self.nfa.last_state_id();
@ -297,7 +234,7 @@ impl NfaBuilder {
Ok(true) Ok(true)
} }
}, },
HirKind::Look(_) => Err(ExpandRegexError::Assertion)?, HirKind::Look(_) => Err(anyhow!("Regex error: Assertions are not supported")),
HirKind::Repetition(repetition) => match (repetition.min, repetition.max) { HirKind::Repetition(repetition) => match (repetition.min, repetition.max) {
(0, Some(1)) => self.expand_zero_or_one(&repetition.sub, next_state_id), (0, Some(1)) => self.expand_zero_or_one(&repetition.sub, next_state_id),
(1, None) => self.expand_one_or_more(&repetition.sub, next_state_id), (1, None) => self.expand_one_or_more(&repetition.sub, next_state_id),
@ -337,7 +274,7 @@ impl NfaBuilder {
Ok(result) Ok(result)
} }
HirKind::Alternation(alternations) => { HirKind::Alternation(alternations) => {
let mut alternative_state_ids = Vec::with_capacity(alternations.len()); let mut alternative_state_ids = Vec::new();
for hir in alternations { for hir in alternations {
if self.expand_regex(hir, next_state_id)? { if self.expand_regex(hir, next_state_id)? {
alternative_state_ids.push(self.nfa.last_state_id()); alternative_state_ids.push(self.nfa.last_state_id());
@ -356,7 +293,7 @@ impl NfaBuilder {
} }
} }
fn expand_one_or_more(&mut self, hir: &Hir, next_state_id: u32) -> ExpandRegexResult<bool> { fn expand_one_or_more(&mut self, hir: &Hir, next_state_id: u32) -> Result<bool> {
self.nfa.states.push(NfaState::Accept { self.nfa.states.push(NfaState::Accept {
variable_index: 0, variable_index: 0,
precedence: 0, precedence: 0,
@ -372,7 +309,7 @@ impl NfaBuilder {
} }
} }
fn expand_zero_or_one(&mut self, hir: &Hir, next_state_id: u32) -> ExpandRegexResult<bool> { fn expand_zero_or_one(&mut self, hir: &Hir, next_state_id: u32) -> Result<bool> {
if self.expand_regex(hir, next_state_id)? { if self.expand_regex(hir, next_state_id)? {
self.push_split(next_state_id); self.push_split(next_state_id);
Ok(true) Ok(true)
@ -381,7 +318,7 @@ impl NfaBuilder {
} }
} }
fn expand_zero_or_more(&mut self, hir: &Hir, next_state_id: u32) -> ExpandRegexResult<bool> { fn expand_zero_or_more(&mut self, hir: &Hir, next_state_id: u32) -> Result<bool> {
if self.expand_one_or_more(hir, next_state_id)? { if self.expand_one_or_more(hir, next_state_id)? {
self.push_split(next_state_id); self.push_split(next_state_id);
Ok(true) Ok(true)
@ -390,12 +327,7 @@ impl NfaBuilder {
} }
} }
fn expand_count( fn expand_count(&mut self, hir: &Hir, count: u32, mut next_state_id: u32) -> Result<bool> {
&mut self,
hir: &Hir,
count: u32,
mut next_state_id: u32,
) -> ExpandRegexResult<bool> {
let mut result = false; let mut result = false;
for _ in 0..count { for _ in 0..count {
if self.expand_regex(hir, next_state_id)? { if self.expand_regex(hir, next_state_id)? {

View file

@ -69,7 +69,9 @@ pub(super) fn extract_default_aliases(
SymbolType::External => &mut external_status_list[symbol.index], SymbolType::External => &mut external_status_list[symbol.index],
SymbolType::NonTerminal => &mut non_terminal_status_list[symbol.index], SymbolType::NonTerminal => &mut non_terminal_status_list[symbol.index],
SymbolType::Terminal => &mut terminal_status_list[symbol.index], SymbolType::Terminal => &mut terminal_status_list[symbol.index],
SymbolType::End | SymbolType::EndOfNonTerminalExtra => panic!("Unexpected end token"), SymbolType::End | SymbolType::EndOfNonTerminalExtra => {
panic!("Unexpected end token")
}
}; };
status.appears_unaliased = true; status.appears_unaliased = true;
} }

View file

@ -1,63 +1,16 @@
use std::collections::HashMap; use std::{collections::HashMap, mem};
use serde::Serialize; use anyhow::{anyhow, Result};
use thiserror::Error;
use super::{ExtractedLexicalGrammar, ExtractedSyntaxGrammar, InternedGrammar}; use super::{ExtractedLexicalGrammar, ExtractedSyntaxGrammar, InternedGrammar};
use crate::{ use crate::{
grammars::{ExternalToken, ReservedWordContext, Variable, VariableType}, grammars::{ExternalToken, Variable, VariableType},
rules::{MetadataParams, Rule, Symbol, SymbolType}, rules::{MetadataParams, Rule, Symbol, SymbolType},
}; };
pub type ExtractTokensResult<T> = Result<T, ExtractTokensError>;
#[derive(Debug, Error, Serialize)]
pub enum ExtractTokensError {
#[error(
"The rule `{0}` contains an empty string.
Tree-sitter does not support syntactic rules that contain an empty string
unless they are used only as the grammar's start rule.
"
)]
EmptyString(String),
#[error("Rule '{0}' cannot be used as both an external token and a non-terminal rule")]
ExternalTokenNonTerminal(String),
#[error("Non-symbol rules cannot be used as external tokens")]
NonSymbolExternalToken,
#[error(transparent)]
WordToken(NonTerminalWordTokenError),
#[error("Reserved word '{0}' must be a token")]
NonTokenReservedWord(String),
}
#[derive(Debug, Error, Serialize)]
pub struct NonTerminalWordTokenError {
pub symbol_name: String,
pub conflicting_symbol_name: Option<String>,
}
impl std::fmt::Display for NonTerminalWordTokenError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(
f,
"Non-terminal symbol '{}' cannot be used as the word token",
self.symbol_name
)?;
if let Some(conflicting_name) = &self.conflicting_symbol_name {
writeln!(
f,
", because its rule is duplicated in '{conflicting_name}'",
)
} else {
writeln!(f)
}
}
}
pub(super) fn extract_tokens( pub(super) fn extract_tokens(
mut grammar: InternedGrammar, mut grammar: InternedGrammar,
) -> ExtractTokensResult<(ExtractedSyntaxGrammar, ExtractedLexicalGrammar)> { ) -> Result<(ExtractedSyntaxGrammar, ExtractedLexicalGrammar)> {
let mut extractor = TokenExtractor { let mut extractor = TokenExtractor {
current_variable_name: String::new(), current_variable_name: String::new(),
current_variable_token_count: 0, current_variable_token_count: 0,
@ -85,7 +38,7 @@ pub(super) fn extract_tokens(
// that pointed to that variable will need to be updated to point to the // that pointed to that variable will need to be updated to point to the
// variable in the lexical grammar. Symbols that pointed to later variables // variable in the lexical grammar. Symbols that pointed to later variables
// will need to have their indices decremented. // will need to have their indices decremented.
let mut variables = Vec::with_capacity(grammar.variables.len()); let mut variables = Vec::new();
let mut symbol_replacer = SymbolReplacer { let mut symbol_replacer = SymbolReplacer {
replacements: HashMap::new(), replacements: HashMap::new(),
}; };
@ -152,14 +105,15 @@ pub(super) fn extract_tokens(
} }
} }
let mut external_tokens = Vec::with_capacity(grammar.external_tokens.len()); let mut external_tokens = Vec::new();
for external_token in grammar.external_tokens { for external_token in grammar.external_tokens {
let rule = symbol_replacer.replace_symbols_in_rule(&external_token.rule); let rule = symbol_replacer.replace_symbols_in_rule(&external_token.rule);
if let Rule::Symbol(symbol) = rule { if let Rule::Symbol(symbol) = rule {
if symbol.is_non_terminal() { if symbol.is_non_terminal() {
Err(ExtractTokensError::ExternalTokenNonTerminal( return Err(anyhow!(
variables[symbol.index].name.clone(), "Rule '{}' cannot be used as both an external token and a non-terminal rule",
))?; &variables[symbol.index].name,
));
} }
if symbol.is_external() { if symbol.is_external() {
@ -176,59 +130,22 @@ pub(super) fn extract_tokens(
}); });
} }
} else { } else {
Err(ExtractTokensError::NonSymbolExternalToken)?; return Err(anyhow!(
"Non-symbol rules cannot be used as external tokens"
));
} }
} }
let word_token = if let Some(token) = grammar.word_token { let mut word_token = None;
if let Some(token) = grammar.word_token {
let token = symbol_replacer.replace_symbol(token); let token = symbol_replacer.replace_symbol(token);
if token.is_non_terminal() { if token.is_non_terminal() {
let word_token_variable = &variables[token.index]; return Err(anyhow!(
let conflicting_symbol_name = variables "Non-terminal symbol '{}' cannot be used as the word token",
.iter() &variables[token.index].name
.enumerate() ));
.find(|(i, v)| *i != token.index && v.rule == word_token_variable.rule)
.map(|(_, v)| v.name.clone());
Err(ExtractTokensError::WordToken(NonTerminalWordTokenError {
symbol_name: word_token_variable.name.clone(),
conflicting_symbol_name,
}))?;
} }
Some(token) word_token = Some(token);
} else {
None
};
let mut reserved_word_contexts = Vec::with_capacity(grammar.reserved_word_sets.len());
for reserved_word_context in grammar.reserved_word_sets {
let mut reserved_words = Vec::with_capacity(reserved_word_contexts.len());
for reserved_rule in reserved_word_context.reserved_words {
if let Rule::Symbol(symbol) = reserved_rule {
reserved_words.push(symbol_replacer.replace_symbol(symbol));
} else if let Some(index) = lexical_variables
.iter()
.position(|v| v.rule == reserved_rule)
{
reserved_words.push(Symbol::terminal(index));
} else {
let rule = if let Rule::Metadata { rule, .. } = &reserved_rule {
rule.as_ref()
} else {
&reserved_rule
};
let token_name = match rule {
Rule::String(s) => s.clone(),
Rule::Pattern(p, _) => p.clone(),
_ => "unknown".to_string(),
};
Err(ExtractTokensError::NonTokenReservedWord(token_name))?;
}
}
reserved_word_contexts.push(ReservedWordContext {
name: reserved_word_context.name,
reserved_words,
});
} }
Ok(( Ok((
@ -241,7 +158,6 @@ pub(super) fn extract_tokens(
external_tokens, external_tokens,
word_token, word_token,
precedence_orderings: grammar.precedence_orderings, precedence_orderings: grammar.precedence_orderings,
reserved_word_sets: reserved_word_contexts,
}, },
ExtractedLexicalGrammar { ExtractedLexicalGrammar {
variables: lexical_variables, variables: lexical_variables,
@ -267,16 +183,18 @@ impl TokenExtractor {
&mut self, &mut self,
is_first: bool, is_first: bool,
variable: &mut Variable, variable: &mut Variable,
) -> ExtractTokensResult<()> { ) -> Result<()> {
self.current_variable_name.clear(); self.current_variable_name.clear();
self.current_variable_name.push_str(&variable.name); self.current_variable_name.push_str(&variable.name);
self.current_variable_token_count = 0; self.current_variable_token_count = 0;
self.is_first_rule = is_first; self.is_first_rule = is_first;
variable.rule = self.extract_tokens_in_rule(&variable.rule)?; let mut rule = Rule::Blank;
mem::swap(&mut rule, &mut variable.rule);
variable.rule = self.extract_tokens_in_rule(&rule)?;
Ok(()) Ok(())
} }
fn extract_tokens_in_rule(&mut self, input: &Rule) -> ExtractTokensResult<Rule> { fn extract_tokens_in_rule(&mut self, input: &Rule) -> Result<Rule> {
match input { match input {
Rule::String(name) => Ok(self.extract_token(input, Some(name))?.into()), Rule::String(name) => Ok(self.extract_token(input, Some(name))?.into()),
Rule::Pattern(..) => Ok(self.extract_token(input, None)?.into()), Rule::Pattern(..) => Ok(self.extract_token(input, None)?.into()),
@ -285,11 +203,10 @@ impl TokenExtractor {
let mut params = params.clone(); let mut params = params.clone();
params.is_token = false; params.is_token = false;
let string_value = if let Rule::String(value) = rule.as_ref() { let mut string_value = None;
Some(value) if let Rule::String(value) = rule.as_ref() {
} else { string_value = Some(value);
None }
};
let rule_to_extract = if params == MetadataParams::default() { let rule_to_extract = if params == MetadataParams::default() {
rule.as_ref() rule.as_ref()
@ -312,27 +229,19 @@ impl TokenExtractor {
elements elements
.iter() .iter()
.map(|e| self.extract_tokens_in_rule(e)) .map(|e| self.extract_tokens_in_rule(e))
.collect::<ExtractTokensResult<Vec<_>>>()?, .collect::<Result<Vec<_>>>()?,
)), )),
Rule::Choice(elements) => Ok(Rule::Choice( Rule::Choice(elements) => Ok(Rule::Choice(
elements elements
.iter() .iter()
.map(|e| self.extract_tokens_in_rule(e)) .map(|e| self.extract_tokens_in_rule(e))
.collect::<ExtractTokensResult<Vec<_>>>()?, .collect::<Result<Vec<_>>>()?,
)), )),
Rule::Reserved { rule, context_name } => Ok(Rule::Reserved {
rule: Box::new(self.extract_tokens_in_rule(rule)?),
context_name: context_name.clone(),
}),
_ => Ok(input.clone()), _ => Ok(input.clone()),
} }
} }
fn extract_token( fn extract_token(&mut self, rule: &Rule, string_value: Option<&String>) -> Result<Symbol> {
&mut self,
rule: &Rule,
string_value: Option<&String>,
) -> ExtractTokensResult<Symbol> {
for (i, variable) in self.extracted_variables.iter_mut().enumerate() { for (i, variable) in self.extracted_variables.iter_mut().enumerate() {
if variable.rule == *rule { if variable.rule == *rule {
self.extracted_usage_counts[i] += 1; self.extracted_usage_counts[i] += 1;
@ -343,9 +252,14 @@ impl TokenExtractor {
let index = self.extracted_variables.len(); let index = self.extracted_variables.len();
let variable = if let Some(string_value) = string_value { let variable = if let Some(string_value) = string_value {
if string_value.is_empty() && !self.is_first_rule { if string_value.is_empty() && !self.is_first_rule {
Err(ExtractTokensError::EmptyString( return Err(anyhow!(
self.current_variable_name.clone(), "The rule `{}` contains an empty string.
))?;
Tree-sitter does not support syntactic rules that contain an empty string
unless they are used only as the grammar's start rule.
",
self.current_variable_name
));
} }
Variable { Variable {
name: string_value.clone(), name: string_value.clone(),
@ -357,7 +271,7 @@ impl TokenExtractor {
Variable { Variable {
name: format!( name: format!(
"{}_token{}", "{}_token{}",
self.current_variable_name, self.current_variable_token_count &self.current_variable_name, self.current_variable_token_count
), ),
kind: VariableType::Auxiliary, kind: VariableType::Auxiliary,
rule: rule.clone(), rule: rule.clone(),
@ -391,10 +305,6 @@ impl SymbolReplacer {
params: params.clone(), params: params.clone(),
rule: Box::new(self.replace_symbols_in_rule(rule)), rule: Box::new(self.replace_symbols_in_rule(rule)),
}, },
Rule::Reserved { rule, context_name } => Rule::Reserved {
rule: Box::new(self.replace_symbols_in_rule(rule)),
context_name: context_name.clone(),
},
_ => rule.clone(), _ => rule.clone(),
} }
} }
@ -590,13 +500,14 @@ mod test {
]); ]);
grammar.external_tokens = vec![Variable::named("rule_1", Rule::non_terminal(1))]; grammar.external_tokens = vec![Variable::named("rule_1", Rule::non_terminal(1))];
let result = extract_tokens(grammar); match extract_tokens(grammar) {
assert!(result.is_err(), "Expected an error but got no error"); Err(e) => {
let err = result.err().unwrap(); assert_eq!(e.to_string(), "Rule 'rule_1' cannot be used as both an external token and a non-terminal rule");
assert_eq!( }
err.to_string(), _ => {
"Rule 'rule_1' cannot be used as both an external token and a non-terminal rule" panic!("Expected an error but got no error");
); }
}
} }
#[test] #[test]

View file

@ -1,96 +1,48 @@
use std::collections::HashMap; use anyhow::{anyhow, Result};
use indoc::indoc;
use serde::Serialize;
use thiserror::Error;
use super::ExtractedSyntaxGrammar; use super::ExtractedSyntaxGrammar;
use crate::{ use crate::{
grammars::{ grammars::{Production, ProductionStep, SyntaxGrammar, SyntaxVariable, Variable},
Production, ProductionStep, ReservedWordSetId, SyntaxGrammar, SyntaxVariable, Variable, rules::{Alias, Associativity, Precedence, Rule, Symbol},
},
rules::{Alias, Associativity, Precedence, Rule, Symbol, TokenSet},
}; };
pub type FlattenGrammarResult<T> = Result<T, FlattenGrammarError>;
#[derive(Debug, Error, Serialize)]
pub enum FlattenGrammarError {
#[error("No such reserved word set: {0}")]
NoReservedWordSet(String),
#[error(
"The rule `{0}` matches the empty string.
Tree-sitter does not support syntactic rules that match the empty string
unless they are used only as the grammar's start rule.
"
)]
EmptyString(String),
#[error("Rule `{0}` cannot be inlined because it contains a reference to itself")]
RecursiveInline(String),
}
struct RuleFlattener { struct RuleFlattener {
production: Production, production: Production,
reserved_word_set_ids: HashMap<String, ReservedWordSetId>,
precedence_stack: Vec<Precedence>, precedence_stack: Vec<Precedence>,
associativity_stack: Vec<Associativity>, associativity_stack: Vec<Associativity>,
reserved_word_stack: Vec<ReservedWordSetId>,
alias_stack: Vec<Alias>, alias_stack: Vec<Alias>,
field_name_stack: Vec<String>, field_name_stack: Vec<String>,
} }
impl RuleFlattener { impl RuleFlattener {
const fn new(reserved_word_set_ids: HashMap<String, ReservedWordSetId>) -> Self { const fn new() -> Self {
Self { Self {
production: Production { production: Production {
steps: Vec::new(), steps: Vec::new(),
dynamic_precedence: 0, dynamic_precedence: 0,
}, },
reserved_word_set_ids,
precedence_stack: Vec::new(), precedence_stack: Vec::new(),
associativity_stack: Vec::new(), associativity_stack: Vec::new(),
reserved_word_stack: Vec::new(),
alias_stack: Vec::new(), alias_stack: Vec::new(),
field_name_stack: Vec::new(), field_name_stack: Vec::new(),
} }
} }
fn flatten_variable(&mut self, variable: Variable) -> FlattenGrammarResult<SyntaxVariable> { fn flatten(mut self, rule: Rule) -> Production {
let choices = extract_choices(variable.rule); self.apply(rule, true);
let mut productions = Vec::with_capacity(choices.len()); self.production
for rule in choices {
let production = self.flatten_rule(rule)?;
if !productions.contains(&production) {
productions.push(production);
}
}
Ok(SyntaxVariable {
name: variable.name,
kind: variable.kind,
productions,
})
} }
fn flatten_rule(&mut self, rule: Rule) -> FlattenGrammarResult<Production> { fn apply(&mut self, rule: Rule, at_end: bool) -> bool {
self.production = Production::default();
self.alias_stack.clear();
self.reserved_word_stack.clear();
self.precedence_stack.clear();
self.associativity_stack.clear();
self.field_name_stack.clear();
self.apply(rule, true)?;
Ok(self.production.clone())
}
fn apply(&mut self, rule: Rule, at_end: bool) -> FlattenGrammarResult<bool> {
match rule { match rule {
Rule::Seq(members) => { Rule::Seq(members) => {
let mut result = false; let mut result = false;
let last_index = members.len() - 1; let last_index = members.len() - 1;
for (i, member) in members.into_iter().enumerate() { for (i, member) in members.into_iter().enumerate() {
result |= self.apply(member, i == last_index && at_end)?; result |= self.apply(member, i == last_index && at_end);
} }
Ok(result) result
} }
Rule::Metadata { rule, params } => { Rule::Metadata { rule, params } => {
let mut has_precedence = false; let mut has_precedence = false;
@ -121,7 +73,7 @@ impl RuleFlattener {
self.production.dynamic_precedence = params.dynamic_precedence; self.production.dynamic_precedence = params.dynamic_precedence;
} }
let did_push = self.apply(*rule, at_end)?; let did_push = self.apply(*rule, at_end);
if has_precedence { if has_precedence {
self.precedence_stack.pop(); self.precedence_stack.pop();
@ -150,20 +102,7 @@ impl RuleFlattener {
self.field_name_stack.pop(); self.field_name_stack.pop();
} }
Ok(did_push) did_push
}
Rule::Reserved { rule, context_name } => {
self.reserved_word_stack.push(
self.reserved_word_set_ids
.get(&context_name)
.copied()
.ok_or_else(|| {
FlattenGrammarError::NoReservedWordSet(context_name.clone())
})?,
);
let did_push = self.apply(*rule, at_end)?;
self.reserved_word_stack.pop();
Ok(did_push)
} }
Rule::Symbol(symbol) => { Rule::Symbol(symbol) => {
self.production.steps.push(ProductionStep { self.production.steps.push(ProductionStep {
@ -174,17 +113,12 @@ impl RuleFlattener {
.cloned() .cloned()
.unwrap_or(Precedence::None), .unwrap_or(Precedence::None),
associativity: self.associativity_stack.last().copied(), associativity: self.associativity_stack.last().copied(),
reserved_word_set_id: self
.reserved_word_stack
.last()
.copied()
.unwrap_or(ReservedWordSetId::default()),
alias: self.alias_stack.last().cloned(), alias: self.alias_stack.last().cloned(),
field_name: self.field_name_stack.last().cloned(), field_name: self.field_name_stack.last().cloned(),
}); });
Ok(true) true
} }
_ => Ok(false), _ => false,
} }
} }
} }
@ -195,7 +129,7 @@ fn extract_choices(rule: Rule) -> Vec<Rule> {
let mut result = vec![Rule::Blank]; let mut result = vec![Rule::Blank];
for element in elements { for element in elements {
let extraction = extract_choices(element); let extraction = extract_choices(element);
let mut next_result = Vec::with_capacity(result.len()); let mut next_result = Vec::new();
for entry in result { for entry in result {
for extraction_entry in &extraction { for extraction_entry in &extraction {
next_result.push(Rule::Seq(vec![entry.clone(), extraction_entry.clone()])); next_result.push(Rule::Seq(vec![entry.clone(), extraction_entry.clone()]));
@ -206,7 +140,7 @@ fn extract_choices(rule: Rule) -> Vec<Rule> {
result result
} }
Rule::Choice(elements) => { Rule::Choice(elements) => {
let mut result = Vec::with_capacity(elements.len()); let mut result = Vec::new();
for element in elements { for element in elements {
for rule in extract_choices(element) { for rule in extract_choices(element) {
result.push(rule); result.push(rule);
@ -221,17 +155,25 @@ fn extract_choices(rule: Rule) -> Vec<Rule> {
params: params.clone(), params: params.clone(),
}) })
.collect(), .collect(),
Rule::Reserved { rule, context_name } => extract_choices(*rule)
.into_iter()
.map(|rule| Rule::Reserved {
rule: Box::new(rule),
context_name: context_name.clone(),
})
.collect(),
_ => vec![rule], _ => vec![rule],
} }
} }
fn flatten_variable(variable: Variable) -> SyntaxVariable {
let mut productions = Vec::new();
for rule in extract_choices(variable.rule) {
let production = RuleFlattener::new().flatten(rule);
if !productions.contains(&production) {
productions.push(production);
}
}
SyntaxVariable {
name: variable.name,
kind: variable.kind,
productions,
}
}
fn symbol_is_used(variables: &[SyntaxVariable], symbol: Symbol) -> bool { fn symbol_is_used(variables: &[SyntaxVariable], symbol: Symbol) -> bool {
for variable in variables { for variable in variables {
for production in &variable.productions { for production in &variable.productions {
@ -245,48 +187,37 @@ fn symbol_is_used(variables: &[SyntaxVariable], symbol: Symbol) -> bool {
false false
} }
pub(super) fn flatten_grammar( pub(super) fn flatten_grammar(grammar: ExtractedSyntaxGrammar) -> Result<SyntaxGrammar> {
grammar: ExtractedSyntaxGrammar, let mut variables = Vec::new();
) -> FlattenGrammarResult<SyntaxGrammar> { for variable in grammar.variables {
let mut reserved_word_set_ids_by_name = HashMap::new(); variables.push(flatten_variable(variable));
for (ix, set) in grammar.reserved_word_sets.iter().enumerate() {
reserved_word_set_ids_by_name.insert(set.name.clone(), ReservedWordSetId(ix));
} }
let mut flattener = RuleFlattener::new(reserved_word_set_ids_by_name);
let variables = grammar
.variables
.into_iter()
.map(|variable| flattener.flatten_variable(variable))
.collect::<FlattenGrammarResult<Vec<_>>>()?;
for (i, variable) in variables.iter().enumerate() { for (i, variable) in variables.iter().enumerate() {
let symbol = Symbol::non_terminal(i); let symbol = Symbol::non_terminal(i);
let used = symbol_is_used(&variables, symbol);
for production in &variable.productions { for production in &variable.productions {
if used && production.steps.is_empty() { if production.steps.is_empty() && symbol_is_used(&variables, symbol) {
Err(FlattenGrammarError::EmptyString(variable.name.clone()))?; return Err(anyhow!(
indoc! {"
The rule `{}` matches the empty string.
Tree-sitter does not support syntactic rules that match the empty string
unless they are used only as the grammar's start rule.
"},
variable.name
));
} }
if grammar.variables_to_inline.contains(&symbol) if grammar.variables_to_inline.contains(&symbol)
&& production.steps.iter().any(|step| step.symbol == symbol) && production.steps.iter().any(|step| step.symbol == symbol)
{ {
Err(FlattenGrammarError::RecursiveInline(variable.name.clone()))?; return Err(anyhow!(
"Rule `{}` cannot be inlined because it contains a reference to itself.",
variable.name,
));
} }
} }
} }
let mut reserved_word_sets = grammar
.reserved_word_sets
.into_iter()
.map(|set| set.reserved_words.into_iter().collect())
.collect::<Vec<_>>();
// If no default reserved word set is specified, there are no reserved words.
if reserved_word_sets.is_empty() {
reserved_word_sets.push(TokenSet::default());
}
Ok(SyntaxGrammar { Ok(SyntaxGrammar {
extra_symbols: grammar.extra_symbols, extra_symbols: grammar.extra_symbols,
expected_conflicts: grammar.expected_conflicts, expected_conflicts: grammar.expected_conflicts,
@ -295,7 +226,6 @@ pub(super) fn flatten_grammar(
external_tokens: grammar.external_tokens, external_tokens: grammar.external_tokens,
supertype_symbols: grammar.supertype_symbols, supertype_symbols: grammar.supertype_symbols,
word_token: grammar.word_token, word_token: grammar.word_token,
reserved_word_sets,
variables, variables,
}) })
} }
@ -307,31 +237,28 @@ mod tests {
#[test] #[test]
fn test_flatten_grammar() { fn test_flatten_grammar() {
let mut flattener = RuleFlattener::new(HashMap::default()); let result = flatten_variable(Variable {
let result = flattener name: "test".to_string(),
.flatten_variable(Variable { kind: VariableType::Named,
name: "test".to_string(), rule: Rule::seq(vec![
kind: VariableType::Named, Rule::non_terminal(1),
rule: Rule::seq(vec![ Rule::prec_left(
Rule::non_terminal(1), Precedence::Integer(101),
Rule::prec_left( Rule::seq(vec![
Precedence::Integer(101), Rule::non_terminal(2),
Rule::seq(vec![ Rule::choice(vec![
Rule::non_terminal(2), Rule::prec_right(
Rule::choice(vec![ Precedence::Integer(102),
Rule::prec_right( Rule::seq(vec![Rule::non_terminal(3), Rule::non_terminal(4)]),
Precedence::Integer(102), ),
Rule::seq(vec![Rule::non_terminal(3), Rule::non_terminal(4)]), Rule::non_terminal(5),
),
Rule::non_terminal(5),
]),
Rule::non_terminal(6),
]), ]),
), Rule::non_terminal(6),
Rule::non_terminal(7), ]),
]), ),
}) Rule::non_terminal(7),
.unwrap(); ]),
});
assert_eq!( assert_eq!(
result.productions, result.productions,
@ -368,31 +295,28 @@ mod tests {
#[test] #[test]
fn test_flatten_grammar_with_maximum_dynamic_precedence() { fn test_flatten_grammar_with_maximum_dynamic_precedence() {
let mut flattener = RuleFlattener::new(HashMap::default()); let result = flatten_variable(Variable {
let result = flattener name: "test".to_string(),
.flatten_variable(Variable { kind: VariableType::Named,
name: "test".to_string(), rule: Rule::seq(vec![
kind: VariableType::Named, Rule::non_terminal(1),
rule: Rule::seq(vec![ Rule::prec_dynamic(
Rule::non_terminal(1), 101,
Rule::prec_dynamic( Rule::seq(vec![
101, Rule::non_terminal(2),
Rule::seq(vec![ Rule::choice(vec![
Rule::non_terminal(2), Rule::prec_dynamic(
Rule::choice(vec![ 102,
Rule::prec_dynamic( Rule::seq(vec![Rule::non_terminal(3), Rule::non_terminal(4)]),
102, ),
Rule::seq(vec![Rule::non_terminal(3), Rule::non_terminal(4)]), Rule::non_terminal(5),
),
Rule::non_terminal(5),
]),
Rule::non_terminal(6),
]), ]),
), Rule::non_terminal(6),
Rule::non_terminal(7), ]),
]), ),
}) Rule::non_terminal(7),
.unwrap(); ]),
});
assert_eq!( assert_eq!(
result.productions, result.productions,
@ -424,17 +348,14 @@ mod tests {
#[test] #[test]
fn test_flatten_grammar_with_final_precedence() { fn test_flatten_grammar_with_final_precedence() {
let mut flattener = RuleFlattener::new(HashMap::default()); let result = flatten_variable(Variable {
let result = flattener name: "test".to_string(),
.flatten_variable(Variable { kind: VariableType::Named,
name: "test".to_string(), rule: Rule::prec_left(
kind: VariableType::Named, Precedence::Integer(101),
rule: Rule::prec_left( Rule::seq(vec![Rule::non_terminal(1), Rule::non_terminal(2)]),
Precedence::Integer(101), ),
Rule::seq(vec![Rule::non_terminal(1), Rule::non_terminal(2)]), });
),
})
.unwrap();
assert_eq!( assert_eq!(
result.productions, result.productions,
@ -449,16 +370,14 @@ mod tests {
}] }]
); );
let result = flattener let result = flatten_variable(Variable {
.flatten_variable(Variable { name: "test".to_string(),
name: "test".to_string(), kind: VariableType::Named,
kind: VariableType::Named, rule: Rule::prec_left(
rule: Rule::prec_left( Precedence::Integer(101),
Precedence::Integer(101), Rule::seq(vec![Rule::non_terminal(1)]),
Rule::seq(vec![Rule::non_terminal(1)]), ),
), });
})
.unwrap();
assert_eq!( assert_eq!(
result.productions, result.productions,
@ -472,21 +391,18 @@ mod tests {
#[test] #[test]
fn test_flatten_grammar_with_field_names() { fn test_flatten_grammar_with_field_names() {
let mut flattener = RuleFlattener::new(HashMap::default()); let result = flatten_variable(Variable {
let result = flattener name: "test".to_string(),
.flatten_variable(Variable { kind: VariableType::Named,
name: "test".to_string(), rule: Rule::seq(vec![
kind: VariableType::Named, Rule::field("first-thing".to_string(), Rule::terminal(1)),
rule: Rule::seq(vec![ Rule::terminal(2),
Rule::field("first-thing".to_string(), Rule::terminal(1)), Rule::choice(vec![
Rule::terminal(2), Rule::Blank,
Rule::choice(vec![ Rule::field("second-thing".to_string(), Rule::terminal(3)),
Rule::Blank,
Rule::field("second-thing".to_string(), Rule::terminal(3)),
]),
]), ]),
}) ]),
.unwrap(); });
assert_eq!( assert_eq!(
result.productions, result.productions,
@ -520,7 +436,6 @@ mod tests {
external_tokens: Vec::new(), external_tokens: Vec::new(),
supertype_symbols: Vec::new(), supertype_symbols: Vec::new(),
word_token: None, word_token: None,
reserved_word_sets: Vec::new(),
variables: vec![Variable { variables: vec![Variable {
name: "test".to_string(), name: "test".to_string(),
kind: VariableType::Named, kind: VariableType::Named,
@ -534,7 +449,7 @@ mod tests {
assert_eq!( assert_eq!(
result.unwrap_err().to_string(), result.unwrap_err().to_string(),
"Rule `test` cannot be inlined because it contains a reference to itself", "Rule `test` cannot be inlined because it contains a reference to itself.",
); );
} }
} }

View file

@ -1,34 +1,16 @@
use log::warn; use anyhow::{anyhow, Result};
use serde::Serialize;
use thiserror::Error;
use super::InternedGrammar; use super::InternedGrammar;
use crate::{ use crate::{
grammars::{InputGrammar, ReservedWordContext, Variable, VariableType}, grammars::{InputGrammar, Variable, VariableType},
rules::{Rule, Symbol}, rules::{Rule, Symbol},
}; };
pub type InternSymbolsResult<T> = Result<T, InternSymbolsError>; pub(super) fn intern_symbols(grammar: &InputGrammar) -> Result<InternedGrammar> {
#[derive(Debug, Error, Serialize)]
pub enum InternSymbolsError {
#[error("A grammar's start rule must be visible.")]
HiddenStartRule,
#[error("Undefined symbol `{0}`")]
Undefined(String),
#[error("Undefined symbol `{0}` in grammar's supertypes array")]
UndefinedSupertype(String),
#[error("Undefined symbol `{0}` in grammar's conflicts array")]
UndefinedConflict(String),
#[error("Undefined symbol `{0}` as grammar's word token")]
UndefinedWordToken(String),
}
pub(super) fn intern_symbols(grammar: &InputGrammar) -> InternSymbolsResult<InternedGrammar> {
let interner = Interner { grammar }; let interner = Interner { grammar };
if variable_type_for_name(&grammar.variables[0].name) == VariableType::Hidden { if variable_type_for_name(&grammar.variables[0].name) == VariableType::Hidden {
Err(InternSymbolsError::HiddenStartRule)?; return Err(anyhow!("A grammar's start rule must be visible."));
} }
let mut variables = Vec::with_capacity(grammar.variables.len()); let mut variables = Vec::with_capacity(grammar.variables.len());
@ -59,31 +41,17 @@ pub(super) fn intern_symbols(grammar: &InputGrammar) -> InternSymbolsResult<Inte
let mut supertype_symbols = Vec::with_capacity(grammar.supertype_symbols.len()); let mut supertype_symbols = Vec::with_capacity(grammar.supertype_symbols.len());
for supertype_symbol_name in &grammar.supertype_symbols { for supertype_symbol_name in &grammar.supertype_symbols {
supertype_symbols.push(interner.intern_name(supertype_symbol_name).ok_or_else(|| { supertype_symbols.push(interner.intern_name(supertype_symbol_name).ok_or_else(|| {
InternSymbolsError::UndefinedSupertype(supertype_symbol_name.clone()) anyhow!("Undefined symbol `{supertype_symbol_name}` in grammar's supertypes array")
})?); })?);
} }
let mut reserved_words = Vec::with_capacity(grammar.reserved_words.len()); let mut expected_conflicts = Vec::new();
for reserved_word_set in &grammar.reserved_words {
let mut interned_set = Vec::with_capacity(reserved_word_set.reserved_words.len());
for rule in &reserved_word_set.reserved_words {
interned_set.push(interner.intern_rule(rule, None)?);
}
reserved_words.push(ReservedWordContext {
name: reserved_word_set.name.clone(),
reserved_words: interned_set,
});
}
let mut expected_conflicts = Vec::with_capacity(grammar.expected_conflicts.len());
for conflict in &grammar.expected_conflicts { for conflict in &grammar.expected_conflicts {
let mut interned_conflict = Vec::with_capacity(conflict.len()); let mut interned_conflict = Vec::with_capacity(conflict.len());
for name in conflict { for name in conflict {
interned_conflict.push( interned_conflict.push(interner.intern_name(name).ok_or_else(|| {
interner anyhow!("Undefined symbol `{name}` in grammar's conflicts array")
.intern_name(name) })?);
.ok_or_else(|| InternSymbolsError::UndefinedConflict(name.clone()))?,
);
} }
expected_conflicts.push(interned_conflict); expected_conflicts.push(interned_conflict);
} }
@ -95,15 +63,14 @@ pub(super) fn intern_symbols(grammar: &InputGrammar) -> InternSymbolsResult<Inte
} }
} }
let word_token = if let Some(name) = grammar.word_token.as_ref() { let mut word_token = None;
Some( if let Some(name) = grammar.word_token.as_ref() {
word_token = Some(
interner interner
.intern_name(name) .intern_name(name)
.ok_or_else(|| InternSymbolsError::UndefinedWordToken(name.clone()))?, .ok_or_else(|| anyhow!("Undefined symbol `{name}` as grammar's word token"))?,
) );
} else { }
None
};
for (i, variable) in variables.iter_mut().enumerate() { for (i, variable) in variables.iter_mut().enumerate() {
if supertype_symbols.contains(&Symbol::non_terminal(i)) { if supertype_symbols.contains(&Symbol::non_terminal(i)) {
@ -120,7 +87,6 @@ pub(super) fn intern_symbols(grammar: &InputGrammar) -> InternSymbolsResult<Inte
supertype_symbols, supertype_symbols,
word_token, word_token,
precedence_orderings: grammar.precedence_orderings.clone(), precedence_orderings: grammar.precedence_orderings.clone(),
reserved_word_sets: reserved_words,
}) })
} }
@ -129,10 +95,10 @@ struct Interner<'a> {
} }
impl Interner<'_> { impl Interner<'_> {
fn intern_rule(&self, rule: &Rule, name: Option<&str>) -> InternSymbolsResult<Rule> { fn intern_rule(&self, rule: &Rule, name: Option<&str>) -> Result<Rule> {
match rule { match rule {
Rule::Choice(elements) => { Rule::Choice(elements) => {
self.check_single(elements, name, "choice"); self.check_single(elements, name);
let mut result = Vec::with_capacity(elements.len()); let mut result = Vec::with_capacity(elements.len());
for element in elements { for element in elements {
result.push(self.intern_rule(element, name)?); result.push(self.intern_rule(element, name)?);
@ -140,7 +106,7 @@ impl Interner<'_> {
Ok(Rule::Choice(result)) Ok(Rule::Choice(result))
} }
Rule::Seq(elements) => { Rule::Seq(elements) => {
self.check_single(elements, name, "seq"); self.check_single(elements, name);
let mut result = Vec::with_capacity(elements.len()); let mut result = Vec::with_capacity(elements.len());
for element in elements { for element in elements {
result.push(self.intern_rule(element, name)?); result.push(self.intern_rule(element, name)?);
@ -152,12 +118,8 @@ impl Interner<'_> {
rule: Box::new(self.intern_rule(rule, name)?), rule: Box::new(self.intern_rule(rule, name)?),
params: params.clone(), params: params.clone(),
}), }),
Rule::Reserved { rule, context_name } => Ok(Rule::Reserved {
rule: Box::new(self.intern_rule(rule, name)?),
context_name: context_name.clone(),
}),
Rule::NamedSymbol(name) => self.intern_name(name).map_or_else( Rule::NamedSymbol(name) => self.intern_name(name).map_or_else(
|| Err(InternSymbolsError::Undefined(name.clone())), || Err(anyhow!("Undefined symbol `{name}`")),
|symbol| Ok(Rule::Symbol(symbol)), |symbol| Ok(Rule::Symbol(symbol)),
), ),
_ => Ok(rule.clone()), _ => Ok(rule.clone()),
@ -184,10 +146,10 @@ impl Interner<'_> {
// In the case of a seq or choice rule of 1 element in a hidden rule, weird // In the case of a seq or choice rule of 1 element in a hidden rule, weird
// inconsistent behavior with queries can occur. So we should warn the user about it. // inconsistent behavior with queries can occur. So we should warn the user about it.
fn check_single(&self, elements: &[Rule], name: Option<&str>, kind: &str) { fn check_single(&self, elements: &[Rule], name: Option<&str>) {
if elements.len() == 1 && matches!(elements[0], Rule::String(_) | Rule::Pattern(_, _)) { if elements.len() == 1 && matches!(elements[0], Rule::String(_) | Rule::Pattern(_, _)) {
warn!( eprintln!(
"rule {} contains a `{kind}` rule with a single element. This is unnecessary.", "Warning: rule {} contains a `seq` or `choice` rule with a single element. This is unnecessary.",
name.unwrap_or_default() name.unwrap_or_default()
); );
} }
@ -278,9 +240,10 @@ mod tests {
fn test_grammar_with_undefined_symbols() { fn test_grammar_with_undefined_symbols() {
let result = intern_symbols(&build_grammar(vec![Variable::named("x", Rule::named("y"))])); let result = intern_symbols(&build_grammar(vec![Variable::named("x", Rule::named("y"))]));
assert!(result.is_err(), "Expected an error but got none"); match result {
let e = result.err().unwrap(); Err(e) => assert_eq!(e.to_string(), "Undefined symbol `y`"),
assert_eq!(e.to_string(), "Undefined symbol `y`"); _ => panic!("Expected an error but got none"),
}
} }
fn build_grammar(variables: Vec<Variable>) -> InputGrammar { fn build_grammar(variables: Vec<Variable>) -> InputGrammar {

View file

@ -8,18 +8,11 @@ mod process_inlines;
use std::{ use std::{
cmp::Ordering, cmp::Ordering,
collections::{hash_map, BTreeSet, HashMap, HashSet}, collections::{hash_map, HashMap, HashSet},
mem, mem,
}; };
pub use expand_tokens::ExpandTokensError; use anyhow::{anyhow, Result};
pub use extract_tokens::ExtractTokensError;
pub use flatten_grammar::FlattenGrammarError;
use indexmap::IndexMap;
pub use intern_symbols::InternSymbolsError;
pub use process_inlines::ProcessInlinesError;
use serde::Serialize;
use thiserror::Error;
pub use self::expand_tokens::expand_tokens; pub use self::expand_tokens::expand_tokens;
use self::{ use self::{
@ -34,7 +27,6 @@ use super::{
}, },
rules::{AliasMap, Precedence, Rule, Symbol}, rules::{AliasMap, Precedence, Rule, Symbol},
}; };
use crate::grammars::ReservedWordContext;
pub struct IntermediateGrammar<T, U> { pub struct IntermediateGrammar<T, U> {
variables: Vec<Variable>, variables: Vec<Variable>,
@ -45,7 +37,6 @@ pub struct IntermediateGrammar<T, U> {
variables_to_inline: Vec<Symbol>, variables_to_inline: Vec<Symbol>,
supertype_symbols: Vec<Symbol>, supertype_symbols: Vec<Symbol>,
word_token: Option<Symbol>, word_token: Option<Symbol>,
reserved_word_sets: Vec<ReservedWordContext<T>>,
} }
pub type InternedGrammar = IntermediateGrammar<Rule, Variable>; pub type InternedGrammar = IntermediateGrammar<Rule, Variable>;
@ -69,96 +60,21 @@ impl<T, U> Default for IntermediateGrammar<T, U> {
variables_to_inline: Vec::default(), variables_to_inline: Vec::default(),
supertype_symbols: Vec::default(), supertype_symbols: Vec::default(),
word_token: Option::default(), word_token: Option::default(),
reserved_word_sets: Vec::default(),
} }
} }
} }
pub type PrepareGrammarResult<T> = Result<T, PrepareGrammarError>;
#[derive(Debug, Error, Serialize)]
#[error(transparent)]
pub enum PrepareGrammarError {
ValidatePrecedences(#[from] ValidatePrecedenceError),
ValidateIndirectRecursion(#[from] IndirectRecursionError),
InternSymbols(#[from] InternSymbolsError),
ExtractTokens(#[from] ExtractTokensError),
FlattenGrammar(#[from] FlattenGrammarError),
ExpandTokens(#[from] ExpandTokensError),
ProcessInlines(#[from] ProcessInlinesError),
}
pub type ValidatePrecedenceResult<T> = Result<T, ValidatePrecedenceError>;
#[derive(Debug, Error, Serialize)]
#[error(transparent)]
pub enum ValidatePrecedenceError {
Undeclared(#[from] UndeclaredPrecedenceError),
Ordering(#[from] ConflictingPrecedenceOrderingError),
}
#[derive(Debug, Error, Serialize)]
pub struct IndirectRecursionError(pub Vec<String>);
impl std::fmt::Display for IndirectRecursionError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(f, "Grammar contains an indirectly recursive rule: ")?;
for (i, symbol) in self.0.iter().enumerate() {
if i > 0 {
write!(f, " -> ")?;
}
write!(f, "{symbol}")?;
}
Ok(())
}
}
#[derive(Debug, Error, Serialize)]
pub struct UndeclaredPrecedenceError {
pub precedence: String,
pub rule: String,
}
impl std::fmt::Display for UndeclaredPrecedenceError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(
f,
"Undeclared precedence '{}' in rule '{}'",
self.precedence, self.rule
)?;
Ok(())
}
}
#[derive(Debug, Error, Serialize)]
pub struct ConflictingPrecedenceOrderingError {
pub precedence_1: String,
pub precedence_2: String,
}
impl std::fmt::Display for ConflictingPrecedenceOrderingError {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(
f,
"Conflicting orderings for precedences {} and {}",
self.precedence_1, self.precedence_2
)?;
Ok(())
}
}
/// Transform an input grammar into separate components that are ready /// Transform an input grammar into separate components that are ready
/// for parse table construction. /// for parse table construction.
pub fn prepare_grammar( pub fn prepare_grammar(
input_grammar: &InputGrammar, input_grammar: &InputGrammar,
) -> PrepareGrammarResult<( ) -> Result<(
SyntaxGrammar, SyntaxGrammar,
LexicalGrammar, LexicalGrammar,
InlinedProductionMap, InlinedProductionMap,
AliasMap, AliasMap,
)> { )> {
validate_precedences(input_grammar)?; validate_precedences(input_grammar)?;
validate_indirect_recursion(input_grammar)?;
let interned_grammar = intern_symbols(input_grammar)?; let interned_grammar = intern_symbols(input_grammar)?;
let (syntax_grammar, lexical_grammar) = extract_tokens(interned_grammar)?; let (syntax_grammar, lexical_grammar) = extract_tokens(interned_grammar)?;
@ -170,94 +86,13 @@ pub fn prepare_grammar(
Ok((syntax_grammar, lexical_grammar, inlines, default_aliases)) Ok((syntax_grammar, lexical_grammar, inlines, default_aliases))
} }
/// Check for indirect recursion cycles in the grammar that can cause infinite loops while
/// parsing. An indirect recursion cycle occurs when a non-terminal can derive itself through
/// a chain of single-symbol productions (e.g., A -> B, B -> A).
fn validate_indirect_recursion(grammar: &InputGrammar) -> Result<(), IndirectRecursionError> {
let mut epsilon_transitions: IndexMap<&str, BTreeSet<String>> = IndexMap::new();
for variable in &grammar.variables {
let productions = get_single_symbol_productions(&variable.rule);
// Filter out rules that *directly* reference themselves, as this doesn't
// cause a parsing loop.
let filtered: BTreeSet<String> = productions
.into_iter()
.filter(|s| s != &variable.name)
.collect();
epsilon_transitions.insert(variable.name.as_str(), filtered);
}
for start_symbol in epsilon_transitions.keys() {
let mut visited = BTreeSet::new();
let mut path = Vec::new();
if let Some((start_idx, end_idx)) =
get_cycle(start_symbol, &epsilon_transitions, &mut visited, &mut path)
{
let cycle_symbols = path[start_idx..=end_idx]
.iter()
.map(|s| (*s).to_string())
.collect();
return Err(IndirectRecursionError(cycle_symbols));
}
}
Ok(())
}
fn get_single_symbol_productions(rule: &Rule) -> BTreeSet<String> {
match rule {
Rule::NamedSymbol(name) => BTreeSet::from([name.clone()]),
Rule::Choice(choices) => choices
.iter()
.flat_map(get_single_symbol_productions)
.collect(),
Rule::Metadata { rule, .. } => get_single_symbol_productions(rule),
_ => BTreeSet::new(),
}
}
/// Perform a depth-first search to detect cycles in single state transitions.
fn get_cycle<'a>(
current: &'a str,
transitions: &'a IndexMap<&'a str, BTreeSet<String>>,
visited: &mut BTreeSet<&'a str>,
path: &mut Vec<&'a str>,
) -> Option<(usize, usize)> {
if let Some(first_idx) = path.iter().position(|s| *s == current) {
path.push(current);
return Some((first_idx, path.len() - 1));
}
if visited.contains(current) {
return None;
}
path.push(current);
visited.insert(current);
if let Some(next_symbols) = transitions.get(current) {
for next in next_symbols {
if let Some(cycle) = get_cycle(next, transitions, visited, path) {
return Some(cycle);
}
}
}
path.pop();
None
}
/// Check that all of the named precedences used in the grammar are declared /// Check that all of the named precedences used in the grammar are declared
/// within the `precedences` lists, and also that there are no conflicting /// within the `precedences` lists, and also that there are no conflicting
/// precedence orderings declared in those lists. /// precedence orderings declared in those lists.
fn validate_precedences(grammar: &InputGrammar) -> ValidatePrecedenceResult<()> { fn validate_precedences(grammar: &InputGrammar) -> Result<()> {
// Check that no rule contains a named precedence that is not present in // Check that no rule contains a named precedence that is not present in
// any of the `precedences` lists. // any of the `precedences` lists.
fn validate( fn validate(rule_name: &str, rule: &Rule, names: &HashSet<&String>) -> Result<()> {
rule_name: &str,
rule: &Rule,
names: &HashSet<&String>,
) -> ValidatePrecedenceResult<()> {
match rule { match rule {
Rule::Repeat(rule) => validate(rule_name, rule, names), Rule::Repeat(rule) => validate(rule_name, rule, names),
Rule::Seq(elements) | Rule::Choice(elements) => elements Rule::Seq(elements) | Rule::Choice(elements) => elements
@ -266,10 +101,7 @@ fn validate_precedences(grammar: &InputGrammar) -> ValidatePrecedenceResult<()>
Rule::Metadata { rule, params } => { Rule::Metadata { rule, params } => {
if let Precedence::Name(n) = &params.precedence { if let Precedence::Name(n) = &params.precedence {
if !names.contains(n) { if !names.contains(n) {
Err(UndeclaredPrecedenceError { return Err(anyhow!("Undeclared precedence '{n}' in rule '{rule_name}'"));
precedence: n.clone(),
rule: rule_name.to_string(),
})?;
} }
} }
validate(rule_name, rule, names)?; validate(rule_name, rule, names)?;
@ -299,10 +131,9 @@ fn validate_precedences(grammar: &InputGrammar) -> ValidatePrecedenceResult<()>
} }
hash_map::Entry::Occupied(e) => { hash_map::Entry::Occupied(e) => {
if e.get() != &ordering { if e.get() != &ordering {
Err(ConflictingPrecedenceOrderingError { return Err(anyhow!(
precedence_1: entry1.to_string(), "Conflicting orderings for precedences {entry1} and {entry2}",
precedence_2: entry2.to_string(), ));
})?;
} }
} }
} }

View file

@ -1,7 +1,6 @@
use std::collections::HashMap; use std::collections::HashMap;
use serde::Serialize; use anyhow::{anyhow, Result};
use thiserror::Error;
use crate::{ use crate::{
grammars::{InlinedProductionMap, LexicalGrammar, Production, ProductionStep, SyntaxGrammar}, grammars::{InlinedProductionMap, LexicalGrammar, Production, ProductionStep, SyntaxGrammar},
@ -70,13 +69,12 @@ impl InlinedProductionMapBuilder {
let production_map = production_indices_by_step_id let production_map = production_indices_by_step_id
.into_iter() .into_iter()
.map(|(step_id, production_indices)| { .map(|(step_id, production_indices)| {
let production = let production = step_id.variable_index.map_or_else(
core::ptr::from_ref::<Production>(step_id.variable_index.map_or_else( || &productions[step_id.production_index],
|| &productions[step_id.production_index], |variable_index| {
|variable_index| { &grammar.variables[variable_index].productions[step_id.production_index]
&grammar.variables[variable_index].productions[step_id.production_index] },
}, ) as *const Production;
));
((production, step_id.step_index as u32), production_indices) ((production, step_id.step_index as u32), production_indices)
}) })
.collect(); .collect();
@ -189,38 +187,29 @@ impl InlinedProductionMapBuilder {
} }
} }
pub type ProcessInlinesResult<T> = Result<T, ProcessInlinesError>;
#[derive(Debug, Error, Serialize)]
pub enum ProcessInlinesError {
#[error("External token `{0}` cannot be inlined")]
ExternalToken(String),
#[error("Token `{0}` cannot be inlined")]
Token(String),
#[error("Rule `{0}` cannot be inlined because it is the first rule")]
FirstRule(String),
}
pub(super) fn process_inlines( pub(super) fn process_inlines(
grammar: &SyntaxGrammar, grammar: &SyntaxGrammar,
lexical_grammar: &LexicalGrammar, lexical_grammar: &LexicalGrammar,
) -> ProcessInlinesResult<InlinedProductionMap> { ) -> Result<InlinedProductionMap> {
for symbol in &grammar.variables_to_inline { for symbol in &grammar.variables_to_inline {
match symbol.kind { match symbol.kind {
SymbolType::External => { SymbolType::External => {
Err(ProcessInlinesError::ExternalToken( return Err(anyhow!(
grammar.external_tokens[symbol.index].name.clone(), "External token `{}` cannot be inlined",
))?; grammar.external_tokens[symbol.index].name
))
} }
SymbolType::Terminal => { SymbolType::Terminal => {
Err(ProcessInlinesError::Token( return Err(anyhow!(
lexical_grammar.variables[symbol.index].name.clone(), "Token `{}` cannot be inlined",
))?; lexical_grammar.variables[symbol.index].name,
))
} }
SymbolType::NonTerminal if symbol.index == 0 => { SymbolType::NonTerminal if symbol.index == 0 => {
Err(ProcessInlinesError::FirstRule( return Err(anyhow!(
grammar.variables[symbol.index].name.clone(), "Rule `{}` cannot be inlined because it is the first rule",
))?; grammar.variables[symbol.index].name,
))
} }
_ => {} _ => {}
} }
@ -549,9 +538,10 @@ mod tests {
..Default::default() ..Default::default()
}; };
let result = process_inlines(&grammar, &lexical_grammar); if let Err(error) = process_inlines(&grammar, &lexical_grammar) {
assert!(result.is_err(), "expected an error, but got none"); assert_eq!(error.to_string(), "Token `something` cannot be inlined");
let err = result.err().unwrap(); } else {
assert_eq!(err.to_string(), "Token `something` cannot be inlined",); panic!("expected an error, but got none");
}
} }
} }

View file

@ -1,19 +1,15 @@
use std::{ use std::{
cmp, cmp,
collections::{BTreeMap, BTreeSet, HashMap, HashSet}, collections::{HashMap, HashSet},
fmt::Write, fmt::Write,
mem::swap, mem::swap,
}; };
use crate::LANGUAGE_VERSION;
use indoc::indoc;
use super::{ use super::{
build_tables::Tables, build_tables::Tables,
grammars::{ExternalToken, LexicalGrammar, SyntaxGrammar, VariableType}, grammars::{ExternalToken, LexicalGrammar, SyntaxGrammar, VariableType},
nfa::CharacterSet, nfa::CharacterSet,
node_types::ChildType, rules::{Alias, AliasMap, Symbol, SymbolType},
rules::{Alias, AliasMap, Symbol, SymbolType, TokenSet},
tables::{ tables::{
AdvanceAction, FieldLocation, GotoAction, LexState, LexTable, ParseAction, ParseTable, AdvanceAction, FieldLocation, GotoAction, LexState, LexTable, ParseAction, ParseTable,
ParseTableEntry, ParseTableEntry,
@ -21,11 +17,12 @@ use super::{
}; };
const SMALL_STATE_THRESHOLD: usize = 64; const SMALL_STATE_THRESHOLD: usize = 64;
pub const ABI_VERSION_MIN: usize = 14; const ABI_VERSION_MIN: usize = 14;
pub const ABI_VERSION_MAX: usize = LANGUAGE_VERSION; const ABI_VERSION_MAX: usize = tree_sitter::LANGUAGE_VERSION;
const ABI_VERSION_WITH_RESERVED_WORDS: usize = 15; const ABI_VERSION_WITH_METADATA: usize = 15;
const BUILD_VERSION: &str = env!("CARGO_PKG_VERSION");
const BUILD_SHA: Option<&'static str> = option_env!("BUILD_SHA");
#[clippy::format_args]
macro_rules! add { macro_rules! add {
($this: tt, $($arg: tt)*) => {{ ($this: tt, $($arg: tt)*) => {{
$this.buffer.write_fmt(format_args!($($arg)*)).unwrap(); $this.buffer.write_fmt(format_args!($($arg)*)).unwrap();
@ -34,15 +31,12 @@ macro_rules! add {
macro_rules! add_whitespace { macro_rules! add_whitespace {
($this:tt) => {{ ($this:tt) => {{
// 4 bytes per char, 2 spaces per indent level
$this.buffer.reserve(4 * 2 * $this.indent_level);
for _ in 0..$this.indent_level { for _ in 0..$this.indent_level {
write!(&mut $this.buffer, " ").unwrap(); write!(&mut $this.buffer, " ").unwrap();
} }
}}; }};
} }
#[clippy::format_args]
macro_rules! add_line { macro_rules! add_line {
($this: tt, $($arg: tt)*) => { ($this: tt, $($arg: tt)*) => {
add_whitespace!($this); add_whitespace!($this);
@ -64,9 +58,9 @@ macro_rules! dedent {
}; };
} }
#[derive(Default)]
struct Generator { struct Generator {
buffer: String, buffer: String,
header_buffer: String,
indent_level: usize, indent_level: usize,
language_name: String, language_name: String,
parse_table: ParseTable, parse_table: ParseTable,
@ -75,6 +69,7 @@ struct Generator {
large_character_sets: Vec<(Option<Symbol>, CharacterSet)>, large_character_sets: Vec<(Option<Symbol>, CharacterSet)>,
large_character_set_info: Vec<LargeCharacterSetInfo>, large_character_set_info: Vec<LargeCharacterSetInfo>,
large_state_count: usize, large_state_count: usize,
keyword_capture_token: Option<Symbol>,
syntax_grammar: SyntaxGrammar, syntax_grammar: SyntaxGrammar,
lexical_grammar: LexicalGrammar, lexical_grammar: LexicalGrammar,
default_aliases: AliasMap, default_aliases: AliasMap,
@ -83,13 +78,10 @@ struct Generator {
alias_ids: HashMap<Alias, String>, alias_ids: HashMap<Alias, String>,
unique_aliases: Vec<Alias>, unique_aliases: Vec<Alias>,
symbol_map: HashMap<Symbol, Symbol>, symbol_map: HashMap<Symbol, Symbol>,
reserved_word_sets: Vec<TokenSet>,
reserved_word_set_ids_by_parse_state: Vec<usize>,
field_names: Vec<String>, field_names: Vec<String>,
supertype_symbol_map: BTreeMap<Symbol, Vec<ChildType>>,
supertype_map: BTreeMap<String, Vec<ChildType>>, #[allow(unused)]
abi_version: usize, abi_version: usize,
metadata: Option<Metadata>,
} }
struct LargeCharacterSetInfo { struct LargeCharacterSetInfo {
@ -97,14 +89,8 @@ struct LargeCharacterSetInfo {
is_used: bool, is_used: bool,
} }
struct Metadata {
major_version: u8,
minor_version: u8,
patch_version: u8,
}
impl Generator { impl Generator {
fn generate(mut self) -> String { fn generate(mut self) -> (String, String) {
self.init(); self.init();
self.add_header(); self.add_header();
self.add_includes(); self.add_includes();
@ -128,17 +114,13 @@ impl Generator {
self.add_non_terminal_alias_map(); self.add_non_terminal_alias_map();
self.add_primary_state_id_list(); self.add_primary_state_id_list();
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS && !self.supertype_map.is_empty() {
self.add_supertype_map();
}
let buffer_offset_before_lex_functions = self.buffer.len(); let buffer_offset_before_lex_functions = self.buffer.len();
let mut main_lex_table = LexTable::default(); let mut main_lex_table = LexTable::default();
swap(&mut main_lex_table, &mut self.main_lex_table); swap(&mut main_lex_table, &mut self.main_lex_table);
self.add_lex_function("ts_lex", main_lex_table); self.add_lex_function("ts_lex", main_lex_table);
if self.syntax_grammar.word_token.is_some() { if self.keyword_capture_token.is_some() {
let mut keyword_lex_table = LexTable::default(); let mut keyword_lex_table = LexTable::default();
swap(&mut keyword_lex_table, &mut self.keyword_lex_table); swap(&mut keyword_lex_table, &mut self.keyword_lex_table);
self.add_lex_function("ts_lex_keywords", keyword_lex_table); self.add_lex_function("ts_lex_keywords", keyword_lex_table);
@ -154,13 +136,7 @@ impl Generator {
} }
self.buffer.push_str(&lex_functions); self.buffer.push_str(&lex_functions);
self.add_lex_modes(); self.add_lex_modes_list();
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS && self.reserved_word_sets.len() > 1
{
self.add_reserved_word_sets();
}
self.add_parse_table(); self.add_parse_table();
if !self.syntax_grammar.external_tokens.is_empty() { if !self.syntax_grammar.external_tokens.is_empty() {
@ -171,7 +147,7 @@ impl Generator {
self.add_parser_export(); self.add_parser_export();
self.buffer (self.buffer, self.header_buffer)
} }
fn init(&mut self) { fn init(&mut self) {
@ -241,24 +217,33 @@ impl Generator {
for alias in &production_info.alias_sequence { for alias in &production_info.alias_sequence {
// Generate a mapping from aliases to C identifiers. // Generate a mapping from aliases to C identifiers.
if let Some(alias) = &alias { if let Some(alias) = &alias {
// Some aliases match an existing symbol in the grammar. let existing_symbol = self.parse_table.symbols.iter().copied().find(|symbol| {
let alias_id = self.default_aliases.get(symbol).map_or_else(
if let Some(existing_symbol) = self.symbols_for_alias(alias).first() { || {
self.symbol_ids[&self.symbol_map[existing_symbol]].clone() let (name, kind) = self.metadata_for_symbol(*symbol);
} name == alias.value && kind == alias.kind()
// Other aliases don't match any existing symbol, and need their own },
// identifiers. |default_alias| default_alias == alias,
else { )
if let Err(i) = self.unique_aliases.binary_search(alias) { });
self.unique_aliases.insert(i, alias.clone());
}
if alias.is_named { // Some aliases match an existing symbol in the grammar.
format!("alias_sym_{}", self.sanitize_identifier(&alias.value)) let alias_id = if let Some(existing_symbol) = existing_symbol {
} else { self.symbol_ids[&self.symbol_map[&existing_symbol]].clone()
format!("anon_alias_sym_{}", self.sanitize_identifier(&alias.value)) }
} // Other aliases don't match any existing symbol, and need their own
}; // identifiers.
else {
if let Err(i) = self.unique_aliases.binary_search(alias) {
self.unique_aliases.insert(i, alias.clone());
}
if alias.is_named {
format!("alias_sym_{}", self.sanitize_identifier(&alias.value))
} else {
format!("anon_alias_sym_{}", self.sanitize_identifier(&alias.value))
}
};
self.alias_ids.entry(alias.clone()).or_insert(alias_id); self.alias_ids.entry(alias.clone()).or_insert(alias_id);
} }
@ -282,34 +267,6 @@ impl Generator {
}); });
} }
// Assign an id to each unique reserved word set
self.reserved_word_sets.push(TokenSet::new());
for state in &self.parse_table.states {
let id = if let Some(ix) = self
.reserved_word_sets
.iter()
.position(|set| *set == state.reserved_words)
{
ix
} else {
self.reserved_word_sets.push(state.reserved_words.clone());
self.reserved_word_sets.len() - 1
};
self.reserved_word_set_ids_by_parse_state.push(id);
}
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS {
for (supertype, subtypes) in &self.supertype_symbol_map {
if let Some(supertype) = self.symbol_ids.get(supertype) {
self.supertype_map
.entry(supertype.clone())
.or_insert_with(|| subtypes.clone());
}
}
self.supertype_symbol_map.clear();
}
// Determine which states should use the "small state" representation, and which should // Determine which states should use the "small state" representation, and which should
// use the normal array representation. // use the normal array representation.
let threshold = cmp::min(SMALL_STATE_THRESHOLD, self.parse_table.symbols.len() / 2); let threshold = cmp::min(SMALL_STATE_THRESHOLD, self.parse_table.symbols.len() / 2);
@ -325,7 +282,14 @@ impl Generator {
} }
fn add_header(&mut self) { fn add_header(&mut self) {
add_line!(self, "/* Automatically @generated by tree-sitter */",); let version = BUILD_SHA.map_or_else(
|| BUILD_VERSION.to_string(),
|build_sha| format!("{BUILD_VERSION} ({build_sha})"),
);
add_line!(
self,
"/* Automatically generated by tree-sitter v{version} */",
);
add_line!(self, ""); add_line!(self, "");
} }
@ -390,7 +354,7 @@ impl Generator {
self.parse_table.symbols.len() self.parse_table.symbols.len()
); );
add_line!(self, "#define ALIAS_COUNT {}", self.unique_aliases.len()); add_line!(self, "#define ALIAS_COUNT {}", self.unique_aliases.len());
add_line!(self, "#define TOKEN_COUNT {token_count}"); add_line!(self, "#define TOKEN_COUNT {}", token_count);
add_line!( add_line!(
self, self,
"#define EXTERNAL_TOKEN_COUNT {}", "#define EXTERNAL_TOKEN_COUNT {}",
@ -402,22 +366,11 @@ impl Generator {
"#define MAX_ALIAS_SEQUENCE_LENGTH {}", "#define MAX_ALIAS_SEQUENCE_LENGTH {}",
self.parse_table.max_aliased_production_length self.parse_table.max_aliased_production_length
); );
add_line!(
self,
"#define MAX_RESERVED_WORD_SET_SIZE {}",
self.reserved_word_sets
.iter()
.map(TokenSet::len)
.max()
.unwrap()
);
add_line!( add_line!(
self, self,
"#define PRODUCTION_ID_COUNT {}", "#define PRODUCTION_ID_COUNT {}",
self.parse_table.production_infos.len() self.parse_table.production_infos.len()
); );
add_line!(self, "#define SUPERTYPE_COUNT {}", self.supertype_map.len());
add_line!(self, ""); add_line!(self, "");
} }
@ -679,32 +632,31 @@ impl Generator {
&mut next_flat_field_map_index, &mut next_flat_field_map_index,
); );
let mut field_map_ids = Vec::with_capacity(self.parse_table.production_infos.len()); let mut field_map_ids = Vec::new();
for production_info in &self.parse_table.production_infos { for production_info in &self.parse_table.production_infos {
if production_info.field_map.is_empty() { if production_info.field_map.is_empty() {
field_map_ids.push((0, 0)); field_map_ids.push((0, 0));
} else { } else {
let mut flat_field_map = Vec::with_capacity(production_info.field_map.len()); let mut flat_field_map = Vec::new();
for (field_name, locations) in &production_info.field_map { for (field_name, locations) in &production_info.field_map {
for location in locations { for location in locations {
flat_field_map.push((field_name.clone(), *location)); flat_field_map.push((field_name.clone(), *location));
} }
} }
let field_map_len = flat_field_map.len();
field_map_ids.push(( field_map_ids.push((
self.get_field_map_id( self.get_field_map_id(
flat_field_map, flat_field_map.clone(),
&mut flat_field_maps, &mut flat_field_maps,
&mut next_flat_field_map_index, &mut next_flat_field_map_index,
), ),
field_map_len, flat_field_map.len(),
)); ));
} }
} }
add_line!( add_line!(
self, self,
"static const TSMapSlice ts_field_map_slices[PRODUCTION_ID_COUNT] = {{", "static const TSFieldMapSlice ts_field_map_slices[PRODUCTION_ID_COUNT] = {{",
); );
indent!(self); indent!(self);
for (production_id, (row_id, length)) in field_map_ids.into_iter().enumerate() { for (production_id, (row_id, length)) in field_map_ids.into_iter().enumerate() {
@ -743,83 +695,6 @@ impl Generator {
add_line!(self, ""); add_line!(self, "");
} }
fn add_supertype_map(&mut self) {
add_line!(
self,
"static const TSSymbol ts_supertype_symbols[SUPERTYPE_COUNT] = {{"
);
indent!(self);
for supertype in self.supertype_map.keys() {
add_line!(self, "{supertype},");
}
dedent!(self);
add_line!(self, "}};\n");
add_line!(
self,
"static const TSMapSlice ts_supertype_map_slices[] = {{",
);
indent!(self);
let mut row_id = 0;
let mut supertype_ids = vec![0];
let mut supertype_string_map = BTreeMap::new();
for (supertype, subtypes) in &self.supertype_map {
supertype_string_map.insert(
supertype,
subtypes
.iter()
.flat_map(|s| match s {
ChildType::Normal(symbol) => vec![self.symbol_ids.get(symbol).cloned()],
ChildType::Aliased(alias) => {
self.alias_ids.get(alias).cloned().map_or_else(
|| {
self.symbols_for_alias(alias)
.into_iter()
.map(|s| self.symbol_ids.get(&s).cloned())
.collect()
},
|a| vec![Some(a)],
)
}
})
.flatten()
.collect::<BTreeSet<String>>(),
);
}
for (supertype, subtypes) in &supertype_string_map {
let length = subtypes.len();
add_line!(
self,
"[{supertype}] = {{.index = {row_id}, .length = {length}}},",
);
row_id += length;
supertype_ids.push(row_id);
}
dedent!(self);
add_line!(self, "}};");
add_line!(self, "");
add_line!(
self,
"static const TSSymbol ts_supertype_map_entries[] = {{",
);
indent!(self);
for (i, (_, subtypes)) in supertype_string_map.iter().enumerate() {
let row_index = supertype_ids[i];
add_line!(self, "[{row_index}] =");
indent!(self);
for subtype in subtypes {
add_whitespace!(self);
add!(self, "{subtype},\n");
}
dedent!(self);
}
dedent!(self);
add_line!(self, "}};");
add_line!(self, "");
}
fn add_lex_function(&mut self, name: &str, lex_table: LexTable) { fn add_lex_function(&mut self, name: &str, lex_table: LexTable) {
add_line!( add_line!(
self, self,
@ -877,7 +752,7 @@ impl Generator {
&& chars.ranges().all(|r| { && chars.ranges().all(|r| {
let start = *r.start() as u32; let start = *r.start() as u32;
let end = *r.end() as u32; let end = *r.end() as u32;
end <= start + 1 && u16::try_from(end).is_ok() end <= start + 1 && end <= u16::MAX as u32
}) })
{ {
leading_simple_transition_count += 1; leading_simple_transition_count += 1;
@ -965,7 +840,10 @@ impl Generator {
large_char_set_ix = Some(char_set_ix); large_char_set_ix = Some(char_set_ix);
} }
let line_break = format!("\n{}", " ".repeat(self.indent_level + 2)); let mut line_break = "\n".to_string();
for _ in 0..self.indent_level + 2 {
line_break.push_str(" ");
}
let has_positive_condition = large_char_set_ix.is_some() || !asserted_chars.is_empty(); let has_positive_condition = large_char_set_ix.is_some() || !asserted_chars.is_empty();
let has_negative_condition = !negated_chars.is_empty(); let has_negative_condition = !negated_chars.is_empty();
@ -992,7 +870,7 @@ impl Generator {
add!( add!(
self, self,
"set_contains({}, {}, lookahead)", "set_contains({}, {}, lookahead)",
char_set_info.constant_name, &char_set_info.constant_name,
large_set.range_count(), large_set.range_count(),
); );
if check_eof { if check_eof {
@ -1057,6 +935,7 @@ impl Generator {
} }
self.add_character(end); self.add_character(end);
add!(self, ")"); add!(self, ")");
continue;
} else if end == start { } else if end == start {
add!(self, "lookahead == "); add!(self, "lookahead == ");
self.add_character(start); self.add_character(start);
@ -1107,8 +986,21 @@ impl Generator {
add_line!( add_line!(
self, self,
"static const TSCharacterRange {}[] = {{", "const TSCharacterRange {}[{}] = {{",
info.constant_name info.constant_name,
characters.range_count()
);
self.header_buffer += &format!(
"extern const TSCharacterRange {}[{}];\n",
info.constant_name,
characters.range_count()
);
self.header_buffer += &format!(
"static const uint32_t {}_length = {};\n\n",
info.constant_name,
characters.range_count()
); );
indent!(self); indent!(self);
@ -1142,66 +1034,25 @@ impl Generator {
} }
} }
fn add_lex_modes(&mut self) { fn add_lex_modes_list(&mut self) {
add_line!( add_line!(
self, self,
"static const {} ts_lex_modes[STATE_COUNT] = {{", "static const TSLexMode ts_lex_modes[STATE_COUNT] = {{"
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS {
"TSLexerMode"
} else {
"TSLexMode"
}
); );
indent!(self); indent!(self);
for (i, state) in self.parse_table.states.iter().enumerate() { for (i, state) in self.parse_table.states.iter().enumerate() {
add_whitespace!(self);
add!(self, "[{i}] = {{");
if state.is_end_of_non_terminal_extra() { if state.is_end_of_non_terminal_extra() {
add!(self, "(TSStateId)(-1),"); add_line!(self, "[{i}] = {{(TSStateId)(-1)}},");
} else if state.external_lex_state_id > 0 {
add_line!(
self,
"[{i}] = {{.lex_state = {}, .external_lex_state = {}}},",
state.lex_state_id,
state.external_lex_state_id
);
} else { } else {
add!(self, ".lex_state = {}", state.lex_state_id); add_line!(self, "[{i}] = {{.lex_state = {}}},", state.lex_state_id);
if state.external_lex_state_id > 0 {
add!(
self,
", .external_lex_state = {}",
state.external_lex_state_id
);
}
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS {
let reserved_word_set_id = self.reserved_word_set_ids_by_parse_state[i];
if reserved_word_set_id != 0 {
add!(self, ", .reserved_word_set_id = {reserved_word_set_id}");
}
}
} }
add!(self, "}},\n");
}
dedent!(self);
add_line!(self, "}};");
add_line!(self, "");
}
fn add_reserved_word_sets(&mut self) {
add_line!(
self,
"static const TSSymbol ts_reserved_words[{}][MAX_RESERVED_WORD_SET_SIZE] = {{",
self.reserved_word_sets.len(),
);
indent!(self);
for (id, set) in self.reserved_word_sets.iter().enumerate() {
if id == 0 {
continue;
}
add_line!(self, "[{id}] = {{");
indent!(self);
for token in set.iter() {
add_line!(self, "{},", self.symbol_ids[&token]);
}
dedent!(self);
add_line!(self, "}},");
} }
dedent!(self); dedent!(self);
add_line!(self, "}};"); add_line!(self, "}};");
@ -1255,7 +1106,7 @@ impl Generator {
indent!(self); indent!(self);
for i in 0..self.parse_table.external_lex_states.len() { for i in 0..self.parse_table.external_lex_states.len() {
if !self.parse_table.external_lex_states[i].is_empty() { if !self.parse_table.external_lex_states[i].is_empty() {
add_line!(self, "[{i}] = {{"); add_line!(self, "[{}] = {{", i);
indent!(self); indent!(self);
for token in self.parse_table.external_lex_states[i].iter() { for token in self.parse_table.external_lex_states[i].iter() {
add_line!( add_line!(
@ -1277,7 +1128,6 @@ impl Generator {
let mut parse_table_entries = HashMap::new(); let mut parse_table_entries = HashMap::new();
let mut next_parse_action_list_index = 0; let mut next_parse_action_list_index = 0;
// Parse action lists zero is for the default value, when a symbol is not valid.
self.get_parse_action_list_id( self.get_parse_action_list_id(
&ParseTableEntry { &ParseTableEntry {
actions: Vec::new(), actions: Vec::new(),
@ -1303,7 +1153,7 @@ impl Generator {
.enumerate() .enumerate()
.take(self.large_state_count) .take(self.large_state_count)
{ {
add_line!(self, "[STATE({i})] = {{"); add_line!(self, "[{i}] = {{");
indent!(self); indent!(self);
// Ensure the entries are in a deterministic order, since they are // Ensure the entries are in a deterministic order, since they are
@ -1335,11 +1185,9 @@ impl Generator {
); );
add_line!(self, "[{}] = ACTIONS({entry_id}),", self.symbol_ids[symbol]); add_line!(self, "[{}] = ACTIONS({entry_id}),", self.symbol_ids[symbol]);
} }
dedent!(self); dedent!(self);
add_line!(self, "}},"); add_line!(self, "}},");
} }
dedent!(self); dedent!(self);
add_line!(self, "}};"); add_line!(self, "}};");
add_line!(self, ""); add_line!(self, "");
@ -1348,16 +1196,11 @@ impl Generator {
add_line!(self, "static const uint16_t ts_small_parse_table[] = {{"); add_line!(self, "static const uint16_t ts_small_parse_table[] = {{");
indent!(self); indent!(self);
let mut next_table_index = 0; let mut index = 0;
let mut small_state_indices = Vec::with_capacity( let mut small_state_indices = Vec::new();
self.parse_table
.states
.len()
.saturating_sub(self.large_state_count),
);
let mut symbols_by_value = HashMap::<(usize, SymbolType), Vec<Symbol>>::new(); let mut symbols_by_value = HashMap::<(usize, SymbolType), Vec<Symbol>>::new();
for state in self.parse_table.states.iter().skip(self.large_state_count) { for state in self.parse_table.states.iter().skip(self.large_state_count) {
small_state_indices.push(next_table_index); small_state_indices.push(index);
symbols_by_value.clear(); symbols_by_value.clear();
terminal_entries.clear(); terminal_entries.clear();
@ -1396,16 +1239,10 @@ impl Generator {
(symbols.len(), *kind, *value, symbols[0]) (symbols.len(), *kind, *value, symbols[0])
}); });
add_line!( add_line!(self, "[{index}] = {},", values_with_symbols.len());
self,
"[{next_table_index}] = {},",
values_with_symbols.len()
);
indent!(self); indent!(self);
next_table_index += 1;
for ((value, kind), symbols) in &mut values_with_symbols { for ((value, kind), symbols) in &mut values_with_symbols {
next_table_index += 2 + symbols.len();
if *kind == SymbolType::NonTerminal { if *kind == SymbolType::NonTerminal {
add_line!(self, "STATE({value}), {},", symbols.len()); add_line!(self, "STATE({value}), {},", symbols.len());
} else { } else {
@ -1421,6 +1258,11 @@ impl Generator {
} }
dedent!(self); dedent!(self);
index += 1 + values_with_symbols
.iter()
.map(|(_, symbols)| 2 + symbols.len())
.sum::<usize>();
} }
dedent!(self); dedent!(self);
@ -1549,7 +1391,7 @@ impl Generator {
indent!(self); indent!(self);
add_line!(self, "static const TSLanguage language = {{"); add_line!(self, "static const TSLanguage language = {{");
indent!(self); indent!(self);
add_line!(self, ".abi_version = LANGUAGE_VERSION,"); add_line!(self, ".version = LANGUAGE_VERSION,");
// Quantities // Quantities
add_line!(self, ".symbol_count = SYMBOL_COUNT,"); add_line!(self, ".symbol_count = SYMBOL_COUNT,");
@ -1559,9 +1401,6 @@ impl Generator {
add_line!(self, ".state_count = STATE_COUNT,"); add_line!(self, ".state_count = STATE_COUNT,");
add_line!(self, ".large_state_count = LARGE_STATE_COUNT,"); add_line!(self, ".large_state_count = LARGE_STATE_COUNT,");
add_line!(self, ".production_id_count = PRODUCTION_ID_COUNT,"); add_line!(self, ".production_id_count = PRODUCTION_ID_COUNT,");
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS {
add_line!(self, ".supertype_count = SUPERTYPE_COUNT,");
}
add_line!(self, ".field_count = FIELD_COUNT,"); add_line!(self, ".field_count = FIELD_COUNT,");
add_line!( add_line!(
self, self,
@ -1583,11 +1422,6 @@ impl Generator {
add_line!(self, ".field_map_slices = ts_field_map_slices,"); add_line!(self, ".field_map_slices = ts_field_map_slices,");
add_line!(self, ".field_map_entries = ts_field_map_entries,"); add_line!(self, ".field_map_entries = ts_field_map_entries,");
} }
if !self.supertype_map.is_empty() && self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS {
add_line!(self, ".supertype_map_slices = ts_supertype_map_slices,");
add_line!(self, ".supertype_map_entries = ts_supertype_map_entries,");
add_line!(self, ".supertype_symbols = ts_supertype_symbols,");
}
add_line!(self, ".symbol_metadata = ts_symbol_metadata,"); add_line!(self, ".symbol_metadata = ts_symbol_metadata,");
add_line!(self, ".public_symbol_map = ts_symbol_map,"); add_line!(self, ".public_symbol_map = ts_symbol_map,");
add_line!(self, ".alias_map = ts_non_terminal_alias_map,"); add_line!(self, ".alias_map = ts_non_terminal_alias_map,");
@ -1596,9 +1430,9 @@ impl Generator {
} }
// Lexing // Lexing
add_line!(self, ".lex_modes = (const void*)ts_lex_modes,"); add_line!(self, ".lex_modes = ts_lex_modes,");
add_line!(self, ".lex_fn = ts_lex,"); add_line!(self, ".lex_fn = ts_lex,");
if let Some(keyword_capture_token) = self.syntax_grammar.word_token { if let Some(keyword_capture_token) = self.keyword_capture_token {
add_line!(self, ".keyword_lex_fn = ts_lex_keywords,"); add_line!(self, ".keyword_lex_fn = ts_lex_keywords,");
add_line!( add_line!(
self, self,
@ -1623,40 +1457,8 @@ impl Generator {
add_line!(self, ".primary_state_ids = ts_primary_state_ids,"); add_line!(self, ".primary_state_ids = ts_primary_state_ids,");
if self.abi_version >= ABI_VERSION_WITH_RESERVED_WORDS { if self.abi_version >= ABI_VERSION_WITH_METADATA {
add_line!(self, ".name = \"{}\",", self.language_name); add_line!(self, ".name = \"{}\",", self.language_name);
if self.reserved_word_sets.len() > 1 {
add_line!(self, ".reserved_words = &ts_reserved_words[0][0],");
}
add_line!(
self,
".max_reserved_word_set_size = {},",
self.reserved_word_sets
.iter()
.map(TokenSet::len)
.max()
.unwrap()
);
let Some(metadata) = &self.metadata else {
panic!(
indoc! {"
Metadata is required to generate ABI version {}.
This means that your grammar doesn't have a tree-sitter.json config file with an appropriate version field in the metadata table.
"},
self.abi_version
);
};
add_line!(self, ".metadata = {{");
indent!(self);
add_line!(self, ".major_version = {},", metadata.major_version);
add_line!(self, ".minor_version = {},", metadata.minor_version);
add_line!(self, ".patch_version = {},", metadata.patch_version);
dedent!(self);
add_line!(self, "}},");
} }
dedent!(self); dedent!(self);
@ -1758,23 +1560,6 @@ impl Generator {
} }
} }
fn symbols_for_alias(&self, alias: &Alias) -> Vec<Symbol> {
self.parse_table
.symbols
.iter()
.copied()
.filter(move |symbol| {
self.default_aliases.get(symbol).map_or_else(
|| {
let (name, kind) = self.metadata_for_symbol(*symbol);
name == alias.value && kind == alias.kind()
},
|default_alias| default_alias == alias,
)
})
.collect()
}
fn sanitize_identifier(&self, name: &str) -> String { fn sanitize_identifier(&self, name: &str) -> String {
let mut result = String::with_capacity(name.len()); let mut result = String::with_capacity(name.len());
for c in name.chars() { for c in name.chars() {
@ -1850,11 +1635,11 @@ impl Generator {
'\u{007F}' => "DEL", '\u{007F}' => "DEL",
'\u{FEFF}' => "BOM", '\u{FEFF}' => "BOM",
'\u{0080}'..='\u{FFFF}' => { '\u{0080}'..='\u{FFFF}' => {
write!(result, "u{:04x}", c as u32).unwrap(); result.push_str(&format!("u{:04x}", c as u32));
break 'special_chars; break 'special_chars;
} }
'\u{10000}'..='\u{10FFFF}' => { '\u{10000}'..='\u{10FFFF}' => {
write!(result, "U{:08x}", c as u32).unwrap(); result.push_str(&format!("U{:08x}", c as u32));
break 'special_chars; break 'special_chars;
} }
'0'..='9' | 'a'..='z' | 'A'..='Z' | '_' => unreachable!(), '0'..='9' | 'a'..='z' | 'A'..='Z' | '_' => unreachable!(),
@ -1885,9 +1670,11 @@ impl Generator {
'\r' => result += "\\r", '\r' => result += "\\r",
'\t' => result += "\\t", '\t' => result += "\\t",
'\0' => result += "\\0", '\0' => result += "\\0",
'\u{0001}'..='\u{001f}' => write!(result, "\\x{:02x}", c as u32).unwrap(), '\u{0001}'..='\u{001f}' => result += &format!("\\x{:02x}", c as u32),
'\u{007F}'..='\u{FFFF}' => write!(result, "\\u{:04x}", c as u32).unwrap(), '\u{007F}'..='\u{FFFF}' => result += &format!("\\u{:04x}", c as u32),
'\u{10000}'..='\u{10FFFF}' => write!(result, "\\U{:08x}", c as u32).unwrap(), '\u{10000}'..='\u{10FFFF}' => {
result.push_str(&format!("\\U{:08x}", c as u32));
}
_ => result.push(c), _ => result.push(c),
} }
} }
@ -1940,32 +1727,34 @@ pub fn render_c_code(
lexical_grammar: LexicalGrammar, lexical_grammar: LexicalGrammar,
default_aliases: AliasMap, default_aliases: AliasMap,
abi_version: usize, abi_version: usize,
semantic_version: Option<(u8, u8, u8)>, ) -> (String, String) {
supertype_symbol_map: BTreeMap<Symbol, Vec<ChildType>>,
) -> String {
assert!( assert!(
(ABI_VERSION_MIN..=ABI_VERSION_MAX).contains(&abi_version), (ABI_VERSION_MIN..=ABI_VERSION_MAX).contains(&abi_version),
"This version of Tree-sitter can only generate parsers with ABI version {ABI_VERSION_MIN} - {ABI_VERSION_MAX}, not {abi_version}", "This version of Tree-sitter can only generate parsers with ABI version {ABI_VERSION_MIN} - {ABI_VERSION_MAX}, not {abi_version}",
); );
Generator { Generator {
buffer: String::new(),
header_buffer: String::new(),
indent_level: 0,
language_name: name.to_string(), language_name: name.to_string(),
large_state_count: 0,
parse_table: tables.parse_table, parse_table: tables.parse_table,
main_lex_table: tables.main_lex_table, main_lex_table: tables.main_lex_table,
keyword_lex_table: tables.keyword_lex_table, keyword_lex_table: tables.keyword_lex_table,
keyword_capture_token: tables.word_token,
large_character_sets: tables.large_character_sets, large_character_sets: tables.large_character_sets,
large_character_set_info: Vec::new(), large_character_set_info: Vec::new(),
syntax_grammar, syntax_grammar,
lexical_grammar, lexical_grammar,
default_aliases, default_aliases,
symbol_ids: HashMap::new(),
symbol_order: HashMap::new(),
alias_ids: HashMap::new(),
symbol_map: HashMap::new(),
unique_aliases: Vec::new(),
field_names: Vec::new(),
abi_version, abi_version,
metadata: semantic_version.map(|(major_version, minor_version, patch_version)| Metadata {
major_version,
minor_version,
patch_version,
}),
supertype_symbol_map,
..Default::default()
} }
.generate() .generate()
} }

View file

@ -1,11 +1,10 @@
use std::{collections::BTreeMap, fmt}; use std::{collections::HashMap, fmt};
use serde::Serialize;
use smallbitvec::SmallBitVec; use smallbitvec::SmallBitVec;
use super::grammars::VariableType; use super::grammars::VariableType;
#[derive(Clone, Copy, Debug, PartialEq, Eq, Hash, PartialOrd, Ord, Serialize)] #[derive(Clone, Copy, Debug, PartialEq, Eq, Hash, PartialOrd, Ord)]
pub enum SymbolType { pub enum SymbolType {
External, External,
End, End,
@ -14,19 +13,19 @@ pub enum SymbolType {
NonTerminal, NonTerminal,
} }
#[derive(Clone, Copy, Debug, PartialEq, Eq, Hash, PartialOrd, Ord, Serialize)] #[derive(Clone, Copy, Debug, PartialEq, Eq, Hash, PartialOrd, Ord)]
pub enum Associativity { pub enum Associativity {
Left, Left,
Right, Right,
} }
#[derive(Clone, Debug, PartialEq, Eq, Hash, PartialOrd, Ord, Serialize)] #[derive(Clone, Debug, PartialEq, Eq, Hash, PartialOrd, Ord)]
pub struct Alias { pub struct Alias {
pub value: String, pub value: String,
pub is_named: bool, pub is_named: bool,
} }
#[derive(Clone, Debug, PartialEq, Eq, Hash, PartialOrd, Ord, Default, Serialize)] #[derive(Clone, Debug, PartialEq, Eq, Hash, PartialOrd, Ord, Default)]
pub enum Precedence { pub enum Precedence {
#[default] #[default]
None, None,
@ -34,50 +33,48 @@ pub enum Precedence {
Name(String), Name(String),
} }
pub type AliasMap = BTreeMap<Symbol, Alias>; pub type AliasMap = HashMap<Symbol, Alias>;
#[derive(Clone, Debug, Default, PartialEq, Eq, Hash, Serialize)] #[derive(Clone, Debug, Default, PartialEq, Eq, Hash)]
pub struct MetadataParams { pub struct MetadataParams {
pub precedence: Precedence, pub precedence: Precedence,
pub dynamic_precedence: i32, pub dynamic_precedence: i32,
pub associativity: Option<Associativity>, pub associativity: Option<Associativity>,
pub is_token: bool, pub is_token: bool,
pub is_string: bool,
pub is_active: bool,
pub is_main_token: bool, pub is_main_token: bool,
pub alias: Option<Alias>, pub alias: Option<Alias>,
pub field_name: Option<String>, pub field_name: Option<String>,
} }
#[derive(Clone, Copy, Debug, PartialEq, Eq, Hash, PartialOrd, Ord, Serialize)] #[derive(Clone, Copy, Debug, PartialEq, Eq, Hash, PartialOrd, Ord)]
pub struct Symbol { pub struct Symbol {
pub kind: SymbolType, pub kind: SymbolType,
pub index: usize, pub index: usize,
} }
#[derive(Clone, Debug, PartialEq, Eq, Hash, Serialize)] #[derive(Clone, Debug, PartialEq, Eq, Hash)]
pub enum Rule { pub enum Rule {
Blank, Blank,
String(String), String(String),
Pattern(String, String), Pattern(String, String),
NamedSymbol(String), NamedSymbol(String),
Symbol(Symbol), Symbol(Symbol),
Choice(Vec<Self>), Choice(Vec<Rule>),
Metadata { Metadata {
params: MetadataParams, params: MetadataParams,
rule: Box<Self>, rule: Box<Rule>,
},
Repeat(Box<Self>),
Seq(Vec<Self>),
Reserved {
rule: Box<Self>,
context_name: String,
}, },
Repeat(Box<Rule>),
Seq(Vec<Rule>),
} }
// Because tokens are represented as small (~400 max) unsigned integers, // Because tokens are represented as small (~400 max) unsigned integers,
// sets of tokens can be efficiently represented as bit vectors with each // sets of tokens can be efficiently represented as bit vectors with each
// index corresponding to a token, and each value representing whether or not // index corresponding to a token, and each value representing whether or not
// the token is present in the set. // the token is present in the set.
#[derive(Default, Clone, PartialEq, Eq, Hash)] #[derive(Debug, Clone, PartialEq, Eq, Hash)]
pub struct TokenSet { pub struct TokenSet {
terminal_bits: SmallBitVec, terminal_bits: SmallBitVec,
external_bits: SmallBitVec, external_bits: SmallBitVec,
@ -85,32 +82,6 @@ pub struct TokenSet {
end_of_nonterminal_extra: bool, end_of_nonterminal_extra: bool,
} }
impl fmt::Debug for TokenSet {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.debug_list().entries(self.iter()).finish()
}
}
impl PartialOrd for TokenSet {
fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> {
Some(self.cmp(other))
}
}
impl Ord for TokenSet {
fn cmp(&self, other: &Self) -> std::cmp::Ordering {
self.terminal_bits
.iter()
.cmp(other.terminal_bits.iter())
.then_with(|| self.external_bits.iter().cmp(other.external_bits.iter()))
.then_with(|| self.eof.cmp(&other.eof))
.then_with(|| {
self.end_of_nonterminal_extra
.cmp(&other.end_of_nonterminal_extra)
})
}
}
impl Rule { impl Rule {
pub fn field(name: String, content: Self) -> Self { pub fn field(name: String, content: Self) -> Self {
add_metadata(content, move |params| { add_metadata(content, move |params| {
@ -183,9 +154,7 @@ impl Rule {
match self { match self {
Self::Blank | Self::Pattern(..) | Self::NamedSymbol(_) | Self::Symbol(_) => false, Self::Blank | Self::Pattern(..) | Self::NamedSymbol(_) | Self::Symbol(_) => false,
Self::String(string) => string.is_empty(), Self::String(string) => string.is_empty(),
Self::Metadata { rule, .. } | Self::Repeat(rule) | Self::Reserved { rule, .. } => { Self::Metadata { rule, .. } | Self::Repeat(rule) => rule.is_empty(),
rule.is_empty()
}
Self::Choice(rules) => rules.iter().any(Self::is_empty), Self::Choice(rules) => rules.iter().any(Self::is_empty),
Self::Seq(rules) => rules.iter().all(Self::is_empty), Self::Seq(rules) => rules.iter().all(Self::is_empty),
} }
@ -306,6 +275,7 @@ impl Symbol {
} }
impl From<Symbol> for Rule { impl From<Symbol> for Rule {
#[must_use]
fn from(symbol: Symbol) -> Self { fn from(symbol: Symbol) -> Self {
Self::Symbol(symbol) Self::Symbol(symbol)
} }
@ -424,9 +394,6 @@ impl TokenSet {
}; };
if other.index < vec.len() && vec[other.index] { if other.index < vec.len() && vec[other.index] {
vec.set(other.index, false); vec.set(other.index, false);
while vec.last() == Some(false) {
vec.pop();
}
return true; return true;
} }
false false
@ -439,13 +406,6 @@ impl TokenSet {
&& !self.external_bits.iter().any(|a| a) && !self.external_bits.iter().any(|a| a)
} }
pub fn len(&self) -> usize {
self.eof as usize
+ self.end_of_nonterminal_extra as usize
+ self.terminal_bits.iter().filter(|b| *b).count()
+ self.external_bits.iter().filter(|b| *b).count()
}
pub fn insert_all_terminals(&mut self, other: &Self) -> bool { pub fn insert_all_terminals(&mut self, other: &Self) -> bool {
let mut result = false; let mut result = false;
if other.terminal_bits.len() > self.terminal_bits.len() { if other.terminal_bits.len() > self.terminal_bits.len() {

View file

@ -47,7 +47,6 @@ pub struct ParseState {
pub id: ParseStateId, pub id: ParseStateId,
pub terminal_entries: IndexMap<Symbol, ParseTableEntry, BuildHasherDefault<FxHasher>>, pub terminal_entries: IndexMap<Symbol, ParseTableEntry, BuildHasherDefault<FxHasher>>,
pub nonterminal_entries: IndexMap<Symbol, GotoAction, BuildHasherDefault<FxHasher>>, pub nonterminal_entries: IndexMap<Symbol, GotoAction, BuildHasherDefault<FxHasher>>,
pub reserved_words: TokenSet,
pub lex_state_id: usize, pub lex_state_id: usize,
pub external_lex_state_id: usize, pub external_lex_state_id: usize,
pub core_id: usize, pub core_id: usize,
@ -65,7 +64,7 @@ pub struct ProductionInfo {
pub field_map: BTreeMap<String, Vec<FieldLocation>>, pub field_map: BTreeMap<String, Vec<FieldLocation>>,
} }
#[derive(Debug, Default, PartialEq, Eq)] #[derive(Debug, PartialEq, Eq)]
pub struct ParseTable { pub struct ParseTable {
pub states: Vec<ParseState>, pub states: Vec<ParseState>,
pub symbols: Vec<Symbol>, pub symbols: Vec<Symbol>,

View file

@ -8,7 +8,6 @@ rust-version.workspace = true
readme = "README.md" readme = "README.md"
homepage.workspace = true homepage.workspace = true
repository.workspace = true repository.workspace = true
documentation = "https://docs.rs/tree-sitter-loader"
license.workspace = true license.workspace = true
keywords.workspace = true keywords.workspace = true
categories.workspace = true categories.workspace = true
@ -17,30 +16,31 @@ categories.workspace = true
all-features = true all-features = true
rustdoc-args = ["--cfg", "docsrs"] rustdoc-args = ["--cfg", "docsrs"]
[lib]
path = "src/loader.rs"
[lints] [lints]
workspace = true workspace = true
[features] [features]
wasm = ["tree-sitter/wasm"] wasm = ["tree-sitter/wasm"]
# TODO: For backward compatibility these must be enabled by default,
# consider removing for the next semver incompatible release
default = ["tree-sitter-highlight", "tree-sitter-tags"] default = ["tree-sitter-highlight", "tree-sitter-tags"]
[dependencies] [dependencies]
anyhow.workspace = true
cc.workspace = true cc.workspace = true
etcetera.workspace = true dirs.workspace = true
fs4.workspace = true fs4.workspace = true
indoc.workspace = true indoc.workspace = true
lazy_static.workspace = true
libloading.workspace = true libloading.workspace = true
log.workspace = true
once_cell.workspace = true once_cell.workspace = true
path-slash.workspace = true
regex.workspace = true regex.workspace = true
semver.workspace = true semver.workspace = true
serde.workspace = true serde.workspace = true
serde_json.workspace = true serde_json.workspace = true
tempfile.workspace = true tempfile.workspace = true
thiserror.workspace = true url.workspace = true
tree-sitter = { workspace = true } tree-sitter = { workspace = true }
tree-sitter-highlight = { workspace = true, optional = true } tree-sitter-highlight = { workspace = true, optional = true }

View file

@ -7,4 +7,7 @@ fn main() {
"cargo:rustc-env=BUILD_HOST={}", "cargo:rustc-env=BUILD_HOST={}",
std::env::var("HOST").unwrap() std::env::var("HOST").unwrap()
); );
let emscripten_version = std::fs::read_to_string("emscripten-version").unwrap();
println!("cargo:rustc-env=EMSCRIPTEN_VERSION={emscripten_version}");
} }

View file

@ -0,0 +1 @@
3.1.64

File diff suppressed because it is too large Load diff

View file

@ -10,7 +10,6 @@ type PrecRightRule = { type: 'PREC_RIGHT'; content: Rule; value: number };
type PrecRule = { type: 'PREC'; content: Rule; value: number }; type PrecRule = { type: 'PREC'; content: Rule; value: number };
type Repeat1Rule = { type: 'REPEAT1'; content: Rule }; type Repeat1Rule = { type: 'REPEAT1'; content: Rule };
type RepeatRule = { type: 'REPEAT'; content: Rule }; type RepeatRule = { type: 'REPEAT'; content: Rule };
type ReservedRule = { type: 'RESERVED'; content: Rule; context_name: string };
type SeqRule = { type: 'SEQ'; members: Rule[] }; type SeqRule = { type: 'SEQ'; members: Rule[] };
type StringRule = { type: 'STRING'; value: string }; type StringRule = { type: 'STRING'; value: string };
type SymbolRule<Name extends string> = { type: 'SYMBOL'; name: Name }; type SymbolRule<Name extends string> = { type: 'SYMBOL'; name: Name };
@ -29,19 +28,12 @@ type Rule =
| PrecRule | PrecRule
| Repeat1Rule | Repeat1Rule
| RepeatRule | RepeatRule
| ReservedRule
| SeqRule | SeqRule
| StringRule | StringRule
| SymbolRule<string> | SymbolRule<string>
| TokenRule; | TokenRule;
declare class RustRegex { type RuleOrLiteral = Rule | RegExp | string;
value: string;
constructor(pattern: string);
}
type RuleOrLiteral = Rule | RegExp | RustRegex | string;
type GrammarSymbols<RuleName extends string> = { type GrammarSymbols<RuleName extends string> = {
[name in RuleName]: SymbolRule<name>; [name in RuleName]: SymbolRule<name>;
@ -113,7 +105,7 @@ interface Grammar<
* @param $ grammar rules * @param $ grammar rules
* @param previous array of externals from the base schema, if any * @param previous array of externals from the base schema, if any
* *
* @see https://tree-sitter.github.io/tree-sitter/creating-parsers/4-external-scanners * @see https://tree-sitter.github.io/tree-sitter/creating-parsers#external-scanners
*/ */
externals?: ( externals?: (
$: Record<string, SymbolRule<string>>, $: Record<string, SymbolRule<string>>,
@ -151,7 +143,7 @@ interface Grammar<
* *
* @param $ grammar rules * @param $ grammar rules
* *
* @see https://tree-sitter.github.io/tree-sitter/using-parsers/6-static-node-types * @see https://tree-sitter.github.io/tree-sitter/using-parsers#static-node-types
*/ */
supertypes?: ( supertypes?: (
$: GrammarSymbols<RuleName | BaseGrammarRuleName>, $: GrammarSymbols<RuleName | BaseGrammarRuleName>,
@ -164,20 +156,9 @@ interface Grammar<
* *
* @param $ grammar rules * @param $ grammar rules
* *
* @see https://tree-sitter.github.io/tree-sitter/creating-parsers/3-writing-the-grammar#keyword-extraction * @see https://tree-sitter.github.io/tree-sitter/creating-parsers#keyword-extraction
*/ */
word?: ($: GrammarSymbols<RuleName | BaseGrammarRuleName>) => RuleOrLiteral; word?: ($: GrammarSymbols<RuleName | BaseGrammarRuleName>) => RuleOrLiteral;
/**
* Mapping of names to reserved word sets. The first reserved word set is the
* global word set, meaning it applies to every rule in every parse state.
* The other word sets can be used with the `reserved` function.
*/
reserved?: Record<
string,
($: GrammarSymbols<RuleName | BaseGrammarRuleName>) => RuleOrLiteral[]
>;
} }
type GrammarSchema<RuleName extends string> = { type GrammarSchema<RuleName extends string> = {
@ -262,7 +243,7 @@ declare function optional(rule: RuleOrLiteral): ChoiceRule;
* @see https://docs.oracle.com/cd/E19504-01/802-5880/6i9k05dh3/index.html * @see https://docs.oracle.com/cd/E19504-01/802-5880/6i9k05dh3/index.html
*/ */
declare const prec: { declare const prec: {
(value: string | number, rule: RuleOrLiteral): PrecRule; (value: String | number, rule: RuleOrLiteral): PrecRule;
/** /**
* Marks the given rule as left-associative (and optionally applies a * Marks the given rule as left-associative (and optionally applies a
@ -278,7 +259,7 @@ declare const prec: {
* @see https://docs.oracle.com/cd/E19504-01/802-5880/6i9k05dh3/index.html * @see https://docs.oracle.com/cd/E19504-01/802-5880/6i9k05dh3/index.html
*/ */
left(rule: RuleOrLiteral): PrecLeftRule; left(rule: RuleOrLiteral): PrecLeftRule;
left(value: string | number, rule: RuleOrLiteral): PrecLeftRule; left(value: String | number, rule: RuleOrLiteral): PrecLeftRule;
/** /**
* Marks the given rule as right-associative (and optionally applies a * Marks the given rule as right-associative (and optionally applies a
@ -294,7 +275,7 @@ declare const prec: {
* @see https://docs.oracle.com/cd/E19504-01/802-5880/6i9k05dh3/index.html * @see https://docs.oracle.com/cd/E19504-01/802-5880/6i9k05dh3/index.html
*/ */
right(rule: RuleOrLiteral): PrecRightRule; right(rule: RuleOrLiteral): PrecRightRule;
right(value: string | number, rule: RuleOrLiteral): PrecRightRule; right(value: String | number, rule: RuleOrLiteral): PrecRightRule;
/** /**
* Marks the given rule with a numerical precedence which will be used to * Marks the given rule with a numerical precedence which will be used to
@ -311,7 +292,7 @@ declare const prec: {
* *
* @see https://www.gnu.org/software/bison/manual/html_node/Generalized-LR-Parsing.html * @see https://www.gnu.org/software/bison/manual/html_node/Generalized-LR-Parsing.html
*/ */
dynamic(value: string | number, rule: RuleOrLiteral): PrecDynamicRule; dynamic(value: String | number, rule: RuleOrLiteral): PrecDynamicRule;
}; };
/** /**
@ -331,15 +312,6 @@ declare function repeat(rule: RuleOrLiteral): RepeatRule;
*/ */
declare function repeat1(rule: RuleOrLiteral): Repeat1Rule; declare function repeat1(rule: RuleOrLiteral): Repeat1Rule;
/**
* Overrides the global reserved word set for a given rule. The word set name
* should be defined in the `reserved` field in the grammar.
*
* @param wordset name of the reserved word set
* @param rule rule that will use the reserved word set
*/
declare function reserved(wordset: string, rule: RuleOrLiteral): ReservedRule;
/** /**
* Creates a rule that matches any number of other rules, one after another. * Creates a rule that matches any number of other rules, one after another.
* It is analogous to simply writing multiple symbols next to each other * It is analogous to simply writing multiple symbols next to each other
@ -358,7 +330,7 @@ declare function sym<Name extends string>(name: Name): SymbolRule<Name>;
/** /**
* Marks the given rule as producing only a single token. Tree-sitter's * Marks the given rule as producing only a single token. Tree-sitter's
* default is to treat each string or RegExp literal in the grammar as a * default is to treat each String or RegExp literal in the grammar as a
* separate token. Each token is matched separately by the lexer and * separate token. Each token is matched separately by the lexer and
* returned as its own leaf node in the tree. The token function allows * returned as its own leaf node in the tree. The token function allows
* you to express a complex rule using the DSL functions (rather * you to express a complex rule using the DSL functions (rather

3
crates/cli/npm/install.js → cli/npm/install.js Normal file → Executable file
View file

@ -6,8 +6,7 @@ const http = require('http');
const https = require('https'); const https = require('https');
const packageJSON = require('./package.json'); const packageJSON = require('./package.json');
https.globalAgent.keepAlive = false; // Look to a results table in https://github.com/tree-sitter/tree-sitter/issues/2196
const matrix = { const matrix = {
platform: { platform: {
'darwin': { 'darwin': {

View file

@ -1,33 +1,24 @@
{ {
"name": "tree-sitter-cli", "name": "tree-sitter-cli",
"version": "0.27.0", "version": "0.25.0",
"author": { "author": "Max Brunsfeld",
"name": "Max Brunsfeld",
"email": "maxbrunsfeld@gmail.com"
},
"maintainers": [
{
"name": "Amaan Qureshi",
"email": "amaanq12@gmail.com"
}
],
"license": "MIT", "license": "MIT",
"repository": { "repository": {
"type": "git", "type": "git",
"url": "git+https://github.com/tree-sitter/tree-sitter.git", "url": "https://github.com/tree-sitter/tree-sitter.git"
"directory": "crates/cli/npm"
}, },
"description": "CLI for generating fast incremental parsers", "description": "CLI for generating fast incremental parsers",
"keywords": [ "keywords": [
"parser", "parser",
"lexer" "lexer"
], ],
"main": "lib/api/index.js",
"engines": { "engines": {
"node": ">=12.0.0" "node": ">=12.0.0"
}, },
"scripts": { "scripts": {
"install": "node install.js", "install": "node install.js",
"prepack": "cp ../../../LICENSE ../README.md .", "prepack": "cp ../../LICENSE ../README.md .",
"postpack": "rm LICENSE README.md" "postpack": "rm LICENSE README.md"
}, },
"bin": { "bin": {

View file

@ -40,11 +40,7 @@ extern "C" {
fn free(ptr: *mut c_void); fn free(ptr: *mut c_void);
} }
pub fn record<T>(f: impl FnOnce() -> T) -> T { pub fn record<T>(f: impl FnOnce() -> T) -> Result<T, String> {
record_checked(f).unwrap()
}
pub fn record_checked<T>(f: impl FnOnce() -> T) -> Result<T, String> {
RECORDER.with(|recorder| { RECORDER.with(|recorder| {
recorder.enabled.store(true, SeqCst); recorder.enabled.store(true, SeqCst);
recorder.allocation_count.store(0, SeqCst); recorder.allocation_count.store(0, SeqCst);
@ -97,49 +93,30 @@ fn record_dealloc(ptr: *mut c_void) {
}); });
} }
/// # Safety unsafe extern "C" fn ts_record_malloc(size: usize) -> *mut c_void {
///
/// The caller must ensure that the returned pointer is eventually
/// freed by calling `ts_record_free`.
#[must_use]
pub unsafe extern "C" fn ts_record_malloc(size: usize) -> *mut c_void {
let result = malloc(size); let result = malloc(size);
record_alloc(result); record_alloc(result);
result result
} }
/// # Safety unsafe extern "C" fn ts_record_calloc(count: usize, size: usize) -> *mut c_void {
///
/// The caller must ensure that the returned pointer is eventually
/// freed by calling `ts_record_free`.
#[must_use]
pub unsafe extern "C" fn ts_record_calloc(count: usize, size: usize) -> *mut c_void {
let result = calloc(count, size); let result = calloc(count, size);
record_alloc(result); record_alloc(result);
result result
} }
/// # Safety unsafe extern "C" fn ts_record_realloc(ptr: *mut c_void, size: usize) -> *mut c_void {
///
/// The caller must ensure that the returned pointer is eventually
/// freed by calling `ts_record_free`.
#[must_use]
pub unsafe extern "C" fn ts_record_realloc(ptr: *mut c_void, size: usize) -> *mut c_void {
let result = realloc(ptr, size); let result = realloc(ptr, size);
if ptr.is_null() { if ptr.is_null() {
record_alloc(result); record_alloc(result);
} else if !core::ptr::eq(ptr, result) { } else if ptr != result {
record_dealloc(ptr); record_dealloc(ptr);
record_alloc(result); record_alloc(result);
} }
result result
} }
/// # Safety unsafe extern "C" fn ts_record_free(ptr: *mut c_void) {
///
/// The caller must ensure that `ptr` was allocated by a previous call
/// to `ts_record_malloc`, `ts_record_calloc`, or `ts_record_realloc`.
pub unsafe extern "C" fn ts_record_free(ptr: *mut c_void) {
record_dealloc(ptr); record_dealloc(ptr);
free(ptr); free(ptr);
} }

View file

@ -23,7 +23,7 @@ pub fn check_consistent_sizes(tree: &Tree, input: &[u8]) {
let mut some_child_has_changes = false; let mut some_child_has_changes = false;
let mut actual_named_child_count = 0; let mut actual_named_child_count = 0;
for i in 0..node.child_count() { for i in 0..node.child_count() {
let child = node.child(i as u32).unwrap(); let child = node.child(i).unwrap();
assert!(child.start_byte() >= last_child_end_byte); assert!(child.start_byte() >= last_child_end_byte);
assert!(child.start_position() >= last_child_end_point); assert!(child.start_position() >= last_child_end_point);
check(child, line_offsets); check(child, line_offsets);

View file

@ -1,11 +1,6 @@
use std::{ use std::{collections::HashMap, env, fs, path::Path};
collections::HashMap,
env, fs,
path::{Path, PathBuf},
sync::LazyLock,
};
use log::{error, info}; use lazy_static::lazy_static;
use rand::Rng; use rand::Rng;
use regex::Regex; use regex::Regex;
use tree_sitter::{Language, Parser}; use tree_sitter::{Language, Parser};
@ -25,30 +20,19 @@ use crate::{
random::Rand, random::Rand,
}, },
parse::perform_edit, parse::perform_edit,
test::{parse_tests, strip_sexp_fields, DiffKey, TestDiff, TestEntry}, test::{parse_tests, print_diff, print_diff_key, strip_sexp_fields, TestEntry},
}; };
pub static LOG_ENABLED: LazyLock<bool> = LazyLock::new(|| env::var("TREE_SITTER_LOG").is_ok()); lazy_static! {
pub static ref LOG_ENABLED: bool = env::var("TREE_SITTER_LOG").is_ok();
pub static LOG_GRAPH_ENABLED: LazyLock<bool> = pub static ref LOG_GRAPH_ENABLED: bool = env::var("TREE_SITTER_LOG_GRAPHS").is_ok();
LazyLock::new(|| env::var("TREE_SITTER_LOG_GRAPHS").is_ok()); pub static ref LANGUAGE_FILTER: Option<String> = env::var("TREE_SITTER_LANGUAGE").ok();
pub static ref EXAMPLE_INCLUDE: Option<Regex> = regex_env_var("TREE_SITTER_EXAMPLE_INCLUDE");
pub static LANGUAGE_FILTER: LazyLock<Option<String>> = pub static ref EXAMPLE_EXCLUDE: Option<Regex> = regex_env_var("TREE_SITTER_EXAMPLE_EXCLUDE");
LazyLock::new(|| env::var("TREE_SITTER_LANGUAGE").ok()); pub static ref START_SEED: usize = new_seed();
pub static ref EDIT_COUNT: usize = int_env_var("TREE_SITTER_EDITS").unwrap_or(3);
pub static EXAMPLE_INCLUDE: LazyLock<Option<Regex>> = pub static ref ITERATION_COUNT: usize = int_env_var("TREE_SITTER_ITERATIONS").unwrap_or(10);
LazyLock::new(|| regex_env_var("TREE_SITTER_EXAMPLE_INCLUDE")); }
pub static EXAMPLE_EXCLUDE: LazyLock<Option<Regex>> =
LazyLock::new(|| regex_env_var("TREE_SITTER_EXAMPLE_EXCLUDE"));
pub static START_SEED: LazyLock<usize> = LazyLock::new(new_seed);
pub static EDIT_COUNT: LazyLock<usize> =
LazyLock::new(|| int_env_var("TREE_SITTER_EDITS").unwrap_or(3));
pub static ITERATION_COUNT: LazyLock<usize> =
LazyLock::new(|| int_env_var("TREE_SITTER_ITERATIONS").unwrap_or(10));
fn int_env_var(name: &'static str) -> Option<usize> { fn int_env_var(name: &'static str) -> Option<usize> {
env::var(name).ok().and_then(|e| e.parse().ok()) env::var(name).ok().and_then(|e| e.parse().ok())
@ -62,15 +46,13 @@ fn regex_env_var(name: &'static str) -> Option<Regex> {
pub fn new_seed() -> usize { pub fn new_seed() -> usize {
int_env_var("TREE_SITTER_SEED").unwrap_or_else(|| { int_env_var("TREE_SITTER_SEED").unwrap_or_else(|| {
let mut rng = rand::thread_rng(); let mut rng = rand::thread_rng();
let seed = rng.gen::<usize>(); rng.gen::<usize>()
info!("Seed: {seed}");
seed
}) })
} }
pub struct FuzzOptions { pub struct FuzzOptions {
pub skipped: Option<Vec<String>>, pub skipped: Option<Vec<String>>,
pub subdir: Option<PathBuf>, pub subdir: Option<String>,
pub edits: usize, pub edits: usize,
pub iterations: usize, pub iterations: usize,
pub include: Option<Regex>, pub include: Option<Regex>,
@ -109,12 +91,12 @@ pub fn fuzz_language_corpus(
let corpus_dir = grammar_dir.join(subdir).join("test").join("corpus"); let corpus_dir = grammar_dir.join(subdir).join("test").join("corpus");
if !corpus_dir.exists() || !corpus_dir.is_dir() { if !corpus_dir.exists() || !corpus_dir.is_dir() {
error!("No corpus directory found, ensure that you have a `test/corpus` directory in your grammar directory with at least one test file."); eprintln!("No corpus directory found, ensure that you have a `test/corpus` directory in your grammar directory with at least one test file.");
return; return;
} }
if std::fs::read_dir(&corpus_dir).unwrap().count() == 0 { if std::fs::read_dir(&corpus_dir).unwrap().count() == 0 {
error!("No corpus files found in `test/corpus`, ensure that you have at least one test file in your corpus directory."); eprintln!("No corpus files found in `test/corpus`, ensure that you have at least one test file in your corpus directory.");
return; return;
} }
@ -150,7 +132,7 @@ pub fn fuzz_language_corpus(
let dump_edits = env::var("TREE_SITTER_DUMP_EDITS").is_ok(); let dump_edits = env::var("TREE_SITTER_DUMP_EDITS").is_ok();
if log_seed { if log_seed {
info!(" start seed: {start_seed}"); println!(" start seed: {start_seed}");
} }
println!(); println!();
@ -164,7 +146,7 @@ pub fn fuzz_language_corpus(
println!(" {test_index}. {test_name}"); println!(" {test_index}. {test_name}");
let passed = allocations::record_checked(|| { let passed = allocations::record(|| {
let mut log_session = None; let mut log_session = None;
let mut parser = get_parser(&mut log_session, "log.html"); let mut parser = get_parser(&mut log_session, "log.html");
parser.set_language(language).unwrap(); parser.set_language(language).unwrap();
@ -183,8 +165,8 @@ pub fn fuzz_language_corpus(
if actual_output != test.output { if actual_output != test.output {
println!("Incorrect initial parse for {test_name}"); println!("Incorrect initial parse for {test_name}");
DiffKey::print(); print_diff_key();
println!("{}", TestDiff::new(&actual_output, &test.output)); print_diff(&actual_output, &test.output, true);
println!(); println!();
return false; return false;
} }
@ -192,7 +174,7 @@ pub fn fuzz_language_corpus(
true true
}) })
.unwrap_or_else(|e| { .unwrap_or_else(|e| {
error!("{e}"); eprintln!("Error: {e}");
false false
}); });
@ -208,7 +190,7 @@ pub fn fuzz_language_corpus(
for trial in 0..options.iterations { for trial in 0..options.iterations {
let seed = start_seed + trial; let seed = start_seed + trial;
let passed = allocations::record_checked(|| { let passed = allocations::record(|| {
let mut rand = Rand::new(seed); let mut rand = Rand::new(seed);
let mut log_session = None; let mut log_session = None;
let mut parser = get_parser(&mut log_session, "log.html"); let mut parser = get_parser(&mut log_session, "log.html");
@ -217,20 +199,19 @@ pub fn fuzz_language_corpus(
let mut input = test.input.clone(); let mut input = test.input.clone();
if options.log_graphs { if options.log_graphs {
info!("{}\n", String::from_utf8_lossy(&input)); eprintln!("{}\n", String::from_utf8_lossy(&input));
} }
// Perform a random series of edits and reparse. // Perform a random series of edits and reparse.
let edit_count = rand.unsigned(*EDIT_COUNT); let mut undo_stack = Vec::new();
let mut undo_stack = Vec::with_capacity(edit_count); for _ in 0..=rand.unsigned(*EDIT_COUNT) {
for _ in 0..=edit_count {
let edit = get_random_edit(&mut rand, &input); let edit = get_random_edit(&mut rand, &input);
undo_stack.push(invert_edit(&input, &edit)); undo_stack.push(invert_edit(&input, &edit));
perform_edit(&mut tree, &mut input, &edit).unwrap(); perform_edit(&mut tree, &mut input, &edit).unwrap();
} }
if log_seed { if log_seed {
info!(" {test_index}.{trial:<2} seed: {seed}"); println!(" {test_index}.{trial:<2} seed: {seed}");
} }
if dump_edits { if dump_edits {
@ -244,7 +225,7 @@ pub fn fuzz_language_corpus(
} }
if options.log_graphs { if options.log_graphs {
info!("{}\n", String::from_utf8_lossy(&input)); eprintln!("{}\n", String::from_utf8_lossy(&input));
} }
set_included_ranges(&mut parser, &input, test.template_delimiters); set_included_ranges(&mut parser, &input, test.template_delimiters);
@ -253,7 +234,7 @@ pub fn fuzz_language_corpus(
// Check that the new tree is consistent. // Check that the new tree is consistent.
check_consistent_sizes(&tree2, &input); check_consistent_sizes(&tree2, &input);
if let Err(message) = check_changed_ranges(&tree, &tree2, &input) { if let Err(message) = check_changed_ranges(&tree, &tree2, &input) {
error!("\nUnexpected scope change in seed {seed} with start seed {start_seed}\n{message}\n\n",); println!("\nUnexpected scope change in seed {seed} with start seed {start_seed}\n{message}\n\n",);
return false; return false;
} }
@ -262,7 +243,7 @@ pub fn fuzz_language_corpus(
perform_edit(&mut tree2, &mut input, &edit).unwrap(); perform_edit(&mut tree2, &mut input, &edit).unwrap();
} }
if options.log_graphs { if options.log_graphs {
info!("{}\n", String::from_utf8_lossy(&input)); eprintln!("{}\n", String::from_utf8_lossy(&input));
} }
set_included_ranges(&mut parser, &test.input, test.template_delimiters); set_included_ranges(&mut parser, &test.input, test.template_delimiters);
@ -276,8 +257,8 @@ pub fn fuzz_language_corpus(
if actual_output != test.output && !test.error { if actual_output != test.output && !test.error {
println!("Incorrect parse for {test_name} - seed {seed}"); println!("Incorrect parse for {test_name} - seed {seed}");
DiffKey::print(); print_diff_key();
println!("{}", TestDiff::new(&actual_output, &test.output)); print_diff(&actual_output, &test.output, true);
println!(); println!();
return false; return false;
} }
@ -285,13 +266,13 @@ pub fn fuzz_language_corpus(
// Check that the edited tree is consistent. // Check that the edited tree is consistent.
check_consistent_sizes(&tree3, &input); check_consistent_sizes(&tree3, &input);
if let Err(message) = check_changed_ranges(&tree2, &tree3, &input) { if let Err(message) = check_changed_ranges(&tree2, &tree3, &input) {
error!("Unexpected scope change in seed {seed} with start seed {start_seed}\n{message}\n\n"); println!("Unexpected scope change in seed {seed} with start seed {start_seed}\n{message}\n\n");
return false; return false;
} }
true true
}).unwrap_or_else(|e| { }).unwrap_or_else(|e| {
error!("{e}"); eprintln!("Error: {e}");
false false
}); });
@ -303,17 +284,17 @@ pub fn fuzz_language_corpus(
} }
if failure_count != 0 { if failure_count != 0 {
info!("{failure_count} {language_name} corpus tests failed fuzzing"); eprintln!("{failure_count} {language_name} corpus tests failed fuzzing");
} }
skipped.retain(|_, v| *v == 0); skipped.retain(|_, v| *v == 0);
if !skipped.is_empty() { if !skipped.is_empty() {
info!("Non matchable skip definitions:"); println!("Non matchable skip definitions:");
for k in skipped.keys() { for k in skipped.keys() {
info!(" {k}"); println!(" {k}");
} }
panic!("Non matchable skip definitions need to be removed"); panic!("Non matchable skip definitions needs to be removed");
} }
} }

View file

@ -20,8 +20,8 @@ impl Rand {
} }
pub fn words(&mut self, max_count: usize) -> Vec<u8> { pub fn words(&mut self, max_count: usize) -> Vec<u8> {
let mut result = Vec::new();
let word_count = self.unsigned(max_count); let word_count = self.unsigned(max_count);
let mut result = Vec::with_capacity(2 * word_count);
for i in 0..word_count { for i in 0..word_count {
if i > 0 { if i > 0 {
if self.unsigned(5) == 0 { if self.unsigned(5) == 0 {

View file

@ -1,24 +1,22 @@
use std::{ use std::{
collections::{BTreeMap, HashSet}, collections::HashMap,
fmt::Write, fmt::Write,
fs, fs,
io::{self, Write as _}, io::{self, Write as _},
path::{self, Path, PathBuf}, path, str,
str, sync::atomic::AtomicUsize,
sync::{atomic::AtomicUsize, Arc},
time::Instant, time::Instant,
}; };
use ansi_colours::{ansi256_from_rgb, rgb_from_ansi256};
use anstyle::{Ansi256Color, AnsiColor, Color, Effects, RgbColor}; use anstyle::{Ansi256Color, AnsiColor, Color, Effects, RgbColor};
use anyhow::Result; use anyhow::Result;
use log::{info, warn}; use lazy_static::lazy_static;
use serde::{ser::SerializeMap, Deserialize, Deserializer, Serialize, Serializer}; use serde::{ser::SerializeMap, Deserialize, Deserializer, Serialize, Serializer};
use serde_json::{json, Value}; use serde_json::{json, Value};
use tree_sitter_highlight::{HighlightConfiguration, HighlightEvent, Highlighter, HtmlRenderer}; use tree_sitter_highlight::{HighlightConfiguration, HighlightEvent, Highlighter, HtmlRenderer};
use tree_sitter_loader::Loader; use tree_sitter_loader::Loader;
pub const HTML_HEAD_HEADER: &str = " pub const HTML_HEADER: &str = "
<!doctype HTML> <!doctype HTML>
<head> <head>
<title>Tree-sitter Highlighting</title> <title>Tree-sitter Highlighting</title>
@ -35,9 +33,7 @@ pub const HTML_HEAD_HEADER: &str = "
.line { .line {
white-space: pre; white-space: pre;
} }
</style>"; </style>
pub const HTML_BODY_HEADER: &str = "
</head> </head>
<body> <body>
"; ";
@ -46,6 +42,11 @@ pub const HTML_FOOTER: &str = "
</body> </body>
"; ";
lazy_static! {
static ref CSS_STYLES_BY_COLOR_ID: Vec<String> =
serde_json::from_str(include_str!("../vendor/xterm-colors.json")).unwrap();
}
#[derive(Debug, Default)] #[derive(Debug, Default)]
pub struct Style { pub struct Style {
pub ansi: anstyle::Style, pub ansi: anstyle::Style,
@ -83,9 +84,9 @@ impl<'de> Deserialize<'de> for Theme {
{ {
let mut styles = Vec::new(); let mut styles = Vec::new();
let mut highlight_names = Vec::new(); let mut highlight_names = Vec::new();
if let Ok(colors) = BTreeMap::<String, Value>::deserialize(deserializer) { if let Ok(colors) = HashMap::<String, Value>::deserialize(deserializer) {
styles.reserve(colors.len());
highlight_names.reserve(colors.len()); highlight_names.reserve(colors.len());
styles.reserve(colors.len());
for (name, style_value) in colors { for (name, style_value) in colors {
let mut style = Style::default(); let mut style = Style::default();
parse_style(&mut style, style_value); parse_style(&mut style, style_value);
@ -128,7 +129,7 @@ impl Serialize for Theme {
|| effects.contains(Effects::ITALIC) || effects.contains(Effects::ITALIC)
|| effects.contains(Effects::UNDERLINE) || effects.contains(Effects::UNDERLINE)
{ {
let mut style_json = BTreeMap::new(); let mut style_json = HashMap::new();
if let Some(color) = color { if let Some(color) = color {
style_json.insert("color", color); style_json.insert("color", color);
} }
@ -155,32 +156,28 @@ impl Serialize for Theme {
impl Default for Theme { impl Default for Theme {
fn default() -> Self { fn default() -> Self {
serde_json::from_value(json!({ serde_json::from_value(json!({
"attribute": {"color": 124, "italic": true}, "attribute": {"color": 124, "italic": true},
"comment": {"color": 245, "italic": true}, "comment": {"color": 245, "italic": true},
"constant": 94, "constant.builtin": {"color": 94, "bold": true},
"constant.builtin": {"color": 94, "bold": true}, "constant": 94,
"constructor": 136, "constructor": 136,
"embedded": null, "embedded": null,
"function": 26, "function.builtin": {"color": 26, "bold": true},
"function.builtin": {"color": 26, "bold": true}, "function": 26,
"keyword": 56, "keyword": 56,
"module": 136, "number": {"color": 94, "bold": true},
"number": {"color": 94, "bold": true}, "module": 136,
"operator": {"color": 239, "bold": true}, "property": 124,
"property": 124, "operator": {"color": 239, "bold": true},
"property.builtin": {"color": 124, "bold": true}, "punctuation.bracket": 239,
"punctuation": 239, "punctuation.delimiter": 239,
"punctuation.bracket": 239, "string.special": 30,
"punctuation.delimiter": 239, "string": 28,
"punctuation.special": 239, "tag": 18,
"string": 28, "type": 23,
"string.special": 30, "type.builtin": {"color": 23, "bold": true},
"tag": 18, "variable.builtin": {"bold": true},
"type": 23, "variable.parameter": {"underline": true}
"type.builtin": {"color": 23, "bold": true},
"variable": 252,
"variable.builtin": {"color": 252, "bold": true},
"variable.parameter": {"color": 252, "underline": true}
})) }))
.unwrap() .unwrap()
} }
@ -223,8 +220,9 @@ fn parse_style(style: &mut Style, json: Value) {
if let Some(Color::Rgb(RgbColor(red, green, blue))) = style.ansi.get_fg_color() { if let Some(Color::Rgb(RgbColor(red, green, blue))) = style.ansi.get_fg_color() {
if !terminal_supports_truecolor() { if !terminal_supports_truecolor() {
let ansi256 = Color::Ansi256(Ansi256Color(ansi256_from_rgb((red, green, blue)))); style.ansi = style
style.ansi = style.ansi.fg_color(Some(ansi256)); .ansi
.fg_color(Some(closest_xterm_color(red, green, blue)));
} }
} }
} }
@ -270,7 +268,7 @@ fn hex_string_to_rgb(s: &str) -> Option<(u8, u8, u8)> {
} }
fn style_to_css(style: anstyle::Style) -> String { fn style_to_css(style: anstyle::Style) -> String {
let mut result = String::new(); let mut result = "style='".to_string();
let effects = style.get_effects(); let effects = style.get_effects();
if effects.contains(Effects::UNDERLINE) { if effects.contains(Effects::UNDERLINE) {
write!(&mut result, "text-decoration: underline;").unwrap(); write!(&mut result, "text-decoration: underline;").unwrap();
@ -284,6 +282,7 @@ fn style_to_css(style: anstyle::Style) -> String {
if let Some(color) = style.get_fg_color() { if let Some(color) = style.get_fg_color() {
write_color(&mut result, color); write_color(&mut result, color);
} }
result.push('\'');
result result
} }
@ -301,8 +300,7 @@ fn write_color(buffer: &mut String, color: Color) {
_ => unreachable!(), _ => unreachable!(),
}, },
Color::Ansi256(Ansi256Color(n)) => { Color::Ansi256(Ansi256Color(n)) => {
let (r, g, b) = rgb_from_ansi256(n); write!(buffer, "color: {}", CSS_STYLES_BY_COLOR_ID[n as usize]).unwrap();
write!(buffer, "color: #{r:02x}{g:02x}{b:02x}").unwrap();
} }
Color::Rgb(RgbColor(r, g, b)) => write!(buffer, "color: #{r:02x}{g:02x}{b:02x}").unwrap(), Color::Rgb(RgbColor(r, g, b)) => write!(buffer, "color: #{r:02x}{g:02x}{b:02x}").unwrap(),
} }
@ -313,144 +311,115 @@ fn terminal_supports_truecolor() -> bool {
.is_ok_and(|truecolor| truecolor == "truecolor" || truecolor == "24bit") .is_ok_and(|truecolor| truecolor == "truecolor" || truecolor == "24bit")
} }
pub struct HighlightOptions { fn closest_xterm_color(red: u8, green: u8, blue: u8) -> Color {
pub theme: Theme, use std::cmp::{max, min};
pub check: bool,
pub captures_path: Option<PathBuf>, let colors = CSS_STYLES_BY_COLOR_ID
pub inline_styles: bool, .iter()
pub html: bool, .enumerate()
pub quiet: bool, .map(|(color_id, hex)| (color_id as u8, hex_string_to_rgb(hex).unwrap()));
pub print_time: bool,
pub cancellation_flag: Arc<AtomicUsize>, // Get the xterm color with the minimum Euclidean distance to the target color
// i.e. distance = √ (r2 - r1)² + (g2 - g1)² + (b2 - b1)²
let distances = colors.map(|(color_id, (r, g, b))| {
let r_delta = (max(r, red) - min(r, red)) as u32;
let g_delta = (max(g, green) - min(g, green)) as u32;
let b_delta = (max(b, blue) - min(b, blue)) as u32;
let distance = r_delta.pow(2) + g_delta.pow(2) + b_delta.pow(2);
// don't need to actually take the square root for the sake of comparison
(color_id, distance)
});
Color::Ansi256(Ansi256Color(
distances.min_by(|(_, d1), (_, d2)| d1.cmp(d2)).unwrap().0,
))
} }
pub fn highlight( pub fn ansi(
loader: &Loader, loader: &Loader,
path: &Path, theme: &Theme,
name: &str, source: &[u8],
config: &HighlightConfiguration, config: &HighlightConfiguration,
print_name: bool, print_time: bool,
opts: &HighlightOptions, cancellation_flag: Option<&AtomicUsize>,
) -> Result<()> { ) -> Result<()> {
if opts.check {
let names = if let Some(path) = opts.captures_path.as_deref() {
let file = fs::read_to_string(path)?;
let capture_names = file
.lines()
.filter_map(|line| {
if line.trim().is_empty() || line.trim().starts_with(';') {
return None;
}
line.split(';').next().map(|s| s.trim().trim_matches('"'))
})
.collect::<HashSet<_>>();
config.nonconformant_capture_names(&capture_names)
} else {
config.nonconformant_capture_names(&HashSet::new())
};
if names.is_empty() {
info!("All highlight captures conform to standards.");
} else {
warn!(
"Non-standard highlight {} detected:\n* {}",
if names.len() > 1 {
"captures"
} else {
"capture"
},
names.join("\n* ")
);
}
}
let source = fs::read(path)?;
let stdout = io::stdout(); let stdout = io::stdout();
let mut stdout = stdout.lock(); let mut stdout = stdout.lock();
let time = Instant::now(); let time = Instant::now();
let mut highlighter = Highlighter::new(); let mut highlighter = Highlighter::new();
let events =
highlighter.highlight(config, &source, Some(&opts.cancellation_flag), |string| {
loader.highlight_config_for_injection_string(string)
})?;
let theme = &opts.theme;
if !opts.quiet && print_name { let events = highlighter.highlight(config, source, cancellation_flag, |string| {
writeln!(&mut stdout, "{name}")?; loader.highlight_config_for_injection_string(string)
} })?;
if opts.html { let mut style_stack = vec![theme.default_style().ansi];
if !opts.quiet { for event in events {
writeln!(&mut stdout, "{HTML_HEAD_HEADER}")?; match event? {
writeln!(&mut stdout, " <style>")?; HighlightEvent::HighlightStart(highlight) => {
let names = theme.highlight_names.iter(); style_stack.push(theme.styles[highlight.0].ansi);
let styles = theme.styles.iter();
for (name, style) in names.zip(styles) {
if let Some(css) = &style.css {
writeln!(&mut stdout, " .{name} {{ {css}; }}")?;
}
} }
writeln!(&mut stdout, " </style>")?; HighlightEvent::HighlightEnd => {
writeln!(&mut stdout, "{HTML_BODY_HEADER}")?; style_stack.pop();
}
let mut renderer = HtmlRenderer::new();
renderer.render(events, &source, &move |highlight, output| {
if opts.inline_styles {
output.extend(b"style='");
output.extend(
theme.styles[highlight.0]
.css
.as_ref()
.map_or_else(|| "".as_bytes(), |css_style| css_style.as_bytes()),
);
output.extend(b"'");
} else {
output.extend(b"class='");
let mut parts = theme.highlight_names[highlight.0].split('.').peekable();
while let Some(part) = parts.next() {
output.extend(part.as_bytes());
if parts.peek().is_some() {
output.extend(b" ");
}
}
output.extend(b"'");
} }
})?; HighlightEvent::Source { start, end } => {
let style = style_stack.last().unwrap();
if !opts.quiet { write!(&mut stdout, "{style}").unwrap();
writeln!(&mut stdout, "<table>")?; stdout.write_all(&source[start..end])?;
for (i, line) in renderer.lines().enumerate() { write!(&mut stdout, "{style:#}").unwrap();
writeln!(
&mut stdout,
"<tr><td class=line-number>{}</td><td class=line>{line}</td></tr>",
i + 1,
)?;
}
writeln!(&mut stdout, "</table>")?;
writeln!(&mut stdout, "{HTML_FOOTER}")?;
}
} else {
let mut style_stack = vec![theme.default_style().ansi];
for event in events {
match event? {
HighlightEvent::HighlightStart(highlight) => {
style_stack.push(theme.styles[highlight.0].ansi);
}
HighlightEvent::HighlightEnd => {
style_stack.pop();
}
HighlightEvent::Source { start, end } => {
let style = style_stack.last().unwrap();
write!(&mut stdout, "{style}").unwrap();
stdout.write_all(&source[start..end])?;
write!(&mut stdout, "{style:#}").unwrap();
}
} }
} }
} }
if opts.print_time { if print_time {
info!("Time: {}ms", time.elapsed().as_millis()); eprintln!("Time: {}ms", time.elapsed().as_millis());
}
Ok(())
}
pub fn html(
loader: &Loader,
theme: &Theme,
source: &[u8],
config: &HighlightConfiguration,
quiet: bool,
print_time: bool,
cancellation_flag: Option<&AtomicUsize>,
) -> Result<()> {
use std::io::Write;
let stdout = io::stdout();
let mut stdout = stdout.lock();
let time = Instant::now();
let mut highlighter = Highlighter::new();
let events = highlighter.highlight(config, source, cancellation_flag, |string| {
loader.highlight_config_for_injection_string(string)
})?;
let mut renderer = HtmlRenderer::new();
renderer.render(events, source, &move |highlight| {
theme.styles[highlight.0]
.css
.as_ref()
.map_or_else(|| "".as_bytes(), |css_style| css_style.as_bytes())
})?;
if !quiet {
writeln!(&mut stdout, "<table>")?;
for (i, line) in renderer.lines().enumerate() {
writeln!(
&mut stdout,
"<tr><td class=line-number>{}</td><td class=line>{line}</td></tr>",
i + 1,
)?;
}
writeln!(&mut stdout, "</table>")?;
}
if print_time {
eprintln!("Time: {}ms", time.elapsed().as_millis());
} }
Ok(()) Ok(())
@ -480,7 +449,7 @@ mod tests {
style.ansi.get_fg_color(), style.ansi.get_fg_color(),
Some(Color::Ansi256(Ansi256Color(36))) Some(Color::Ansi256(Ansi256Color(36)))
); );
assert_eq!(style.css, Some("color: #00af87".to_string())); assert_eq!(style.css, Some("style=\'color: #00af87\'".to_string()));
// junglegreen is not an ANSI color and is preserved when the terminal supports it // junglegreen is not an ANSI color and is preserved when the terminal supports it
env::set_var("COLORTERM", "truecolor"); env::set_var("COLORTERM", "truecolor");
@ -489,16 +458,16 @@ mod tests {
style.ansi.get_fg_color(), style.ansi.get_fg_color(),
Some(Color::Rgb(RgbColor(38, 166, 154))) Some(Color::Rgb(RgbColor(38, 166, 154)))
); );
assert_eq!(style.css, Some("color: #26a69a".to_string())); assert_eq!(style.css, Some("style=\'color: #26a69a\'".to_string()));
// junglegreen gets approximated as cadetblue when the terminal does not support it // junglegreen gets approximated as darkcyan when the terminal does not support it
env::set_var("COLORTERM", ""); env::set_var("COLORTERM", "");
parse_style(&mut style, Value::String(JUNGLE_GREEN.to_string())); parse_style(&mut style, Value::String(JUNGLE_GREEN.to_string()));
assert_eq!( assert_eq!(
style.ansi.get_fg_color(), style.ansi.get_fg_color(),
Some(Color::Ansi256(Ansi256Color(72))) Some(Color::Ansi256(Ansi256Color(36)))
); );
assert_eq!(style.css, Some("color: #26a69a".to_string())); assert_eq!(style.css, Some("style=\'color: #26a69a\'".to_string()));
if let Ok(environment_variable) = original_environment_variable { if let Ok(environment_variable) = original_environment_variable {
env::set_var("COLORTERM", environment_variable); env::set_var("COLORTERM", environment_variable);

992
cli/src/init.rs Normal file
View file

@ -0,0 +1,992 @@
use std::{
fs,
path::{Path, PathBuf},
str::{self, FromStr},
};
use anyhow::{anyhow, Context, Result};
use heck::{ToKebabCase, ToShoutySnakeCase, ToSnakeCase, ToUpperCamelCase};
use regex::Regex;
use semver::Version;
use serde::{Deserialize, Serialize};
use serde_json::{Map, Value};
use tree_sitter_generate::write_file;
use tree_sitter_loader::{
Author, Bindings, Grammar, Links, Metadata, PackageJSON, PackageJSONAuthor,
PackageJSONRepository, PathsJSON, TreeSitterJSON,
};
use url::Url;
const CLI_VERSION: &str = env!("CARGO_PKG_VERSION");
const CLI_VERSION_PLACEHOLDER: &str = "CLI_VERSION";
const ABI_VERSION_MAX: usize = tree_sitter::LANGUAGE_VERSION;
const ABI_VERSION_MAX_PLACEHOLDER: &str = "ABI_VERSION_MAX";
const PARSER_NAME_PLACEHOLDER: &str = "PARSER_NAME";
const CAMEL_PARSER_NAME_PLACEHOLDER: &str = "CAMEL_PARSER_NAME";
const UPPER_PARSER_NAME_PLACEHOLDER: &str = "UPPER_PARSER_NAME";
const LOWER_PARSER_NAME_PLACEHOLDER: &str = "LOWER_PARSER_NAME";
const PARSER_DESCRIPTION_PLACEHOLDER: &str = "PARSER_DESCRIPTION";
const PARSER_LICENSE_PLACEHOLDER: &str = "PARSER_LICENSE";
const PARSER_URL_PLACEHOLDER: &str = "PARSER_URL";
const PARSER_URL_STRIPPED_PLACEHOLDER: &str = "PARSER_URL_STRIPPED";
const PARSER_VERSION_PLACEHOLDER: &str = "PARSER_VERSION";
const AUTHOR_NAME_PLACEHOLDER: &str = "PARSER_AUTHOR_NAME";
const AUTHOR_EMAIL_PLACEHOLDER: &str = "PARSER_AUTHOR_EMAIL";
const AUTHOR_URL_PLACEHOLDER: &str = "PARSER_AUTHOR_URL";
const AUTHOR_BLOCK_JS: &str = "\n \"author\": {";
const AUTHOR_NAME_PLACEHOLDER_JS: &str = "\n \"name\": \"PARSER_AUTHOR_NAME\",";
const AUTHOR_EMAIL_PLACEHOLDER_JS: &str = ",\n \"email\": \"PARSER_AUTHOR_EMAIL\"";
const AUTHOR_URL_PLACEHOLDER_JS: &str = ",\n \"url\": \"PARSER_AUTHOR_URL\"";
const AUTHOR_BLOCK_PY: &str = "\nauthors = [{";
const AUTHOR_NAME_PLACEHOLDER_PY: &str = "name = \"PARSER_AUTHOR_NAME\"";
const AUTHOR_EMAIL_PLACEHOLDER_PY: &str = ", email = \"PARSER_AUTHOR_EMAIL\"";
const AUTHOR_BLOCK_RS: &str = "\nauthors = [";
const AUTHOR_NAME_PLACEHOLDER_RS: &str = "PARSER_AUTHOR_NAME";
const AUTHOR_EMAIL_PLACEHOLDER_RS: &str = " PARSER_AUTHOR_EMAIL";
const AUTHOR_BLOCK_GRAMMAR: &str = "\n * @author ";
const AUTHOR_NAME_PLACEHOLDER_GRAMMAR: &str = "PARSER_AUTHOR_NAME";
const AUTHOR_EMAIL_PLACEHOLDER_GRAMMAR: &str = " PARSER_AUTHOR_EMAIL";
const GRAMMAR_JS_TEMPLATE: &str = include_str!("./templates/grammar.js");
const PACKAGE_JSON_TEMPLATE: &str = include_str!("./templates/package.json");
const GITIGNORE_TEMPLATE: &str = include_str!("./templates/gitignore");
const GITATTRIBUTES_TEMPLATE: &str = include_str!("./templates/gitattributes");
const EDITORCONFIG_TEMPLATE: &str = include_str!("./templates/.editorconfig");
const RUST_BINDING_VERSION: &str = env!("CARGO_PKG_VERSION");
const RUST_BINDING_VERSION_PLACEHOLDER: &str = "RUST_BINDING_VERSION";
const LIB_RS_TEMPLATE: &str = include_str!("./templates/lib.rs");
const BUILD_RS_TEMPLATE: &str = include_str!("./templates/build.rs");
const CARGO_TOML_TEMPLATE: &str = include_str!("./templates/_cargo.toml");
const INDEX_JS_TEMPLATE: &str = include_str!("./templates/index.js");
const INDEX_D_TS_TEMPLATE: &str = include_str!("./templates/index.d.ts");
const JS_BINDING_CC_TEMPLATE: &str = include_str!("./templates/js-binding.cc");
const BINDING_GYP_TEMPLATE: &str = include_str!("./templates/binding.gyp");
const BINDING_TEST_JS_TEMPLATE: &str = include_str!("./templates/binding_test.js");
const MAKEFILE_TEMPLATE: &str = include_str!("./templates/makefile");
const CMAKELISTS_TXT_TEMPLATE: &str = include_str!("./templates/cmakelists.cmake");
const PARSER_NAME_H_TEMPLATE: &str = include_str!("./templates/PARSER_NAME.h");
const PARSER_NAME_PC_IN_TEMPLATE: &str = include_str!("./templates/PARSER_NAME.pc.in");
const GO_MOD_TEMPLATE: &str = include_str!("./templates/go.mod");
const BINDING_GO_TEMPLATE: &str = include_str!("./templates/binding.go");
const BINDING_TEST_GO_TEMPLATE: &str = include_str!("./templates/binding_test.go");
const SETUP_PY_TEMPLATE: &str = include_str!("./templates/setup.py");
const INIT_PY_TEMPLATE: &str = include_str!("./templates/__init__.py");
const INIT_PYI_TEMPLATE: &str = include_str!("./templates/__init__.pyi");
const PYPROJECT_TOML_TEMPLATE: &str = include_str!("./templates/pyproject.toml");
const PY_BINDING_C_TEMPLATE: &str = include_str!("./templates/py-binding.c");
const TEST_BINDING_PY_TEMPLATE: &str = include_str!("./templates/test_binding.py");
const PACKAGE_SWIFT_TEMPLATE: &str = include_str!("./templates/package.swift");
const TESTS_SWIFT_TEMPLATE: &str = include_str!("./templates/tests.swift");
const TREE_SITTER_JSON_SCHEMA: &str =
"https://tree-sitter.github.io/tree-sitter/assets/schemas/config.schema.json";
#[must_use]
pub fn path_in_ignore(repo_path: &Path) -> bool {
[
"bindings",
"build",
"examples",
"node_modules",
"queries",
"script",
"src",
"target",
"test",
"types",
]
.iter()
.any(|dir| repo_path.ends_with(dir))
}
#[derive(Serialize, Deserialize, Clone)]
pub struct JsonConfigOpts {
pub name: String,
pub camelcase: String,
pub description: String,
#[serde(skip_serializing_if = "Option::is_none")]
pub repository: Option<Url>,
pub scope: String,
pub file_types: Vec<String>,
pub version: Version,
pub license: String,
pub author: String,
#[serde(skip_serializing_if = "Option::is_none")]
pub email: Option<String>,
#[serde(skip_serializing_if = "Option::is_none")]
pub url: Option<Url>,
}
impl JsonConfigOpts {
#[must_use]
pub fn to_tree_sitter_json(self) -> TreeSitterJSON {
TreeSitterJSON {
schema: Some(TREE_SITTER_JSON_SCHEMA.to_string()),
grammars: vec![Grammar {
name: self.name.clone(),
camelcase: Some(self.camelcase),
scope: self.scope,
path: None,
external_files: PathsJSON::Empty,
file_types: Some(self.file_types),
highlights: PathsJSON::Empty,
injections: PathsJSON::Empty,
locals: PathsJSON::Empty,
tags: PathsJSON::Empty,
injection_regex: Some(format!("^{}$", self.name)),
first_line_regex: None,
content_regex: None,
}],
metadata: Metadata {
version: self.version,
license: Some(self.license),
description: Some(self.description),
authors: Some(vec![Author {
name: self.author,
email: self.email,
url: self.url.map(|url| url.to_string()),
}]),
links: Some(Links {
repository: self.repository.unwrap_or_else(|| {
Url::parse(&format!(
"https://github.com/tree-sitter/tree-sitter-{}",
self.name
))
.expect("Failed to parse default repository URL")
}),
homepage: None,
}),
namespace: None,
},
bindings: Bindings::default(),
}
}
}
impl Default for JsonConfigOpts {
fn default() -> Self {
Self {
name: String::new(),
camelcase: String::new(),
description: String::new(),
repository: None,
scope: String::new(),
file_types: vec![],
version: Version::from_str("0.1.0").unwrap(),
license: String::new(),
author: String::new(),
email: None,
url: None,
}
}
}
struct GenerateOpts<'a> {
author_name: Option<&'a str>,
author_email: Option<&'a str>,
author_url: Option<&'a str>,
license: Option<&'a str>,
description: Option<&'a str>,
repository: Option<&'a str>,
version: &'a Version,
camel_parser_name: &'a str,
}
// TODO: remove in 0.25
// A return value of true means migration was successful, and false if not.
pub fn migrate_package_json(repo_path: &Path) -> Result<bool> {
let root_path =
get_root_path(&repo_path.join("package.json")).unwrap_or_else(|_| repo_path.to_path_buf());
let (package_json_path, tree_sitter_json_path) = (
root_path.join("package.json"),
root_path.join("tree-sitter.json"),
);
let old_config = serde_json::from_str::<PackageJSON>(
&fs::read_to_string(&package_json_path)
.with_context(|| format!("Failed to read package.json in {}", root_path.display()))?,
)?;
if old_config.tree_sitter.is_none() {
eprintln!("Failed to find `tree-sitter` section in package.json, unable to migrate");
return Ok(false);
}
let name = old_config.name.replace("tree-sitter-", "");
let new_config = TreeSitterJSON {
schema: Some(TREE_SITTER_JSON_SCHEMA.to_string()),
grammars: old_config
.tree_sitter
.unwrap()
.into_iter()
.map(|l| Grammar {
name: name.clone(),
camelcase: Some(name.to_upper_camel_case()),
scope: l.scope.unwrap_or_else(|| format!("source.{name}")),
path: Some(l.path),
external_files: l.external_files,
file_types: l.file_types,
highlights: l.highlights,
injections: l.injections,
locals: l.locals,
tags: l.tags,
injection_regex: l.injection_regex,
first_line_regex: l.first_line_regex,
content_regex: l.content_regex,
})
.collect(),
metadata: Metadata {
version: old_config.version,
license: old_config
.license
.map_or_else(|| Some("MIT".to_string()), Some),
description: old_config
.description
.map_or_else(|| Some(format!("{name} grammar for tree-sitter")), Some),
authors: {
let authors = old_config
.author
.map_or_else(|| vec![].into_iter(), |a| vec![a].into_iter())
.chain(old_config.maintainers.unwrap_or_default())
.filter_map(|a| match a {
PackageJSONAuthor::String(s) => {
let mut name = s.trim().to_string();
if name.is_empty() {
return None;
}
let mut email = None;
let mut url = None;
if let Some(url_start) = name.rfind('(') {
if let Some(url_end) = name.rfind(')') {
url = Some(name[url_start + 1..url_end].trim().to_string());
name = name[..url_start].trim().to_string();
}
}
if let Some(email_start) = name.rfind('<') {
if let Some(email_end) = name.rfind('>') {
email =
Some(name[email_start + 1..email_end].trim().to_string());
name = name[..email_start].trim().to_string();
}
}
Some(Author { name, email, url })
}
PackageJSONAuthor::Object { name, email, url } => {
if name.is_empty() {
None
} else {
Some(Author { name, email, url })
}
}
})
.collect::<Vec<_>>();
if authors.is_empty() {
None
} else {
Some(authors)
}
},
links: Some(Links {
repository: old_config
.repository
.map(|r| match r {
PackageJSONRepository::String(s) => {
if let Some(stripped) = s.strip_prefix("github:") {
Url::parse(&format!("https://github.com/{stripped}"))
} else if Regex::new(r"^[\w.-]+/[\w.-]+$").unwrap().is_match(&s) {
Url::parse(&format!("https://github.com/{s}"))
} else if let Some(stripped) = s.strip_prefix("gitlab:") {
Url::parse(&format!("https://gitlab.com/{stripped}"))
} else if let Some(stripped) = s.strip_prefix("bitbucket:") {
Url::parse(&format!("https://bitbucket.org/{stripped}"))
} else {
Url::parse(&s)
}
}
PackageJSONRepository::Object { url, .. } => Url::parse(&url),
})
.transpose()?
.unwrap_or_else(|| {
Url::parse(&format!(
"https://github.com/tree-sitter/tree-sitter-{name}"
))
.expect("Failed to parse default repository URL")
}),
homepage: None,
}),
namespace: None,
},
bindings: Bindings::default(),
};
write_file(
&tree_sitter_json_path,
serde_json::to_string_pretty(&new_config)? + "\n",
)?;
// Remove the `tree-sitter` field in-place
let mut package_json = serde_json::from_str::<Map<String, Value>>(
&fs::read_to_string(&package_json_path)
.with_context(|| format!("Failed to read package.json in {}", root_path.display()))?,
)
.unwrap();
package_json.remove("tree-sitter");
write_file(
&root_path.join("package.json"),
serde_json::to_string_pretty(&package_json)? + "\n",
)?;
println!("Warning: your package.json's `tree-sitter` field has been automatically migrated to the new `tree-sitter.json` config file");
println!(
"For more information, visit https://tree-sitter.github.io/tree-sitter/creating-parsers"
);
Ok(true)
}
pub fn generate_grammar_files(
repo_path: &Path,
language_name: &str,
allow_update: bool,
opts: Option<&JsonConfigOpts>,
) -> Result<()> {
let dashed_language_name = language_name.to_kebab_case();
let tree_sitter_config = missing_path_else(
repo_path.join("tree-sitter.json"),
true,
|path| {
// invariant: opts is always Some when `tree-sitter.json` doesn't exist
let Some(opts) = opts else { unreachable!() };
let tree_sitter_json = opts.clone().to_tree_sitter_json();
write_file(path, serde_json::to_string_pretty(&tree_sitter_json)?)
},
|path| {
// updating the config, if needed
if let Some(opts) = opts {
let tree_sitter_json = opts.clone().to_tree_sitter_json();
write_file(path, serde_json::to_string_pretty(&tree_sitter_json)?)?;
}
Ok(())
},
)?;
let tree_sitter_config = serde_json::from_str::<TreeSitterJSON>(
&fs::read_to_string(tree_sitter_config.as_path())
.with_context(|| "Failed to read tree-sitter.json")?,
)?;
let authors = tree_sitter_config.metadata.authors.as_ref();
let camel_name = tree_sitter_config.grammars[0]
.camelcase
.clone()
.unwrap_or_else(|| language_name.to_upper_camel_case());
let generate_opts = GenerateOpts {
author_name: authors
.map(|a| a.first().map(|a| a.name.as_str()))
.unwrap_or_default(),
author_email: authors
.map(|a| a.first().and_then(|a| a.email.as_deref()))
.unwrap_or_default(),
author_url: authors
.map(|a| a.first().and_then(|a| a.url.as_deref()))
.unwrap_or_default(),
license: tree_sitter_config.metadata.license.as_deref(),
description: tree_sitter_config.metadata.description.as_deref(),
repository: tree_sitter_config
.metadata
.links
.as_ref()
.map(|l| l.repository.as_str()),
version: &tree_sitter_config.metadata.version,
camel_parser_name: &camel_name,
};
// Create package.json
missing_path(repo_path.join("package.json"), |path| {
generate_file(
path,
PACKAGE_JSON_TEMPLATE,
dashed_language_name.as_str(),
&generate_opts,
)
})?;
// Do not create a grammar.js file in a repo with multiple language configs
if !tree_sitter_config.has_multiple_language_configs() {
missing_path(repo_path.join("grammar.js"), |path| {
generate_file(path, GRAMMAR_JS_TEMPLATE, language_name, &generate_opts)
})?;
}
// Write .gitignore file
missing_path(repo_path.join(".gitignore"), |path| {
generate_file(path, GITIGNORE_TEMPLATE, language_name, &generate_opts)
})?;
// Write .gitattributes file
missing_path(repo_path.join(".gitattributes"), |path| {
generate_file(path, GITATTRIBUTES_TEMPLATE, language_name, &generate_opts)
})?;
// Write .editorconfig file
missing_path(repo_path.join(".editorconfig"), |path| {
generate_file(path, EDITORCONFIG_TEMPLATE, language_name, &generate_opts)
})?;
let bindings_dir = repo_path.join("bindings");
// Generate Rust bindings
if tree_sitter_config.bindings.rust {
missing_path(bindings_dir.join("rust"), create_dir)?.apply(|path| {
missing_path(path.join("lib.rs"), |path| {
generate_file(path, LIB_RS_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(path.join("build.rs"), |path| {
generate_file(path, BUILD_RS_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(repo_path.join("Cargo.toml"), |path| {
generate_file(
path,
CARGO_TOML_TEMPLATE,
dashed_language_name.as_str(),
&generate_opts,
)
})?;
Ok(())
})?;
}
// Generate Node bindings
if tree_sitter_config.bindings.node {
missing_path(bindings_dir.join("node"), create_dir)?.apply(|path| {
missing_path_else(
path.join("index.js"),
allow_update,
|path| generate_file(path, INDEX_JS_TEMPLATE, language_name, &generate_opts),
|path| {
let contents = fs::read_to_string(path)?;
if !contents.contains("bun") {
generate_file(path, INDEX_JS_TEMPLATE, language_name, &generate_opts)?;
}
Ok(())
},
)?;
missing_path(path.join("index.d.ts"), |path| {
generate_file(path, INDEX_D_TS_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(path.join("binding_test.js"), |path| {
generate_file(
path,
BINDING_TEST_JS_TEMPLATE,
language_name,
&generate_opts,
)
})?;
missing_path(path.join("binding.cc"), |path| {
generate_file(path, JS_BINDING_CC_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(repo_path.join("binding.gyp"), |path| {
generate_file(path, BINDING_GYP_TEMPLATE, language_name, &generate_opts)
})?;
Ok(())
})?;
}
// Generate C bindings
if tree_sitter_config.bindings.c {
missing_path(bindings_dir.join("c"), create_dir)?.apply(|path| {
missing_path(
path.join(format!("tree-sitter-{language_name}.h")),
|path| generate_file(path, PARSER_NAME_H_TEMPLATE, language_name, &generate_opts),
)?;
missing_path(
path.join(format!("tree-sitter-{language_name}.pc.in")),
|path| {
generate_file(
path,
PARSER_NAME_PC_IN_TEMPLATE,
language_name,
&generate_opts,
)
},
)?;
missing_path(repo_path.join("Makefile"), |path| {
generate_file(path, MAKEFILE_TEMPLATE, language_name, &generate_opts)
})?;
missing_path_else(
repo_path.join("CMakeLists.txt"),
allow_update,
|path| generate_file(path, CMAKELISTS_TXT_TEMPLATE, language_name, &generate_opts),
|path| {
let contents = fs::read_to_string(path)?;
let old = "add_custom_target(test";
if contents.contains(old) {
write_file(path, contents.replace(old, "add_custom_target(ts-test"))
} else {
Ok(())
}
},
)?;
Ok(())
})?;
}
// Generate Go bindings
if tree_sitter_config.bindings.go {
missing_path(bindings_dir.join("go"), create_dir)?.apply(|path| {
missing_path(path.join("binding.go"), |path| {
generate_file(path, BINDING_GO_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(path.join("binding_test.go"), |path| {
generate_file(
path,
BINDING_TEST_GO_TEMPLATE,
language_name,
&generate_opts,
)
})?;
missing_path(repo_path.join("go.mod"), |path| {
generate_file(path, GO_MOD_TEMPLATE, language_name, &generate_opts)
})?;
Ok(())
})?;
}
// Generate Python bindings
if tree_sitter_config.bindings.python {
missing_path(bindings_dir.join("python"), create_dir)?.apply(|path| {
let lang_path = path.join(format!("tree_sitter_{}", language_name.to_snake_case()));
missing_path(&lang_path, create_dir)?;
missing_path(lang_path.join("binding.c"), |path| {
generate_file(path, PY_BINDING_C_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(lang_path.join("__init__.py"), |path| {
generate_file(path, INIT_PY_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(lang_path.join("__init__.pyi"), |path| {
generate_file(path, INIT_PYI_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(lang_path.join("py.typed"), |path| {
generate_file(path, "", language_name, &generate_opts) // py.typed is empty
})?;
missing_path(path.join("tests"), create_dir)?.apply(|path| {
missing_path(path.join("test_binding.py"), |path| {
generate_file(
path,
TEST_BINDING_PY_TEMPLATE,
language_name,
&generate_opts,
)
})?;
Ok(())
})?;
missing_path(repo_path.join("setup.py"), |path| {
generate_file(path, SETUP_PY_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(repo_path.join("pyproject.toml"), |path| {
generate_file(
path,
PYPROJECT_TOML_TEMPLATE,
dashed_language_name.as_str(),
&generate_opts,
)
})?;
Ok(())
})?;
}
// Generate Swift bindings
if tree_sitter_config.bindings.swift {
missing_path(bindings_dir.join("swift"), create_dir)?.apply(|path| {
let lang_path = path.join(format!("TreeSitter{camel_name}",));
missing_path(&lang_path, create_dir)?;
missing_path(lang_path.join(format!("{language_name}.h")), |path| {
generate_file(path, PARSER_NAME_H_TEMPLATE, language_name, &generate_opts)
})?;
missing_path(
path.join(format!("TreeSitter{camel_name}Tests",)),
create_dir,
)?
.apply(|path| {
missing_path(
path.join(format!("TreeSitter{camel_name}Tests.swift")),
|path| generate_file(path, TESTS_SWIFT_TEMPLATE, language_name, &generate_opts),
)?;
Ok(())
})?;
missing_path(repo_path.join("Package.swift"), |path| {
generate_file(path, PACKAGE_SWIFT_TEMPLATE, language_name, &generate_opts)
})?;
Ok(())
})?;
}
Ok(())
}
pub fn get_root_path(path: &Path) -> Result<PathBuf> {
let mut pathbuf = path.to_owned();
let filename = path.file_name().unwrap().to_str().unwrap();
let is_package_json = filename == "package.json";
loop {
let json = pathbuf
.exists()
.then(|| {
let contents = fs::read_to_string(pathbuf.as_path())
.with_context(|| format!("Failed to read {filename}"))?;
if is_package_json {
serde_json::from_str::<Map<String, Value>>(&contents)
.context(format!("Failed to parse {filename}"))
.map(|v| v.contains_key("tree-sitter"))
} else {
serde_json::from_str::<TreeSitterJSON>(&contents)
.context(format!("Failed to parse {filename}"))
.map(|_| true)
}
})
.transpose()?;
if json == Some(true) {
return Ok(pathbuf.parent().unwrap().to_path_buf());
}
pathbuf.pop(); // filename
if !pathbuf.pop() {
return Err(anyhow!(format!(
concat!(
"Failed to locate a {} file,",
" please ensure you have one, and if you don't then consult the docs",
),
filename
)));
}
pathbuf.push(filename);
}
}
fn generate_file(
path: &Path,
template: &str,
language_name: &str,
generate_opts: &GenerateOpts,
) -> Result<()> {
let filename = path.file_name().unwrap().to_str().unwrap();
let mut replacement = template
.replace(
CAMEL_PARSER_NAME_PLACEHOLDER,
generate_opts.camel_parser_name,
)
.replace(
UPPER_PARSER_NAME_PLACEHOLDER,
&language_name.to_shouty_snake_case(),
)
.replace(
LOWER_PARSER_NAME_PLACEHOLDER,
&language_name.to_snake_case(),
)
.replace(PARSER_NAME_PLACEHOLDER, language_name)
.replace(CLI_VERSION_PLACEHOLDER, CLI_VERSION)
.replace(RUST_BINDING_VERSION_PLACEHOLDER, RUST_BINDING_VERSION)
.replace(ABI_VERSION_MAX_PLACEHOLDER, &ABI_VERSION_MAX.to_string())
.replace(
PARSER_VERSION_PLACEHOLDER,
&generate_opts.version.to_string(),
);
if let Some(name) = generate_opts.author_name {
replacement = replacement.replace(AUTHOR_NAME_PLACEHOLDER, name);
} else {
match filename {
"package.json" => {
replacement = replacement.replace(AUTHOR_NAME_PLACEHOLDER_JS, "");
}
"pyproject.toml" => {
replacement = replacement.replace(AUTHOR_NAME_PLACEHOLDER_PY, "");
}
"grammar.js" => {
replacement = replacement.replace(AUTHOR_NAME_PLACEHOLDER_GRAMMAR, "");
}
"Cargo.toml" => {
replacement = replacement.replace(AUTHOR_NAME_PLACEHOLDER_RS, "");
}
_ => {}
}
}
if let Some(email) = generate_opts.author_email {
replacement = match filename {
"Cargo.toml" | "grammar.js" => {
replacement.replace(AUTHOR_EMAIL_PLACEHOLDER, &format!("<{email}>"))
}
_ => replacement.replace(AUTHOR_EMAIL_PLACEHOLDER, email),
}
} else {
match filename {
"package.json" => {
replacement = replacement.replace(AUTHOR_EMAIL_PLACEHOLDER_JS, "");
}
"pyproject.toml" => {
replacement = replacement.replace(AUTHOR_EMAIL_PLACEHOLDER_PY, "");
}
"grammar.js" => {
replacement = replacement.replace(AUTHOR_EMAIL_PLACEHOLDER_GRAMMAR, "");
}
"Cargo.toml" => {
replacement = replacement.replace(AUTHOR_EMAIL_PLACEHOLDER_RS, "");
}
_ => {}
}
}
if filename == "package.json" {
if let Some(url) = generate_opts.author_url {
replacement = replacement.replace(AUTHOR_URL_PLACEHOLDER, url);
} else {
replacement = replacement.replace(AUTHOR_URL_PLACEHOLDER_JS, "");
}
}
if generate_opts.author_name.is_none()
&& generate_opts.author_email.is_none()
&& generate_opts.author_url.is_none()
&& filename == "package.json"
{
if let Some(start_idx) = replacement.find(AUTHOR_BLOCK_JS) {
if let Some(end_idx) = replacement[start_idx..]
.find("},")
.map(|i| i + start_idx + 2)
{
replacement.replace_range(start_idx..end_idx, "");
}
}
} else if generate_opts.author_name.is_none() && generate_opts.author_email.is_none() {
match filename {
"pyproject.toml" => {
if let Some(start_idx) = replacement.find(AUTHOR_BLOCK_PY) {
if let Some(end_idx) = replacement[start_idx..]
.find("}]")
.map(|i| i + start_idx + 2)
{
replacement.replace_range(start_idx..end_idx, "");
} else {
println!("none 2");
}
} else {
println!("none 1");
}
}
"grammar.js" => {
if let Some(start_idx) = replacement.find(AUTHOR_BLOCK_GRAMMAR) {
if let Some(end_idx) = replacement[start_idx..]
.find(" \n")
.map(|i| i + start_idx + 1)
{
replacement.replace_range(start_idx..end_idx, "");
} else {
println!("none 2");
}
} else {
println!("none 1");
}
}
"Cargo.toml" => {
if let Some(start_idx) = replacement.find(AUTHOR_BLOCK_RS) {
if let Some(end_idx) = replacement[start_idx..]
.find("\"]")
.map(|i| i + start_idx + 2)
{
replacement.replace_range(start_idx..end_idx, "");
}
}
}
_ => {}
}
}
match generate_opts.license {
Some(license) => replacement = replacement.replace(PARSER_LICENSE_PLACEHOLDER, license),
_ => replacement = replacement.replace(PARSER_LICENSE_PLACEHOLDER, "MIT"),
}
match generate_opts.description {
Some(description) => {
replacement = replacement.replace(PARSER_DESCRIPTION_PLACEHOLDER, description);
}
_ => {
replacement = replacement.replace(
PARSER_DESCRIPTION_PLACEHOLDER,
&format!(
"{} grammar for tree-sitter",
generate_opts.camel_parser_name,
),
);
}
}
match generate_opts.repository {
Some(repository) => {
replacement = replacement
.replace(
PARSER_URL_STRIPPED_PLACEHOLDER,
&repository.replace("https://", "").to_lowercase(),
)
.replace(PARSER_URL_PLACEHOLDER, &repository.to_lowercase());
}
_ => {
replacement = replacement
.replace(
PARSER_URL_STRIPPED_PLACEHOLDER,
&format!(
"github.com/tree-sitter/tree-sitter-{}",
language_name.to_lowercase()
),
)
.replace(
PARSER_URL_PLACEHOLDER,
&format!(
"https://github.com/tree-sitter/tree-sitter-{}",
language_name.to_lowercase()
),
);
}
}
write_file(path, replacement)
}
fn create_dir(path: &Path) -> Result<()> {
fs::create_dir_all(path)
.with_context(|| format!("Failed to create {:?}", path.to_string_lossy()))
}
#[derive(PartialEq, Eq, Debug)]
enum PathState<P>
where
P: AsRef<Path>,
{
Exists(P),
Missing(P),
}
#[allow(dead_code)]
impl<P> PathState<P>
where
P: AsRef<Path>,
{
fn exists(&self, mut action: impl FnMut(&Path) -> Result<()>) -> Result<&Self> {
if let Self::Exists(path) = self {
action(path.as_ref())?;
}
Ok(self)
}
fn missing(&self, mut action: impl FnMut(&Path) -> Result<()>) -> Result<&Self> {
if let Self::Missing(path) = self {
action(path.as_ref())?;
}
Ok(self)
}
fn apply(&self, mut action: impl FnMut(&Path) -> Result<()>) -> Result<&Self> {
action(self.as_path())?;
Ok(self)
}
fn apply_state(&self, mut action: impl FnMut(&Self) -> Result<()>) -> Result<&Self> {
action(self)?;
Ok(self)
}
fn as_path(&self) -> &Path {
match self {
Self::Exists(path) | Self::Missing(path) => path.as_ref(),
}
}
}
fn missing_path<P, F>(path: P, mut action: F) -> Result<PathState<P>>
where
P: AsRef<Path>,
F: FnMut(&Path) -> Result<()>,
{
let path_ref = path.as_ref();
if !path_ref.exists() {
action(path_ref)?;
Ok(PathState::Missing(path))
} else {
Ok(PathState::Exists(path))
}
}
fn missing_path_else<P, T, F>(
path: P,
allow_update: bool,
mut action: T,
mut else_action: F,
) -> Result<PathState<P>>
where
P: AsRef<Path>,
T: FnMut(&Path) -> Result<()>,
F: FnMut(&Path) -> Result<()>,
{
let path_ref = path.as_ref();
if !path_ref.exists() {
action(path_ref)?;
Ok(PathState::Missing(path))
} else {
if allow_update {
else_action(path_ref)?;
}
Ok(PathState::Exists(path))
}
}

View file

@ -1,9 +1,8 @@
#![cfg_attr(not(any(test, doctest)), doc = include_str!("../README.md"))] #![doc = include_str!("../README.md")]
pub mod fuzz; pub mod fuzz;
pub mod highlight; pub mod highlight;
pub mod init; pub mod init;
pub mod input;
pub mod logger; pub mod logger;
pub mod parse; pub mod parse;
pub mod playground; pub mod playground;
@ -20,5 +19,6 @@ pub mod wasm;
#[cfg(test)] #[cfg(test)]
mod tests; mod tests;
// To run compile fail tests
#[cfg(doctest)] #[cfg(doctest)]
mod tests; mod tests;

30
cli/src/logger.rs Normal file
View file

@ -0,0 +1,30 @@
use log::{LevelFilter, Log, Metadata, Record};
#[allow(dead_code)]
struct Logger {
pub filter: Option<String>,
}
impl Log for Logger {
fn enabled(&self, _: &Metadata) -> bool {
true
}
fn log(&self, record: &Record) {
eprintln!(
"[{}] {}",
record
.module_path()
.unwrap_or_default()
.trim_start_matches("rust_tree_sitter_cli::"),
record.args()
);
}
fn flush(&self) {}
}
pub fn init() {
log::set_boxed_logger(Box::new(Logger { filter: None })).unwrap();
log::set_max_level(LevelFilter::Info);
}

Some files were not shown because too many files have changed in this diff Show more